diff --git a/dist/famous-global.js b/dist/famous-global.js new file mode 100644 index 00000000..2255bcc4 --- /dev/null +++ b/dist/famous-global.js @@ -0,0 +1,19024 @@ +!function(e){if("object"==typeof exports&&"undefined"!=typeof module)module.exports=e();else if("function"==typeof define&&define.amd)define([],e);else{var f;"undefined"!=typeof window?f=window:"undefined"!=typeof global?f=global:"undefined"!=typeof self&&(f=self),f.famous=e()}}(function(){var define,module,exports;return (function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof require=="function"&&require;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof require=="function"&&require;for(var o=0;o 0) { + result = nodeStore.pop(); + } + else { + result = document.createElement(type); + this.container.appendChild(result); + } + this.nodeCount++; + return result; +}; + +/** + * De-allocate an element of specified type to the pool. + * + * @private + * @method deallocate + * + * @param {Node} element document element to deallocate + */ +ElementAllocator.prototype.deallocate = function deallocate(element) { + var nodeType = element.nodeName.toLowerCase(); + var nodeStore = this.detachedNodes[nodeType]; + nodeStore.push(element); + this.nodeCount--; +}; + +/** + * Get count of total allocated nodes in the document. + * + * @private + * @method getNodeCount + * + * @return {Number} total node count + */ +ElementAllocator.prototype.getNodeCount = function getNodeCount() { + return this.nodeCount; +}; + +module.exports = ElementAllocator; +},{}],3:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Entity = _dereq_('./Entity'); +var EventHandler = _dereq_('./EventHandler'); +var Transform = _dereq_('./Transform'); + +var usePrefix = !('transform' in document.documentElement.style); +var devicePixelRatio = window.devicePixelRatio || 1; + +/** + * A base class for viewable content and event + * targets inside a Famo.us application, containing a renderable document + * fragment. Like an HTML div, it can accept internal markup, + * properties, classes, and handle events. + * + * @class ElementOutput + * @constructor + * + * @param {Node} element document parent of this container + */ +function ElementOutput(element) { + this._matrix = null; + this._opacity = 1; + this._origin = null; + this._size = null; + + this._eventOutput = new EventHandler(); + this._eventOutput.bindThis(this); + + /** @ignore */ + this.eventForwarder = function eventForwarder(event) { + this._eventOutput.emit(event.type, event); + }.bind(this); + + this.id = Entity.register(this); + this._element = null; + this._sizeDirty = false; + this._originDirty = false; + this._transformDirty = false; + + this._invisible = false; + if (element) this.attach(element); +} + +/** + * Bind a callback function to an event type handled by this object. + * + * @method "on" + * + * @param {string} type event type key (for example, 'click') + * @param {function(string, Object)} fn handler callback + * @return {EventHandler} this + */ +ElementOutput.prototype.on = function on(type, fn) { + if (this._element) this._element.addEventListener(type, this.eventForwarder); + this._eventOutput.on(type, fn); +}; + +/** + * Unbind an event by type and handler. + * This undoes the work of "on" + * + * @method removeListener + * @param {string} type event type key (for example, 'click') + * @param {function(string, Object)} fn handler + */ +ElementOutput.prototype.removeListener = function removeListener(type, fn) { + this._eventOutput.removeListener(type, fn); +}; + +/** + * Trigger an event, sending to all downstream handlers + * listening for provided 'type' key. + * + * @method emit + * + * @param {string} type event type key (for example, 'click') + * @param {Object} [event] event data + * @return {EventHandler} this + */ +ElementOutput.prototype.emit = function emit(type, event) { + if (event && !event.origin) event.origin = this; + var handled = this._eventOutput.emit(type, event); + if (handled && event && event.stopPropagation) event.stopPropagation(); + return handled; +}; + +/** + * Add event handler object to set of downstream handlers. + * + * @method pipe + * + * @param {EventHandler} target event handler target object + * @return {EventHandler} passed event handler + */ +ElementOutput.prototype.pipe = function pipe(target) { + return this._eventOutput.pipe(target); +}; + +/** + * Remove handler object from set of downstream handlers. + * Undoes work of "pipe" + * + * @method unpipe + * + * @param {EventHandler} target target handler object + * @return {EventHandler} provided target + */ +ElementOutput.prototype.unpipe = function unpipe(target) { + return this._eventOutput.unpipe(target); +}; + +/** + * Return spec for this surface. Note that for a base surface, this is + * simply an id. + * + * @method render + * @private + * @return {Object} render spec for this surface (spec id) + */ +ElementOutput.prototype.render = function render() { + return this.id; +}; + +// Attach Famous event handling to document events emanating from target +// document element. This occurs just after attachment to the document. +// Calling this enables methods like #on and #pipe. +function _addEventListeners(target) { + for (var i in this._eventOutput.listeners) { + target.addEventListener(i, this.eventForwarder); + } +} + +// Detach Famous event handling from document events emanating from target +// document element. This occurs just before detach from the document. +function _removeEventListeners(target) { + for (var i in this._eventOutput.listeners) { + target.removeEventListener(i, this.eventForwarder); + } +} + +/** + * Return a Matrix's webkit css representation to be used with the + * CSS3 -webkit-transform style. + * Example: -webkit-transform: matrix3d(1,0,0,0,0,1,0,0,0,0,1,0,716,243,0,1) + * + * @method _formatCSSTransform + * @private + * @param {FamousMatrix} m matrix + * @return {string} matrix3d CSS style representation of the transform + */ +function _formatCSSTransform(m) { + m[12] = Math.round(m[12] * devicePixelRatio) / devicePixelRatio; + m[13] = Math.round(m[13] * devicePixelRatio) / devicePixelRatio; + + var result = 'matrix3d('; + for (var i = 0; i < 15; i++) { + result += (m[i] < 0.000001 && m[i] > -0.000001) ? '0,' : m[i] + ','; + } + result += m[15] + ')'; + return result; +} + +/** + * Directly apply given FamousMatrix to the document element as the + * appropriate webkit CSS style. + * + * @method setMatrix + * + * @static + * @private + * @param {Element} element document element + * @param {FamousMatrix} matrix + */ + +var _setMatrix; +if (navigator.userAgent.toLowerCase().indexOf('firefox') > -1) { + _setMatrix = function(element, matrix) { + element.style.zIndex = (matrix[14] * 1000000) | 0; // fix for Firefox z-buffer issues + element.style.transform = _formatCSSTransform(matrix); + }; +} +else if (usePrefix) { + _setMatrix = function(element, matrix) { + element.style.webkitTransform = _formatCSSTransform(matrix); + }; +} +else { + _setMatrix = function(element, matrix) { + element.style.transform = _formatCSSTransform(matrix); + }; +} + +// format origin as CSS percentage string +function _formatCSSOrigin(origin) { + return (100 * origin[0]) + '% ' + (100 * origin[1]) + '%'; +} + +// Directly apply given origin coordinates to the document element as the +// appropriate webkit CSS style. +var _setOrigin = usePrefix ? function(element, origin) { + element.style.webkitTransformOrigin = _formatCSSOrigin(origin); +} : function(element, origin) { + element.style.transformOrigin = _formatCSSOrigin(origin); +}; + +// Shrink given document element until it is effectively invisible. +var _setInvisible = usePrefix ? function(element) { + element.style.webkitTransform = 'scale3d(0.0001,0.0001,0.0001)'; + element.style.opacity = 0; +} : function(element) { + element.style.transform = 'scale3d(0.0001,0.0001,0.0001)'; + element.style.opacity = 0; +}; + +function _xyNotEquals(a, b) { + return (a && b) ? (a[0] !== b[0] || a[1] !== b[1]) : a !== b; +} + +/** + * Apply changes from this component to the corresponding document element. + * This includes changes to classes, styles, size, content, opacity, origin, + * and matrix transforms. + * + * @private + * @method commit + * @param {Context} context commit context + */ +ElementOutput.prototype.commit = function commit(context) { + var target = this._element; + if (!target) return; + + var matrix = context.transform; + var opacity = context.opacity; + var origin = context.origin; + var size = context.size; + + if (!matrix && this._matrix) { + this._matrix = null; + this._opacity = 0; + _setInvisible(target); + return; + } + + if (_xyNotEquals(this._origin, origin)) this._originDirty = true; + if (Transform.notEquals(this._matrix, matrix)) this._transformDirty = true; + + if (this._invisible) { + this._invisible = false; + this._element.style.display = ''; + } + + if (this._opacity !== opacity) { + this._opacity = opacity; + target.style.opacity = (opacity >= 1) ? '0.999999' : opacity; + } + + if (this._transformDirty || this._originDirty || this._sizeDirty) { + if (this._sizeDirty) this._sizeDirty = false; + + if (this._originDirty) { + if (origin) { + if (!this._origin) this._origin = [0, 0]; + this._origin[0] = origin[0]; + this._origin[1] = origin[1]; + } + else this._origin = null; + _setOrigin(target, this._origin); + this._originDirty = false; + } + + if (!matrix) matrix = Transform.identity; + this._matrix = matrix; + var aaMatrix = this._size ? Transform.thenMove(matrix, [-this._size[0]*origin[0], -this._size[1]*origin[1], 0]) : matrix; + _setMatrix(target, aaMatrix); + this._transformDirty = false; + } +}; + +ElementOutput.prototype.cleanup = function cleanup() { + if (this._element) { + this._invisible = true; + this._element.style.display = 'none'; + } +}; + +/** + * Place the document element that this component manages into the document. + * + * @private + * @method attach + * @param {Node} target document parent of this container + */ +ElementOutput.prototype.attach = function attach(target) { + this._element = target; + _addEventListeners.call(this, target); +}; + +/** + * Remove any contained document content associated with this surface + * from the actual document. + * + * @private + * @method detach + */ +ElementOutput.prototype.detach = function detach() { + var target = this._element; + if (target) { + _removeEventListeners.call(this, target); + if (this._invisible) { + this._invisible = false; + this._element.style.display = ''; + } + } + this._element = null; + return target; +}; + +module.exports = ElementOutput; +},{"./Entity":5,"./EventHandler":7,"./Transform":15}],4:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +/** + * The singleton object initiated upon process + * startup which manages all active Context instances, runs + * the render dispatch loop, and acts as a listener and dispatcher + * for events. All methods are therefore static. + * + * On static initialization, window.requestAnimationFrame is called with + * the event loop function. + * + * Note: Any window in which Engine runs will prevent default + * scrolling behavior on the 'touchmove' event. + * + * @static + * @class Engine + */ +var Context = _dereq_('./Context'); +var EventHandler = _dereq_('./EventHandler'); +var OptionsManager = _dereq_('./OptionsManager'); + +var Engine = {}; + +var contexts = []; + +var nextTickQueue = []; + +var currentFrame = 0; +var nextTickFrame = 0; + +var deferQueue = []; + +var lastTime = Date.now(); +var frameTime; +var frameTimeLimit; +var loopEnabled = true; +var eventForwarders = {}; +var eventHandler = new EventHandler(); + +var options = { + containerType: 'div', + containerClass: 'famous-container', + fpsCap: undefined, + runLoop: true, + appMode: true +}; +var optionsManager = new OptionsManager(options); + +/** @const */ +var MAX_DEFER_FRAME_TIME = 10; + +/** + * Inside requestAnimationFrame loop, step() is called, which: + * calculates current FPS (throttling loop if it is over limit set in setFPSCap), + * emits dataless 'prerender' event on start of loop, + * calls in order any one-shot functions registered by nextTick on last loop, + * calls Context.update on all Context objects registered, + * and emits dataless 'postrender' event on end of loop. + * + * @static + * @private + * @method step + */ +Engine.step = function step() { + currentFrame++; + nextTickFrame = currentFrame; + + var currentTime = Date.now(); + + // skip frame if we're over our framerate cap + if (frameTimeLimit && currentTime - lastTime < frameTimeLimit) return; + + var i = 0; + + frameTime = currentTime - lastTime; + lastTime = currentTime; + + eventHandler.emit('prerender'); + + // empty the queue + var numFunctions = nextTickQueue.length; + while (numFunctions--) (nextTickQueue.shift())(currentFrame); + + // limit total execution time for deferrable functions + while (deferQueue.length && (Date.now() - currentTime) < MAX_DEFER_FRAME_TIME) { + deferQueue.shift().call(this); + } + + for (i = 0; i < contexts.length; i++) contexts[i].update(); + + eventHandler.emit('postrender'); +}; + +// engage requestAnimationFrame +function loop() { + if (options.runLoop) { + Engine.step(); + window.requestAnimationFrame(loop); + } + else loopEnabled = false; +} +window.requestAnimationFrame(loop); + +// +// Upon main document window resize (unless on an "input" HTML element): +// scroll to the top left corner of the window, +// and for each managed Context: emit the 'resize' event and update its size. +// @param {Object=} event document event +// +function handleResize(event) { + for (var i = 0; i < contexts.length; i++) { + contexts[i].emit('resize'); + } + eventHandler.emit('resize'); +} +window.addEventListener('resize', handleResize, false); +handleResize(); + +/** + * Initialize famous for app mode + * + * @static + * @private + * @method initialize + */ +function initialize() { + // prevent scrolling via browser + window.addEventListener('touchmove', function(event) { + event.preventDefault(); + }, true); + + addRootClasses(); +} +var initialized = false; + +function addRootClasses() { + if (!document.body) { + Engine.nextTick(addRootClasses); + return; + } + + document.body.classList.add('famous-root'); + document.documentElement.classList.add('famous-root'); +} + +/** + * Add event handler object to set of downstream handlers. + * + * @method pipe + * + * @param {EventHandler} target event handler target object + * @return {EventHandler} passed event handler + */ +Engine.pipe = function pipe(target) { + if (target.subscribe instanceof Function) return target.subscribe(Engine); + else return eventHandler.pipe(target); +}; + +/** + * Remove handler object from set of downstream handlers. + * Undoes work of "pipe". + * + * @method unpipe + * + * @param {EventHandler} target target handler object + * @return {EventHandler} provided target + */ +Engine.unpipe = function unpipe(target) { + if (target.unsubscribe instanceof Function) return target.unsubscribe(Engine); + else return eventHandler.unpipe(target); +}; + +/** + * Bind a callback function to an event type handled by this object. + * + * @static + * @method "on" + * + * @param {string} type event type key (for example, 'click') + * @param {function(string, Object)} handler callback + * @return {EventHandler} this + */ +Engine.on = function on(type, handler) { + if (!(type in eventForwarders)) { + eventForwarders[type] = eventHandler.emit.bind(eventHandler, type); + + addEngineListener(type, eventForwarders[type]); + } + return eventHandler.on(type, handler); +}; + +function addEngineListener(type, forwarder) { + if (!document.body) { + Engine.nextTick(addEventListener.bind(this, type, forwarder)); + return; + } + + document.body.addEventListener(type, forwarder); +} + +/** + * Trigger an event, sending to all downstream handlers + * listening for provided 'type' key. + * + * @method emit + * + * @param {string} type event type key (for example, 'click') + * @param {Object} event event data + * @return {EventHandler} this + */ +Engine.emit = function emit(type, event) { + return eventHandler.emit(type, event); +}; + +/** + * Unbind an event by type and handler. + * This undoes the work of "on". + * + * @static + * @method removeListener + * + * @param {string} type event type key (for example, 'click') + * @param {function} handler function object to remove + * @return {EventHandler} internal event handler object (for chaining) + */ +Engine.removeListener = function removeListener(type, handler) { + return eventHandler.removeListener(type, handler); +}; + +/** + * Return the current calculated frames per second of the Engine. + * + * @static + * @method getFPS + * + * @return {Number} calculated fps + */ +Engine.getFPS = function getFPS() { + return 1000 / frameTime; +}; + +/** + * Set the maximum fps at which the system should run. If internal render + * loop is called at a greater frequency than this FPSCap, Engine will + * throttle render and update until this rate is achieved. + * + * @static + * @method setFPSCap + * + * @param {Number} fps maximum frames per second + */ +Engine.setFPSCap = function setFPSCap(fps) { + frameTimeLimit = Math.floor(1000 / fps); +}; + +/** + * Return engine options. + * + * @static + * @method getOptions + * @param {string} key + * @return {Object} engine options + */ +Engine.getOptions = function getOptions(key) { + return optionsManager.getOptions(key); +}; + +/** + * Set engine options + * + * @static + * @method setOptions + * + * @param {Object} [options] overrides of default options + * @param {Number} [options.fpsCap] maximum fps at which the system should run + * @param {boolean} [options.runLoop=true] whether the run loop should continue + * @param {string} [options.containerType="div"] type of container element. Defaults to 'div'. + * @param {string} [options.containerClass="famous-container"] type of container element. Defaults to 'famous-container'. + */ +Engine.setOptions = function setOptions(options) { + return optionsManager.setOptions.apply(optionsManager, arguments); +}; + +/** + * Creates a new Context for rendering and event handling with + * provided document element as top of each tree. This will be tracked by the + * process-wide Engine. + * + * @static + * @method createContext + * + * @param {Node} el will be top of Famo.us document element tree + * @return {Context} new Context within el + */ +Engine.createContext = function createContext(el) { + if (!initialized && options.appMode) Engine.nextTick(initialize); + + var needMountContainer = false; + if (!el) { + el = document.createElement(options.containerType); + el.classList.add(options.containerClass); + needMountContainer = true; + } + + var context = new Context(el); + Engine.registerContext(context); + + if (needMountContainer) mount(context, el); + + return context; +}; + +function mount(context, el) { + if (!document.body) { + Engine.nextTick(mount.bind(this, context, el)); + return; + } + + document.body.appendChild(el); + context.emit('resize'); +} + +/** + * Registers an existing context to be updated within the run loop. + * + * @static + * @method registerContext + * + * @param {Context} context Context to register + * @return {FamousContext} provided context + */ +Engine.registerContext = function registerContext(context) { + contexts.push(context); + return context; +}; + +/** + * Returns a list of all contexts. + * + * @static + * @method getContexts + * @return {Array} contexts that are updated on each tick + */ +Engine.getContexts = function getContexts() { + return contexts; +}; + +/** + * Removes a context from the run loop. Note: this does not do any + * cleanup. + * + * @static + * @method deregisterContext + * + * @param {Context} context Context to deregister + */ +Engine.deregisterContext = function deregisterContext(context) { + var i = contexts.indexOf(context); + if (i >= 0) contexts.splice(i, 1); +}; + +/** + * Queue a function to be executed on the next tick of the + * Engine. + * + * @static + * @method nextTick + * + * @param {function(Object)} fn function accepting window object + */ +Engine.nextTick = function nextTick(fn) { + nextTickQueue.push(fn); +}; + +/** + * Queue a function to be executed sometime soon, at a time that is + * unlikely to affect frame rate. + * + * @static + * @method defer + * + * @param {Function} fn + */ +Engine.defer = function defer(fn) { + deferQueue.push(fn); +}; + +optionsManager.on('change', function(data) { + if (data.id === 'fpsCap') Engine.setFPSCap(data.value); + else if (data.id === 'runLoop') { + // kick off the loop only if it was stopped + if (!loopEnabled && data.value) { + loopEnabled = true; + window.requestAnimationFrame(loop); + } + } +}); + +module.exports = Engine; +},{"./Context":1,"./EventHandler":7,"./OptionsManager":10}],5:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + + + +/** + * A singleton that maintains a global registry of Surfaces. + * Private. + * + * @private + * @static + * @class Entity + */ + +var entities = []; + +/** + * Get entity from global index. + * + * @private + * @method get + * @param {Number} id entity registration id + * @return {Surface} entity in the global index + */ +function get(id) { + return entities[id]; +} + +/** + * Overwrite entity in the global index + * + * @private + * @method set + * @param {Number} id entity registration id + * @param {Surface} entity to add to the global index + */ +function set(id, entity) { + entities[id] = entity; +} + +/** + * Add entity to global index + * + * @private + * @method register + * @param {Surface} entity to add to global index + * @return {Number} new id + */ +function register(entity) { + var id = entities.length; + set(id, entity); + return id; +} + +/** + * Remove entity from global index + * + * @private + * @method unregister + * @param {Number} id entity registration id + */ +function unregister(id) { + set(id, null); +} + +module.exports = { + register: register, + unregister: unregister, + get: get, + set: set +}; +},{}],6:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + + + +/** + * EventEmitter represents a channel for events. + * + * @class EventEmitter + * @constructor + */ +function EventEmitter() { + this.listeners = {}; + this._owner = this; +} + +/** + * Trigger an event, sending to all downstream handlers + * listening for provided 'type' key. + * + * @method emit + * + * @param {string} type event type key (for example, 'click') + * @param {Object} event event data + * @return {EventHandler} this + */ +EventEmitter.prototype.emit = function emit(type, event) { + var handlers = this.listeners[type]; + if (handlers) { + for (var i = 0; i < handlers.length; i++) { + handlers[i].call(this._owner, event); + } + } + return this; +}; + +/** + * Bind a callback function to an event type handled by this object. + * + * @method "on" + * + * @param {string} type event type key (for example, 'click') + * @param {function(string, Object)} handler callback + * @return {EventHandler} this + */ + EventEmitter.prototype.on = function on(type, handler) { + if (!(type in this.listeners)) this.listeners[type] = []; + var index = this.listeners[type].indexOf(handler); + if (index < 0) this.listeners[type].push(handler); + return this; +}; + +/** + * Alias for "on". + * @method addListener + */ +EventEmitter.prototype.addListener = EventEmitter.prototype.on; + + /** + * Unbind an event by type and handler. + * This undoes the work of "on". + * + * @method removeListener + * + * @param {string} type event type key (for example, 'click') + * @param {function} handler function object to remove + * @return {EventEmitter} this + */ +EventEmitter.prototype.removeListener = function removeListener(type, handler) { + var listener = this.listeners[type]; + if (listener !== undefined) { + var index = listener.indexOf(handler); + if (index >= 0) listener.splice(index, 1); + } + return this; +}; + +/** + * Call event handlers with this set to owner. + * + * @method bindThis + * + * @param {Object} owner object this EventEmitter belongs to + */ +EventEmitter.prototype.bindThis = function bindThis(owner) { + this._owner = owner; +}; + +module.exports = EventEmitter; +},{}],7:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var EventEmitter = _dereq_('./EventEmitter'); + +/** + * EventHandler forwards received events to a set of provided callback functions. + * It allows events to be captured, processed, and optionally piped through to other event handlers. + * + * @class EventHandler + * @extends EventEmitter + * @constructor + */ +function EventHandler() { + EventEmitter.apply(this, arguments); + + this.downstream = []; // downstream event handlers + this.downstreamFn = []; // downstream functions + + this.upstream = []; // upstream event handlers + this.upstreamListeners = {}; // upstream listeners +} +EventHandler.prototype = Object.create(EventEmitter.prototype); +EventHandler.prototype.constructor = EventHandler; + +/** + * Assign an event handler to receive an object's input events. + * + * @method setInputHandler + * @static + * + * @param {Object} object object to mix trigger, subscribe, and unsubscribe functions into + * @param {EventHandler} handler assigned event handler + */ +EventHandler.setInputHandler = function setInputHandler(object, handler) { + object.trigger = handler.trigger.bind(handler); + if (handler.subscribe && handler.unsubscribe) { + object.subscribe = handler.subscribe.bind(handler); + object.unsubscribe = handler.unsubscribe.bind(handler); + } +}; + +/** + * Assign an event handler to receive an object's output events. + * + * @method setOutputHandler + * @static + * + * @param {Object} object object to mix pipe, unpipe, on, addListener, and removeListener functions into + * @param {EventHandler} handler assigned event handler + */ +EventHandler.setOutputHandler = function setOutputHandler(object, handler) { + if (handler instanceof EventHandler) handler.bindThis(object); + object.pipe = handler.pipe.bind(handler); + object.unpipe = handler.unpipe.bind(handler); + object.on = handler.on.bind(handler); + object.addListener = object.on; + object.removeListener = handler.removeListener.bind(handler); +}; + +/** + * Trigger an event, sending to all downstream handlers + * listening for provided 'type' key. + * + * @method emit + * + * @param {string} type event type key (for example, 'click') + * @param {Object} event event data + * @return {EventHandler} this + */ +EventHandler.prototype.emit = function emit(type, event) { + EventEmitter.prototype.emit.apply(this, arguments); + var i = 0; + for (i = 0; i < this.downstream.length; i++) { + if (this.downstream[i].trigger) this.downstream[i].trigger(type, event); + } + for (i = 0; i < this.downstreamFn.length; i++) { + this.downstreamFn[i](type, event); + } + return this; +}; + +/** + * Alias for emit + * @method addListener + */ +EventHandler.prototype.trigger = EventHandler.prototype.emit; + +/** + * Add event handler object to set of downstream handlers. + * + * @method pipe + * + * @param {EventHandler} target event handler target object + * @return {EventHandler} passed event handler + */ +EventHandler.prototype.pipe = function pipe(target) { + if (target.subscribe instanceof Function) return target.subscribe(this); + + var downstreamCtx = (target instanceof Function) ? this.downstreamFn : this.downstream; + var index = downstreamCtx.indexOf(target); + if (index < 0) downstreamCtx.push(target); + + if (target instanceof Function) target('pipe', null); + else if (target.trigger) target.trigger('pipe', null); + + return target; +}; + +/** + * Remove handler object from set of downstream handlers. + * Undoes work of "pipe". + * + * @method unpipe + * + * @param {EventHandler} target target handler object + * @return {EventHandler} provided target + */ +EventHandler.prototype.unpipe = function unpipe(target) { + if (target.unsubscribe instanceof Function) return target.unsubscribe(this); + + var downstreamCtx = (target instanceof Function) ? this.downstreamFn : this.downstream; + var index = downstreamCtx.indexOf(target); + if (index >= 0) { + downstreamCtx.splice(index, 1); + if (target instanceof Function) target('unpipe', null); + else if (target.trigger) target.trigger('unpipe', null); + return target; + } + else return false; +}; + +/** + * Bind a callback function to an event type handled by this object. + * + * @method "on" + * + * @param {string} type event type key (for example, 'click') + * @param {function(string, Object)} handler callback + * @return {EventHandler} this + */ +EventHandler.prototype.on = function on(type, handler) { + EventEmitter.prototype.on.apply(this, arguments); + if (!(type in this.upstreamListeners)) { + var upstreamListener = this.trigger.bind(this, type); + this.upstreamListeners[type] = upstreamListener; + for (var i = 0; i < this.upstream.length; i++) { + this.upstream[i].on(type, upstreamListener); + } + } + return this; +}; + +/** + * Alias for "on" + * @method addListener + */ +EventHandler.prototype.addListener = EventHandler.prototype.on; + +/** + * Listen for events from an upstream event handler. + * + * @method subscribe + * + * @param {EventEmitter} source source emitter object + * @return {EventHandler} this + */ +EventHandler.prototype.subscribe = function subscribe(source) { + var index = this.upstream.indexOf(source); + if (index < 0) { + this.upstream.push(source); + for (var type in this.upstreamListeners) { + source.on(type, this.upstreamListeners[type]); + } + } + return this; +}; + +/** + * Stop listening to events from an upstream event handler. + * + * @method unsubscribe + * + * @param {EventEmitter} source source emitter object + * @return {EventHandler} this + */ +EventHandler.prototype.unsubscribe = function unsubscribe(source) { + var index = this.upstream.indexOf(source); + if (index >= 0) { + this.upstream.splice(index, 1); + for (var type in this.upstreamListeners) { + source.removeListener(type, this.upstreamListeners[type]); + } + } + return this; +}; + +module.exports = EventHandler; +},{"./EventEmitter":6}],8:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Context = _dereq_('./Context'); +var Transform = _dereq_('./Transform'); +var Surface = _dereq_('./Surface'); + +/** + * A Context designed to contain surfaces and set properties + * to be applied to all of them at once. + * This is primarily used for specific performance improvements in the rendering engine. + * Private. + * + * @private + * @class Group + * @extends Surface + * @constructor + * @param {Object} [options] Surface options array (see Surface}) + */ +function Group(options) { + Surface.call(this, options); + this._shouldRecalculateSize = false; + this._container = document.createDocumentFragment(); + this.context = new Context(this._container); + this.setContent(this._container); + this._groupSize = [undefined, undefined]; +} + +/** @const */ +Group.SIZE_ZERO = [0, 0]; + +Group.prototype = Object.create(Surface.prototype); +Group.prototype.elementType = 'div'; +Group.prototype.elementClass = 'famous-group'; + +/** + * Add renderables to this component's render tree. + * + * @method add + * @private + * @param {Object} obj renderable object + * @return {RenderNode} Render wrapping provided object, if not already a RenderNode + */ +Group.prototype.add = function add() { + return this.context.add.apply(this.context, arguments); +}; + +/** + * Generate a render spec from the contents of this component. + * + * @private + * @method render + * @return {Number} Render spec for this component + */ +Group.prototype.render = function render() { + return Surface.prototype.render.call(this); +}; + +/** + * Place the document element this component manages into the document. + * + * @private + * @method deploy + * @param {Node} target document parent of this container + */ +Group.prototype.deploy = function deploy(target) { + this.context.migrate(target); +}; + +/** + * Remove this component and contained content from the document + * + * @private + * @method recall + * + * @param {Node} target node to which the component was deployed + */ +Group.prototype.recall = function recall(target) { + this._container = document.createDocumentFragment(); + this.context.migrate(this._container); +}; + +/** + * Apply changes from this component to the corresponding document element. + * + * @private + * @method commit + * + * @param {Object} context update spec passed in from above in the render tree. + */ +Group.prototype.commit = function commit(context) { + var transform = context.transform; + var origin = context.origin; + var opacity = context.opacity; + var size = context.size; + var result = Surface.prototype.commit.call(this, { + allocator: context.allocator, + transform: Transform.thenMove(transform, [-origin[0] * size[0], -origin[1] * size[1], 0]), + opacity: opacity, + origin: origin, + size: Group.SIZE_ZERO + }); + if (size[0] !== this._groupSize[0] || size[1] !== this._groupSize[1]) { + this._groupSize[0] = size[0]; + this._groupSize[1] = size[1]; + this.context.setSize(size); + } + this.context.update({ + transform: Transform.translate(-origin[0] * size[0], -origin[1] * size[1], 0), + origin: origin, + size: size + }); + return result; +}; + +module.exports = Group; +},{"./Context":1,"./Surface":14,"./Transform":15}],9:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Transform = _dereq_('./Transform'); +var Transitionable = _dereq_('../transitions/Transitionable'); +var TransitionableTransform = _dereq_('../transitions/TransitionableTransform'); + +/** + * + * A collection of visual changes to be + * applied to another renderable component. This collection includes a + * transform matrix, an opacity constant, a size, an origin specifier. + * Modifier objects can be added to any RenderNode or object + * capable of displaying renderables. The Modifier's children and descendants + * are transformed by the amounts specified in the Modifier's properties. + * + * @class Modifier + * @constructor + * @param {Object} [options] overrides of default options + * @param {Transform} [options.transform] affine transformation matrix + * @param {Number} [options.opacity] + * @param {Array.Number} [options.origin] origin adjustment + * @param {Array.Number} [options.size] size to apply to descendants + */ +function Modifier(options) { + this._transformGetter = null; + this._opacityGetter = null; + this._originGetter = null; + this._alignGetter = null; + this._sizeGetter = null; + this._proportionGetter = null; + + /* TODO: remove this when deprecation complete */ + this._legacyStates = {}; + + this._output = { + transform: Transform.identity, + opacity: 1, + origin: null, + align: null, + size: null, + proportions: null, + target: null + }; + + if (options) { + if (options.transform) this.transformFrom(options.transform); + if (options.opacity !== undefined) this.opacityFrom(options.opacity); + if (options.origin) this.originFrom(options.origin); + if (options.align) this.alignFrom(options.align); + if (options.size) this.sizeFrom(options.size); + if (options.proportions) this.proportionsFrom(options.proportions); + } +} + +/** + * Function, object, or static transform matrix which provides the transform. + * This is evaluated on every tick of the engine. + * + * @method transformFrom + * + * @param {Object} transform transform provider object + * @return {Modifier} this + */ +Modifier.prototype.transformFrom = function transformFrom(transform) { + if (transform instanceof Function) this._transformGetter = transform; + else if (transform instanceof Object && transform.get) this._transformGetter = transform.get.bind(transform); + else { + this._transformGetter = null; + this._output.transform = transform; + } + return this; +}; + +/** + * Set function, object, or number to provide opacity, in range [0,1]. + * + * @method opacityFrom + * + * @param {Object} opacity provider object + * @return {Modifier} this + */ +Modifier.prototype.opacityFrom = function opacityFrom(opacity) { + if (opacity instanceof Function) this._opacityGetter = opacity; + else if (opacity instanceof Object && opacity.get) this._opacityGetter = opacity.get.bind(opacity); + else { + this._opacityGetter = null; + this._output.opacity = opacity; + } + return this; +}; + +/** + * Set function, object, or numerical array to provide origin, as [x,y], + * where x and y are in the range [0,1]. + * + * @method originFrom + * + * @param {Object} origin provider object + * @return {Modifier} this + */ +Modifier.prototype.originFrom = function originFrom(origin) { + if (origin instanceof Function) this._originGetter = origin; + else if (origin instanceof Object && origin.get) this._originGetter = origin.get.bind(origin); + else { + this._originGetter = null; + this._output.origin = origin; + } + return this; +}; + +/** + * Set function, object, or numerical array to provide align, as [x,y], + * where x and y are in the range [0,1]. + * + * @method alignFrom + * + * @param {Object} align provider object + * @return {Modifier} this + */ +Modifier.prototype.alignFrom = function alignFrom(align) { + if (align instanceof Function) this._alignGetter = align; + else if (align instanceof Object && align.get) this._alignGetter = align.get.bind(align); + else { + this._alignGetter = null; + this._output.align = align; + } + return this; +}; + +/** + * Set function, object, or numerical array to provide size, as [width, height]. + * + * @method sizeFrom + * + * @param {Object} size provider object + * @return {Modifier} this + */ +Modifier.prototype.sizeFrom = function sizeFrom(size) { + if (size instanceof Function) this._sizeGetter = size; + else if (size instanceof Object && size.get) this._sizeGetter = size.get.bind(size); + else { + this._sizeGetter = null; + this._output.size = size; + } + return this; +}; + +/** + * Set function, object, or numerical array to provide proportions, as [percent of width, percent of height]. + * + * @method proportionsFrom + * + * @param {Object} proportions provider object + * @return {Modifier} this + */ +Modifier.prototype.proportionsFrom = function proportionsFrom(proportions) { + if (proportions instanceof Function) this._proportionGetter = proportions; + else if (proportions instanceof Object && proportions.get) this._proportionGetter = proportions.get.bind(proportions); + else { + this._proportionGetter = null; + this._output.proportions = proportions; + } + return this; +}; + + /** + * Deprecated: Prefer transformFrom with static Transform, or use a TransitionableTransform. + * @deprecated + * @method setTransform + * + * @param {Transform} transform Transform to transition to + * @param {Transitionable} transition Valid transitionable object + * @param {Function} callback callback to call after transition completes + * @return {Modifier} this + */ +Modifier.prototype.setTransform = function setTransform(transform, transition, callback) { + if (transition || this._legacyStates.transform) { + if (!this._legacyStates.transform) { + this._legacyStates.transform = new TransitionableTransform(this._output.transform); + } + if (!this._transformGetter) this.transformFrom(this._legacyStates.transform); + + this._legacyStates.transform.set(transform, transition, callback); + return this; + } + else return this.transformFrom(transform); +}; + +/** + * Deprecated: Prefer opacityFrom with static opacity array, or use a Transitionable with that opacity. + * @deprecated + * @method setOpacity + * + * @param {Number} opacity Opacity value to transition to. + * @param {Transitionable} transition Valid transitionable object + * @param {Function} callback callback to call after transition completes + * @return {Modifier} this + */ +Modifier.prototype.setOpacity = function setOpacity(opacity, transition, callback) { + if (transition || this._legacyStates.opacity) { + if (!this._legacyStates.opacity) { + this._legacyStates.opacity = new Transitionable(this._output.opacity); + } + if (!this._opacityGetter) this.opacityFrom(this._legacyStates.opacity); + + return this._legacyStates.opacity.set(opacity, transition, callback); + } + else return this.opacityFrom(opacity); +}; + +/** + * Deprecated: Prefer originFrom with static origin array, or use a Transitionable with that origin. + * @deprecated + * @method setOrigin + * + * @param {Array.Number} origin two element array with values between 0 and 1. + * @param {Transitionable} transition Valid transitionable object + * @param {Function} callback callback to call after transition completes + * @return {Modifier} this + */ +Modifier.prototype.setOrigin = function setOrigin(origin, transition, callback) { + /* TODO: remove this if statement when deprecation complete */ + if (transition || this._legacyStates.origin) { + + if (!this._legacyStates.origin) { + this._legacyStates.origin = new Transitionable(this._output.origin || [0, 0]); + } + if (!this._originGetter) this.originFrom(this._legacyStates.origin); + + this._legacyStates.origin.set(origin, transition, callback); + return this; + } + else return this.originFrom(origin); +}; + +/** + * Deprecated: Prefer alignFrom with static align array, or use a Transitionable with that align. + * @deprecated + * @method setAlign + * + * @param {Array.Number} align two element array with values between 0 and 1. + * @param {Transitionable} transition Valid transitionable object + * @param {Function} callback callback to call after transition completes + * @return {Modifier} this + */ +Modifier.prototype.setAlign = function setAlign(align, transition, callback) { + /* TODO: remove this if statement when deprecation complete */ + if (transition || this._legacyStates.align) { + + if (!this._legacyStates.align) { + this._legacyStates.align = new Transitionable(this._output.align || [0, 0]); + } + if (!this._alignGetter) this.alignFrom(this._legacyStates.align); + + this._legacyStates.align.set(align, transition, callback); + return this; + } + else return this.alignFrom(align); +}; + +/** + * Deprecated: Prefer sizeFrom with static origin array, or use a Transitionable with that size. + * @deprecated + * @method setSize + * @param {Array.Number} size two element array of [width, height] + * @param {Transitionable} transition Valid transitionable object + * @param {Function} callback callback to call after transition completes + * @return {Modifier} this + */ +Modifier.prototype.setSize = function setSize(size, transition, callback) { + if (size && (transition || this._legacyStates.size)) { + if (!this._legacyStates.size) { + this._legacyStates.size = new Transitionable(this._output.size || [0, 0]); + } + if (!this._sizeGetter) this.sizeFrom(this._legacyStates.size); + + this._legacyStates.size.set(size, transition, callback); + return this; + } + else return this.sizeFrom(size); +}; + +/** + * Deprecated: Prefer proportionsFrom with static origin array, or use a Transitionable with those proportions. + * @deprecated + * @method setProportions + * @param {Array.Number} proportions two element array of [percent of width, percent of height] + * @param {Transitionable} transition Valid transitionable object + * @param {Function} callback callback to call after transition completes + * @return {Modifier} this + */ +Modifier.prototype.setProportions = function setProportions(proportions, transition, callback) { + if (proportions && (transition || this._legacyStates.proportions)) { + if (!this._legacyStates.proportions) { + this._legacyStates.proportions = new Transitionable(this._output.proportions || [0, 0]); + } + if (!this._proportionGetter) this.proportionsFrom(this._legacyStates.proportions); + + this._legacyStates.proportions.set(proportions, transition, callback); + return this; + } + else return this.proportionsFrom(proportions); +}; + +/** + * Deprecated: Prefer to stop transform in your provider object. + * @deprecated + * @method halt + */ +Modifier.prototype.halt = function halt() { + if (this._legacyStates.transform) this._legacyStates.transform.halt(); + if (this._legacyStates.opacity) this._legacyStates.opacity.halt(); + if (this._legacyStates.origin) this._legacyStates.origin.halt(); + if (this._legacyStates.align) this._legacyStates.align.halt(); + if (this._legacyStates.size) this._legacyStates.size.halt(); + if (this._legacyStates.proportions) this._legacyStates.proportions.halt(); + this._transformGetter = null; + this._opacityGetter = null; + this._originGetter = null; + this._alignGetter = null; + this._sizeGetter = null; + this._proportionGetter = null; +}; + +/** + * Deprecated: Prefer to use your provided transform or output of your transform provider. + * @deprecated + * @method getTransform + * @return {Object} transform provider object + */ +Modifier.prototype.getTransform = function getTransform() { + return this._transformGetter(); +}; + +/** + * Deprecated: Prefer to determine the end state of your transform from your transform provider + * @deprecated + * @method getFinalTransform + * @return {Transform} transform matrix + */ +Modifier.prototype.getFinalTransform = function getFinalTransform() { + return this._legacyStates.transform ? this._legacyStates.transform.getFinal() : this._output.transform; +}; + +/** + * Deprecated: Prefer to use your provided opacity or output of your opacity provider. + * @deprecated + * @method getOpacity + * @return {Object} opacity provider object + */ +Modifier.prototype.getOpacity = function getOpacity() { + return this._opacityGetter(); +}; + +/** + * Deprecated: Prefer to use your provided origin or output of your origin provider. + * @deprecated + * @method getOrigin + * @return {Object} origin provider object + */ +Modifier.prototype.getOrigin = function getOrigin() { + return this._originGetter(); +}; + +/** + * Deprecated: Prefer to use your provided align or output of your align provider. + * @deprecated + * @method getAlign + * @return {Object} align provider object + */ +Modifier.prototype.getAlign = function getAlign() { + return this._alignGetter(); +}; + +/** + * Deprecated: Prefer to use your provided size or output of your size provider. + * @deprecated + * @method getSize + * @return {Object} size provider object + */ +Modifier.prototype.getSize = function getSize() { + return this._sizeGetter ? this._sizeGetter() : this._output.size; +}; + +/** + * Deprecated: Prefer to use your provided proportions or output of your proportions provider. + * @deprecated + * @method getProportions + * @return {Object} proportions provider object + */ +Modifier.prototype.getProportions = function getProportions() { + return this._proportionGetter ? this._proportionGetter() : this._output.proportions; +}; + +// call providers on tick to receive render spec elements to apply +function _update() { + if (this._transformGetter) this._output.transform = this._transformGetter(); + if (this._opacityGetter) this._output.opacity = this._opacityGetter(); + if (this._originGetter) this._output.origin = this._originGetter(); + if (this._alignGetter) this._output.align = this._alignGetter(); + if (this._sizeGetter) this._output.size = this._sizeGetter(); + if (this._proportionGetter) this._output.proportions = this._proportionGetter(); +} + +/** + * Return render spec for this Modifier, applying to the provided + * target component. This is similar to render() for Surfaces. + * + * @private + * @method modify + * + * @param {Object} target (already rendered) render spec to + * which to apply the transform. + * @return {Object} render spec for this Modifier, including the + * provided target + */ +Modifier.prototype.modify = function modify(target) { + _update.call(this); + this._output.target = target; + return this._output; +}; + +module.exports = Modifier; +},{"../transitions/Transitionable":89,"../transitions/TransitionableTransform":90,"./Transform":15}],10:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var EventHandler = _dereq_('./EventHandler'); + +/** + * A collection of methods for setting options which can be extended + * onto other classes. + * + * + * **** WARNING **** + * You can only pass through objects that will compile into valid JSON. + * + * Valid options: + * Strings, + * Arrays, + * Objects, + * Numbers, + * Nested Objects, + * Nested Arrays. + * + * This excludes: + * Document Fragments, + * Functions + * @class OptionsManager + * @constructor + * @param {Object} value options dictionary + */ +function OptionsManager(value) { + this._value = value; + this.eventOutput = null; +} + +/** + * Create options manager from source dictionary with arguments overriden by patch dictionary. + * + * @static + * @method OptionsManager.patch + * + * @param {Object} source source arguments + * @param {...Object} data argument additions and overwrites + * @return {Object} source object + */ +OptionsManager.patch = function patchObject(source, data) { + var manager = new OptionsManager(source); + for (var i = 1; i < arguments.length; i++) manager.patch(arguments[i]); + return source; +}; + +function _createEventOutput() { + this.eventOutput = new EventHandler(); + this.eventOutput.bindThis(this); + EventHandler.setOutputHandler(this, this.eventOutput); +} + +/** + * Create OptionsManager from source with arguments overriden by patches. + * Triggers 'change' event on this object's event handler if the state of + * the OptionsManager changes as a result. + * + * @method patch + * + * @param {...Object} arguments list of patch objects + * @return {OptionsManager} this + */ +OptionsManager.prototype.patch = function patch() { + var myState = this._value; + for (var i = 0; i < arguments.length; i++) { + var data = arguments[i]; + for (var k in data) { + if ((k in myState) && (data[k] && data[k].constructor === Object) && (myState[k] && myState[k].constructor === Object)) { + if (!myState.hasOwnProperty(k)) myState[k] = Object.create(myState[k]); + this.key(k).patch(data[k]); + if (this.eventOutput) this.eventOutput.emit('change', {id: k, value: this.key(k).value()}); + } + else this.set(k, data[k]); + } + } + return this; +}; + +/** + * Alias for patch + * + * @method setOptions + * + */ +OptionsManager.prototype.setOptions = OptionsManager.prototype.patch; + +/** + * Return OptionsManager based on sub-object retrieved by key + * + * @method key + * + * @param {string} identifier key + * @return {OptionsManager} new options manager with the value + */ +OptionsManager.prototype.key = function key(identifier) { + var result = new OptionsManager(this._value[identifier]); + if (!(result._value instanceof Object) || result._value instanceof Array) result._value = {}; + return result; +}; + +/** + * Look up value by key or get the full options hash + * @method get + * + * @param {string} key key + * @return {Object} associated object or full options hash + */ +OptionsManager.prototype.get = function get(key) { + return key ? this._value[key] : this._value; +}; + +/** + * Alias for get + * @method getOptions + */ +OptionsManager.prototype.getOptions = OptionsManager.prototype.get; + +/** + * Set key to value. Outputs 'change' event if a value is overwritten. + * + * @method set + * + * @param {string} key key string + * @param {Object} value value object + * @return {OptionsManager} new options manager based on the value object + */ +OptionsManager.prototype.set = function set(key, value) { + var originalValue = this.get(key); + this._value[key] = value; + if (this.eventOutput && value !== originalValue) this.eventOutput.emit('change', {id: key, value: value}); + return this; +}; + +/** + * Bind a callback function to an event type handled by this object. + * + * @method "on" + * + * @param {string} type event type key (for example, 'change') + * @param {function(string, Object)} handler callback + * @return {EventHandler} this + */ +OptionsManager.prototype.on = function on() { + _createEventOutput.call(this); + return this.on.apply(this, arguments); +}; + +/** + * Unbind an event by type and handler. + * This undoes the work of "on". + * + * @method removeListener + * + * @param {string} type event type key (for example, 'change') + * @param {function} handler function object to remove + * @return {EventHandler} internal event handler object (for chaining) + */ +OptionsManager.prototype.removeListener = function removeListener() { + _createEventOutput.call(this); + return this.removeListener.apply(this, arguments); +}; + +/** + * Add event handler object to set of downstream handlers. + * + * @method pipe + * + * @param {EventHandler} target event handler target object + * @return {EventHandler} passed event handler + */ +OptionsManager.prototype.pipe = function pipe() { + _createEventOutput.call(this); + return this.pipe.apply(this, arguments); +}; + +/** + * Remove handler object from set of downstream handlers. + * Undoes work of "pipe" + * + * @method unpipe + * + * @param {EventHandler} target target handler object + * @return {EventHandler} provided target + */ +OptionsManager.prototype.unpipe = function unpipe() { + _createEventOutput.call(this); + return this.unpipe.apply(this, arguments); +}; + +module.exports = OptionsManager; +},{"./EventHandler":7}],11:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Entity = _dereq_('./Entity'); +var SpecParser = _dereq_('./SpecParser'); + +/** + * A wrapper for inserting a renderable component (like a Modifer or + * Surface) into the render tree. + * + * @class RenderNode + * @constructor + * + * @param {Object} object Target renderable component + */ +function RenderNode(object) { + this._object = null; + this._child = null; + this._hasMultipleChildren = false; + this._isRenderable = false; + this._isModifier = false; + + this._resultCache = {}; + this._prevResults = {}; + + this._childResult = null; + + if (object) this.set(object); +} + +/** + * Append a renderable to the list of this node's children. + * This produces a new RenderNode in the tree. + * Note: Does not double-wrap if child is a RenderNode already. + * + * @method add + * @param {Object} child renderable object + * @return {RenderNode} new render node wrapping child + */ +RenderNode.prototype.add = function add(child) { + var childNode = (child instanceof RenderNode) ? child : new RenderNode(child); + if (this._child instanceof Array) this._child.push(childNode); + else if (this._child) { + this._child = [this._child, childNode]; + this._hasMultipleChildren = true; + this._childResult = []; // to be used later + } + else this._child = childNode; + + return childNode; +}; + +/** + * Return the single wrapped object. Returns null if this node has multiple child nodes. + * + * @method get + * + * @return {Ojbect} contained renderable object + */ +RenderNode.prototype.get = function get() { + return this._object || (this._hasMultipleChildren ? null : (this._child ? this._child.get() : null)); +}; + +/** + * Overwrite the list of children to contain the single provided object + * + * @method set + * @param {Object} child renderable object + * @return {RenderNode} this render node, or child if it is a RenderNode + */ +RenderNode.prototype.set = function set(child) { + this._childResult = null; + this._hasMultipleChildren = false; + this._isRenderable = child.render ? true : false; + this._isModifier = child.modify ? true : false; + this._object = child; + this._child = null; + if (child instanceof RenderNode) return child; + else return this; +}; + +/** + * Get render size of contained object. + * + * @method getSize + * @return {Array.Number} size of this or size of single child. + */ +RenderNode.prototype.getSize = function getSize() { + var result = null; + var target = this.get(); + if (target && target.getSize) result = target.getSize(); + if (!result && this._child && this._child.getSize) result = this._child.getSize(); + return result; +}; + +// apply results of rendering this subtree to the document +function _applyCommit(spec, context, cacheStorage) { + var result = SpecParser.parse(spec, context); + var keys = Object.keys(result); + for (var i = 0; i < keys.length; i++) { + var id = keys[i]; + var childNode = Entity.get(id); + var commitParams = result[id]; + commitParams.allocator = context.allocator; + var commitResult = childNode.commit(commitParams); + if (commitResult) _applyCommit(commitResult, context, cacheStorage); + else cacheStorage[id] = commitParams; + } +} + +/** + * Commit the content change from this node to the document. + * + * @private + * @method commit + * @param {Context} context render context + */ +RenderNode.prototype.commit = function commit(context) { + // free up some divs from the last loop + var prevKeys = Object.keys(this._prevResults); + for (var i = 0; i < prevKeys.length; i++) { + var id = prevKeys[i]; + if (this._resultCache[id] === undefined) { + var object = Entity.get(id); + if (object.cleanup) object.cleanup(context.allocator); + } + } + + this._prevResults = this._resultCache; + this._resultCache = {}; + _applyCommit(this.render(), context, this._resultCache); +}; + +/** + * Generate a render spec from the contents of the wrapped component. + * + * @private + * @method render + * + * @return {Object} render specification for the component subtree + * only under this node. + */ +RenderNode.prototype.render = function render() { + if (this._isRenderable) return this._object.render(); + + var result = null; + if (this._hasMultipleChildren) { + result = this._childResult; + var children = this._child; + for (var i = 0; i < children.length; i++) { + result[i] = children[i].render(); + } + } + else if (this._child) result = this._child.render(); + + return this._isModifier ? this._object.modify(result) : result; +}; + +module.exports = RenderNode; +},{"./Entity":5,"./SpecParser":13}],12:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Transform = _dereq_('./Transform'); +var Modifier = _dereq_('./Modifier'); +var RenderNode = _dereq_('./RenderNode'); + +/** + * Builds and renders a scene graph based on a declarative structure definition. + * See the Scene examples in the examples distribution (http://github.com/Famous/examples.git). + * + * @class Scene + * @constructor + * @param {Object|Array|Spec} definition in the format of a render spec. + */ +function Scene(definition) { + this.id = null; + this._objects = null; + + this.node = new RenderNode(); + this._definition = null; + + if (definition) this.load(definition); +} + +var _MATRIX_GENERATORS = { + 'translate': Transform.translate, + 'rotate': Transform.rotate, + 'rotateX': Transform.rotateX, + 'rotateY': Transform.rotateY, + 'rotateZ': Transform.rotateZ, + 'rotateAxis': Transform.rotateAxis, + 'scale': Transform.scale, + 'skew': Transform.skew, + 'matrix3d': function() { + return arguments; + } +}; + +/** + * Clone this scene + * + * @method create + * @return {Scene} deep copy of this scene + */ +Scene.prototype.create = function create() { + return new Scene(this._definition); +}; + +function _resolveTransformMatrix(matrixDefinition) { + for (var type in _MATRIX_GENERATORS) { + if (type in matrixDefinition) { + var args = matrixDefinition[type]; + if (!(args instanceof Array)) args = [args]; + return _MATRIX_GENERATORS[type].apply(this, args); + } + } +} + +// parse transform into tree of render nodes, doing matrix multiplication +// when available +function _parseTransform(definition) { + var transformDefinition = definition.transform; + var opacity = definition.opacity; + var origin = definition.origin; + var align = definition.align; + var size = definition.size; + var transform = Transform.identity; + if (transformDefinition instanceof Array) { + if (transformDefinition.length === 16 && typeof transformDefinition[0] === 'number') { + transform = transformDefinition; + } + else { + for (var i = 0; i < transformDefinition.length; i++) { + transform = Transform.multiply(transform, _resolveTransformMatrix(transformDefinition[i])); + } + } + } + else if (transformDefinition instanceof Function) { + transform = transformDefinition; + } + else if (transformDefinition instanceof Object) { + transform = _resolveTransformMatrix(transformDefinition); + } + + var result = new Modifier({ + transform: transform, + opacity: opacity, + origin: origin, + align: align, + size: size + }); + return result; +} + +function _parseArray(definition) { + var result = new RenderNode(); + for (var i = 0; i < definition.length; i++) { + var obj = _parse.call(this, definition[i]); + if (obj) result.add(obj); + } + return result; +} + +// parse object directly into tree of RenderNodes +function _parse(definition) { + var result; + var id; + if (definition instanceof Array) { + result = _parseArray.call(this, definition); + } + else { + id = this._objects.length; + if (definition.render && (definition.render instanceof Function)) { + result = definition; + } + else if (definition.target) { + var targetObj = _parse.call(this, definition.target); + var obj = _parseTransform.call(this, definition); + + result = new RenderNode(obj); + result.add(targetObj); + if (definition.id) this.id[definition.id] = obj; + } + else if (definition.id) { + result = new RenderNode(); + this.id[definition.id] = result; + } + } + this._objects[id] = result; + return result; +} + +/** + * Builds and renders a scene graph based on a canonical declarative scene definition. + * See examples/Scene/example.js. + * + * @method load + * @param {Object} definition definition in the format of a render spec. + */ +Scene.prototype.load = function load(definition) { + this._definition = definition; + this.id = {}; + this._objects = []; + this.node.set(_parse.call(this, definition)); +}; + +/** + * Add renderables to this component's render tree + * + * @method add + * + * @param {Object} obj renderable object + * @return {RenderNode} Render wrapping provided object, if not already a RenderNode + */ +Scene.prototype.add = function add() { + return this.node.add.apply(this.node, arguments); +}; + +/** + * Generate a render spec from the contents of this component. + * + * @private + * @method render + * @return {number} Render spec for this component + */ +Scene.prototype.render = function render() { + return this.node.render.apply(this.node, arguments); +}; + +module.exports = Scene; +},{"./Modifier":9,"./RenderNode":11,"./Transform":15}],13:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Transform = _dereq_('./Transform'); + +/** + * + * This object translates the rendering instructions ("render specs") + * that renderable components generate into document update + * instructions ("update specs"). Private. + * + * @private + * @class SpecParser + * @constructor + */ +function SpecParser() { + this.result = {}; +} +SpecParser._instance = new SpecParser(); + +/** + * Convert a render spec coming from the context's render chain to an + * update spec for the update chain. This is the only major entry point + * for a consumer of this class. + * + * @method parse + * @static + * @private + * + * @param {renderSpec} spec input render spec + * @param {Object} context context to do the parse in + * @return {Object} the resulting update spec (if no callback + * specified, else none) + */ +SpecParser.parse = function parse(spec, context) { + return SpecParser._instance.parse(spec, context); +}; + +/** + * Convert a renderSpec coming from the context's render chain to an update + * spec for the update chain. This is the only major entrypoint for a + * consumer of this class. + * + * @method parse + * + * @private + * @param {renderSpec} spec input render spec + * @param {Context} context + * @return {updateSpec} the resulting update spec + */ +SpecParser.prototype.parse = function parse(spec, context) { + this.reset(); + this._parseSpec(spec, context, Transform.identity); + return this.result; +}; + +/** + * Prepare SpecParser for re-use (or first use) by setting internal state + * to blank. + * + * @private + * @method reset + */ +SpecParser.prototype.reset = function reset() { + this.result = {}; +}; + +// Multiply matrix M by vector v +function _vecInContext(v, m) { + return [ + v[0] * m[0] + v[1] * m[4] + v[2] * m[8], + v[0] * m[1] + v[1] * m[5] + v[2] * m[9], + v[0] * m[2] + v[1] * m[6] + v[2] * m[10] + ]; +} + +var _zeroZero = [0, 0]; + +// From the provided renderSpec tree, recursively compose opacities, +// origins, transforms, and sizes corresponding to each surface id from +// the provided renderSpec tree structure. On completion, those +// properties of 'this' object should be ready to use to build an +// updateSpec. +SpecParser.prototype._parseSpec = function _parseSpec(spec, parentContext, sizeContext) { + var id; + var target; + var transform; + var opacity; + var origin; + var align; + var size; + + if (typeof spec === 'number') { + id = spec; + transform = parentContext.transform; + align = parentContext.align || _zeroZero; + if (parentContext.size && align && (align[0] || align[1])) { + var alignAdjust = [align[0] * parentContext.size[0], align[1] * parentContext.size[1], 0]; + transform = Transform.thenMove(transform, _vecInContext(alignAdjust, sizeContext)); + } + this.result[id] = { + transform: transform, + opacity: parentContext.opacity, + origin: parentContext.origin || _zeroZero, + align: parentContext.align || _zeroZero, + size: parentContext.size + }; + } + else if (!spec) { // placed here so 0 will be cached earlier + return; + } + else if (spec instanceof Array) { + for (var i = 0; i < spec.length; i++) { + this._parseSpec(spec[i], parentContext, sizeContext); + } + } + else { + target = spec.target; + transform = parentContext.transform; + opacity = parentContext.opacity; + origin = parentContext.origin; + align = parentContext.align; + size = parentContext.size; + var nextSizeContext = sizeContext; + + if (spec.opacity !== undefined) opacity = parentContext.opacity * spec.opacity; + if (spec.transform) transform = Transform.multiply(parentContext.transform, spec.transform); + if (spec.origin) { + origin = spec.origin; + nextSizeContext = parentContext.transform; + } + if (spec.align) align = spec.align; + + if (spec.size || spec.proportions) { + var parentSize = size; + size = [size[0], size[1]]; + + if (spec.size) { + if (spec.size[0] !== undefined) size[0] = spec.size[0]; + if (spec.size[1] !== undefined) size[1] = spec.size[1]; + } + + if (spec.proportions) { + if (spec.proportions[0] !== undefined) size[0] = size[0] * spec.proportions[0]; + if (spec.proportions[1] !== undefined) size[1] = size[1] * spec.proportions[1]; + } + + if (parentSize) { + if (align && (align[0] || align[1])) transform = Transform.thenMove(transform, _vecInContext([align[0] * parentSize[0], align[1] * parentSize[1], 0], sizeContext)); + if (origin && (origin[0] || origin[1])) transform = Transform.moveThen([-origin[0] * size[0], -origin[1] * size[1], 0], transform); + } + + nextSizeContext = parentContext.transform; + origin = null; + align = null; + } + + this._parseSpec(target, { + transform: transform, + opacity: opacity, + origin: origin, + align: align, + size: size + }, nextSizeContext); + } +}; + +module.exports = SpecParser; +},{"./Transform":15}],14:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var ElementOutput = _dereq_('./ElementOutput'); + +/** + * A base class for viewable content and event + * targets inside a Famo.us application, containing a renderable document + * fragment. Like an HTML div, it can accept internal markup, + * properties, classes, and handle events. + * + * @class Surface + * @constructor + * + * @param {Object} [options] default option overrides + * @param {Array.Number} [options.size] [width, height] in pixels + * @param {Array.string} [options.classes] CSS classes to set on target div + * @param {Array} [options.properties] string dictionary of CSS properties to set on target div + * @param {Array} [options.attributes] string dictionary of HTML attributes to set on target div + * @param {string} [options.content] inner (HTML) content of surface + */ +function Surface(options) { + ElementOutput.call(this); + + this.options = {}; + + this.properties = {}; + this.attributes = {}; + this.content = ''; + this.classList = []; + this.size = null; + + this._classesDirty = true; + this._stylesDirty = true; + this._attributesDirty = true; + this._sizeDirty = true; + this._contentDirty = true; + this._trueSizeCheck = true; + + this._dirtyClasses = []; + + if (options) this.setOptions(options); + + this._currentTarget = null; +} +Surface.prototype = Object.create(ElementOutput.prototype); +Surface.prototype.constructor = Surface; +Surface.prototype.elementType = 'div'; +Surface.prototype.elementClass = 'famous-surface'; + +/** + * Set HTML attributes on this Surface. Note that this will cause + * dirtying and thus re-rendering, even if values do not change. + * + * @method setAttributes +* @param {Object} attributes property dictionary of "key" => "value" + */ +Surface.prototype.setAttributes = function setAttributes(attributes) { + for (var n in attributes) { + if (n === 'style') throw new Error('Cannot set styles via "setAttributes" as it will break Famo.us. Use "setProperties" instead.'); + this.attributes[n] = attributes[n]; + } + this._attributesDirty = true; +}; + +/** + * Get HTML attributes on this Surface. + * + * @method getAttributes + * + * @return {Object} Dictionary of this Surface's attributes. + */ +Surface.prototype.getAttributes = function getAttributes() { + return this.attributes; +}; + +/** + * Set CSS-style properties on this Surface. Note that this will cause + * dirtying and thus re-rendering, even if values do not change. + * + * @method setProperties + * @chainable + * @param {Object} properties property dictionary of "key" => "value" + */ +Surface.prototype.setProperties = function setProperties(properties) { + for (var n in properties) { + this.properties[n] = properties[n]; + } + this._stylesDirty = true; + return this; +}; + +/** + * Get CSS-style properties on this Surface. + * + * @method getProperties + * + * @return {Object} Dictionary of this Surface's properties. + */ +Surface.prototype.getProperties = function getProperties() { + return this.properties; +}; + +/** + * Add CSS-style class to the list of classes on this Surface. Note + * this will map directly to the HTML property of the actual + * corresponding rendered
. + * + * @method addClass + * @chainable + * @param {string} className name of class to add + */ +Surface.prototype.addClass = function addClass(className) { + if (this.classList.indexOf(className) < 0) { + this.classList.push(className); + this._classesDirty = true; + } + return this; +}; + +/** + * Remove CSS-style class from the list of classes on this Surface. + * Note this will map directly to the HTML property of the actual + * corresponding rendered
. + * + * @method removeClass + * @chainable + * @param {string} className name of class to remove + */ +Surface.prototype.removeClass = function removeClass(className) { + var i = this.classList.indexOf(className); + if (i >= 0) { + this._dirtyClasses.push(this.classList.splice(i, 1)[0]); + this._classesDirty = true; + } + return this; +}; + +/** + * Toggle CSS-style class from the list of classes on this Surface. + * Note this will map directly to the HTML property of the actual + * corresponding rendered
. + * + * @method toggleClass + * @param {string} className name of class to toggle + */ +Surface.prototype.toggleClass = function toggleClass(className) { + var i = this.classList.indexOf(className); + if (i >= 0) { + this.removeClass(className); + } else { + this.addClass(className); + } + return this; +}; + +/** + * Reset class list to provided dictionary. + * @method setClasses + * @chainable + * @param {Array.string} classList + */ +Surface.prototype.setClasses = function setClasses(classList) { + var i = 0; + var removal = []; + for (i = 0; i < this.classList.length; i++) { + if (classList.indexOf(this.classList[i]) < 0) removal.push(this.classList[i]); + } + for (i = 0; i < removal.length; i++) this.removeClass(removal[i]); + // duplicates are already checked by addClass() + for (i = 0; i < classList.length; i++) this.addClass(classList[i]); + return this; +}; + +/** + * Get array of CSS-style classes attached to this div. + * + * @method getClasslist + * @return {Array.string} array of class names + */ +Surface.prototype.getClassList = function getClassList() { + return this.classList; +}; + +/** + * Set or overwrite inner (HTML) content of this surface. Note that this + * causes a re-rendering if the content has changed. + * + * @method setContent + * @chainable + * @param {string|Document Fragment} content HTML content + */ +Surface.prototype.setContent = function setContent(content) { + if (this.content !== content) { + this.content = content; + this._contentDirty = true; + } + return this; +}; + +/** + * Return inner (HTML) content of this surface. + * + * @method getContent + * + * @return {string} inner (HTML) content + */ +Surface.prototype.getContent = function getContent() { + return this.content; +}; + +/** + * Set options for this surface + * + * @method setOptions + * @chainable + * @param {Object} [options] overrides for default options. See constructor. + */ +Surface.prototype.setOptions = function setOptions(options) { + if (options.size) this.setSize(options.size); + if (options.classes) this.setClasses(options.classes); + if (options.properties) this.setProperties(options.properties); + if (options.attributes) this.setAttributes(options.attributes); + if (options.content) this.setContent(options.content); + return this; +}; + +// Apply to document all changes from removeClass() since last setup(). +function _cleanupClasses(target) { + for (var i = 0; i < this._dirtyClasses.length; i++) target.classList.remove(this._dirtyClasses[i]); + this._dirtyClasses = []; +} + +// Apply values of all Famous-managed styles to the document element. +// These will be deployed to the document on call to #setup(). +function _applyStyles(target) { + for (var n in this.properties) { + target.style[n] = this.properties[n]; + } +} + +// Clear all Famous-managed styles from the document element. +// These will be deployed to the document on call to #setup(). +function _cleanupStyles(target) { + for (var n in this.properties) { + target.style[n] = ''; + } +} + +// Apply values of all Famous-managed attributes to the document element. +// These will be deployed to the document on call to #setup(). +function _applyAttributes(target) { + for (var n in this.attributes) { + target.setAttribute(n, this.attributes[n]); + } +} + +// Clear all Famous-managed attributes from the document element. +// These will be deployed to the document on call to #setup(). +function _cleanupAttributes(target) { + for (var n in this.attributes) { + target.removeAttribute(n); + } +} + +function _xyNotEquals(a, b) { + return (a && b) ? (a[0] !== b[0] || a[1] !== b[1]) : a !== b; +} + +/** + * One-time setup for an element to be ready for commits to document. + * + * @private + * @method setup + * + * @param {ElementAllocator} allocator document element pool for this context + */ +Surface.prototype.setup = function setup(allocator) { + var target = allocator.allocate(this.elementType); + if (this.elementClass) { + if (this.elementClass instanceof Array) { + for (var i = 0; i < this.elementClass.length; i++) { + target.classList.add(this.elementClass[i]); + } + } + else { + target.classList.add(this.elementClass); + } + } + target.style.display = ''; + this.attach(target); + this._opacity = null; + this._currentTarget = target; + this._stylesDirty = true; + this._classesDirty = true; + this._attributesDirty = true; + this._sizeDirty = true; + this._contentDirty = true; + this._originDirty = true; + this._transformDirty = true; +}; + +/** + * Apply changes from this component to the corresponding document element. + * This includes changes to classes, styles, size, content, opacity, origin, + * and matrix transforms. + * + * @private + * @method commit + * @param {Context} context commit context + */ +Surface.prototype.commit = function commit(context) { + if (!this._currentTarget) this.setup(context.allocator); + var target = this._currentTarget; + var size = context.size; + + if (this._classesDirty) { + _cleanupClasses.call(this, target); + var classList = this.getClassList(); + for (var i = 0; i < classList.length; i++) target.classList.add(classList[i]); + this._classesDirty = false; + this._trueSizeCheck = true; + } + + if (this._stylesDirty) { + _applyStyles.call(this, target); + this._stylesDirty = false; + this._trueSizeCheck = true; + } + + if (this._attributesDirty) { + _applyAttributes.call(this, target); + this._attributesDirty = false; + this._trueSizeCheck = true; + } + + if (this.size) { + var origSize = context.size; + size = [this.size[0], this.size[1]]; + if (size[0] === undefined) size[0] = origSize[0]; + if (size[1] === undefined) size[1] = origSize[1]; + if (size[0] === true || size[1] === true) { + if (size[0] === true){ + if (this._trueSizeCheck || (this._size[0] === 0)) { + var width = target.offsetWidth; + if (this._size && this._size[0] !== width) { + this._size[0] = width; + this._sizeDirty = true; + } + size[0] = width; + } else { + if (this._size) size[0] = this._size[0]; + } + } + if (size[1] === true){ + if (this._trueSizeCheck || (this._size[1] === 0)) { + var height = target.offsetHeight; + if (this._size && this._size[1] !== height) { + this._size[1] = height; + this._sizeDirty = true; + } + size[1] = height; + } else { + if (this._size) size[1] = this._size[1]; + } + } + this._trueSizeCheck = false; + } + } + + if (_xyNotEquals(this._size, size)) { + if (!this._size) this._size = [0, 0]; + this._size[0] = size[0]; + this._size[1] = size[1]; + + this._sizeDirty = true; + } + + if (this._sizeDirty) { + if (this._size) { + target.style.width = (this.size && this.size[0] === true) ? '' : this._size[0] + 'px'; + target.style.height = (this.size && this.size[1] === true) ? '' : this._size[1] + 'px'; + } + + this._eventOutput.emit('resize'); + } + + if (this._contentDirty) { + this.deploy(target); + this._eventOutput.emit('deploy'); + this._contentDirty = false; + this._trueSizeCheck = true; + } + + ElementOutput.prototype.commit.call(this, context); +}; + +/** + * Remove all Famous-relevant attributes from a document element. + * This is called by SurfaceManager's detach(). + * This is in some sense the reverse of .deploy(). + * + * @private + * @method cleanup + * @param {ElementAllocator} allocator + */ +Surface.prototype.cleanup = function cleanup(allocator) { + var i = 0; + var target = this._currentTarget; + this._eventOutput.emit('recall'); + this.recall(target); + target.style.display = 'none'; + target.style.opacity = ''; + target.style.width = ''; + target.style.height = ''; + _cleanupStyles.call(this, target); + _cleanupAttributes.call(this, target); + var classList = this.getClassList(); + _cleanupClasses.call(this, target); + for (i = 0; i < classList.length; i++) target.classList.remove(classList[i]); + if (this.elementClass) { + if (this.elementClass instanceof Array) { + for (i = 0; i < this.elementClass.length; i++) { + target.classList.remove(this.elementClass[i]); + } + } + else { + target.classList.remove(this.elementClass); + } + } + this.detach(target); + this._currentTarget = null; + allocator.deallocate(target); +}; + +/** + * Place the document element that this component manages into the document. + * + * @private + * @method deploy + * @param {Node} target document parent of this container + */ +Surface.prototype.deploy = function deploy(target) { + var content = this.getContent(); + if (content instanceof Node) { + while (target.hasChildNodes()) target.removeChild(target.firstChild); + target.appendChild(content); + } + else target.innerHTML = content; +}; + +/** + * Remove any contained document content associated with this surface + * from the actual document. + * + * @private + * @method recall + */ +Surface.prototype.recall = function recall(target) { + var df = document.createDocumentFragment(); + while (target.hasChildNodes()) df.appendChild(target.firstChild); + this.setContent(df); +}; + +/** + * Get the x and y dimensions of the surface. + * + * @method getSize + * @return {Array.Number} [x,y] size of surface + */ +Surface.prototype.getSize = function getSize() { + return this._size ? this._size : this.size; +}; + +/** + * Set x and y dimensions of the surface. + * + * @method setSize + * @chainable + * @param {Array.Number} size as [width, height] + */ +Surface.prototype.setSize = function setSize(size) { + this.size = size ? [size[0], size[1]] : null; + this._sizeDirty = true; + return this; +}; + +module.exports = Surface; +},{"./ElementOutput":3}],15:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + + + + +/** + * A high-performance static matrix math library used to calculate + * affine transforms on surfaces and other renderables. + * Famo.us uses 4x4 matrices corresponding directly to + * WebKit matrices (column-major order). + * + * The internal "type" of a Matrix is a 16-long float array in + * row-major order, with: + * elements [0],[1],[2],[4],[5],[6],[8],[9],[10] forming the 3x3 + * transformation matrix; + * elements [12], [13], [14] corresponding to the t_x, t_y, t_z + * translation; + * elements [3], [7], [11] set to 0; + * element [15] set to 1. + * All methods are static. + * + * @static + * + * @class Transform + */ +var Transform = {}; + +// WARNING: these matrices correspond to WebKit matrices, which are +// transposed from their math counterparts +Transform.precision = 1e-6; +Transform.identity = [1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1]; + +/** + * Multiply two or more Transform matrix types to return a Transform matrix. + * + * @method multiply4x4 + * @static + * @param {Transform} a left Transform + * @param {Transform} b right Transform + * @return {Transform} + */ +Transform.multiply4x4 = function multiply4x4(a, b) { + return [ + a[0] * b[0] + a[4] * b[1] + a[8] * b[2] + a[12] * b[3], + a[1] * b[0] + a[5] * b[1] + a[9] * b[2] + a[13] * b[3], + a[2] * b[0] + a[6] * b[1] + a[10] * b[2] + a[14] * b[3], + a[3] * b[0] + a[7] * b[1] + a[11] * b[2] + a[15] * b[3], + a[0] * b[4] + a[4] * b[5] + a[8] * b[6] + a[12] * b[7], + a[1] * b[4] + a[5] * b[5] + a[9] * b[6] + a[13] * b[7], + a[2] * b[4] + a[6] * b[5] + a[10] * b[6] + a[14] * b[7], + a[3] * b[4] + a[7] * b[5] + a[11] * b[6] + a[15] * b[7], + a[0] * b[8] + a[4] * b[9] + a[8] * b[10] + a[12] * b[11], + a[1] * b[8] + a[5] * b[9] + a[9] * b[10] + a[13] * b[11], + a[2] * b[8] + a[6] * b[9] + a[10] * b[10] + a[14] * b[11], + a[3] * b[8] + a[7] * b[9] + a[11] * b[10] + a[15] * b[11], + a[0] * b[12] + a[4] * b[13] + a[8] * b[14] + a[12] * b[15], + a[1] * b[12] + a[5] * b[13] + a[9] * b[14] + a[13] * b[15], + a[2] * b[12] + a[6] * b[13] + a[10] * b[14] + a[14] * b[15], + a[3] * b[12] + a[7] * b[13] + a[11] * b[14] + a[15] * b[15] + ]; +}; + +/** + * Fast-multiply two or more Transform matrix types to return a + * Matrix, assuming bottom row on each is [0 0 0 1]. + * + * @method multiply + * @static + * @param {Transform} a left Transform + * @param {Transform} b right Transform + * @return {Transform} + */ +Transform.multiply = function multiply(a, b) { + return [ + a[0] * b[0] + a[4] * b[1] + a[8] * b[2], + a[1] * b[0] + a[5] * b[1] + a[9] * b[2], + a[2] * b[0] + a[6] * b[1] + a[10] * b[2], + 0, + a[0] * b[4] + a[4] * b[5] + a[8] * b[6], + a[1] * b[4] + a[5] * b[5] + a[9] * b[6], + a[2] * b[4] + a[6] * b[5] + a[10] * b[6], + 0, + a[0] * b[8] + a[4] * b[9] + a[8] * b[10], + a[1] * b[8] + a[5] * b[9] + a[9] * b[10], + a[2] * b[8] + a[6] * b[9] + a[10] * b[10], + 0, + a[0] * b[12] + a[4] * b[13] + a[8] * b[14] + a[12], + a[1] * b[12] + a[5] * b[13] + a[9] * b[14] + a[13], + a[2] * b[12] + a[6] * b[13] + a[10] * b[14] + a[14], + 1 + ]; +}; + +/** + * Return a Transform translated by additional amounts in each + * dimension. This is equivalent to the result of + * + * Transform.multiply(Matrix.translate(t[0], t[1], t[2]), m). + * + * @method thenMove + * @static + * @param {Transform} m a Transform + * @param {Array.Number} t floats delta vector of length 2 or 3 + * @return {Transform} + */ +Transform.thenMove = function thenMove(m, t) { + if (!t[2]) t[2] = 0; + return [m[0], m[1], m[2], 0, m[4], m[5], m[6], 0, m[8], m[9], m[10], 0, m[12] + t[0], m[13] + t[1], m[14] + t[2], 1]; +}; + +/** + * Return a Transform matrix which represents the result of a transform matrix + * applied after a move. This is faster than the equivalent multiply. + * This is equivalent to the result of: + * + * Transform.multiply(m, Transform.translate(t[0], t[1], t[2])). + * + * @method moveThen + * @static + * @param {Array.Number} v vector representing initial movement + * @param {Transform} m matrix to apply afterwards + * @return {Transform} the resulting matrix + */ +Transform.moveThen = function moveThen(v, m) { + if (!v[2]) v[2] = 0; + var t0 = v[0] * m[0] + v[1] * m[4] + v[2] * m[8]; + var t1 = v[0] * m[1] + v[1] * m[5] + v[2] * m[9]; + var t2 = v[0] * m[2] + v[1] * m[6] + v[2] * m[10]; + return Transform.thenMove(m, [t0, t1, t2]); +}; + +/** + * Return a Transform which represents a translation by specified + * amounts in each dimension. + * + * @method translate + * @static + * @param {Number} x x translation + * @param {Number} y y translation + * @param {Number} z z translation + * @return {Transform} + */ +Transform.translate = function translate(x, y, z) { + if (z === undefined) z = 0; + return [1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, x, y, z, 1]; +}; + +/** + * Return a Transform scaled by a vector in each + * dimension. This is a more performant equivalent to the result of + * + * Transform.multiply(Transform.scale(s[0], s[1], s[2]), m). + * + * @method thenScale + * @static + * @param {Transform} m a matrix + * @param {Array.Number} s delta vector (array of floats && + * array.length == 3) + * @return {Transform} + */ +Transform.thenScale = function thenScale(m, s) { + return [ + s[0] * m[0], s[1] * m[1], s[2] * m[2], 0, + s[0] * m[4], s[1] * m[5], s[2] * m[6], 0, + s[0] * m[8], s[1] * m[9], s[2] * m[10], 0, + s[0] * m[12], s[1] * m[13], s[2] * m[14], 1 + ]; +}; + +/** + * Return a Transform which represents a scale by specified amounts + * in each dimension. + * + * @method scale + * @static + * @param {Number} x x scale factor + * @param {Number} y y scale factor + * @param {Number} z z scale factor + * @return {Transform} + */ +Transform.scale = function scale(x, y, z) { + if (z === undefined) z = 1; + if (y === undefined) y = x; + return [x, 0, 0, 0, 0, y, 0, 0, 0, 0, z, 0, 0, 0, 0, 1]; +}; + +/** + * Return a Transform which represents a clockwise + * rotation around the x axis. + * + * @method rotateX + * @static + * @param {Number} theta radians + * @return {Transform} + */ +Transform.rotateX = function rotateX(theta) { + var cosTheta = Math.cos(theta); + var sinTheta = Math.sin(theta); + return [1, 0, 0, 0, 0, cosTheta, sinTheta, 0, 0, -sinTheta, cosTheta, 0, 0, 0, 0, 1]; +}; + +/** + * Return a Transform which represents a clockwise + * rotation around the y axis. + * + * @method rotateY + * @static + * @param {Number} theta radians + * @return {Transform} + */ +Transform.rotateY = function rotateY(theta) { + var cosTheta = Math.cos(theta); + var sinTheta = Math.sin(theta); + return [cosTheta, 0, -sinTheta, 0, 0, 1, 0, 0, sinTheta, 0, cosTheta, 0, 0, 0, 0, 1]; +}; + +/** + * Return a Transform which represents a clockwise + * rotation around the z axis. + * + * @method rotateZ + * @static + * @param {Number} theta radians + * @return {Transform} + */ +Transform.rotateZ = function rotateZ(theta) { + var cosTheta = Math.cos(theta); + var sinTheta = Math.sin(theta); + return [cosTheta, sinTheta, 0, 0, -sinTheta, cosTheta, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1]; +}; + +/** + * Return a Transform which represents composed clockwise + * rotations along each of the axes. Equivalent to the result of + * Matrix.multiply(rotateX(phi), rotateY(theta), rotateZ(psi)). + * + * @method rotate + * @static + * @param {Number} phi radians to rotate about the positive x axis + * @param {Number} theta radians to rotate about the positive y axis + * @param {Number} psi radians to rotate about the positive z axis + * @return {Transform} + */ +Transform.rotate = function rotate(phi, theta, psi) { + var cosPhi = Math.cos(phi); + var sinPhi = Math.sin(phi); + var cosTheta = Math.cos(theta); + var sinTheta = Math.sin(theta); + var cosPsi = Math.cos(psi); + var sinPsi = Math.sin(psi); + var result = [ + cosTheta * cosPsi, + cosPhi * sinPsi + sinPhi * sinTheta * cosPsi, + sinPhi * sinPsi - cosPhi * sinTheta * cosPsi, + 0, + -cosTheta * sinPsi, + cosPhi * cosPsi - sinPhi * sinTheta * sinPsi, + sinPhi * cosPsi + cosPhi * sinTheta * sinPsi, + 0, + sinTheta, + -sinPhi * cosTheta, + cosPhi * cosTheta, + 0, + 0, 0, 0, 1 + ]; + return result; +}; + +/** + * Return a Transform which represents an axis-angle rotation + * + * @method rotateAxis + * @static + * @param {Array.Number} v unit vector representing the axis to rotate about + * @param {Number} theta radians to rotate clockwise about the axis + * @return {Transform} + */ +Transform.rotateAxis = function rotateAxis(v, theta) { + var sinTheta = Math.sin(theta); + var cosTheta = Math.cos(theta); + var verTheta = 1 - cosTheta; // versine of theta + + var xxV = v[0] * v[0] * verTheta; + var xyV = v[0] * v[1] * verTheta; + var xzV = v[0] * v[2] * verTheta; + var yyV = v[1] * v[1] * verTheta; + var yzV = v[1] * v[2] * verTheta; + var zzV = v[2] * v[2] * verTheta; + var xs = v[0] * sinTheta; + var ys = v[1] * sinTheta; + var zs = v[2] * sinTheta; + + var result = [ + xxV + cosTheta, xyV + zs, xzV - ys, 0, + xyV - zs, yyV + cosTheta, yzV + xs, 0, + xzV + ys, yzV - xs, zzV + cosTheta, 0, + 0, 0, 0, 1 + ]; + return result; +}; + +/** + * Return a Transform which represents a transform matrix applied about + * a separate origin point. + * + * @method aboutOrigin + * @static + * @param {Array.Number} v origin point to apply matrix + * @param {Transform} m matrix to apply + * @return {Transform} + */ +Transform.aboutOrigin = function aboutOrigin(v, m) { + var t0 = v[0] - (v[0] * m[0] + v[1] * m[4] + v[2] * m[8]); + var t1 = v[1] - (v[0] * m[1] + v[1] * m[5] + v[2] * m[9]); + var t2 = v[2] - (v[0] * m[2] + v[1] * m[6] + v[2] * m[10]); + return Transform.thenMove(m, [t0, t1, t2]); +}; + +/** + * Return a Transform representation of a skew transformation + * + * @method skew + * @static + * @param {Number} phi scale factor skew in the x axis + * @param {Number} theta scale factor skew in the y axis + * @param {Number} psi scale factor skew in the z axis + * @return {Transform} + */ +Transform.skew = function skew(phi, theta, psi) { + return [1, Math.tan(theta), 0, 0, Math.tan(psi), 1, 0, 0, 0, Math.tan(phi), 1, 0, 0, 0, 0, 1]; +}; + +/** + * Return a Transform representation of a skew in the x-direction + * + * @method skewX + * @static + * @param {Number} angle the angle between the top and left sides + * @return {Transform} + */ +Transform.skewX = function skewX(angle) { + return [1, 0, 0, 0, Math.tan(angle), 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1]; +}; + +/** + * Return a Transform representation of a skew in the y-direction + * + * @method skewY + * @static + * @param {Number} angle the angle between the top and right sides + * @return {Transform} + */ +Transform.skewY = function skewY(angle) { + return [1, Math.tan(angle), 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1]; +}; + +/** + * Returns a perspective Transform matrix + * + * @method perspective + * @static + * @param {Number} focusZ z position of focal point + * @return {Transform} + */ +Transform.perspective = function perspective(focusZ) { + return [1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, -1 / focusZ, 0, 0, 0, 1]; +}; + +/** + * Return translation vector component of given Transform + * + * @method getTranslate + * @static + * @param {Transform} m Transform + * @return {Array.Number} the translation vector [t_x, t_y, t_z] + */ +Transform.getTranslate = function getTranslate(m) { + return [m[12], m[13], m[14]]; +}; + +/** + * Return inverse affine transform for given Transform. + * Note: This assumes m[3] = m[7] = m[11] = 0, and m[15] = 1. + * Will provide incorrect results if not invertible or preconditions not met. + * + * @method inverse + * @static + * @param {Transform} m Transform + * @return {Transform} + */ +Transform.inverse = function inverse(m) { + // only need to consider 3x3 section for affine + var c0 = m[5] * m[10] - m[6] * m[9]; + var c1 = m[4] * m[10] - m[6] * m[8]; + var c2 = m[4] * m[9] - m[5] * m[8]; + var c4 = m[1] * m[10] - m[2] * m[9]; + var c5 = m[0] * m[10] - m[2] * m[8]; + var c6 = m[0] * m[9] - m[1] * m[8]; + var c8 = m[1] * m[6] - m[2] * m[5]; + var c9 = m[0] * m[6] - m[2] * m[4]; + var c10 = m[0] * m[5] - m[1] * m[4]; + var detM = m[0] * c0 - m[1] * c1 + m[2] * c2; + var invD = 1 / detM; + var result = [ + invD * c0, -invD * c4, invD * c8, 0, + -invD * c1, invD * c5, -invD * c9, 0, + invD * c2, -invD * c6, invD * c10, 0, + 0, 0, 0, 1 + ]; + result[12] = -m[12] * result[0] - m[13] * result[4] - m[14] * result[8]; + result[13] = -m[12] * result[1] - m[13] * result[5] - m[14] * result[9]; + result[14] = -m[12] * result[2] - m[13] * result[6] - m[14] * result[10]; + return result; +}; + +/** + * Returns the transpose of a 4x4 matrix + * + * @method transpose + * @static + * @param {Transform} m matrix + * @return {Transform} the resulting transposed matrix + */ +Transform.transpose = function transpose(m) { + return [m[0], m[4], m[8], m[12], m[1], m[5], m[9], m[13], m[2], m[6], m[10], m[14], m[3], m[7], m[11], m[15]]; +}; + +function _normSquared(v) { + return (v.length === 2) ? v[0] * v[0] + v[1] * v[1] : v[0] * v[0] + v[1] * v[1] + v[2] * v[2]; +} +function _norm(v) { + return Math.sqrt(_normSquared(v)); +} +function _sign(n) { + return (n < 0) ? -1 : 1; +} + +/** + * Decompose Transform into separate .translate, .rotate, .scale, + * and .skew components. + * + * @method interpret + * @static + * @param {Transform} M transform matrix + * @return {Object} matrix spec object with component matrices .translate, + * .rotate, .scale, .skew + */ +Transform.interpret = function interpret(M) { + + // QR decomposition via Householder reflections + //FIRST ITERATION + + //default Q1 to the identity matrix; + var x = [M[0], M[1], M[2]]; // first column vector + var sgn = _sign(x[0]); // sign of first component of x (for stability) + var xNorm = _norm(x); // norm of first column vector + var v = [x[0] + sgn * xNorm, x[1], x[2]]; // v = x + sign(x[0])|x|e1 + var mult = 2 / _normSquared(v); // mult = 2/v'v + + //bail out if our Matrix is singular + if (mult >= Infinity) { + return {translate: Transform.getTranslate(M), rotate: [0, 0, 0], scale: [0, 0, 0], skew: [0, 0, 0]}; + } + + //evaluate Q1 = I - 2vv'/v'v + var Q1 = [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1]; + + //diagonals + Q1[0] = 1 - mult * v[0] * v[0]; // 0,0 entry + Q1[5] = 1 - mult * v[1] * v[1]; // 1,1 entry + Q1[10] = 1 - mult * v[2] * v[2]; // 2,2 entry + + //upper diagonal + Q1[1] = -mult * v[0] * v[1]; // 0,1 entry + Q1[2] = -mult * v[0] * v[2]; // 0,2 entry + Q1[6] = -mult * v[1] * v[2]; // 1,2 entry + + //lower diagonal + Q1[4] = Q1[1]; // 1,0 entry + Q1[8] = Q1[2]; // 2,0 entry + Q1[9] = Q1[6]; // 2,1 entry + + //reduce first column of M + var MQ1 = Transform.multiply(Q1, M); + + //SECOND ITERATION on (1,1) minor + var x2 = [MQ1[5], MQ1[6]]; + var sgn2 = _sign(x2[0]); // sign of first component of x (for stability) + var x2Norm = _norm(x2); // norm of first column vector + var v2 = [x2[0] + sgn2 * x2Norm, x2[1]]; // v = x + sign(x[0])|x|e1 + var mult2 = 2 / _normSquared(v2); // mult = 2/v'v + + //evaluate Q2 = I - 2vv'/v'v + var Q2 = [1, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 1]; + + //diagonal + Q2[5] = 1 - mult2 * v2[0] * v2[0]; // 1,1 entry + Q2[10] = 1 - mult2 * v2[1] * v2[1]; // 2,2 entry + + //off diagonals + Q2[6] = -mult2 * v2[0] * v2[1]; // 2,1 entry + Q2[9] = Q2[6]; // 1,2 entry + + //calc QR decomposition. Q = Q1*Q2, R = Q'*M + var Q = Transform.multiply(Q2, Q1); //note: really Q transpose + var R = Transform.multiply(Q, M); + + //remove negative scaling + var remover = Transform.scale(R[0] < 0 ? -1 : 1, R[5] < 0 ? -1 : 1, R[10] < 0 ? -1 : 1); + R = Transform.multiply(R, remover); + Q = Transform.multiply(remover, Q); + + //decompose into rotate/scale/skew matrices + var result = {}; + result.translate = Transform.getTranslate(M); + result.rotate = [Math.atan2(-Q[6], Q[10]), Math.asin(Q[2]), Math.atan2(-Q[1], Q[0])]; + if (!result.rotate[0]) { + result.rotate[0] = 0; + result.rotate[2] = Math.atan2(Q[4], Q[5]); + } + result.scale = [R[0], R[5], R[10]]; + result.skew = [Math.atan2(R[9], result.scale[2]), Math.atan2(R[8], result.scale[2]), Math.atan2(R[4], result.scale[0])]; + + //double rotation workaround + if (Math.abs(result.rotate[0]) + Math.abs(result.rotate[2]) > 1.5 * Math.PI) { + result.rotate[1] = Math.PI - result.rotate[1]; + if (result.rotate[1] > Math.PI) result.rotate[1] -= 2 * Math.PI; + if (result.rotate[1] < -Math.PI) result.rotate[1] += 2 * Math.PI; + if (result.rotate[0] < 0) result.rotate[0] += Math.PI; + else result.rotate[0] -= Math.PI; + if (result.rotate[2] < 0) result.rotate[2] += Math.PI; + else result.rotate[2] -= Math.PI; + } + + return result; +}; + +/** + * Weighted average between two matrices by averaging their + * translation, rotation, scale, skew components. + * f(M1,M2,t) = (1 - t) * M1 + t * M2 + * + * @method average + * @static + * @param {Transform} M1 f(M1,M2,0) = M1 + * @param {Transform} M2 f(M1,M2,1) = M2 + * @param {Number} t + * @return {Transform} + */ +Transform.average = function average(M1, M2, t) { + t = (t === undefined) ? 0.5 : t; + var specM1 = Transform.interpret(M1); + var specM2 = Transform.interpret(M2); + + var specAvg = { + translate: [0, 0, 0], + rotate: [0, 0, 0], + scale: [0, 0, 0], + skew: [0, 0, 0] + }; + + for (var i = 0; i < 3; i++) { + specAvg.translate[i] = (1 - t) * specM1.translate[i] + t * specM2.translate[i]; + specAvg.rotate[i] = (1 - t) * specM1.rotate[i] + t * specM2.rotate[i]; + specAvg.scale[i] = (1 - t) * specM1.scale[i] + t * specM2.scale[i]; + specAvg.skew[i] = (1 - t) * specM1.skew[i] + t * specM2.skew[i]; + } + return Transform.build(specAvg); +}; + +/** + * Compose .translate, .rotate, .scale, .skew components into + * Transform matrix + * + * @method build + * @static + * @param {matrixSpec} spec object with component matrices .translate, + * .rotate, .scale, .skew + * @return {Transform} composed transform + */ +Transform.build = function build(spec) { + var scaleMatrix = Transform.scale(spec.scale[0], spec.scale[1], spec.scale[2]); + var skewMatrix = Transform.skew(spec.skew[0], spec.skew[1], spec.skew[2]); + var rotateMatrix = Transform.rotate(spec.rotate[0], spec.rotate[1], spec.rotate[2]); + return Transform.thenMove(Transform.multiply(Transform.multiply(rotateMatrix, skewMatrix), scaleMatrix), spec.translate); +}; + +/** + * Determine if two Transforms are component-wise equal + * Warning: breaks on perspective Transforms + * + * @method equals + * @static + * @param {Transform} a matrix + * @param {Transform} b matrix + * @return {boolean} + */ +Transform.equals = function equals(a, b) { + return !Transform.notEquals(a, b); +}; + +/** + * Determine if two Transforms are component-wise unequal + * Warning: breaks on perspective Transforms + * + * @method notEquals + * @static + * @param {Transform} a matrix + * @param {Transform} b matrix + * @return {boolean} + */ +Transform.notEquals = function notEquals(a, b) { + if (a === b) return false; + + // shortci + return !(a && b) || + a[12] !== b[12] || a[13] !== b[13] || a[14] !== b[14] || + a[0] !== b[0] || a[1] !== b[1] || a[2] !== b[2] || + a[4] !== b[4] || a[5] !== b[5] || a[6] !== b[6] || + a[8] !== b[8] || a[9] !== b[9] || a[10] !== b[10]; +}; + +/** + * Constrain angle-trio components to range of [-pi, pi). + * + * @method normalizeRotation + * @static + * @param {Array.Number} rotation phi, theta, psi (array of floats + * && array.length == 3) + * @return {Array.Number} new phi, theta, psi triplet + * (array of floats && array.length == 3) + */ +Transform.normalizeRotation = function normalizeRotation(rotation) { + var result = rotation.slice(0); + if (result[0] === Math.PI * 0.5 || result[0] === -Math.PI * 0.5) { + result[0] = -result[0]; + result[1] = Math.PI - result[1]; + result[2] -= Math.PI; + } + if (result[0] > Math.PI * 0.5) { + result[0] = result[0] - Math.PI; + result[1] = Math.PI - result[1]; + result[2] -= Math.PI; + } + if (result[0] < -Math.PI * 0.5) { + result[0] = result[0] + Math.PI; + result[1] = -Math.PI - result[1]; + result[2] -= Math.PI; + } + while (result[1] < -Math.PI) result[1] += 2 * Math.PI; + while (result[1] >= Math.PI) result[1] -= 2 * Math.PI; + while (result[2] < -Math.PI) result[2] += 2 * Math.PI; + while (result[2] >= Math.PI) result[2] -= 2 * Math.PI; + return result; +}; + +/** + * (Property) Array defining a translation forward in z by 1 + * + * @property {array} inFront + * @static + * @final + */ +Transform.inFront = [1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, 1e-3, 1]; + +/** + * (Property) Array defining a translation backwards in z by 1 + * + * @property {array} behind + * @static + * @final + */ +Transform.behind = [1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 0, 0, -1e-3, 1]; + +module.exports = Transform; +},{}],16:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var EventHandler = _dereq_('./EventHandler'); +var OptionsManager = _dereq_('./OptionsManager'); +var RenderNode = _dereq_('./RenderNode'); +var Utility = _dereq_('../utilities/Utility'); + +/** + * Useful for quickly creating elements within applications + * with large event systems. Consists of a RenderNode paired with + * an input EventHandler and an output EventHandler. + * Meant to be extended by the developer. + * + * @class View + * @uses EventHandler + * @uses OptionsManager + * @uses RenderNode + * @constructor + */ +function View(options) { + this._node = new RenderNode(); + + this._eventInput = new EventHandler(); + this._eventOutput = new EventHandler(); + EventHandler.setInputHandler(this, this._eventInput); + EventHandler.setOutputHandler(this, this._eventOutput); + + this.options = Utility.clone(this.constructor.DEFAULT_OPTIONS || View.DEFAULT_OPTIONS); + this._optionsManager = new OptionsManager(this.options); + + if (options) this.setOptions(options); +} + +View.DEFAULT_OPTIONS = {}; // no defaults + +/** + * Look up options value by key + * @method getOptions + * + * @param {string} key key + * @return {Object} associated object + */ +View.prototype.getOptions = function getOptions(key) { + return this._optionsManager.getOptions(key); +}; + +/* + * Set internal options. + * No defaults options are set in View. + * + * @method setOptions + * @param {Object} options + */ +View.prototype.setOptions = function setOptions(options) { + this._optionsManager.patch(options); +}; + +/** + * Add a child renderable to the view. + * Note: This is meant to be used by an inheriting class + * rather than from outside the prototype chain. + * + * @method add + * @return {RenderNode} + * @protected + */ +View.prototype.add = function add() { + return this._node.add.apply(this._node, arguments); +}; + +/** + * Alias for add + * @method _add + */ +View.prototype._add = View.prototype.add; + +/** + * Generate a render spec from the contents of this component. + * + * @private + * @method render + * @return {number} Render spec for this component + */ +View.prototype.render = function render() { + return this._node.render(); +}; + +/** + * Return size of contained element. + * + * @method getSize + * @return {Array.Number} [width, height] + */ +View.prototype.getSize = function getSize() { + if (this._node && this._node.getSize) { + return this._node.getSize.apply(this._node, arguments) || this.options.size; + } + else return this.options.size; +}; + +module.exports = View; +},{"../utilities/Utility":96,"./EventHandler":7,"./OptionsManager":10,"./RenderNode":11}],17:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + + + + +/** + * Helper object used to iterate through items sequentially. Used in + * views that deal with layout. A ViewSequence object conceptually points + * to a node in a linked list. + * + * @class ViewSequence + * + * @constructor + * @param {Object|Array} options Options object, or content array. + * @param {Number} [options.index] starting index. + * @param {Number} [options.array] Array of elements to populate the ViewSequence + * @param {Object} [options._] Optional backing store (internal + * @param {Boolean} [options.loop] Whether to wrap when accessing elements just past the end + * (or beginning) of the sequence. + */ +function ViewSequence(options) { + if (!options) options = []; + if (options instanceof Array) options = {array: options}; + + this._ = null; + this.index = options.index || 0; + + if (options.array) this._ = new (this.constructor.Backing)(options.array); + else if (options._) this._ = options._; + + if (this.index === this._.firstIndex) this._.firstNode = this; + if (this.index === this._.firstIndex + this._.array.length - 1) this._.lastNode = this; + + if (options.loop !== undefined) this._.loop = options.loop; + + if (options.trackSize !== undefined) this._.trackSize = options.trackSize; + + this._previousNode = null; + this._nextNode = null; +} + +// constructor for internal storage +ViewSequence.Backing = function Backing(array) { + this.array = array; + this.firstIndex = 0; + this.loop = false; + this.firstNode = null; + this.lastNode = null; + this.cumulativeSizes = [[0, 0]]; + this.sizeDirty = true; + this.trackSize = false; +}; + +// Get value "i" slots away from the first index. +ViewSequence.Backing.prototype.getValue = function getValue(i) { + var _i = i - this.firstIndex; + if (_i < 0 || _i >= this.array.length) return null; + return this.array[_i]; +}; + +// Set value "i" slots away from the first index. +ViewSequence.Backing.prototype.setValue = function setValue(i, value) { + this.array[i - this.firstIndex] = value; +}; + +// Get sequence size from backing up to index +// TODO: remove from viewSequence with proper abstraction +ViewSequence.Backing.prototype.getSize = function getSize(index) { + return this.cumulativeSizes[index]; +}; + +// Calculates cumulative size +// TODO: remove from viewSequence with proper abstraction +ViewSequence.Backing.prototype.calculateSize = function calculateSize(index) { + index = index || this.array.length; + var size = [0, 0]; + for (var i = 0; i < index; i++) { + var nodeSize = this.array[i].getSize(); + if (!nodeSize) return undefined; + if (size[0] !== undefined) { + if (nodeSize[0] === undefined) size[0] = undefined; + else size[0] += nodeSize[0]; + } + if (size[1] !== undefined) { + if (nodeSize[1] === undefined) size[1] = undefined; + else size[1] += nodeSize[1]; + } + this.cumulativeSizes[i + 1] = size.slice(); + } + this.sizeDirty = false; + return size; +}; + +// After splicing into the backing store, restore the indexes of each node correctly. +ViewSequence.Backing.prototype.reindex = function reindex(start, removeCount, insertCount) { + if (!this.array[0]) return; + + var i = 0; + var index = this.firstIndex; + var indexShiftAmount = insertCount - removeCount; + var node = this.firstNode; + + // find node to begin + while (index < start - 1) { + node = node.getNext(); + index++; + } + // skip removed nodes + var spliceStartNode = node; + for (i = 0; i < removeCount; i++) { + node = node.getNext(); + if (node) node._previousNode = spliceStartNode; + } + var spliceResumeNode = node ? node.getNext() : null; + // generate nodes for inserted items + spliceStartNode._nextNode = null; + node = spliceStartNode; + for (i = 0; i < insertCount; i++) node = node.getNext(); + index += insertCount; + // resume the chain + if (node !== spliceResumeNode) { + node._nextNode = spliceResumeNode; + if (spliceResumeNode) spliceResumeNode._previousNode = node; + } + if (spliceResumeNode) { + node = spliceResumeNode; + index++; + while (node && index < this.array.length + this.firstIndex) { + if (node._nextNode) node.index += indexShiftAmount; + else node.index = index; + node = node.getNext(); + index++; + } + } + if (this.trackSize) this.sizeDirty = true; +}; + +/** + * Return ViewSequence node previous to this node in the list, respecting looping if applied. + * + * @method getPrevious + * @return {ViewSequence} previous node. + */ +ViewSequence.prototype.getPrevious = function getPrevious() { + var len = this._.array.length; + if (!len) { + this._previousNode = null; + } + else if (this.index === this._.firstIndex) { + if (this._.loop) { + this._previousNode = this._.lastNode || new (this.constructor)({_: this._, index: this._.firstIndex + len - 1}); + this._previousNode._nextNode = this; + } + else { + this._previousNode = null; + } + } + else if (!this._previousNode) { + this._previousNode = new (this.constructor)({_: this._, index: this.index - 1}); + this._previousNode._nextNode = this; + } + return this._previousNode; +}; + +/** + * Return ViewSequence node next after this node in the list, respecting looping if applied. + * + * @method getNext + * @return {ViewSequence} previous node. + */ +ViewSequence.prototype.getNext = function getNext() { + var len = this._.array.length; + if (!len) { + this._nextNode = null; + } + else if (this.index === this._.firstIndex + len - 1) { + if (this._.loop) { + this._nextNode = this._.firstNode || new (this.constructor)({_: this._, index: this._.firstIndex}); + this._nextNode._previousNode = this; + } + else { + this._nextNode = null; + } + } + else if (!this._nextNode) { + this._nextNode = new (this.constructor)({_: this._, index: this.index + 1}); + this._nextNode._previousNode = this; + } + return this._nextNode; +}; + +/** + * Return index of the provided item in the backing array + * + * @method indexOf + * @return {Number} index or -1 if not found + */ +ViewSequence.prototype.indexOf = function indexOf(item) { + return this._.array.indexOf(item); +}; + +/** + * Return index of this ViewSequence node. + * + * @method getIndex + * @return {Number} index + */ +ViewSequence.prototype.getIndex = function getIndex() { + return this.index; +}; + +/** + * Return printable version of this ViewSequence node. + * + * @method toString + * @return {string} this index as a string + */ +ViewSequence.prototype.toString = function toString() { + return '' + this.index; +}; + +/** + * Add one or more objects to the beginning of the sequence. + * + * @method unshift + * @param {...Object} value arguments array of objects + */ +ViewSequence.prototype.unshift = function unshift(value) { + this._.array.unshift.apply(this._.array, arguments); + this._.firstIndex -= arguments.length; + if (this._.trackSize) this._.sizeDirty = true; +}; + +/** + * Add one or more objects to the end of the sequence. + * + * @method push + * @param {...Object} value arguments array of objects + */ +ViewSequence.prototype.push = function push(value) { + this._.array.push.apply(this._.array, arguments); + if (this._.trackSize) this._.sizeDirty = true; +}; + +/** + * Remove objects from the sequence + * + * @method splice + * @param {Number} index starting index for removal + * @param {Number} howMany how many elements to remove + * @param {...Object} value arguments array of objects + */ +ViewSequence.prototype.splice = function splice(index, howMany) { + var values = Array.prototype.slice.call(arguments, 2); + this._.array.splice.apply(this._.array, [index - this._.firstIndex, howMany].concat(values)); + this._.reindex(index, howMany, values.length); +}; + +/** + * Exchange this element's sequence position with another's. + * + * @method swap + * @param {ViewSequence} other element to swap with. + */ +ViewSequence.prototype.swap = function swap(other) { + var otherValue = other.get(); + var myValue = this.get(); + this._.setValue(this.index, otherValue); + this._.setValue(other.index, myValue); + + var myPrevious = this._previousNode; + var myNext = this._nextNode; + var myIndex = this.index; + var otherPrevious = other._previousNode; + var otherNext = other._nextNode; + var otherIndex = other.index; + + this.index = otherIndex; + this._previousNode = (otherPrevious === this) ? other : otherPrevious; + if (this._previousNode) this._previousNode._nextNode = this; + this._nextNode = (otherNext === this) ? other : otherNext; + if (this._nextNode) this._nextNode._previousNode = this; + + other.index = myIndex; + other._previousNode = (myPrevious === other) ? this : myPrevious; + if (other._previousNode) other._previousNode._nextNode = other; + other._nextNode = (myNext === other) ? this : myNext; + if (other._nextNode) other._nextNode._previousNode = other; + + if (this.index === this._.firstIndex) this._.firstNode = this; + else if (this.index === this._.firstIndex + this._.array.length - 1) this._.lastNode = this; + if (other.index === this._.firstIndex) this._.firstNode = other; + else if (other.index === this._.firstIndex + this._.array.length - 1) this._.lastNode = other; + if (this._.trackSize) this._.sizeDirty = true; +}; + + /** + * Return value of this ViewSequence node. + * + * @method get + * @return {Object} value of thiss + */ +ViewSequence.prototype.get = function get() { + return this._.getValue(this.index); +}; + + /** + * Call getSize() on the contained View. + * + * @method getSize + * @return {Array.Number} [width, height] + */ +ViewSequence.prototype.getSize = function getSize() { + var target = this.get(); + return target ? target.getSize() : null; +}; + +/** + * Generate a render spec from the contents of this component. + * Specifically, this will render the value at the current index. + * @private + * @method render + * @return {number} Render spec for this component + */ +ViewSequence.prototype.render = function render() { + if (this._.trackSize && this._.sizeDirty) this._.calculateSize(); + var target = this.get(); + return target ? target.render.apply(target, arguments) : null; +}; + +module.exports = ViewSequence; +},{}],18:[function(_dereq_,module,exports){ +module.exports = { + Context: _dereq_('./Context'), + ElementAllocator: _dereq_('./ElementAllocator'), + ElementOutput: _dereq_('./ElementOutput'), + Engine: _dereq_('./Engine'), + Entity: _dereq_('./Entity'), + EventEmitter: _dereq_('./EventEmitter'), + EventHandler: _dereq_('./EventHandler'), + Group: _dereq_('./Group'), + Modifier: _dereq_('./Modifier'), + OptionsManager: _dereq_('./OptionsManager'), + RenderNode: _dereq_('./RenderNode'), + Scene: _dereq_('./Scene'), + SpecParser: _dereq_('./SpecParser'), + Surface: _dereq_('./Surface'), + Transform: _dereq_('./Transform'), + View: _dereq_('./View'), + ViewSequence: _dereq_('./ViewSequence') +}; + +},{"./Context":1,"./ElementAllocator":2,"./ElementOutput":3,"./Engine":4,"./Entity":5,"./EventEmitter":6,"./EventHandler":7,"./Group":8,"./Modifier":9,"./OptionsManager":10,"./RenderNode":11,"./Scene":12,"./SpecParser":13,"./Surface":14,"./Transform":15,"./View":16,"./ViewSequence":17}],19:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var EventHandler = _dereq_('../core/EventHandler'); + +/** + * A switch which wraps several event destinations and + * redirects received events to at most one of them. + * Setting the 'mode' of the object dictates which one + * of these destinations will receive events. + * + * @class EventArbiter + * @constructor + * + * @param {Number | string} startMode initial setting of switch, + */ +function EventArbiter(startMode) { + this.dispatchers = {}; + this.currMode = undefined; + this.setMode(startMode); +} + +/** + * Set switch to this mode, passing events to the corresponding + * EventHandler. If mode has changed, emits 'change' event, + * emits 'unpipe' event to the old mode's handler, and emits 'pipe' + * event to the new mode's handler. + * + * @method setMode + * + * @param {string | number} mode indicating which event handler to send to. + */ +EventArbiter.prototype.setMode = function setMode(mode) { + if (mode !== this.currMode) { + var startMode = this.currMode; + + if (this.dispatchers[this.currMode]) this.dispatchers[this.currMode].trigger('unpipe'); + this.currMode = mode; + if (this.dispatchers[mode]) this.dispatchers[mode].emit('pipe'); + this.emit('change', {from: startMode, to: mode}); + } +}; + +/** + * Return the existing EventHandler corresponding to this + * mode, creating one if it doesn't exist. + * + * @method forMode + * + * @param {string | number} mode mode to which this eventHandler corresponds + * + * @return {EventHandler} eventHandler corresponding to this mode + */ +EventArbiter.prototype.forMode = function forMode(mode) { + if (!this.dispatchers[mode]) this.dispatchers[mode] = new EventHandler(); + return this.dispatchers[mode]; +}; + +/** + * Trigger an event, sending to currently selected handler, if + * it is listening for provided 'type' key. + * + * @method emit + * + * @param {string} eventType event type key (for example, 'click') + * @param {Object} event event data + * @return {EventHandler} this + */ +EventArbiter.prototype.emit = function emit(eventType, event) { + if (this.currMode === undefined) return false; + if (!event) event = {}; + var dispatcher = this.dispatchers[this.currMode]; + if (dispatcher) return dispatcher.trigger(eventType, event); +}; + +module.exports = EventArbiter; +},{"../core/EventHandler":7}],20:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var EventHandler = _dereq_('../core/EventHandler'); + +/** + * EventFilter regulates the broadcasting of events based on + * a specified condition function of standard event type: function(type, data). + * + * @class EventFilter + * @constructor + * + * @param {function} condition function to determine whether or not + * events are emitted. + */ +function EventFilter(condition) { + EventHandler.call(this); + this._condition = condition; +} +EventFilter.prototype = Object.create(EventHandler.prototype); +EventFilter.prototype.constructor = EventFilter; + +/** + * If filter condition is met, trigger an event, sending to all downstream handlers + * listening for provided 'type' key. + * + * @method emit + * + * @param {string} type event type key (for example, 'click') + * @param {Object} data event data + * @return {EventHandler} this + */ +EventFilter.prototype.emit = function emit(type, data) { + if (this._condition(type, data)) + return EventHandler.prototype.emit.apply(this, arguments); +}; + +/** + * An alias of emit. Trigger determines whether to send + * events based on the return value of it's condition function + * when passed the event type and associated data. + * + * @method trigger + * @param {string} type name of the event + * @param {object} data associated data + */ +EventFilter.prototype.trigger = EventFilter.prototype.emit; + +module.exports = EventFilter; +},{"../core/EventHandler":7}],21:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var EventHandler = _dereq_('../core/EventHandler'); + +/** + * EventMapper routes events to various event destinations + * based on custom logic. The function signature is arbitrary. + * + * @class EventMapper + * @constructor + * + * @param {function} mappingFunction function to determine where + * events are routed to. + */ +function EventMapper(mappingFunction) { + EventHandler.call(this); + this._mappingFunction = mappingFunction; +} +EventMapper.prototype = Object.create(EventHandler.prototype); +EventMapper.prototype.constructor = EventMapper; + +EventMapper.prototype.subscribe = null; +EventMapper.prototype.unsubscribe = null; + +/** + * Trigger an event, sending to all mapped downstream handlers + * listening for provided 'type' key. + * + * @method emit + * + * @param {string} type event type key (for example, 'click') + * @param {Object} data event data + * @return {EventHandler} this + */ +EventMapper.prototype.emit = function emit(type, data) { + var target = this._mappingFunction.apply(this, arguments); + if (target && (target.emit instanceof Function)) target.emit(type, data); +}; + +/** + * Alias of emit. + * @method trigger + */ +EventMapper.prototype.trigger = EventMapper.prototype.emit; + +module.exports = EventMapper; +},{"../core/EventHandler":7}],22:[function(_dereq_,module,exports){ +module.exports = { + EventArbiter: _dereq_('./EventArbiter'), + EventFilter: _dereq_('./EventFilter'), + EventMapper: _dereq_('./EventMapper') +}; + +},{"./EventArbiter":19,"./EventFilter":20,"./EventMapper":21}],23:[function(_dereq_,module,exports){ +module.exports = { + core: _dereq_('./core'), + events: _dereq_('./events'), + inputs: _dereq_('./inputs'), + math: _dereq_('./math'), + modifiers: _dereq_('./modifiers'), + physics: _dereq_('./physics'), + surfaces: _dereq_('./surfaces'), + transitions: _dereq_('./transitions'), + utilities: _dereq_('./utilities'), + views: _dereq_('./views'), + widgets: _dereq_('./widgets') +}; + +},{"./core":18,"./events":22,"./inputs":37,"./math":43,"./modifiers":48,"./physics":72,"./surfaces":83,"./transitions":93,"./utilities":97,"./views":112,"./widgets":117}],24:[function(_dereq_,module,exports){ +var EventHandler = _dereq_('../core/EventHandler'); +var Transitionable = _dereq_('../transitions/Transitionable'); + +/** + * Accumulates differentials of event sources that emit a `delta` + * attribute taking a Number or Array of Number types. The accumulated + * value is stored in a getter/setter. + * + * @class Accumulator + * @constructor + * @param value {Number|Array|Transitionable} Initializing value + * @param [eventName='update'] {String} Name of update event + */ +function Accumulator(value, eventName) { + if (eventName === undefined) eventName = 'update'; + + this._state = (value && value.get && value.set) + ? value + : new Transitionable(value || 0); + + this._eventInput = new EventHandler(); + EventHandler.setInputHandler(this, this._eventInput); + + this._eventInput.on(eventName, _handleUpdate.bind(this)); +} + +function _handleUpdate(data) { + var delta = data.delta; + var state = this.get(); + + if (delta.constructor === state.constructor){ + var newState = (delta instanceof Array) + ? [state[0] + delta[0], state[1] + delta[1]] + : state + delta; + this.set(newState); + } +} + +/** + * Basic getter + * + * @method get + * @return {Number|Array} current value + */ +Accumulator.prototype.get = function get() { + return this._state.get(); +}; + +/** + * Basic setter + * + * @method set + * @param value {Number|Array} new value + */ +Accumulator.prototype.set = function set(value) { + this._state.set(value); +}; + +module.exports = Accumulator; +},{"../core/EventHandler":7,"../transitions/Transitionable":89}],25:[function(_dereq_,module,exports){ +var hasTouch = 'ontouchstart' in window; + +function kill(type) { + window.addEventListener(type, function(event) { + event.stopPropagation(); + return false; + }, true); +} + +if (hasTouch) { + kill('mousedown'); + kill('mousemove'); + kill('mouseup'); + kill('mouseleave'); +} +},{}],26:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + + + +/** + * FastClick is an override shim which maps event pairs of + * 'touchstart' and 'touchend' which differ by less than a certain + * threshold to the 'click' event. + * This is used to speed up clicks on some browsers. + */ +(function() { + if (!window.CustomEvent) return; + var clickThreshold = 300; + var clickWindow = 500; + var potentialClicks = {}; + var recentlyDispatched = {}; + var _now = Date.now; + + window.addEventListener('touchstart', function(event) { + var timestamp = _now(); + for (var i = 0; i < event.changedTouches.length; i++) { + var touch = event.changedTouches[i]; + potentialClicks[touch.identifier] = timestamp; + } + }); + + window.addEventListener('touchmove', function(event) { + for (var i = 0; i < event.changedTouches.length; i++) { + var touch = event.changedTouches[i]; + delete potentialClicks[touch.identifier]; + } + }); + + window.addEventListener('touchend', function(event) { + var currTime = _now(); + for (var i = 0; i < event.changedTouches.length; i++) { + var touch = event.changedTouches[i]; + var startTime = potentialClicks[touch.identifier]; + if (startTime && currTime - startTime < clickThreshold) { + var clickEvt = new window.CustomEvent('click', { + 'bubbles': true, + 'detail': touch + }); + recentlyDispatched[currTime] = event; + event.target.dispatchEvent(clickEvt); + } + delete potentialClicks[touch.identifier]; + } + }); + + window.addEventListener('click', function(event) { + var currTime = _now(); + for (var i in recentlyDispatched) { + var previousEvent = recentlyDispatched[i]; + if (currTime - i < clickWindow) { + if (event instanceof window.MouseEvent && event.target === previousEvent.target) event.stopPropagation(); + } + else delete recentlyDispatched[i]; + } + }, true); +})(); +},{}],27:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ +var EventHandler = _dereq_('../core/EventHandler'); + +/** + * Combines multiple types of sync classes (e.g. mouse, touch, + * scrolling) into one standardized interface for inclusion in widgets. + * + * Sync classes are first registered with a key, and then can be accessed + * globally by key. + * + * Emits 'start', 'update' and 'end' events as a union of the sync class + * providers. + * + * @class GenericSync + * @constructor + * @param syncs {Object|Array} object with fields {sync key : sync options} + * or an array of registered sync keys + * @param [options] {Object|Array} options object to set on all syncs + */ +function GenericSync(syncs, options) { + this._eventInput = new EventHandler(); + this._eventOutput = new EventHandler(); + + EventHandler.setInputHandler(this, this._eventInput); + EventHandler.setOutputHandler(this, this._eventOutput); + + this._syncs = {}; + if (syncs) this.addSync(syncs); + if (options) this.setOptions(options); +} + +GenericSync.DIRECTION_X = 0; +GenericSync.DIRECTION_Y = 1; +GenericSync.DIRECTION_Z = 2; + +// Global registry of sync classes. Append only. +var registry = {}; + +/** + * Register a global sync class with an identifying key + * + * @static + * @method register + * + * @param syncObject {Object} an object of {sync key : sync options} fields + */ +GenericSync.register = function register(syncObject) { + for (var key in syncObject){ + if (registry[key]){ // skip redundant registration + if (registry[key] !== syncObject[key]) // only if same registered class + throw new Error('Conflicting sync classes for key: ' + key); + } + else registry[key] = syncObject[key]; + } +}; + +/** + * Helper to set options on all sync instances + * + * @method setOptions + * @param options {Object} options object + */ +GenericSync.prototype.setOptions = function(options) { + for (var key in this._syncs){ + this._syncs[key].setOptions(options); + } +}; + +/** + * Pipe events to a sync class + * + * @method pipeSync + * @param key {String} identifier for sync class + */ +GenericSync.prototype.pipeSync = function pipeToSync(key) { + var sync = this._syncs[key]; + this._eventInput.pipe(sync); + sync.pipe(this._eventOutput); +}; + +/** + * Unpipe events from a sync class + * + * @method unpipeSync + * @param key {String} identifier for sync class + */ +GenericSync.prototype.unpipeSync = function unpipeFromSync(key) { + var sync = this._syncs[key]; + this._eventInput.unpipe(sync); + sync.unpipe(this._eventOutput); +}; + +function _addSingleSync(key, options) { + if (!registry[key]) return; + this._syncs[key] = new (registry[key])(options); + this.pipeSync(key); +} + +/** + * Add a sync class to from the registered classes + * + * @method addSync + * @param syncs {Object|Array.String} an array of registered sync keys + * or an object with fields {sync key : sync options} + */ +GenericSync.prototype.addSync = function addSync(syncs) { + if (syncs instanceof Array) + for (var i = 0; i < syncs.length; i++) + _addSingleSync.call(this, syncs[i]); + else if (syncs instanceof Object) + for (var key in syncs) + _addSingleSync.call(this, key, syncs[key]); +}; + +module.exports = GenericSync; +},{"../core/EventHandler":7}],28:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ +var EventHandler = _dereq_('../core/EventHandler'); +var OptionsManager = _dereq_('../core/OptionsManager'); +var SyncUtils = _dereq_('./SyncUtils'); + +/** + * Handles piped in mouse drag events. Outputs an object with the position delta from last frame, position from start, + * current velocity averaged out over the velocitySampleLength (set via options), clientX, clientY, offsetX, and offsetY. + * + * Emits 'start', 'update' and 'end' events. Designed to be used either as a standalone MouseSync, or as part of a + * GenericSync. + * + * @class MouseSync + * @constructor + * + * @example + * var Surface = require('../core/Surface'); + * var MouseSync = require('../inputs/MouseSync'); + * + * var surface = new Surface({ size: [100, 100] }); + * var mouseSync = new MouseSync(); + * surface.pipe(mouseSync); + * + * mouseSync.on('start', function (e) { // react to start }); + * mouseSync.on('update', function (e) { // react to update }); + * mouseSync.on('end', function (e) { // react to end }); + * + * @param [options] {Object} An object of the following configurable options. + * @param [options.clickThreshold] {Number} Absolute distance from click origin that will still trigger a click. + * @param [options.direction] {Number} Read from a particular axis. Valid options are: undefined, 0 or 1. 0 corresponds to x, and 1 to y. Default is undefined, which allows both x and y. + * @param [options.rails] {Boolean} Read from axis with the greatest differential. + * @param [options.velocitySampleLength] {Number} Number of previous frames to check velocity against. + * @param [options.propogate] {Boolean} Add a listener to document on mouseleave. This allows drag events to continue across the entire page. + */ +function MouseSync(options) { + this.options = Object.create(MouseSync.DEFAULT_OPTIONS); + this._optionsManager = new OptionsManager(this.options); + + if (options) this.setOptions(options); + + this._eventInput = new EventHandler(); + this._eventOutput = new EventHandler(); + + EventHandler.setInputHandler(this, this._eventInput); + EventHandler.setOutputHandler(this, this._eventOutput); + + this._eventInput.on('mousedown', _handleStart.bind(this)); + this._eventInput.on('mousemove', _handleMove.bind(this)); + this._eventInput.on('mouseup', _handleEnd.bind(this)); + + if (this.options.propogate) this._eventInput.on('mouseleave', _handleLeave.bind(this)); + else this._eventInput.on('mouseleave', _handleEnd.bind(this)); + + if (this.options.clickThreshold) { + window.addEventListener('click', function(event) { + if (Math.sqrt(Math.pow(this._displacement[0], 2) + Math.pow(this._displacement[1], 2)) > this.options.clickThreshold) { + event.stopPropagation(); + } + }.bind(this), true); + } + + this._payload = { + delta : null, + position : null, + velocity : null, + clientX : 0, + clientY : 0, + offsetX : 0, + offsetY : 0 + }; + + this._positionHistory = []; + this._position = null; // to be deprecated + this._down = false; + this._moved = false; + this._displacement = [0,0]; + this._documentActive = false; +} + +MouseSync.DEFAULT_OPTIONS = { + clickThreshold: undefined, + direction: undefined, + rails: false, + scale: 1, + propogate: true, // events piped to document on mouseleave + velocitySampleLength: 10, + timeSampleDuration: 400, + preventDefault: true +}; + +MouseSync.DIRECTION_X = 0; +MouseSync.DIRECTION_Y = 1; + +var MINIMUM_TICK_TIME = 8; + +/** + * Triggered by mousedown. + * + * @method _handleStart + * @private + */ +function _handleStart(event) { + var delta; + var velocity; + if (this.options.preventDefault) event.preventDefault(); // prevent drag + + var x = event.clientX; + var y = event.clientY; + var currTime = Date.now(); + + this._down = true; + this._move = false; + + if (this.options.direction !== undefined) { + this._position = 0; + delta = 0; + velocity = 0; + } + else { + this._position = [0, 0]; + delta = [0, 0]; + velocity = [0, 0]; + } + + if (this.options.clickThreshold) { + this._displacement = [0,0]; + } + + var payload = this._payload; + payload.delta = delta; + payload.position = this._position; + payload.velocity = velocity; + payload.clientX = x; + payload.clientY = y; + payload.offsetX = event.offsetX; + payload.offsetY = event.offsetY; + + this._positionHistory.push({ + position: payload.position.slice ? payload.position.slice(0) : payload.position, + clientPosition: [x, y], + timestamp: currTime + }); + this._eventOutput.emit('start', payload); + this._documentActive = false; +} + +/** + * Triggered by mousemove. + * + * @method _handleMove + * @private + */ +function _handleMove(event) { + if (this._positionHistory.length === 0) return; + var payload = calculatePayload.call(this, event); + this._eventOutput.emit('update', payload); + this._move = true; +} + +/** + * Triggered by mouseup on the element or document body if propagation is enabled, or + * mouseleave if propagation is off. + * + * @method _handleEnd + * @private + */ +function _handleEnd(event) { + if (!this._down) return; + var payload = calculatePayload.call(this, event); + this._eventOutput.emit('end', payload); + this._down = false; + this._move = false; + this._positionHistory = []; +} + +/** + * Switches the mousemove listener to the document body, if propagation is enabled. + * @method _handleLeave + * @private + */ +function _handleLeave(event) { + if (!this._down || !this._move) return; + + if (!this._documentActive) { + var boundMove = _handleMove.bind(this); + var boundEnd = function(event) { + _handleEnd.call(this, event); + document.removeEventListener('mousemove', boundMove); + document.removeEventListener('mouseup', boundEnd); + }.bind(this); + document.addEventListener('mousemove', boundMove); + document.addEventListener('mouseup', boundEnd); + this._documentActive = true; + } +} + +/** + * Calculates the data to send to listeners. + * @method calculatePayload + * @private + */ +function calculatePayload (event) { + var payload = this._payload; + + var scale = this.options.scale; + var nextVel; + var nextDelta; + + var x = event.clientX; + var y = event.clientY; + + var currTime = Date.now(); + + var lastPos = this._positionHistory[this._positionHistory.length - 1]; + var diffX = (x * scale) - lastPos.clientPosition[0]; + var diffY = (y * scale) - lastPos.clientPosition[1]; + + if (this.options.rails) { + if (Math.abs(diffX) > Math.abs(diffY)) diffY = 0; + else diffX = 0; + } + if (this.options.direction === MouseSync.DIRECTION_X) { + nextDelta = diffX; + this._position += nextDelta; + } + else if (this.options.direction === MouseSync.DIRECTION_Y) { + nextDelta = diffY; + this._position += nextDelta; + } + else { + nextDelta = [diffX, diffY]; + this._position[0] += diffX; + this._position[1] += diffY; + } + + if (this.options.clickThreshold !== false) { + this._displacement[0] += diffX; + this._displacement[1] += diffY; + } + + payload.delta = nextDelta; + payload.position = this._position; + payload.clientX = x; + payload.clientY = y; + payload.offsetX = event.offsetX; + payload.offsetY = event.offsetY; + + if (this._positionHistory.length === this.options.velocitySampleLength) { + this._positionHistory.shift(); + } + + this._positionHistory.push({ + position: payload.position.slice ? payload.position.slice(0) : payload.position, + clientPosition: [x, y], + timestamp: currTime + }); + + // Calculate velocity + var lastPositionHistory = SyncUtils.getTimeHistoryPosition(this._positionHistory, this.options.timeSampleDuration); + var diffTime = Math.max(currTime - lastPositionHistory.timestamp, MINIMUM_TICK_TIME); // minimum tick time + + if (this.options.direction !== undefined) { + nextVel = scale * (this._position - lastPositionHistory.position) / diffTime; + } + else { + nextVel = [ + scale * (this._position[0] - lastPositionHistory.position[0]) / diffTime, + scale * (this._position[1] - lastPositionHistory.position[1]) / diffTime + ]; + } + + payload.velocity = nextVel; + + return payload; +} + +/** + * Return entire options dictionary, including defaults. + * + * @method getOptions + * @return {Object} configuration options + */ +MouseSync.prototype.getOptions = function getOptions() { + return this.options; +}; + +/** + * Set internal options, overriding any default options + * + * @method setOptions + * + * @param [options] {Object} default options overrides + * @param [options.direction] {Number} read from a particular axis + * @param [options.rails] {Boolean} read from axis with greatest differential + * @param [options.propogate] {Boolean} add listened to document on mouseleave + */ +MouseSync.prototype.setOptions = function setOptions(options) { + return this._optionsManager.setOptions(options); +}; + +module.exports = MouseSync; +},{"../core/EventHandler":7,"../core/OptionsManager":10,"./SyncUtils":33}],29:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ +var TwoFingerSync = _dereq_('./TwoFingerSync'); +var OptionsManager = _dereq_('../core/OptionsManager'); + +/** + * Handles piped in two-finger touch events to change position via pinching / expanding. + * Emits 'start', 'update' and 'end' events with + * position, velocity, touch ids, and distance between fingers. + * + * @class PinchSync + * @extends TwoFingerSync + * @constructor + * @param {Object} options default options overrides + * @param {Number} [options.scale] scale velocity by this factor + */ +function PinchSync(options) { + TwoFingerSync.call(this); + + this.options = Object.create(PinchSync.DEFAULT_OPTIONS); + this._optionsManager = new OptionsManager(this.options); + if (options) this.setOptions(options); + + this._displacement = 0; + this._previousDistance = 0; +} + +PinchSync.prototype = Object.create(TwoFingerSync.prototype); +PinchSync.prototype.constructor = PinchSync; + +PinchSync.DEFAULT_OPTIONS = { + scale : 1 +}; + +PinchSync.prototype._startUpdate = function _startUpdate(event) { + this._previousDistance = TwoFingerSync.calculateDistance(this.posA, this.posB); + this._displacement = 0; + + this._eventOutput.emit('start', { + count: event.touches.length, + touches: [this.touchAId, this.touchBId], + distance: this._dist, + center: TwoFingerSync.calculateCenter(this.posA, this.posB) + }); +}; + +PinchSync.prototype._moveUpdate = function _moveUpdate(diffTime) { + var currDist = TwoFingerSync.calculateDistance(this.posA, this.posB); + var center = TwoFingerSync.calculateCenter(this.posA, this.posB); + + var scale = this.options.scale; + var delta = scale * (currDist - this._previousDistance); + var velocity = delta / diffTime; + + this._previousDistance = currDist; + this._displacement += delta; + + this._eventOutput.emit('update', { + delta : delta, + velocity: velocity, + distance: currDist, + displacement: this._displacement, + center: center, + touches: [this.touchAId, this.touchBId] + }); +}; + +/** + * Return entire options dictionary, including defaults. + * + * @method getOptions + * @return {Object} configuration options + */ +PinchSync.prototype.getOptions = function getOptions() { + return this.options; +}; + +/** + * Set internal options, overriding any default options + * + * @method setOptions + * + * @param {Object} [options] overrides of default options + * @param {Number} [options.scale] scale velocity by this factor + */ +PinchSync.prototype.setOptions = function setOptions(options) { + return this._optionsManager.setOptions(options); +}; + +module.exports = PinchSync; +},{"../core/OptionsManager":10,"./TwoFingerSync":36}],30:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ +var TwoFingerSync = _dereq_('./TwoFingerSync'); +var OptionsManager = _dereq_('../core/OptionsManager'); + +/** + * Handles piped in two-finger touch events to increase or decrease scale via pinching / expanding. + * Emits 'start', 'update' and 'end' events an object with position, velocity, touch ids, and angle. + * Useful for determining a rotation factor from initial two-finger touch. + * + * @class RotateSync + * @extends TwoFingerSync + * @constructor + * @param {Object} options default options overrides + * @param {Number} [options.scale] scale velocity by this factor + */ +function RotateSync(options) { + TwoFingerSync.call(this); + + this.options = Object.create(RotateSync.DEFAULT_OPTIONS); + this._optionsManager = new OptionsManager(this.options); + if (options) this.setOptions(options); + + this._angle = 0; + this._previousAngle = 0; +} + +RotateSync.prototype = Object.create(TwoFingerSync.prototype); +RotateSync.prototype.constructor = RotateSync; + +RotateSync.DEFAULT_OPTIONS = { + scale : 1 +}; + +RotateSync.prototype._startUpdate = function _startUpdate(event) { + this._angle = 0; + this._previousAngle = TwoFingerSync.calculateAngle(this.posA, this.posB); + var center = TwoFingerSync.calculateCenter(this.posA, this.posB); + this._eventOutput.emit('start', { + count: event.touches.length, + angle: this._angle, + center: center, + touches: [this.touchAId, this.touchBId] + }); +}; + +RotateSync.prototype._moveUpdate = function _moveUpdate(diffTime) { + var scale = this.options.scale; + + var currAngle = TwoFingerSync.calculateAngle(this.posA, this.posB); + var center = TwoFingerSync.calculateCenter(this.posA, this.posB); + + var diffTheta = scale * (currAngle - this._previousAngle); + var velTheta = diffTheta / diffTime; + + this._angle += diffTheta; + + this._eventOutput.emit('update', { + delta : diffTheta, + velocity: velTheta, + angle: this._angle, + center: center, + touches: [this.touchAId, this.touchBId] + }); + + this._previousAngle = currAngle; +}; + +/** + * Return entire options dictionary, including defaults. + * + * @method getOptions + * @return {Object} configuration options + */ +RotateSync.prototype.getOptions = function getOptions() { + return this.options; +}; + +/** + * Set internal options, overriding any default options + * + * @method setOptions + * + * @param {Object} [options] overrides of default options + * @param {Number} [options.scale] scale velocity by this factor + */ +RotateSync.prototype.setOptions = function setOptions(options) { + return this._optionsManager.setOptions(options); +}; + +module.exports = RotateSync; +},{"../core/OptionsManager":10,"./TwoFingerSync":36}],31:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ +var TwoFingerSync = _dereq_('./TwoFingerSync'); +var OptionsManager = _dereq_('../core/OptionsManager'); + +/** + * Handles piped in two-finger touch events to increase or decrease scale via pinching / expanding. + * Emits 'start', 'update' and 'end' events an object with position, velocity, touch ids, distance, and scale factor. + * Useful for determining a scaling factor from initial two-finger touch. + * + * @class ScaleSync + * @extends TwoFingerSync + * @constructor + * @param {Object} options default options overrides + * @param {Number} [options.scale] scale velocity by this factor + */ +function ScaleSync(options) { + TwoFingerSync.call(this); + + this.options = Object.create(ScaleSync.DEFAULT_OPTIONS); + this._optionsManager = new OptionsManager(this.options); + if (options) this.setOptions(options); + + this._scaleFactor = 1; + this._startDist = 0; + this._eventInput.on('pipe', _reset.bind(this)); +} + +ScaleSync.prototype = Object.create(TwoFingerSync.prototype); +ScaleSync.prototype.constructor = ScaleSync; + +ScaleSync.DEFAULT_OPTIONS = { + scale : 1 +}; + +function _reset() { + this.touchAId = undefined; + this.touchBId = undefined; +} + +// handles initial touch of two fingers +ScaleSync.prototype._startUpdate = function _startUpdate(event) { + this._scaleFactor = 1; + this._startDist = TwoFingerSync.calculateDistance(this.posA, this.posB); + this._eventOutput.emit('start', { + count: event.touches.length, + touches: [this.touchAId, this.touchBId], + distance: this._startDist, + center: TwoFingerSync.calculateCenter(this.posA, this.posB) + }); +}; + +// handles movement of two fingers +ScaleSync.prototype._moveUpdate = function _moveUpdate(diffTime) { + var scale = this.options.scale; + + var currDist = TwoFingerSync.calculateDistance(this.posA, this.posB); + var center = TwoFingerSync.calculateCenter(this.posA, this.posB); + + var delta = (currDist - this._startDist) / this._startDist; + var newScaleFactor = Math.max(1 + scale * delta, 0); + var veloScale = (newScaleFactor - this._scaleFactor) / diffTime; + + this._eventOutput.emit('update', { + delta : delta, + scale: newScaleFactor, + velocity: veloScale, + distance: currDist, + center : center, + touches: [this.touchAId, this.touchBId] + }); + + this._scaleFactor = newScaleFactor; +}; + +/** + * Return entire options dictionary, including defaults. + * + * @method getOptions + * @return {Object} configuration options + */ +ScaleSync.prototype.getOptions = function getOptions() { + return this.options; +}; + +/** + * Set internal options, overriding any default options + * + * @method setOptions + * + * @param {Object} [options] overrides of default options + * @param {Number} [options.scale] scale velocity by this factor + */ +ScaleSync.prototype.setOptions = function setOptions(options) { + return this._optionsManager.setOptions(options); +}; + +module.exports = ScaleSync; +},{"../core/OptionsManager":10,"./TwoFingerSync":36}],32:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ +var EventHandler = _dereq_('../core/EventHandler'); +var Engine = _dereq_('../core/Engine'); +var OptionsManager = _dereq_('../core/OptionsManager'); + +/** + * Handles piped in mousewheel events. + * Emits 'start', 'update', and 'end' events with payloads including: + * delta: change since last position, + * position: accumulated deltas, + * velocity: speed of change in pixels per ms, + * slip: true (unused). + * + * Can be used as delegate of GenericSync. + * + * @class ScrollSync + * @constructor + * @param {Object} [options] overrides of default options + * @param {Number} [options.direction] Pay attention to x changes (ScrollSync.DIRECTION_X), + * y changes (ScrollSync.DIRECTION_Y) or both (undefined) + * @param {Number} [options.minimumEndSpeed] End speed calculation floors at this number, in pixels per ms + * @param {boolean} [options.rails] whether to snap position calculations to nearest axis + * @param {Number | Array.Number} [options.scale] scale outputs in by scalar or pair of scalars + * @param {Number} [options.stallTime] reset time for velocity calculation in ms + */ +function ScrollSync(options) { + this.options = Object.create(ScrollSync.DEFAULT_OPTIONS); + this._optionsManager = new OptionsManager(this.options); + if (options) this.setOptions(options); + + this._payload = { + delta : null, + position : null, + velocity : null, + slip : true + }; + + this._eventInput = new EventHandler(); + this._eventOutput = new EventHandler(); + + EventHandler.setInputHandler(this, this._eventInput); + EventHandler.setOutputHandler(this, this._eventOutput); + + this._position = (this.options.direction === undefined) ? [0,0] : 0; + this._prevTime = undefined; + this._prevVel = undefined; + this._eventInput.on('mousewheel', _handleMove.bind(this)); + this._eventInput.on('wheel', _handleMove.bind(this)); + this._inProgress = false; + this._loopBound = false; +} + +ScrollSync.DEFAULT_OPTIONS = { + direction: undefined, + minimumEndSpeed: Infinity, + rails: false, + scale: 1, + stallTime: 50, + lineHeight: 40, + preventDefault: true +}; + +ScrollSync.DIRECTION_X = 0; +ScrollSync.DIRECTION_Y = 1; + +var MINIMUM_TICK_TIME = 8; + +var _now = Date.now; + +function _newFrame() { + if (this._inProgress && (_now() - this._prevTime) > this.options.stallTime) { + this._inProgress = false; + + var finalVel = (Math.abs(this._prevVel) >= this.options.minimumEndSpeed) + ? this._prevVel + : 0; + + var payload = this._payload; + payload.position = this._position; + payload.velocity = finalVel; + payload.slip = true; + + this._eventOutput.emit('end', payload); + } +} + +function _handleMove(event) { + if (this.options.preventDefault) event.preventDefault(); + + if (!this._inProgress) { + this._inProgress = true; + this._position = (this.options.direction === undefined) ? [0,0] : 0; + payload = this._payload; + payload.slip = true; + payload.position = this._position; + payload.clientX = event.clientX; + payload.clientY = event.clientY; + payload.offsetX = event.offsetX; + payload.offsetY = event.offsetY; + this._eventOutput.emit('start', payload); + if (!this._loopBound) { + Engine.on('prerender', _newFrame.bind(this)); + this._loopBound = true; + } + } + + var currTime = _now(); + var prevTime = this._prevTime || currTime; + + var diffX = (event.wheelDeltaX !== undefined) ? event.wheelDeltaX : -event.deltaX; + var diffY = (event.wheelDeltaY !== undefined) ? event.wheelDeltaY : -event.deltaY; + + if (event.deltaMode === 1) { // units in lines, not pixels + diffX *= this.options.lineHeight; + diffY *= this.options.lineHeight; + } + + if (this.options.rails) { + if (Math.abs(diffX) > Math.abs(diffY)) diffY = 0; + else diffX = 0; + } + + var diffTime = Math.max(currTime - prevTime, MINIMUM_TICK_TIME); // minimum tick time + + var velX = diffX / diffTime; + var velY = diffY / diffTime; + + var scale = this.options.scale; + var nextVel; + var nextDelta; + + if (this.options.direction === ScrollSync.DIRECTION_X) { + nextDelta = scale * diffX; + nextVel = scale * velX; + this._position += nextDelta; + } + else if (this.options.direction === ScrollSync.DIRECTION_Y) { + nextDelta = scale * diffY; + nextVel = scale * velY; + this._position += nextDelta; + } + else { + nextDelta = [scale * diffX, scale * diffY]; + nextVel = [scale * velX, scale * velY]; + this._position[0] += nextDelta[0]; + this._position[1] += nextDelta[1]; + } + + var payload = this._payload; + payload.delta = nextDelta; + payload.velocity = nextVel; + payload.position = this._position; + payload.slip = true; + + this._eventOutput.emit('update', payload); + + this._prevTime = currTime; + this._prevVel = nextVel; +} + +/** + * Return entire options dictionary, including defaults. + * + * @method getOptions + * @return {Object} configuration options + */ +ScrollSync.prototype.getOptions = function getOptions() { + return this.options; +}; + +/** + * Set internal options, overriding any default options + * + * @method setOptions + * + * @param {Object} [options] overrides of default options + * @param {Number} [options.minimimEndSpeed] If final velocity smaller than this, round down to 0. + * @param {Number} [options.stallTime] ms of non-motion before 'end' emitted + * @param {Number} [options.rails] whether to constrain to nearest axis. + * @param {Number} [options.direction] ScrollSync.DIRECTION_X, DIRECTION_Y - + * pay attention to one specific direction. + * @param {Number} [options.scale] constant factor to scale velocity output + */ +ScrollSync.prototype.setOptions = function setOptions(options) { + return this._optionsManager.setOptions(options); +}; + +module.exports = ScrollSync; +},{"../core/Engine":4,"../core/EventHandler":7,"../core/OptionsManager":10}],33:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + + +module.exports = { + getTimeHistoryPosition: function getTimeHistoryPosition(history, timeSampleDuration) { + var len = history.length - 1; + var index = len; + var searching = true; + var timeSearched = 0; + + var lastHist; + var hist; + var diffTime; + + while (searching) { + hist = history[index]; + if (index < 0) return lastHist; + + if (hist && lastHist) { + diffTime = lastHist.timestamp - hist.timestamp; + timeSearched += diffTime; + if (timeSearched >= timeSampleDuration) { + searching = false; + return hist; + } + } + + index--; + lastHist = hist; + } + } +}; +},{}],34:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ +var TouchTracker = _dereq_('./TouchTracker'); +var EventHandler = _dereq_('../core/EventHandler'); +var OptionsManager = _dereq_('../core/OptionsManager'); +var SyncUtils = _dereq_('./SyncUtils'); + +/** + * Handles piped in touch events. Emits 'start', 'update', and 'events' + * events with delta, position, velocity, acceleration, clientX, clientY, count, and touch id. + * Useful for dealing with inputs on touch devices. Designed to be used either as standalone, or + * included in a GenericSync. + * + * @class TouchSync + * @constructor + * + * @example + * var Surface = require('../core/Surface'); + * var TouchSync = require('../inputs/TouchSync'); + * + * var surface = new Surface({ size: [100, 100] }); + * var touchSync = new TouchSync(); + * surface.pipe(touchSync); + * + * touchSync.on('start', function (e) { // react to start }); + * touchSync.on('update', function (e) { // react to update }); + * touchSync.on('end', function (e) { // react to end });* + * + * @param [options] {Object} default options overrides + * @param [options.direction] {Number} read from a particular axis + * @param [options.rails] {Boolean} read from axis with greatest differential + * @param [options.velocitySampleLength] {Number} Number of previous frames to check velocity against. + * @param [options.scale] {Number} constant factor to scale velocity output + * @param [options.touchLimit] {Number} touchLimit upper bound for emitting events based on number of touches + */ +function TouchSync(options) { + this.options = Object.create(TouchSync.DEFAULT_OPTIONS); + this._optionsManager = new OptionsManager(this.options); + if (options) this.setOptions(options); + + this._eventOutput = new EventHandler(); + this._touchTracker = new TouchTracker({ + touchLimit: this.options.touchLimit + }); + + EventHandler.setOutputHandler(this, this._eventOutput); + EventHandler.setInputHandler(this, this._touchTracker); + + this._touchTracker.on('trackstart', _handleStart.bind(this)); + this._touchTracker.on('trackmove', _handleMove.bind(this)); + this._touchTracker.on('trackend', _handleEnd.bind(this)); + + this._payload = { + delta : null, + position : null, + velocity : null, + clientX : undefined, + clientY : undefined, + count : 0, + touch : undefined + }; + + this._position = null; // to be deprecated +} + +TouchSync.DEFAULT_OPTIONS = { + direction: undefined, + rails: false, + touchLimit: 1, + velocitySampleLength: 10, + scale: 1, + timeSampleDuration: 400 +}; + +TouchSync.DIRECTION_X = 0; +TouchSync.DIRECTION_Y = 1; + +var MINIMUM_TICK_TIME = 8; + +/** + * Triggered by trackstart. + * @method _handleStart + * @private + */ +function _handleStart(data) { + var velocity; + var delta; + if (this.options.direction !== undefined){ + this._position = 0; + velocity = 0; + delta = 0; + } + else { + this._position = [0, 0]; + velocity = [0, 0]; + delta = [0, 0]; + } + + var payload = this._payload; + payload.delta = delta; + payload.position = this._position; + payload.velocity = velocity; + payload.clientX = data.x; + payload.clientY = data.y; + payload.count = data.count; + payload.touch = data.identifier; + + this._eventOutput.emit('start', payload); +} + +/** + * Triggered by trackmove. + * @method _handleMove + * @private + */ +function _handleMove(data) { + calculatePayload.call(this, data); +} + +function calculatePayload (data) { + var history = data.history; + + var currHistory = history[history.length - 1]; + + var distantHistory = SyncUtils.getTimeHistoryPosition(history, this.options.timeSampleDuration); + + var distantTime = distantHistory.timestamp; + var currTime = currHistory.timestamp; + + var diffX = currHistory.x - distantTime.x; + var diffY = currHistory.y - distantTime.y; + + var velDiffX = currHistory.x - distantHistory.x; + var velDiffY = currHistory.y - distantHistory.y; + + if (this.options.rails) { + if (Math.abs(diffX) > Math.abs(diffY)) diffY = 0; + else diffX = 0; + + if (Math.abs(velDiffX) > Math.abs(velDiffY)) velDiffY = 0; + else velDiffX = 0; + } + + var diffTime = Math.max(currTime - distantTime, MINIMUM_TICK_TIME); + + var velX = velDiffX / diffTime; + var velY = velDiffY / diffTime; + + var scale = this.options.scale; + var nextVel; + var nextDelta; + + if (this.options.direction === TouchSync.DIRECTION_X) { + nextDelta = scale * diffX; + nextVel = scale * velX; + this._position += nextDelta; + } + else if (this.options.direction === TouchSync.DIRECTION_Y) { + nextDelta = scale * diffY; + nextVel = scale * velY; + this._position += nextDelta; + } + else { + nextDelta = [scale * diffX, scale * diffY]; + nextVel = [scale * velX, scale * velY]; + this._position[0] += nextDelta[0]; + this._position[1] += nextDelta[1]; + } + + var payload = this._payload; + payload.delta = nextDelta; + payload.velocity = nextVel; + payload.position = this._position; + payload.clientX = data.x; + payload.clientY = data.y; + payload.count = data.count; + payload.touch = data.identifier; + + this._eventOutput.emit('update', payload); +} + +/** + * Triggered by trackend. + * @method _handleEnd + * @private + */ +function _handleEnd(data) { + calculatePayload.call(this, data); + this._payload.count = data.count; + this._eventOutput.emit('end', this._payload); +} + +/** + * Set internal options, overriding any default options + * + * @method setOptions + * + * @param [options] {Object} default options overrides + * @param [options.direction] {Number} read from a particular axis + * @param [options.rails] {Boolean} read from axis with greatest differential + * @param [options.scale] {Number} constant factor to scale velocity output + */ +TouchSync.prototype.setOptions = function setOptions(options) { + return this._optionsManager.setOptions(options); +}; + +/** + * Return entire options dictionary, including defaults. + * + * @method getOptions + * @return {Object} configuration options + */ +TouchSync.prototype.getOptions = function getOptions() { + return this.options; +}; + +module.exports = TouchSync; +},{"../core/EventHandler":7,"../core/OptionsManager":10,"./SyncUtils":33,"./TouchTracker":35}],35:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ +var EventHandler = _dereq_('../core/EventHandler'); + +var _now = Date.now; + +function _timestampTouch(touch, event, history) { + return { + x: touch.clientX, + y: touch.clientY, + identifier : touch.identifier, + origin: event.origin, + timestamp: _now(), + count: event.touches.length, + history: history + }; +} + +function _handleStart(event) { + if (event.touches.length > this.touchLimit) return; + this.isTouched = true; + + for (var i = 0; i < event.changedTouches.length; i++) { + var touch = event.changedTouches[i]; + var data = _timestampTouch(touch, event, null); + this.eventOutput.emit('trackstart', data); + if (!this.selective && !this.touchHistory[touch.identifier]) this.track(data); + } +} + +function _handleMove(event) { + if (event.touches.length > this.touchLimit) return; + + for (var i = 0; i < event.changedTouches.length; i++) { + var touch = event.changedTouches[i]; + var history = this.touchHistory[touch.identifier]; + if (history) { + var data = _timestampTouch(touch, event, history); + this.touchHistory[touch.identifier].push(data); + this.eventOutput.emit('trackmove', data); + } + } +} + +function _handleEnd(event) { + if (!this.isTouched) return; + + for (var i = 0; i < event.changedTouches.length; i++) { + var touch = event.changedTouches[i]; + var history = this.touchHistory[touch.identifier]; + if (history) { + var data = _timestampTouch(touch, event, history); + this.touchHistory[touch.identifier].push(data); + this.eventOutput.emit('trackend', data); + delete this.touchHistory[touch.identifier]; + } + } + + this.isTouched = false; +} + +function _handleUnpipe() { + for (var i in this.touchHistory) { + var history = this.touchHistory[i]; + this.eventOutput.emit('trackend', { + touch: history[history.length - 1].touch, + timestamp: Date.now(), + count: 0, + history: history + }); + delete this.touchHistory[i]; + } +} + +/** + * Helper to TouchSync – tracks piped in touch events, organizes touch + * events by ID, and emits track events back to TouchSync. + * Emits 'trackstart', 'trackmove', and 'trackend' events upstream. + * + * @class TouchTracker + * @constructor + * @param {Object} options default options overrides + * @param [options.selective] {Boolean} selective if false, saves state for each touch + * @param [options.touchLimit] {Number} touchLimit upper bound for emitting events based on number of touches + */ +function TouchTracker(options) { + this.selective = options.selective; + this.touchLimit = options.touchLimit || 1; + + this.touchHistory = {}; + + this.eventInput = new EventHandler(); + this.eventOutput = new EventHandler(); + + EventHandler.setInputHandler(this, this.eventInput); + EventHandler.setOutputHandler(this, this.eventOutput); + + this.eventInput.on('touchstart', _handleStart.bind(this)); + this.eventInput.on('touchmove', _handleMove.bind(this)); + this.eventInput.on('touchend', _handleEnd.bind(this)); + this.eventInput.on('touchcancel', _handleEnd.bind(this)); + this.eventInput.on('unpipe', _handleUnpipe.bind(this)); + + this.isTouched = false; +} + +/** + * Record touch data, if selective is false. + * @private + * @method track + * @param {Object} data touch data + */ +TouchTracker.prototype.track = function track(data) { + this.touchHistory[data.identifier] = [data]; +}; + +module.exports = TouchTracker; +},{"../core/EventHandler":7}],36:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ +var EventHandler = _dereq_('../core/EventHandler'); + +/** + * Helper to PinchSync, RotateSync, and ScaleSync. Generalized handling of + * two-finger touch events. + * This class is meant to be overridden and not used directly. + * + * @class TwoFingerSync + * @constructor + */ +function TwoFingerSync() { + this._eventInput = new EventHandler(); + this._eventOutput = new EventHandler(); + + EventHandler.setInputHandler(this, this._eventInput); + EventHandler.setOutputHandler(this, this._eventOutput); + + this.touchAEnabled = false; + this.touchAId = 0; + this.posA = null; + this.timestampA = 0; + this.touchBEnabled = false; + this.touchBId = 0; + this.posB = null; + this.timestampB = 0; + + this._eventInput.on('touchstart', this.handleStart.bind(this)); + this._eventInput.on('touchmove', this.handleMove.bind(this)); + this._eventInput.on('touchend', this.handleEnd.bind(this)); + this._eventInput.on('touchcancel', this.handleEnd.bind(this)); +} + +TwoFingerSync.calculateAngle = function(posA, posB) { + var diffX = posB[0] - posA[0]; + var diffY = posB[1] - posA[1]; + return Math.atan2(diffY, diffX); +}; + +TwoFingerSync.calculateDistance = function(posA, posB) { + var diffX = posB[0] - posA[0]; + var diffY = posB[1] - posA[1]; + return Math.sqrt(diffX * diffX + diffY * diffY); +}; + +TwoFingerSync.calculateCenter = function(posA, posB) { + return [(posA[0] + posB[0]) / 2.0, (posA[1] + posB[1]) / 2.0]; +}; + +var _now = Date.now; + +// private +TwoFingerSync.prototype.handleStart = function handleStart(event) { + for (var i = 0; i < event.changedTouches.length; i++) { + var touch = event.changedTouches[i]; + if (!this.touchAEnabled) { + this.touchAId = touch.identifier; + this.touchAEnabled = true; + this.posA = [touch.pageX, touch.pageY]; + this.timestampA = _now(); + } + else if (!this.touchBEnabled) { + this.touchBId = touch.identifier; + this.touchBEnabled = true; + this.posB = [touch.pageX, touch.pageY]; + this.timestampB = _now(); + this._startUpdate(event); + } + } +}; + +// private +TwoFingerSync.prototype.handleMove = function handleMove(event) { + if (!(this.touchAEnabled && this.touchBEnabled)) return; + var prevTimeA = this.timestampA; + var prevTimeB = this.timestampB; + var diffTime; + for (var i = 0; i < event.changedTouches.length; i++) { + var touch = event.changedTouches[i]; + if (touch.identifier === this.touchAId) { + this.posA = [touch.pageX, touch.pageY]; + this.timestampA = _now(); + diffTime = this.timestampA - prevTimeA; + } + else if (touch.identifier === this.touchBId) { + this.posB = [touch.pageX, touch.pageY]; + this.timestampB = _now(); + diffTime = this.timestampB - prevTimeB; + } + } + if (diffTime) this._moveUpdate(diffTime); +}; + +// private +TwoFingerSync.prototype.handleEnd = function handleEnd(event) { + for (var i = 0; i < event.changedTouches.length; i++) { + var touch = event.changedTouches[i]; + if (touch.identifier === this.touchAId || touch.identifier === this.touchBId) { + if (this.touchAEnabled && this.touchBEnabled) { + this._eventOutput.emit('end', { + touches : [this.touchAId, this.touchBId], + angle : this._angle + }); + } + this.touchAEnabled = false; + this.touchAId = 0; + this.touchBEnabled = false; + this.touchBId = 0; + } + } +}; + +module.exports = TwoFingerSync; +},{"../core/EventHandler":7}],37:[function(_dereq_,module,exports){ +module.exports = { + Accumulator: _dereq_('./Accumulator'), + DesktopEmulationMode: _dereq_('./DesktopEmulationMode'), + FastClick: _dereq_('./FastClick'), + GenericSync: _dereq_('./GenericSync'), + MouseSync: _dereq_('./MouseSync'), + PinchSync: _dereq_('./PinchSync'), + RotateSync: _dereq_('./RotateSync'), + ScaleSync: _dereq_('./ScaleSync'), + ScrollSync: _dereq_('./ScrollSync'), + SyncUtils: _dereq_('./SyncUtils'), + TouchSync: _dereq_('./TouchSync'), + TouchTracker: _dereq_('./TouchTracker'), + TwoFingerSync: _dereq_('./TwoFingerSync') +}; + +},{"./Accumulator":24,"./DesktopEmulationMode":25,"./FastClick":26,"./GenericSync":27,"./MouseSync":28,"./PinchSync":29,"./RotateSync":30,"./ScaleSync":31,"./ScrollSync":32,"./SyncUtils":33,"./TouchSync":34,"./TouchTracker":35,"./TwoFingerSync":36}],38:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Vector = _dereq_('./Vector'); + +/** + * A library for using a 3x3 numerical matrix, represented as a two-level array. + * + * @class Matrix + * @constructor + * + * @param {Array.Array} values array of rows + */ +function Matrix(values) { + this.values = values || + [ + [1,0,0], + [0,1,0], + [0,0,1] + ]; + + return this; +} + +var _register = new Matrix(); +var _vectorRegister = new Vector(); + +/** + * Return the values in the matrix as an array of numerical row arrays + * + * @method get + * + * @return {Array.array} matrix values as array of rows. + */ +Matrix.prototype.get = function get() { + return this.values; +}; + +/** + * Set the nested array of rows in the matrix. + * + * @method set + * + * @param {Array.array} values matrix values as array of rows. + */ +Matrix.prototype.set = function set(values) { + this.values = values; +}; + +/** + * Take this matrix as A, input vector V as a column vector, and return matrix product (A)(V). + * Note: This sets the internal vector register. Current handles to the vector register + * will see values changed. + * + * @method vectorMultiply + * + * @param {Vector} v input vector V + * @return {Vector} result of multiplication, as a handle to the internal vector register + */ +Matrix.prototype.vectorMultiply = function vectorMultiply(v) { + var M = this.get(); + var v0 = v.x; + var v1 = v.y; + var v2 = v.z; + + var M0 = M[0]; + var M1 = M[1]; + var M2 = M[2]; + + var M00 = M0[0]; + var M01 = M0[1]; + var M02 = M0[2]; + var M10 = M1[0]; + var M11 = M1[1]; + var M12 = M1[2]; + var M20 = M2[0]; + var M21 = M2[1]; + var M22 = M2[2]; + + return _vectorRegister.setXYZ( + M00*v0 + M01*v1 + M02*v2, + M10*v0 + M11*v1 + M12*v2, + M20*v0 + M21*v1 + M22*v2 + ); +}; + +/** + * Multiply the provided matrix M2 with this matrix. Result is (this) * (M2). + * Note: This sets the internal matrix register. Current handles to the register + * will see values changed. + * + * @method multiply + * + * @param {Matrix} M2 input matrix to multiply on the right + * @return {Matrix} result of multiplication, as a handle to the internal register + */ +Matrix.prototype.multiply = function multiply(M2) { + var M1 = this.get(); + var result = [[]]; + for (var i = 0; i < 3; i++) { + result[i] = []; + for (var j = 0; j < 3; j++) { + var sum = 0; + for (var k = 0; k < 3; k++) { + sum += M1[i][k] * M2[k][j]; + } + result[i][j] = sum; + } + } + return _register.set(result); +}; + +/** + * Creates a Matrix which is the transpose of this matrix. + * Note: This sets the internal matrix register. Current handles to the register + * will see values changed. + * + * @method transpose + * + * @return {Matrix} result of transpose, as a handle to the internal register + */ +Matrix.prototype.transpose = function transpose() { + var result = []; + var M = this.get(); + for (var row = 0; row < 3; row++) { + for (var col = 0; col < 3; col++) { + result[row][col] = M[col][row]; + } + } + return _register.set(result); +}; + +/** + * Clones the matrix + * + * @method clone + * @return {Matrix} New copy of the original matrix + */ +Matrix.prototype.clone = function clone() { + var values = this.get(); + var M = []; + for (var row = 0; row < 3; row++) + M[row] = values[row].slice(); + return new Matrix(M); +}; + +module.exports = Matrix; +},{"./Vector":42}],39:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Matrix = _dereq_('./Matrix'); + +/** + * @class Quaternion + * @constructor + * + * @param {Number} w + * @param {Number} x + * @param {Number} y + * @param {Number} z + */ +function Quaternion(w,x,y,z) { + if (arguments.length === 1) this.set(w); + else { + this.w = (w !== undefined) ? w : 1; //Angle + this.x = (x !== undefined) ? x : 0; //Axis.x + this.y = (y !== undefined) ? y : 0; //Axis.y + this.z = (z !== undefined) ? z : 0; //Axis.z + } + return this; +} + +var register = new Quaternion(1,0,0,0); + +/** + * Doc: TODO + * @method add + * @param {Quaternion} q + * @return {Quaternion} + */ +Quaternion.prototype.add = function add(q) { + return register.setWXYZ( + this.w + q.w, + this.x + q.x, + this.y + q.y, + this.z + q.z + ); +}; + +/* + * Docs: TODO + * + * @method sub + * @param {Quaternion} q + * @return {Quaternion} + */ +Quaternion.prototype.sub = function sub(q) { + return register.setWXYZ( + this.w - q.w, + this.x - q.x, + this.y - q.y, + this.z - q.z + ); +}; + +/** + * Doc: TODO + * + * @method scalarDivide + * @param {Number} s + * @return {Quaternion} + */ +Quaternion.prototype.scalarDivide = function scalarDivide(s) { + return this.scalarMultiply(1/s); +}; + +/* + * Docs: TODO + * + * @method scalarMultiply + * @param {Number} s + * @return {Quaternion} + */ +Quaternion.prototype.scalarMultiply = function scalarMultiply(s) { + return register.setWXYZ( + this.w * s, + this.x * s, + this.y * s, + this.z * s + ); +}; + +/* + * Docs: TODO + * + * @method multiply + * @param {Quaternion} q + * @return {Quaternion} + */ +Quaternion.prototype.multiply = function multiply(q) { + //left-handed coordinate system multiplication + var x1 = this.x; + var y1 = this.y; + var z1 = this.z; + var w1 = this.w; + var x2 = q.x; + var y2 = q.y; + var z2 = q.z; + var w2 = q.w || 0; + + return register.setWXYZ( + w1*w2 - x1*x2 - y1*y2 - z1*z2, + x1*w2 + x2*w1 + y2*z1 - y1*z2, + y1*w2 + y2*w1 + x1*z2 - x2*z1, + z1*w2 + z2*w1 + x2*y1 - x1*y2 + ); +}; + +var conj = new Quaternion(1,0,0,0); + +/* + * Docs: TODO + * + * @method rotateVector + * @param {Vector} v + * @return {Quaternion} + */ +Quaternion.prototype.rotateVector = function rotateVector(v) { + conj.set(this.conj()); + return register.set(this.multiply(v).multiply(conj)); +}; + +/* + * Docs: TODO + * + * @method inverse + * @return {Quaternion} + */ +Quaternion.prototype.inverse = function inverse() { + return register.set(this.conj().scalarDivide(this.normSquared())); +}; + +/* + * Docs: TODO + * + * @method negate + * @return {Quaternion} + */ +Quaternion.prototype.negate = function negate() { + return this.scalarMultiply(-1); +}; + +/* + * Docs: TODO + * + * @method conj + * @return {Quaternion} + */ +Quaternion.prototype.conj = function conj() { + return register.setWXYZ( + this.w, + -this.x, + -this.y, + -this.z + ); +}; + +/* + * Docs: TODO + * + * @method normalize + * @param {Number} length + * @return {Quaternion} + */ +Quaternion.prototype.normalize = function normalize(length) { + length = (length === undefined) ? 1 : length; + return this.scalarDivide(length * this.norm()); +}; + +/* + * Docs: TODO + * + * @method makeFromAngleAndAxis + * @param {Number} angle + * @param {Vector} v + * @return {Quaternion} + */ +Quaternion.prototype.makeFromAngleAndAxis = function makeFromAngleAndAxis(angle, v) { + //left handed quaternion creation: theta -> -theta + var n = v.normalize(); + var ha = angle*0.5; + var s = -Math.sin(ha); + this.x = s*n.x; + this.y = s*n.y; + this.z = s*n.z; + this.w = Math.cos(ha); + return this; +}; + +/* + * Docs: TODO + * + * @method setWXYZ + * @param {Number} w + * @param {Number} x + * @param {Number} y + * @param {Number} z + * @return {Quaternion} + */ +Quaternion.prototype.setWXYZ = function setWXYZ(w,x,y,z) { + register.clear(); + this.w = w; + this.x = x; + this.y = y; + this.z = z; + return this; +}; + +/* + * Docs: TODO + * + * @method set + * @param {Array|Quaternion} v + * @return {Quaternion} + */ +Quaternion.prototype.set = function set(v) { + if (v instanceof Array) { + this.w = 0; + this.x = v[0]; + this.y = v[1]; + this.z = v[2]; + } + else { + this.w = v.w; + this.x = v.x; + this.y = v.y; + this.z = v.z; + } + if (this !== register) register.clear(); + return this; +}; + +/** + * Docs: TODO + * + * @method put + * @param {Quaternion} q + * @return {Quaternion} + */ +Quaternion.prototype.put = function put(q) { + q.set(register); +}; + +/** + * Doc: TODO + * + * @method clone + * @return {Quaternion} + */ +Quaternion.prototype.clone = function clone() { + return new Quaternion(this); +}; + +/** + * Doc: TODO + * + * @method clear + * @return {Quaternion} + */ +Quaternion.prototype.clear = function clear() { + this.w = 1; + this.x = 0; + this.y = 0; + this.z = 0; + return this; +}; + +/** + * Doc: TODO + * + * @method isEqual + * @param {Quaternion} q + * @return {Boolean} + */ +Quaternion.prototype.isEqual = function isEqual(q) { + return q.w === this.w && q.x === this.x && q.y === this.y && q.z === this.z; +}; + +/** + * Doc: TODO + * + * @method dot + * @param {Quaternion} q + * @return {Number} + */ +Quaternion.prototype.dot = function dot(q) { + return this.w * q.w + this.x * q.x + this.y * q.y + this.z * q.z; +}; + +/** + * Doc: TODO + * + * @method normSquared + * @return {Number} + */ +Quaternion.prototype.normSquared = function normSquared() { + return this.dot(this); +}; + +/** + * Doc: TODO + * + * @method norm + * @return {Number} + */ +Quaternion.prototype.norm = function norm() { + return Math.sqrt(this.normSquared()); +}; + +/** + * Doc: TODO + * + * @method isZero + * @return {Boolean} + */ +Quaternion.prototype.isZero = function isZero() { + return !(this.x || this.y || this.z); +}; + +/** + * Doc: TODO + * + * @method getTransform + * @return {Transform} + */ +Quaternion.prototype.getTransform = function getTransform() { + var temp = this.normalize(1); + var x = temp.x; + var y = temp.y; + var z = temp.z; + var w = temp.w; + + //LHC system flattened to column major = RHC flattened to row major + return [ + 1 - 2*y*y - 2*z*z, + 2*x*y - 2*z*w, + 2*x*z + 2*y*w, + 0, + 2*x*y + 2*z*w, + 1 - 2*x*x - 2*z*z, + 2*y*z - 2*x*w, + 0, + 2*x*z - 2*y*w, + 2*y*z + 2*x*w, + 1 - 2*x*x - 2*y*y, + 0, + 0, + 0, + 0, + 1 + ]; +}; + +var matrixRegister = new Matrix(); + +/** + * Doc: TODO + * + * @method getMatrix + * @return {Transform} + */ +Quaternion.prototype.getMatrix = function getMatrix() { + var temp = this.normalize(1); + var x = temp.x; + var y = temp.y; + var z = temp.z; + var w = temp.w; + + //LHC system flattened to row major + return matrixRegister.set([ + [ + 1 - 2*y*y - 2*z*z, + 2*x*y + 2*z*w, + 2*x*z - 2*y*w + ], + [ + 2*x*y - 2*z*w, + 1 - 2*x*x - 2*z*z, + 2*y*z + 2*x*w + ], + [ + 2*x*z + 2*y*w, + 2*y*z - 2*x*w, + 1 - 2*x*x - 2*y*y + ] + ]); +}; + +var epsilon = 1e-5; + +/** + * Doc: TODO + * + * @method slerp + * @param {Quaternion} q + * @param {Number} t + * @return {Transform} + */ +Quaternion.prototype.slerp = function slerp(q, t) { + var omega; + var cosomega; + var sinomega; + var scaleFrom; + var scaleTo; + + cosomega = this.dot(q); + if ((1.0 - cosomega) > epsilon) { + omega = Math.acos(cosomega); + sinomega = Math.sin(omega); + scaleFrom = Math.sin((1.0 - t) * omega) / sinomega; + scaleTo = Math.sin(t * omega) / sinomega; + } + else { + scaleFrom = 1.0 - t; + scaleTo = t; + } + return register.set(this.scalarMultiply(scaleFrom/scaleTo).add(q).multiply(scaleTo)); +}; + +module.exports = Quaternion; +},{"./Matrix":38}],40:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + + + + +var RAND = Math.random; + +function _randomFloat(min,max) { + return min + RAND() * (max - min); +} + +function _randomInteger(min,max) { + return (min + RAND() * (max - min + 1)) >> 0; +} + +/** + * Very simple uniform random number generator library wrapping Math.random(). + * + * @class Random + * @static + */ +var Random = {}; + +/** + * Get single random integer between min and max (inclusive), or array + * of size dim if specified. + * + * @method integer + * + * @param {Number} min lower bound, default 0 + * @param {Number} max upper bound, default 1 + * @param {Number} dim (optional) dimension of output array, if specified + * @return {number | array} random integer, or optionally, an array of random integers + */ +Random.integer = function integer(min,max,dim) { + min = (min !== undefined) ? min : 0; + max = (max !== undefined) ? max : 1; + if (dim !== undefined) { + var result = []; + for (var i = 0; i < dim; i++) result.push(_randomInteger(min,max)); + return result; + } + else return _randomInteger(min,max); +}; + +/** + * Get single random float between min and max (inclusive), or array + * of size dim if specified + * + * @method range + * + * @param {Number} min lower bound, default 0 + * @param {Number} max upper bound, default 1 + * @param {Number} [dim] dimension of output array, if specified + * @return {Number} random float, or optionally an array + */ +Random.range = function range(min,max,dim) { + min = (min !== undefined) ? min : 0; + max = (max !== undefined) ? max : 1; + if (dim !== undefined) { + var result = []; + for (var i = 0; i < dim; i++) result.push(_randomFloat(min,max)); + return result; + } + else return _randomFloat(min,max); +}; + +/** + * Return random number among the set {-1 ,1} + * + * @method sign + * + * @param {Number} prob probability of returning 1, default 0.5 + * @return {Number} random sign (-1 or 1) + */ +Random.sign = function sign(prob) { + prob = (prob !== undefined) ? prob : 0.5; + return (RAND() < prob) ? 1 : -1; +}; + +/** + * Return random boolean value, true or false. + * + * @method bool + * + * @param {Number} prob probability of returning true, default 0.5 + * @return {Boolean} random boolean + */ +Random.bool = function bool(prob) { + prob = (prob !== undefined) ? prob : 0.5; + return RAND() < prob; +}; + +module.exports = Random; +},{}],41:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + + + +/** + * A few static methods. + * + * @class Utilities + * @static + */ +var Utilities = {}; + +/** + * Constrain input to range. + * + * @method clamp + * @param {Number} value input + * @param {Array.Number} range [min, max] + * @static + */ +Utilities.clamp = function clamp(value, range) { + return Math.max(Math.min(value, range[1]), range[0]); +}; + +/** + * Euclidean length of numerical array. + * + * @method length + * @param {Array.Number} array array of numbers + * @static + */ +Utilities.length = function length(array) { + var distanceSquared = 0; + for (var i = 0; i < array.length; i++) { + distanceSquared += array[i] * array[i]; + } + return Math.sqrt(distanceSquared); +}; + +module.exports = Utilities; +},{}],42:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + + + + +/** + * Three-element floating point vector. + * + * @class Vector + * @constructor + * + * @param {number} x x element value + * @param {number} y y element value + * @param {number} z z element value + */ +function Vector(x,y,z) { + if (arguments.length === 1 && x !== undefined) this.set(x); + else { + this.x = x || 0; + this.y = y || 0; + this.z = z || 0; + } + return this; +} + +var _register = new Vector(0,0,0); + +/** + * Add this element-wise to another Vector, element-wise. + * Note: This sets the internal result register, so other references to that vector will change. + * + * @method add + * @param {Vector} v addend + * @return {Vector} vector sum + */ +Vector.prototype.add = function add(v) { + return _setXYZ.call(_register, + this.x + v.x, + this.y + v.y, + this.z + v.z + ); +}; + +/** + * Subtract another vector from this vector, element-wise. + * Note: This sets the internal result register, so other references to that vector will change. + * + * @method sub + * @param {Vector} v subtrahend + * @return {Vector} vector difference + */ +Vector.prototype.sub = function sub(v) { + return _setXYZ.call(_register, + this.x - v.x, + this.y - v.y, + this.z - v.z + ); +}; + +/** + * Scale Vector by floating point r. + * Note: This sets the internal result register, so other references to that vector will change. + * + * @method mult + * + * @param {number} r scalar + * @return {Vector} vector result + */ +Vector.prototype.mult = function mult(r) { + return _setXYZ.call(_register, + r * this.x, + r * this.y, + r * this.z + ); +}; + +/** + * Scale Vector by floating point 1/r. + * Note: This sets the internal result register, so other references to that vector will change. + * + * @method div + * + * @param {number} r scalar + * @return {Vector} vector result + */ +Vector.prototype.div = function div(r) { + return this.mult(1 / r); +}; + +/** + * Given another vector v, return cross product (v)x(this). + * Note: This sets the internal result register, so other references to that vector will change. + * + * @method cross + * @param {Vector} v Left Hand Vector + * @return {Vector} vector result + */ +Vector.prototype.cross = function cross(v) { + var x = this.x; + var y = this.y; + var z = this.z; + var vx = v.x; + var vy = v.y; + var vz = v.z; + + return _setXYZ.call(_register, + z * vy - y * vz, + x * vz - z * vx, + y * vx - x * vy + ); +}; + +/** + * Component-wise equality test between this and Vector v. + * @method equals + * @param {Vector} v vector to compare + * @return {boolean} + */ +Vector.prototype.equals = function equals(v) { + return (v.x === this.x && v.y === this.y && v.z === this.z); +}; + +/** + * Rotate clockwise around x-axis by theta radians. + * Note: This sets the internal result register, so other references to that vector will change. + * @method rotateX + * @param {number} theta radians + * @return {Vector} rotated vector + */ +Vector.prototype.rotateX = function rotateX(theta) { + var x = this.x; + var y = this.y; + var z = this.z; + + var cosTheta = Math.cos(theta); + var sinTheta = Math.sin(theta); + + return _setXYZ.call(_register, + x, + y * cosTheta - z * sinTheta, + y * sinTheta + z * cosTheta + ); +}; + +/** + * Rotate clockwise around y-axis by theta radians. + * Note: This sets the internal result register, so other references to that vector will change. + * @method rotateY + * @param {number} theta radians + * @return {Vector} rotated vector + */ +Vector.prototype.rotateY = function rotateY(theta) { + var x = this.x; + var y = this.y; + var z = this.z; + + var cosTheta = Math.cos(theta); + var sinTheta = Math.sin(theta); + + return _setXYZ.call(_register, + z * sinTheta + x * cosTheta, + y, + z * cosTheta - x * sinTheta + ); +}; + +/** + * Rotate clockwise around z-axis by theta radians. + * Note: This sets the internal result register, so other references to that vector will change. + * @method rotateZ + * @param {number} theta radians + * @return {Vector} rotated vector + */ +Vector.prototype.rotateZ = function rotateZ(theta) { + var x = this.x; + var y = this.y; + var z = this.z; + + var cosTheta = Math.cos(theta); + var sinTheta = Math.sin(theta); + + return _setXYZ.call(_register, + x * cosTheta - y * sinTheta, + x * sinTheta + y * cosTheta, + z + ); +}; + +/** + * Return dot product of this with a second Vector + * @method dot + * @param {Vector} v second vector + * @return {number} dot product + */ +Vector.prototype.dot = function dot(v) { + return this.x * v.x + this.y * v.y + this.z * v.z; +}; + +/** + * Return squared length of this vector + * @method normSquared + * @return {number} squared length + */ +Vector.prototype.normSquared = function normSquared() { + return this.dot(this); +}; + +/** + * Return length of this vector + * @method norm + * @return {number} length + */ +Vector.prototype.norm = function norm() { + return Math.sqrt(this.normSquared()); +}; + +/** + * Scale Vector to specified length. + * If length is less than internal tolerance, set vector to [length, 0, 0]. + * Note: This sets the internal result register, so other references to that vector will change. + * @method normalize + * + * @param {number} length target length, default 1.0 + * @return {Vector} + */ +Vector.prototype.normalize = function normalize(length) { + if (arguments.length === 0) length = 1; + var norm = this.norm(); + + if (norm > 1e-7) return _setFromVector.call(_register, this.mult(length / norm)); + else return _setXYZ.call(_register, length, 0, 0); +}; + +/** + * Make a separate copy of the Vector. + * + * @method clone + * + * @return {Vector} + */ +Vector.prototype.clone = function clone() { + return new Vector(this); +}; + +/** + * True if and only if every value is 0 (or falsy) + * + * @method isZero + * + * @return {boolean} + */ +Vector.prototype.isZero = function isZero() { + return !(this.x || this.y || this.z); +}; + +function _setXYZ(x,y,z) { + this.x = x; + this.y = y; + this.z = z; + return this; +} + +function _setFromArray(v) { + return _setXYZ.call(this,v[0],v[1],v[2] || 0); +} + +function _setFromVector(v) { + return _setXYZ.call(this, v.x, v.y, v.z); +} + +function _setFromNumber(x) { + return _setXYZ.call(this,x,0,0); +} + +/** + * Set this Vector to the values in the provided Array or Vector. + * + * @method set + * @param {object} v array, Vector, or number + * @return {Vector} this + */ +Vector.prototype.set = function set(v) { + if (v instanceof Array) return _setFromArray.call(this, v); + if (typeof v === 'number') return _setFromNumber.call(this, v); + return _setFromVector.call(this, v); +}; + +Vector.prototype.setXYZ = function(x,y,z) { + return _setXYZ.apply(this, arguments); +}; + +Vector.prototype.set1D = function(x) { + return _setFromNumber.call(this, x); +}; + +/** + * Put result of last internal register calculation in specified output vector. + * + * @method put + * @param {Vector} v destination vector + * @return {Vector} destination vector + */ + +Vector.prototype.put = function put(v) { + if (this === _register) _setFromVector.call(v, _register); + else _setFromVector.call(v, this); +}; + +/** + * Set this vector to [0,0,0] + * + * @method clear + */ +Vector.prototype.clear = function clear() { + return _setXYZ.call(this,0,0,0); +}; + +/** + * Scale this Vector down to specified "cap" length. + * If Vector shorter than cap, or cap is Infinity, do nothing. + * Note: This sets the internal result register, so other references to that vector will change. + * + * @method cap + * @return {Vector} capped vector + */ +Vector.prototype.cap = function cap(cap) { + if (cap === Infinity) return _setFromVector.call(_register, this); + var norm = this.norm(); + if (norm > cap) return _setFromVector.call(_register, this.mult(cap / norm)); + else return _setFromVector.call(_register, this); +}; + +/** + * Return projection of this Vector onto another. + * Note: This sets the internal result register, so other references to that vector will change. + * + * @method project + * @param {Vector} n vector to project upon + * @return {Vector} projected vector + */ +Vector.prototype.project = function project(n) { + return n.mult(this.dot(n)); +}; + +/** + * Reflect this Vector across provided vector. + * Note: This sets the internal result register, so other references to that vector will change. + * + * @method reflectAcross + * @param {Vector} n vector to reflect across + * @return {Vector} reflected vector + */ +Vector.prototype.reflectAcross = function reflectAcross(n) { + n.normalize().put(n); + return _setFromVector(_register, this.sub(this.project(n).mult(2))); +}; + +/** + * Convert Vector to three-element array. + * + * @method get + * @return {array} three-element array + */ +Vector.prototype.get = function get() { + return [this.x, this.y, this.z]; +}; + +Vector.prototype.get1D = function() { + return this.x; +}; + +module.exports = Vector; +},{}],43:[function(_dereq_,module,exports){ +module.exports = { + Matrix: _dereq_('./Matrix'), + Quaternion: _dereq_('./Quaternion'), + Random: _dereq_('./Random'), + Utilities: _dereq_('./Utilities'), + Vector: _dereq_('./Vector') +}; + +},{"./Matrix":38,"./Quaternion":39,"./Random":40,"./Utilities":41,"./Vector":42}],44:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Transform = _dereq_('../core/Transform'); +var Transitionable = _dereq_('../transitions/Transitionable'); +var EventHandler = _dereq_('../core/EventHandler'); +var Utilities = _dereq_('../math/Utilities'); +var GenericSync = _dereq_('../inputs/GenericSync'); +var MouseSync = _dereq_('../inputs/MouseSync'); +var TouchSync = _dereq_('../inputs/TouchSync'); +GenericSync.register({'mouse': MouseSync, 'touch': TouchSync}); + +/** + * Makes added render nodes responsive to drag beahvior. + * Emits events 'start', 'update', 'end'. + * @class Draggable + * @constructor + * @param {Object} [options] options configuration object. + * @param {Number} [options.snapX] grid width for snapping during drag + * @param {Number} [options.snapY] grid height for snapping during drag + * @param {Array.Number} [options.xRange] maxmimum [negative, positive] x displacement from start of drag + * @param {Array.Number} [options.yRange] maxmimum [negative, positive] y displacement from start of drag + * @param {Number} [options.scale] one pixel of input motion translates to this many pixels of output drag motion + * @param {Number} [options.projection] User should set to Draggable._direction.x or + * Draggable._direction.y to constrain to one axis. + * + */ +function Draggable(options) { + this.options = Object.create(Draggable.DEFAULT_OPTIONS); + if (options) this.setOptions(options); + + this._positionState = new Transitionable([0,0]); + this._differential = [0,0]; + this._active = true; + + this.sync = new GenericSync(['mouse', 'touch'], {scale : this.options.scale}); + this.eventOutput = new EventHandler(); + EventHandler.setInputHandler(this, this.sync); + EventHandler.setOutputHandler(this, this.eventOutput); + + _bindEvents.call(this); +} + +//binary representation of directions for bitwise operations +var _direction = { + x : 0x01, //001 + y : 0x02 //010 +}; + +Draggable.DIRECTION_X = _direction.x; +Draggable.DIRECTION_Y = _direction.y; + +var _clamp = Utilities.clamp; + +Draggable.DEFAULT_OPTIONS = { + projection : _direction.x | _direction.y, + scale : 1, + xRange : null, + yRange : null, + snapX : 0, + snapY : 0, + transition : {duration : 0} +}; + +function _mapDifferential(differential) { + var opts = this.options; + var projection = opts.projection; + var snapX = opts.snapX; + var snapY = opts.snapY; + + //axes + var tx = (projection & _direction.x) ? differential[0] : 0; + var ty = (projection & _direction.y) ? differential[1] : 0; + + //snapping + if (snapX > 0) tx -= tx % snapX; + if (snapY > 0) ty -= ty % snapY; + + return [tx, ty]; +} + +function _handleStart() { + if (!this._active) return; + if (this._positionState.isActive()) this._positionState.halt(); + this.eventOutput.emit('start', {position : this.getPosition()}); +} + +function _handleMove(event) { + if (!this._active) return; + + var options = this.options; + this._differential = event.position; + var newDifferential = _mapDifferential.call(this, this._differential); + + //buffer the differential if snapping is set + this._differential[0] -= newDifferential[0]; + this._differential[1] -= newDifferential[1]; + + var pos = this.getPosition(); + + //modify position, retain reference + pos[0] += newDifferential[0]; + pos[1] += newDifferential[1]; + + //handle bounding box + if (options.xRange){ + var xRange = [options.xRange[0] + 0.5 * options.snapX, options.xRange[1] - 0.5 * options.snapX]; + pos[0] = _clamp(pos[0], xRange); + } + + if (options.yRange){ + var yRange = [options.yRange[0] + 0.5 * options.snapY, options.yRange[1] - 0.5 * options.snapY]; + pos[1] = _clamp(pos[1], yRange); + } + + this.eventOutput.emit('update', {position : pos}); +} + +function _handleEnd() { + if (!this._active) return; + this.eventOutput.emit('end', {position : this.getPosition()}); +} + +function _bindEvents() { + this.sync.on('start', _handleStart.bind(this)); + this.sync.on('update', _handleMove.bind(this)); + this.sync.on('end', _handleEnd.bind(this)); +} + +/** + * Set internal options, overriding any default options + * + * @method setOptions + * + * @param {Object} [options] overrides of default options. See constructor. + */ +Draggable.prototype.setOptions = function setOptions(options) { + var currentOptions = this.options; + if (options.projection !== undefined) { + var proj = options.projection; + this.options.projection = 0; + ['x', 'y'].forEach(function(val) { + if (proj.indexOf(val) !== -1) currentOptions.projection |= _direction[val]; + }); + } + if (options.scale !== undefined) { + currentOptions.scale = options.scale; + this.sync.setOptions({ + scale: options.scale + }); + } + if (options.xRange !== undefined) currentOptions.xRange = options.xRange; + if (options.yRange !== undefined) currentOptions.yRange = options.yRange; + if (options.snapX !== undefined) currentOptions.snapX = options.snapX; + if (options.snapY !== undefined) currentOptions.snapY = options.snapY; +}; + +/** + * Get current delta in position from where this draggable started. + * + * @method getPosition + * + * @return {array} [x, y] position delta from start. + */ +Draggable.prototype.getPosition = function getPosition() { + return this._positionState.get(); +}; + +/** + * Transition the element to the desired relative position via provided transition. + * For example, calling this with [0,0] will not change the position. + * Callback will be executed on completion. + * + * @method setRelativePosition + * + * @param {array} position end state to which we interpolate + * @param {transition} transition transition object specifying how object moves to new position + * @param {function} callback zero-argument function to call on observed completion + */ +Draggable.prototype.setRelativePosition = function setRelativePosition(position, transition, callback) { + var currPos = this.getPosition(); + var relativePosition = [currPos[0] + position[0], currPos[1] + position[1]]; + this.setPosition(relativePosition, transition, callback); +}; + +/** + * Transition the element to the desired absolute position via provided transition. + * Callback will be executed on completion. + * + * @method setPosition + * + * @param {array} position end state to which we interpolate + * @param {transition} transition transition object specifying how object moves to new position + * @param {function} callback zero-argument function to call on observed completion + */ +Draggable.prototype.setPosition = function setPosition(position, transition, callback) { + if (this._positionState.isActive()) this._positionState.halt(); + this._positionState.set(position, transition, callback); +}; + +/** + * Set this draggable to respond to user input. + * + * @method activate + * + */ +Draggable.prototype.activate = function activate() { + this._active = true; +}; + +/** + * Set this draggable to ignore user input. + * + * @method deactivate + * + */ +Draggable.prototype.deactivate = function deactivate() { + this._active = false; +}; + +/** + * Switch the input response stage between active and inactive. + * + * @method toggle + * + */ +Draggable.prototype.toggle = function toggle() { + this._active = !this._active; +}; + +/** + * Return render spec for this Modifier, applying to the provided + * target component. This is similar to render() for Surfaces. + * + * @private + * @method modify + * + * @param {Object} target (already rendered) render spec to + * which to apply the transform. + * @return {Object} render spec for this Modifier, including the + * provided target + */ +Draggable.prototype.modify = function modify(target) { + var pos = this.getPosition(); + return { + transform: Transform.translate(pos[0], pos[1]), + target: target + }; +}; + +module.exports = Draggable; +},{"../core/EventHandler":7,"../core/Transform":15,"../inputs/GenericSync":27,"../inputs/MouseSync":28,"../inputs/TouchSync":34,"../math/Utilities":41,"../transitions/Transitionable":89}],45:[function(_dereq_,module,exports){ +var Transitionable = _dereq_('../transitions/Transitionable'); +var OptionsManager = _dereq_('../core/OptionsManager'); + +/** + * Modifier that allows you to fade the opacity of affected renderables in and out. + * @class Fader + * @constructor + * @param {Object} [options] options configuration object. + * @param {Boolean} [options.cull=false] Stops returning affected renderables up the tree when they're fully faded when true. + * @param {Transition} [options.transition=true] The main transition for showing and hiding. + * @param {Transition} [options.pulseInTransition=true] Controls the transition to a pulsed state when the Fader instance's pulse + * method is called. + * @param {Transition} [options.pulseOutTransition=true]Controls the transition back from a pulsed state when the Fader instance's pulse + * method is called. + * + */ +function Fader(options, startState) { + this.options = Object.create(Fader.DEFAULT_OPTIONS); + this._optionsManager = new OptionsManager(this.options); + + if (options) this.setOptions(options); + + if (!startState) startState = 0; + this.transitionHelper = new Transitionable(startState); +} + +Fader.DEFAULT_OPTIONS = { + cull: false, + transition: true, + pulseInTransition: true, + pulseOutTransition: true +}; + +/** + * Set internal options, overriding any default options + * + * @method setOptions + * + * @param {Object} [options] overrides of default options. See constructor. + */ +Fader.prototype.setOptions = function setOptions(options) { + return this._optionsManager.setOptions(options); +}; + +/** + * Fully displays the Fader instance's associated renderables. + * + * @method show + * @param {Transition} [transition] The transition that coordinates setting to the new state. + * @param {Function} [callback] A callback that executes once you've transitioned to the fully shown state. + */ +Fader.prototype.show = function show(transition, callback) { + transition = transition || this.options.transition; + this.set(1, transition, callback); +}; + +/** + * Fully fades the Fader instance's associated renderables. + * + * @method hide + * @param {Transition} [transition] The transition that coordinates setting to the new state. + * @param {Function} [callback] A callback that executes once you've transitioned to the fully faded state. + */ +Fader.prototype.hide = function hide(transition, callback) { + transition = transition || this.options.transition; + this.set(0, transition, callback); +}; + +/** + * Manually sets the opacity state of the fader to the passed-in one. Executes with an optional + * transition and callback. + * + * @method set + * @param {Number} state A number from zero to one: the amount of opacity you want to set to. + * @param {Transition} [transition] The transition that coordinates setting to the new state. + * @param {Function} [callback] A callback that executes once you've finished executing the pulse. + */ +Fader.prototype.set = function set(state, transition, callback) { + this.halt(); + this.transitionHelper.set(state, transition, callback); +}; + +/** + * Halt the transition + * + * @method halt + */ +Fader.prototype.halt = function halt() { + this.transitionHelper.halt(); +}; + +/** + * Tells you if your Fader instance is above its visibility threshold. + * + * @method isVisible + * @return {Boolean} Whether or not your Fader instance is visible. + */ +Fader.prototype.isVisible = function isVisible() { + return (this.transitionHelper.get() > 0); +}; + +/** + * Return render spec for this Modifier, applying to the provided + * target component. This is similar to render() for Surfaces. + * + * @private + * @method modify + * + * @param {Object} target (already rendered) render spec to + * which to apply the transform. + * @return {Object} render spec for this Modifier, including the + * provided target + */ +Fader.prototype.modify = function modify(target) { + var currOpacity = this.transitionHelper.get(); + if (this.options.cull && !currOpacity) return undefined; + else return {opacity: currOpacity, target: target}; +}; + +module.exports = Fader; +},{"../core/OptionsManager":10,"../transitions/Transitionable":89}],46:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + + + + +/** + * A class to add and remove a chain of modifiers + * at a single point in the render tree + * + * @class ModifierChain + * @constructor + */ +function ModifierChain() { + this._chain = []; + if (arguments.length) this.addModifier.apply(this, arguments); +} + +/** + * Add a modifier, or comma separated modifiers, to the modifier chain. + * + * @method addModifier + * + * @param {...Modifier*} varargs args list of Modifiers + */ +ModifierChain.prototype.addModifier = function addModifier(varargs) { + Array.prototype.push.apply(this._chain, arguments); +}; + +/** + * Remove a modifier from the modifier chain. + * + * @method removeModifier + * + * @param {Modifier} modifier + */ +ModifierChain.prototype.removeModifier = function removeModifier(modifier) { + var index = this._chain.indexOf(modifier); + if (index < 0) return; + this._chain.splice(index, 1); +}; + +/** + * Return render spec for this Modifier, applying to the provided + * target component. This is similar to render() for Surfaces. + * + * @private + * @method modify + * + * @param {Object} input (already rendered) render spec to + * which to apply the transform. + * @return {Object} render spec for this Modifier, including the + * provided target + */ +ModifierChain.prototype.modify = function modify(input) { + var chain = this._chain; + var result = input; + for (var i = 0; i < chain.length; i++) { + result = chain[i].modify(result); + } + return result; +}; + +module.exports = ModifierChain; +},{}],47:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Modifier = _dereq_('../core/Modifier'); +var Transform = _dereq_('../core/Transform'); +var Transitionable = _dereq_('../transitions/Transitionable'); +var TransitionableTransform = _dereq_('../transitions/TransitionableTransform'); + +/** + * A collection of visual changes to be + * applied to another renderable component, strongly coupled with the state that defines + * those changes. This collection includes a + * transform matrix, an opacity constant, a size, an origin specifier, and an alignment specifier. + * StateModifier objects can be added to any RenderNode or object + * capable of displaying renderables. The StateModifier's children and descendants + * are transformed by the amounts specified in the modifier's properties. + * + * @class StateModifier + * @constructor + * @param {Object} [options] overrides of default options + * @param {Transform} [options.transform] affine transformation matrix + * @param {Number} [options.opacity] + * @param {Array.Number} [options.origin] origin adjustment + * @param {Array.Number} [options.align] align adjustment + * @param {Array.Number} [options.size] size to apply to descendants + * @param {Array.Number} [options.propportions] proportions to apply to descendants + */ +function StateModifier(options) { + this._transformState = new TransitionableTransform(Transform.identity); + this._opacityState = new Transitionable(1); + this._originState = new Transitionable([0, 0]); + this._alignState = new Transitionable([0, 0]); + this._sizeState = new Transitionable([0, 0]); + this._proportionsState = new Transitionable([0, 0]); + + this._modifier = new Modifier({ + transform: this._transformState, + opacity: this._opacityState, + origin: null, + align: null, + size: null, + proportions: null + }); + + this._hasOrigin = false; + this._hasAlign = false; + this._hasSize = false; + this._hasProportions = false; + + if (options) { + if (options.transform) this.setTransform(options.transform); + if (options.opacity !== undefined) this.setOpacity(options.opacity); + if (options.origin) this.setOrigin(options.origin); + if (options.align) this.setAlign(options.align); + if (options.size) this.setSize(options.size); + if (options.proportions) this.setProportions(options.proportions); + } +} + +/** + * Set the transform matrix of this modifier, either statically or + * through a provided Transitionable. + * + * @method setTransform + * + * @param {Transform} transform Transform to transition to. + * @param {Transitionable} transition object of type {duration: number, curve: + * f[0,1] -> [0,1] or name}. If transition is omitted, change will be + * instantaneous. + * @param {Function} [callback] callback to call after transition completes + * @return {StateModifier} this + */ +StateModifier.prototype.setTransform = function setTransform(transform, transition, callback) { + this._transformState.set(transform, transition, callback); + return this; +}; + +/** + * Set the opacity of this modifier, either statically or + * through a provided Transitionable. + * + * @method setOpacity + * + * @param {Number} opacity Opacity value to transition to. + * @param {Transitionable} transition object of type {duration: number, curve: + * f[0,1] -> [0,1] or name}. If transition is omitted, change will be + * instantaneous. + * @param {Function} callback callback to call after transition completes + * @return {StateModifier} this + */ +StateModifier.prototype.setOpacity = function setOpacity(opacity, transition, callback) { + this._opacityState.set(opacity, transition, callback); + return this; +}; + +/** + * Set the origin of this modifier, either statically or + * through a provided Transitionable. + * + * @method setOrigin + * + * @param {Array.Number} origin two element array with values between 0 and 1. + * @param {Transitionable} transition object of type {duration: number, curve: + * f[0,1] -> [0,1] or name}. If transition is omitted, change will be + * instantaneous. + * @param {Function} callback callback to call after transition completes + * @return {StateModifier} this + */ +StateModifier.prototype.setOrigin = function setOrigin(origin, transition, callback) { + if (origin === null) { + if (this._hasOrigin) { + this._modifier.originFrom(null); + this._hasOrigin = false; + } + return this; + } + else if (!this._hasOrigin) { + this._hasOrigin = true; + this._modifier.originFrom(this._originState); + } + this._originState.set(origin, transition, callback); + return this; +}; + +/** + * Set the alignment of this modifier, either statically or + * through a provided Transitionable. + * + * @method setAlign + * + * @param {Array.Number} align two element array with values between 0 and 1. + * @param {Transitionable} transition object of type {duration: number, curve: + * f[0,1] -> [0,1] or name}. If transition is omitted, change will be + * instantaneous. + * @param {Function} callback callback to call after transition completes + * @return {StateModifier} this + */ +StateModifier.prototype.setAlign = function setOrigin(align, transition, callback) { + if (align === null) { + if (this._hasAlign) { + this._modifier.alignFrom(null); + this._hasAlign = false; + } + return this; + } + else if (!this._hasAlign) { + this._hasAlign = true; + this._modifier.alignFrom(this._alignState); + } + this._alignState.set(align, transition, callback); + return this; +}; + +/** + * Set the size of this modifier, either statically or + * through a provided Transitionable. + * + * @method setSize + * + * @param {Array.Number} size two element array of [width, height] + * @param {Transitionable} transition object of type {duration: number, curve: + * f[0,1] -> [0,1] or name}. If transition is omitted, change will be + * instantaneous. + * @param {Function} callback callback to call after transition completes + * @return {StateModifier} this + */ +StateModifier.prototype.setSize = function setSize(size, transition, callback) { + if (size === null) { + if (this._hasSize) { + this._modifier.sizeFrom(null); + this._hasSize = false; + } + return this; + } + else if (!this._hasSize) { + this._hasSize = true; + this._modifier.sizeFrom(this._sizeState); + } + this._sizeState.set(size, transition, callback); + return this; +}; + +/** + * Set the proportions of this modifier, either statically or + * through a provided Transitionable. + * + * @method setProportions + * + * @param {Array.Number} proportions two element array with values between 0 and 1. + * @param {Transitionable} transition Valid transitionable object + * @param {Function} callback callback to call after transition completes + * @return {StateModifier} this + */ +StateModifier.prototype.setProportions = function setSize(proportions, transition, callback) { + if (proportions === null) { + if (this._hasProportions) { + this._modifier.proportionsFrom(null); + this._hasProportions = false; + } + return this; + } + else if (!this._hasProportions) { + this._hasProportions = true; + this._modifier.proportionsFrom(this._proportionsState); + } + this._proportionsState.set(proportions, transition, callback); + return this; +}; + +/** + * Stop the transition. + * + * @method halt + */ +StateModifier.prototype.halt = function halt() { + this._transformState.halt(); + this._opacityState.halt(); + this._originState.halt(); + this._alignState.halt(); + this._sizeState.halt(); + this._proportionsState.halt(); +}; + +/** + * Get the current state of the transform matrix component. + * + * @method getTransform + * @return {Object} transform provider object + */ +StateModifier.prototype.getTransform = function getTransform() { + return this._transformState.get(); +}; + +/** + * Get the destination state of the transform component. + * + * @method getFinalTransform + * @return {Transform} transform matrix + */ +StateModifier.prototype.getFinalTransform = function getFinalTransform() { + return this._transformState.getFinal(); +}; + +/** + * Get the current state of the opacity component. + * + * @method getOpacity + * @return {Object} opacity provider object + */ +StateModifier.prototype.getOpacity = function getOpacity() { + return this._opacityState.get(); +}; + +/** + * Get the current state of the origin component. + * + * @method getOrigin + * @return {Object} origin provider object + */ +StateModifier.prototype.getOrigin = function getOrigin() { + return this._hasOrigin ? this._originState.get() : null; +}; + +/** + * Get the current state of the align component. + * + * @method getAlign + * @return {Object} align provider object + */ +StateModifier.prototype.getAlign = function getAlign() { + return this._hasAlign ? this._alignState.get() : null; +}; + +/** + * Get the current state of the size component. + * + * @method getSize + * @return {Object} size provider object + */ +StateModifier.prototype.getSize = function getSize() { + return this._hasSize ? this._sizeState.get() : null; +}; + +/** + * Get the current state of the propportions component. + * + * @method getProportions + * @return {Object} size provider object + */ +StateModifier.prototype.getProportions = function getProportions() { + return this._hasProportions ? this._proportionsState.get() : null; +}; + +/** + * Return render spec for this StateModifier, applying to the provided + * target component. This is similar to render() for Surfaces. + * + * @private + * @method modify + * + * @param {Object} target (already rendered) render spec to + * which to apply the transform. + * @return {Object} render spec for this StateModifier, including the + * provided target + */ +StateModifier.prototype.modify = function modify(target) { + return this._modifier.modify(target); +}; + +module.exports = StateModifier; +},{"../core/Modifier":9,"../core/Transform":15,"../transitions/Transitionable":89,"../transitions/TransitionableTransform":90}],48:[function(_dereq_,module,exports){ +module.exports = { + Draggable: _dereq_('./Draggable'), + Fader: _dereq_('./Fader'), + ModifierChain: _dereq_('./ModifierChain'), + StateModifier: _dereq_('./StateModifier') +}; + +},{"./Draggable":44,"./Fader":45,"./ModifierChain":46,"./StateModifier":47}],49:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ +var EventHandler = _dereq_('../core/EventHandler'); + +/** + * The Physics Engine is responsible for mediating bodies with their + * interaction with forces and constraints (agents). Specifically, it + * is responsible for: + * + * - adding and removing bodies + * - updating a body's state over time + * - attaching and detaching agents + * - sleeping upon equillibrium and waking upon excitation + * + * @class PhysicsEngine + * @constructor + * @param options {Object} options + */ +function PhysicsEngine(options) { + this.options = Object.create(PhysicsEngine.DEFAULT_OPTIONS); + if (options) this.setOptions(options); + + this._particles = []; //list of managed particles + this._bodies = []; //list of managed bodies + this._agentData = {}; //hash of managed agent data + this._forces = []; //list of Ids of agents that are forces + this._constraints = []; //list of Ids of agents that are constraints + + this._buffer = 0.0; + this._prevTime = now(); + this._isSleeping = false; + this._eventHandler = null; + this._currAgentId = 0; + this._hasBodies = false; + this._eventHandler = null; +} + +/** const */ +var TIMESTEP = 17; +var MIN_TIME_STEP = 1000 / 120; +var MAX_TIME_STEP = 17; + +var now = Date.now; + +// Catalogue of outputted events +var _events = { + start : 'start', + update : 'update', + end : 'end' +}; + +/** + * @property PhysicsEngine.DEFAULT_OPTIONS + * @type Object + * @protected + * @static + */ +PhysicsEngine.DEFAULT_OPTIONS = { + + /** + * The number of iterations the engine takes to resolve constraints + * @attribute constraintSteps + * @type Number + */ + constraintSteps : 1, + + /** + * The energy threshold required for the Physics Engine to update + * @attribute sleepTolerance + * @type Number + */ + sleepTolerance : 1e-7, + + /** + * The maximum velocity magnitude of a physics body + * Range : [0, Infinity] + * @attribute velocityCap + * @type Number + */ + velocityCap : undefined, + + /** + * The maximum angular velocity magnitude of a physics body + * Range : [0, Infinity] + * @attribute angularVelocityCap + * @type Number + */ + angularVelocityCap : undefined +}; + +/** + * Options setter + * + * @method setOptions + * @param opts {Object} + */ +PhysicsEngine.prototype.setOptions = function setOptions(opts) { + for (var key in opts) if (this.options[key]) this.options[key] = opts[key]; +}; + +/** + * Method to add a physics body to the engine. Necessary to update the + * body over time. + * + * @method addBody + * @param body {Body} + * @return body {Body} + */ +PhysicsEngine.prototype.addBody = function addBody(body) { + body._engine = this; + if (body.isBody) { + this._bodies.push(body); + this._hasBodies = true; + } + else this._particles.push(body); + body.on('start', this.wake.bind(this)); + return body; +}; + +/** + * Remove a body from the engine. Detaches body from all forces and + * constraints. + * + * TODO: Fix for in loop + * + * @method removeBody + * @param body {Body} + */ +PhysicsEngine.prototype.removeBody = function removeBody(body) { + var array = (body.isBody) ? this._bodies : this._particles; + var index = array.indexOf(body); + if (index > -1) { + for (var agentKey in this._agentData) { + if (this._agentData.hasOwnProperty(agentKey)) { + this.detachFrom(this._agentData[agentKey].id, body); + } + } + array.splice(index,1); + } + if (this.getBodies().length === 0) this._hasBodies = false; +}; + +function _mapAgentArray(agent) { + if (agent.applyForce) return this._forces; + if (agent.applyConstraint) return this._constraints; +} + +function _attachOne(agent, targets, source) { + if (targets === undefined) targets = this.getParticlesAndBodies(); + if (!(targets instanceof Array)) targets = [targets]; + + agent.on('change', this.wake.bind(this)); + + this._agentData[this._currAgentId] = { + agent : agent, + id : this._currAgentId, + targets : targets, + source : source + }; + + _mapAgentArray.call(this, agent).push(this._currAgentId); + return this._currAgentId++; +} + +/** + * Attaches a force or constraint to a Body. Returns an AgentId of the + * attached agent which can be used to detach the agent. + * + * @method attach + * @param agents {Agent|Array.Agent} A force, constraint, or array of them. + * @param [targets=All] {Body|Array.Body} The Body or Bodies affected by the agent + * @param [source] {Body} The source of the agent + * @return AgentId {Number} + */ +PhysicsEngine.prototype.attach = function attach(agents, targets, source) { + this.wake(); + + if (agents instanceof Array) { + var agentIDs = []; + for (var i = 0; i < agents.length; i++) + agentIDs[i] = _attachOne.call(this, agents[i], targets, source); + return agentIDs; + } + else return _attachOne.call(this, agents, targets, source); +}; + +/** + * Append a body to the targets of a previously defined physics agent. + * + * @method attachTo + * @param agentID {AgentId} The agentId of a previously defined agent + * @param target {Body} The Body affected by the agent + */ +PhysicsEngine.prototype.attachTo = function attachTo(agentID, target) { + _getAgentData.call(this, agentID).targets.push(target); +}; + +/** + * Undoes PhysicsEngine.attach. Removes an agent and its associated + * effect on its affected Bodies. + * + * @method detach + * @param id {AgentId} The agentId of a previously defined agent + */ +PhysicsEngine.prototype.detach = function detach(id) { + // detach from forces/constraints array + var agent = this.getAgent(id); + var agentArray = _mapAgentArray.call(this, agent); + var index = agentArray.indexOf(id); + agentArray.splice(index,1); + + // detach agents array + delete this._agentData[id]; +}; + +/** + * Remove a single Body from a previously defined agent. + * + * @method detach + * @param id {AgentId} The agentId of a previously defined agent + * @param target {Body} The body to remove from the agent + */ +PhysicsEngine.prototype.detachFrom = function detachFrom(id, target) { + var boundAgent = _getAgentData.call(this, id); + if (boundAgent.source === target) this.detach(id); + else { + var targets = boundAgent.targets; + var index = targets.indexOf(target); + if (index > -1) targets.splice(index,1); + } +}; + +/** + * A convenience method to give the Physics Engine a clean slate of + * agents. Preserves all added Body objects. + * + * @method detachAll + */ +PhysicsEngine.prototype.detachAll = function detachAll() { + this._agentData = {}; + this._forces = []; + this._constraints = []; + this._currAgentId = 0; +}; + +function _getAgentData(id) { + return this._agentData[id]; +} + +/** + * Returns the corresponding agent given its agentId. + * + * @method getAgent + * @param id {AgentId} + */ +PhysicsEngine.prototype.getAgent = function getAgent(id) { + return _getAgentData.call(this, id).agent; +}; + +/** + * Returns all particles that are currently managed by the Physics Engine. + * + * @method getParticles + * @return particles {Array.Particles} + */ +PhysicsEngine.prototype.getParticles = function getParticles() { + return this._particles; +}; + +/** + * Returns all bodies, except particles, that are currently managed by the Physics Engine. + * + * @method getBodies + * @return bodies {Array.Bodies} + */ +PhysicsEngine.prototype.getBodies = function getBodies() { + return this._bodies; +}; + +/** + * Returns all bodies that are currently managed by the Physics Engine. + * + * @method getBodies + * @return bodies {Array.Bodies} + */ +PhysicsEngine.prototype.getParticlesAndBodies = function getParticlesAndBodies() { + return this.getParticles().concat(this.getBodies()); +}; + +/** + * Iterates over every Particle and applies a function whose first + * argument is the Particle + * + * @method forEachParticle + * @param fn {Function} Function to iterate over + * @param [dt] {Number} Delta time + */ +PhysicsEngine.prototype.forEachParticle = function forEachParticle(fn, dt) { + var particles = this.getParticles(); + for (var index = 0, len = particles.length; index < len; index++) + fn.call(this, particles[index], dt); +}; + +/** + * Iterates over every Body that isn't a Particle and applies + * a function whose first argument is the Body + * + * @method forEachBody + * @param fn {Function} Function to iterate over + * @param [dt] {Number} Delta time + */ +PhysicsEngine.prototype.forEachBody = function forEachBody(fn, dt) { + if (!this._hasBodies) return; + var bodies = this.getBodies(); + for (var index = 0, len = bodies.length; index < len; index++) + fn.call(this, bodies[index], dt); +}; + +/** + * Iterates over every Body and applies a function whose first + * argument is the Body + * + * @method forEach + * @param fn {Function} Function to iterate over + * @param [dt] {Number} Delta time + */ +PhysicsEngine.prototype.forEach = function forEach(fn, dt) { + this.forEachParticle(fn, dt); + this.forEachBody(fn, dt); +}; + +function _updateForce(index) { + var boundAgent = _getAgentData.call(this, this._forces[index]); + boundAgent.agent.applyForce(boundAgent.targets, boundAgent.source); +} + +function _updateForces() { + for (var index = this._forces.length - 1; index > -1; index--) + _updateForce.call(this, index); +} + +function _updateConstraint(index, dt) { + var boundAgent = this._agentData[this._constraints[index]]; + return boundAgent.agent.applyConstraint(boundAgent.targets, boundAgent.source, dt); +} + +function _updateConstraints(dt) { + var iteration = 0; + while (iteration < this.options.constraintSteps) { + for (var index = this._constraints.length - 1; index > -1; index--) + _updateConstraint.call(this, index, dt); + iteration++; + } +} + +function _updateVelocities(body, dt) { + body.integrateVelocity(dt); + if (this.options.velocityCap) + body.velocity.cap(this.options.velocityCap).put(body.velocity); +} + +function _updateAngularVelocities(body, dt) { + body.integrateAngularMomentum(dt); + body.updateAngularVelocity(); + if (this.options.angularVelocityCap) + body.angularVelocity.cap(this.options.angularVelocityCap).put(body.angularVelocity); +} + +function _updateOrientations(body, dt) { + body.integrateOrientation(dt); +} + +function _updatePositions(body, dt) { + body.integratePosition(dt); + body.emit(_events.update, body); +} + +function _integrate(dt) { + _updateForces.call(this, dt); + this.forEach(_updateVelocities, dt); + this.forEachBody(_updateAngularVelocities, dt); + _updateConstraints.call(this, dt); + this.forEachBody(_updateOrientations, dt); + this.forEach(_updatePositions, dt); +} + +function _getParticlesEnergy() { + var energy = 0.0; + var particleEnergy = 0.0; + this.forEach(function(particle) { + particleEnergy = particle.getEnergy(); + energy += particleEnergy; + }); + return energy; +} + +function _getAgentsEnergy() { + var energy = 0; + for (var id in this._agentData) + energy += this.getAgentEnergy(id); + return energy; +} + +/** + * Calculates the potential energy of an agent, like a spring, by its Id + * + * @method getAgentEnergy + * @param agentId {Number} The attached agent Id + * @return energy {Number} + */ +PhysicsEngine.prototype.getAgentEnergy = function(agentId) { + var agentData = _getAgentData.call(this, agentId); + return agentData.agent.getEnergy(agentData.targets, agentData.source); +}; + +/** + * Calculates the kinetic energy of all Body objects and potential energy + * of all attached agents. + * + * TODO: implement. + * @method getEnergy + * @return energy {Number} + */ +PhysicsEngine.prototype.getEnergy = function getEnergy() { + return _getParticlesEnergy.call(this) + _getAgentsEnergy.call(this); +}; + +/** + * Updates all Body objects managed by the physics engine over the + * time duration since the last time step was called. + * + * @method step + */ +PhysicsEngine.prototype.step = function step() { + if (this.isSleeping()) return; + + //set current frame's time + var currTime = now(); + + //milliseconds elapsed since last frame + var dtFrame = currTime - this._prevTime; + + this._prevTime = currTime; + + if (dtFrame < MIN_TIME_STEP) return; + if (dtFrame > MAX_TIME_STEP) dtFrame = MAX_TIME_STEP; + + //robust integration +// this._buffer += dtFrame; +// while (this._buffer > this._timestep){ +// _integrate.call(this, this._timestep); +// this._buffer -= this._timestep; +// }; +// _integrate.call(this, this._buffer); +// this._buffer = 0.0; + + _integrate.call(this, TIMESTEP); + + this.emit(_events.update, this); + + if (this.getEnergy() < this.options.sleepTolerance) this.sleep(); +}; + +/** + * Tells whether the Physics Engine is sleeping or awake. + * + * @method isSleeping + * @return {Boolean} + */ +PhysicsEngine.prototype.isSleeping = function isSleeping() { + return this._isSleeping; +}; + +/** + * Tells whether the Physics Engine is sleeping or awake. + * + * @method isActive + * @return {Boolean} + */ +PhysicsEngine.prototype.isActive = function isSleeping() { + return !this._isSleeping; +}; + +/** + * Stops the Physics Engine update loop. Emits an 'end' event. + * + * @method sleep + */ +PhysicsEngine.prototype.sleep = function sleep() { + if (this._isSleeping) return; + this.forEach(function(body) { + body.sleep(); + }); + this.emit(_events.end, this); + this._isSleeping = true; +}; + +/** + * Restarts the Physics Engine update loop. Emits an 'start' event. + * + * @method wake + */ +PhysicsEngine.prototype.wake = function wake() { + if (!this._isSleeping) return; + this._prevTime = now(); + this.emit(_events.start, this); + this._isSleeping = false; +}; + +PhysicsEngine.prototype.emit = function emit(type, data) { + if (this._eventHandler === null) return; + this._eventHandler.emit(type, data); +}; + +PhysicsEngine.prototype.on = function on(event, fn) { + if (this._eventHandler === null) this._eventHandler = new EventHandler(); + this._eventHandler.on(event, fn); +}; + +module.exports = PhysicsEngine; +},{"../core/EventHandler":7}],50:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Particle = _dereq_('./Particle'); +var Transform = _dereq_('../../core/Transform'); +var Vector = _dereq_('../../math/Vector'); +var Quaternion = _dereq_('../../math/Quaternion'); +var Matrix = _dereq_('../../math/Matrix'); +var Integrator = _dereq_('../integrators/SymplecticEuler'); + +/** + * A unit controlled by the physics engine which extends the zero-dimensional + * Particle to include geometry. In addition to maintaining the state + * of a Particle its state includes orientation, angular velocity + * and angular momentum and responds to torque forces. + * + * @class Body + * @extends Particle + * @constructor + */ +function Body(options) { + Particle.call(this, options); + options = options || {}; + + this.orientation = new Quaternion(); + this.angularVelocity = new Vector(); + this.angularMomentum = new Vector(); + this.torque = new Vector(); + + if (options.orientation) this.orientation.set(options.orientation); + if (options.angularVelocity) this.angularVelocity.set(options.angularVelocity); + if (options.angularMomentum) this.angularMomentum.set(options.angularMomentum); + if (options.torque) this.torque.set(options.torque); + + this.angularVelocity.w = 0; //quaternify the angular velocity + this.setMomentsOfInertia(); + + // registers + this.pWorld = new Vector(); //placeholder for world space position +} + +Body.DEFAULT_OPTIONS = Particle.DEFAULT_OPTIONS; +Body.DEFAULT_OPTIONS.orientation = [0, 0, 0, 1]; +Body.DEFAULT_OPTIONS.angularVelocity = [0, 0, 0]; + +Body.prototype = Object.create(Particle.prototype); +Body.prototype.constructor = Body; + +Body.prototype.isBody = true; + +Body.prototype.setMass = function setMass() { + Particle.prototype.setMass.apply(this, arguments); + this.setMomentsOfInertia(); +}; + +/** + * Setter for moment of inertia, which is necessary to give proper + * angular inertia depending on the geometry of the body. + * + * @method setMomentsOfInertia + */ +Body.prototype.setMomentsOfInertia = function setMomentsOfInertia() { + this.inertia = new Matrix(); + this.inverseInertia = new Matrix(); +}; + +/** + * Update the angular velocity from the angular momentum state. + * + * @method updateAngularVelocity + */ +Body.prototype.updateAngularVelocity = function updateAngularVelocity() { + this.angularVelocity.set(this.inverseInertia.vectorMultiply(this.angularMomentum)); +}; + +/** + * Determine world coordinates from the local coordinate system. Useful + * if the Body has rotated in space. + * + * @method toWorldCoordinates + * @param localPosition {Vector} local coordinate vector + * @return global coordinate vector {Vector} + */ +Body.prototype.toWorldCoordinates = function toWorldCoordinates(localPosition) { + return this.pWorld.set(this.orientation.rotateVector(localPosition)); +}; + +/** + * Calculates the kinetic and intertial energy of a body. + * + * @method getEnergy + * @return energy {Number} + */ +Body.prototype.getEnergy = function getEnergy() { + return Particle.prototype.getEnergy.call(this) + + 0.5 * this.inertia.vectorMultiply(this.angularVelocity).dot(this.angularVelocity); +}; + +/** + * Extends Particle.reset to reset orientation, angular velocity + * and angular momentum. + * + * @method reset + * @param [p] {Array|Vector} position + * @param [v] {Array|Vector} velocity + * @param [q] {Array|Quaternion} orientation + * @param [L] {Array|Vector} angular momentum + */ +Body.prototype.reset = function reset(p, v, q, L) { + Particle.prototype.reset.call(this, p, v); + this.angularVelocity.clear(); + this.setOrientation(q || [1,0,0,0]); + this.setAngularMomentum(L || [0,0,0]); +}; + +/** + * Setter for orientation + * + * @method setOrientation + * @param q {Array|Quaternion} orientation + */ +Body.prototype.setOrientation = function setOrientation(q) { + this.orientation.set(q); +}; + +/** + * Setter for angular velocity + * + * @method setAngularVelocity + * @param w {Array|Vector} angular velocity + */ +Body.prototype.setAngularVelocity = function setAngularVelocity(w) { + this.wake(); + this.angularVelocity.set(w); +}; + +/** + * Setter for angular momentum + * + * @method setAngularMomentum + * @param L {Array|Vector} angular momentum + */ +Body.prototype.setAngularMomentum = function setAngularMomentum(L) { + this.wake(); + this.angularMomentum.set(L); +}; + +/** + * Extends Particle.applyForce with an optional argument + * to apply the force at an off-centered location, resulting in a torque. + * + * @method applyForce + * @param force {Vector} force + * @param [location] {Vector} off-center location on the body + */ +Body.prototype.applyForce = function applyForce(force, location) { + Particle.prototype.applyForce.call(this, force); + if (location !== undefined) this.applyTorque(location.cross(force)); +}; + +/** + * Applied a torque force to a body, inducing a rotation. + * + * @method applyTorque + * @param torque {Vector} torque + */ +Body.prototype.applyTorque = function applyTorque(torque) { + this.wake(); + this.torque.set(this.torque.add(torque)); +}; + +/** + * Extends Particle.getTransform to include a rotational component + * derived from the particle's orientation. + * + * @method getTransform + * @return transform {Transform} + */ +Body.prototype.getTransform = function getTransform() { + return Transform.thenMove( + this.orientation.getTransform(), + Transform.getTranslate(Particle.prototype.getTransform.call(this)) + ); +}; + +/** + * Extends Particle._integrate to also update the rotational states + * of the body. + * + * @method getTransform + * @protected + * @param dt {Number} delta time + */ +Body.prototype._integrate = function _integrate(dt) { + Particle.prototype._integrate.call(this, dt); + this.integrateAngularMomentum(dt); + this.updateAngularVelocity(dt); + this.integrateOrientation(dt); +}; + +/** + * Updates the angular momentum via the its integrator. + * + * @method integrateAngularMomentum + * @param dt {Number} delta time + */ +Body.prototype.integrateAngularMomentum = function integrateAngularMomentum(dt) { + Integrator.integrateAngularMomentum(this, dt); +}; + +/** + * Updates the orientation via the its integrator. + * + * @method integrateOrientation + * @param dt {Number} delta time + */ +Body.prototype.integrateOrientation = function integrateOrientation(dt) { + Integrator.integrateOrientation(this, dt); +}; + +module.exports = Body; +},{"../../core/Transform":15,"../../math/Matrix":38,"../../math/Quaternion":39,"../../math/Vector":42,"../integrators/SymplecticEuler":73,"./Particle":52}],51:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Body = _dereq_('./Body'); +var Matrix = _dereq_('../../math/Matrix'); + +/** + * Implements a circle, or spherical, geometry for a Body with + * radius. + * + * @class Circle + * @extends Body + * @constructor + */ +function Circle(options) { + options = options || {}; + this.setRadius(options.radius || 0); + Body.call(this, options); +} + +Circle.prototype = Object.create(Body.prototype); +Circle.prototype.constructor = Circle; + +/** + * Basic setter for radius. + * @method setRadius + * @param r {Number} radius + */ +Circle.prototype.setRadius = function setRadius(r) { + this.radius = r; + this.size = [2*this.radius, 2*this.radius]; + this.setMomentsOfInertia(); +}; + +Circle.prototype.setMomentsOfInertia = function setMomentsOfInertia() { + var m = this.mass; + var r = this.radius; + + this.inertia = new Matrix([ + [0.25 * m * r * r, 0, 0], + [0, 0.25 * m * r * r, 0], + [0, 0, 0.5 * m * r * r] + ]); + + this.inverseInertia = new Matrix([ + [4 / (m * r * r), 0, 0], + [0, 4 / (m * r * r), 0], + [0, 0, 2 / (m * r * r)] + ]); +}; + +module.exports = Circle; +},{"../../math/Matrix":38,"./Body":50}],52:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Vector = _dereq_('../../math/Vector'); +var Transform = _dereq_('../../core/Transform'); +var EventHandler = _dereq_('../../core/EventHandler'); +var Integrator = _dereq_('../integrators/SymplecticEuler'); + +/** + * A point body that is controlled by the Physics Engine. A particle has + * position and velocity states that are updated by the Physics Engine. + * Ultimately, a particle is a special type of modifier, and can be added to + * the Famo.us Scene Graph like any other modifier. + * + * @class Particle + * @uses EventHandler + * @extensionfor Body + * + * @param [options] {Options} An object of configurable options. + * @param [options.position] {Array} The position of the particle. + * @param [options.velocity] {Array} The velocity of the particle. + * @param [options.mass] {Number} The mass of the particle. + */ + function Particle(options) { + options = options || {}; + var defaults = Particle.DEFAULT_OPTIONS; + + // registers + this.position = new Vector(); + this.velocity = new Vector(); + this.force = new Vector(); + + // state variables + this._engine = null; + this._isSleeping = true; + this._eventOutput = null; + + // set scalars + this.mass = (options.mass !== undefined) + ? options.mass + : defaults.mass; + + this.inverseMass = 1 / this.mass; + + // set vectors + this.setPosition(options.position || defaults.position); + this.setVelocity(options.velocity || defaults.velocity); + this.force.set(options.force || [0,0,0]); + + this.transform = Transform.identity.slice(); + + // cached _spec + this._spec = { + size : [true, true], + target : { + transform : this.transform, + origin : [0.5, 0.5], + target : null + } + }; +} + +Particle.DEFAULT_OPTIONS = { + position : [0, 0, 0], + velocity : [0, 0, 0], + mass : 1 +}; + +//Catalogue of outputted events +var _events = { + start : 'start', + update : 'update', + end : 'end' +}; + +// Cached timing function +var now = Date.now; + +/** + * @attribute isBody + * @type Boolean + * @static + */ +Particle.prototype.isBody = false; + +/** + * Determines if particle is active + * + * @method isActive + * @return {Boolean} + */ +Particle.prototype.isActive = function isActive() { + return !this._isSleeping; +}; + +/** + * Stops the particle from updating + * + * @method sleep + */ +Particle.prototype.sleep = function sleep() { + if (this._isSleeping) return; + this.emit(_events.end, this); + this._isSleeping = true; +}; + +/** + * Starts the particle update + * + * @method wake + */ +Particle.prototype.wake = function wake() { + if (!this._isSleeping) return; + this.emit(_events.start, this); + this._isSleeping = false; + this._prevTime = now(); + if (this._engine) this._engine.wake(); +}; + +/** + * Basic setter for position + * + * @method setPosition + * @param position {Array|Vector} + */ +Particle.prototype.setPosition = function setPosition(position) { + this.position.set(position); +}; + +/** + * 1-dimensional setter for position + * + * @method setPosition1D + * @param x {Number} + */ +Particle.prototype.setPosition1D = function setPosition1D(x) { + this.position.x = x; +}; + +/** + * Basic getter function for position + * + * @method getPosition + * @return position {Array} + */ +Particle.prototype.getPosition = function getPosition() { + this._engine.step(); + return this.position.get(); +}; + +/** + * 1-dimensional getter for position + * + * @method getPosition1D + * @return value {Number} + */ +Particle.prototype.getPosition1D = function getPosition1D() { + this._engine.step(); + return this.position.x; +}; + +/** + * Basic setter function for velocity Vector + * + * @method setVelocity + * @function + */ +Particle.prototype.setVelocity = function setVelocity(velocity) { + this.velocity.set(velocity); + if (!(velocity[0] === 0 && velocity[1] === 0 && velocity[2] === 0)) + this.wake(); +}; + +/** + * 1-dimensional setter for velocity + * + * @method setVelocity1D + * @param x {Number} + */ +Particle.prototype.setVelocity1D = function setVelocity1D(x) { + this.velocity.x = x; + if (x !== 0) this.wake(); +}; + +/** + * Basic getter function for velocity Vector + * + * @method getVelocity + * @return velocity {Array} + */ +Particle.prototype.getVelocity = function getVelocity() { + return this.velocity.get(); +}; + +/** + * Basic setter function for force Vector + * + * @method setForce + * @return force {Array} + */ +Particle.prototype.setForce = function setForce(force) { + this.force.set(force); + this.wake(); +}; + +/** + * 1-dimensional getter for velocity + * + * @method getVelocity1D + * @return velocity {Number} + */ +Particle.prototype.getVelocity1D = function getVelocity1D() { + return this.velocity.x; +}; + +/** + * Basic setter function for mass quantity + * + * @method setMass + * @param mass {Number} mass + */ +Particle.prototype.setMass = function setMass(mass) { + this.mass = mass; + this.inverseMass = 1 / mass; +}; + +/** + * Basic getter function for mass quantity + * + * @method getMass + * @return mass {Number} + */ +Particle.prototype.getMass = function getMass() { + return this.mass; +}; + +/** + * Reset position and velocity + * + * @method reset + * @param position {Array|Vector} + * @param velocity {Array|Vector} + */ +Particle.prototype.reset = function reset(position, velocity) { + this.setPosition(position || [0,0,0]); + this.setVelocity(velocity || [0,0,0]); +}; + +/** + * Add force vector to existing internal force Vector + * + * @method applyForce + * @param force {Vector} + */ +Particle.prototype.applyForce = function applyForce(force) { + if (force.isZero()) return; + this.force.add(force).put(this.force); + this.wake(); +}; + +/** + * Add impulse (change in velocity) Vector to this Vector's velocity. + * + * @method applyImpulse + * @param impulse {Vector} + */ +Particle.prototype.applyImpulse = function applyImpulse(impulse) { + if (impulse.isZero()) return; + var velocity = this.velocity; + velocity.add(impulse.mult(this.inverseMass)).put(velocity); +}; + +/** + * Update a particle's velocity from its force accumulator + * + * @method integrateVelocity + * @param dt {Number} Time differential + */ +Particle.prototype.integrateVelocity = function integrateVelocity(dt) { + Integrator.integrateVelocity(this, dt); +}; + +/** + * Update a particle's position from its velocity + * + * @method integratePosition + * @param dt {Number} Time differential + */ +Particle.prototype.integratePosition = function integratePosition(dt) { + Integrator.integratePosition(this, dt); +}; + +/** + * Update the position and velocity of the particle + * + * @method _integrate + * @protected + * @param dt {Number} Time differential + */ +Particle.prototype._integrate = function _integrate(dt) { + this.integrateVelocity(dt); + this.integratePosition(dt); +}; + +/** + * Get kinetic energy of the particle. + * + * @method getEnergy + * @function + */ +Particle.prototype.getEnergy = function getEnergy() { + return 0.5 * this.mass * this.velocity.normSquared(); +}; + +/** + * Generate transform from the current position state + * + * @method getTransform + * @return Transform {Transform} + */ +Particle.prototype.getTransform = function getTransform() { + this._engine.step(); + + var position = this.position; + var transform = this.transform; + + transform[12] = position.x; + transform[13] = position.y; + transform[14] = position.z; + return transform; +}; + +/** + * The modify interface of a Modifier + * + * @method modify + * @param target {Spec} + * @return Spec {Spec} + */ +Particle.prototype.modify = function modify(target) { + var _spec = this._spec.target; + _spec.transform = this.getTransform(); + _spec.target = target; + return this._spec; +}; + +// private +function _createEventOutput() { + this._eventOutput = new EventHandler(); + this._eventOutput.bindThis(this); + EventHandler.setOutputHandler(this, this._eventOutput); +} + +Particle.prototype.emit = function emit(type, data) { + if (!this._eventOutput) return; + this._eventOutput.emit(type, data); +}; + +Particle.prototype.on = function on() { + _createEventOutput.call(this); + return this.on.apply(this, arguments); +}; + +Particle.prototype.removeListener = function removeListener() { + _createEventOutput.call(this); + return this.removeListener.apply(this, arguments); +}; + +Particle.prototype.pipe = function pipe() { + _createEventOutput.call(this); + return this.pipe.apply(this, arguments); +}; + +Particle.prototype.unpipe = function unpipe() { + _createEventOutput.call(this); + return this.unpipe.apply(this, arguments); +}; + +module.exports = Particle; +},{"../../core/EventHandler":7,"../../core/Transform":15,"../../math/Vector":42,"../integrators/SymplecticEuler":73}],53:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Body = _dereq_('./Body'); +var Matrix = _dereq_('../../math/Matrix'); + +/** + * Implements a rectangular geometry for an Body with + * size = [width, height]. + * + * @class Rectangle + * @extends Body + * @constructor + */ +function Rectangle(options) { + options = options || {}; + this.size = options.size || [0,0]; + Body.call(this, options); +} + +Rectangle.prototype = Object.create(Body.prototype); +Rectangle.prototype.constructor = Rectangle; + +/** + * Basic setter for size. + * @method setSize + * @param size {Array} size = [width, height] + */ +Rectangle.prototype.setSize = function setSize(size) { + this.size = size; + this.setMomentsOfInertia(); +}; + +Rectangle.prototype.setMomentsOfInertia = function setMomentsOfInertia() { + var m = this.mass; + var w = this.size[0]; + var h = this.size[1]; + + this.inertia = new Matrix([ + [m * h * h / 12, 0, 0], + [0, m * w * w / 12, 0], + [0, 0, m * (w * w + h * h) / 12] + ]); + + this.inverseInertia = new Matrix([ + [12 / (m * h * h), 0, 0], + [0, 12 / (m * w * w), 0], + [0, 0, 12 / (m * (w * w + h * h))] + ]); +}; + +module.exports = Rectangle; +},{"../../math/Matrix":38,"./Body":50}],54:[function(_dereq_,module,exports){ +module.exports = { + Body: _dereq_('./Body'), + Circle: _dereq_('./Circle'), + Particle: _dereq_('./Particle'), + Rectangle: _dereq_('./Rectangle') +}; + +},{"./Body":50,"./Circle":51,"./Particle":52,"./Rectangle":53}],55:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Constraint = _dereq_('./Constraint'); +var Vector = _dereq_('../../math/Vector'); + +/** + * Allows for two circular bodies to collide and bounce off each other. + * + * @class Collision + * @constructor + * @extends Constraint + * @param {Options} [options] An object of configurable options. + * @param {Number} [options.restitution] The energy ratio lost in a collision (0 = stick, 1 = elastic) Range : [0, 1] + * @param {Number} [options.drift] Baumgarte stabilization parameter. Makes constraints "loosely" (0) or "tightly" (1) enforced. Range : [0, 1] + * @param {Number} [options.slop] Amount of penetration in pixels to ignore before collision event triggers + * + */ +function Collision(options) { + this.options = Object.create(Collision.DEFAULT_OPTIONS); + if (options) this.setOptions(options); + + //registers + this.normal = new Vector(); + this.pDiff = new Vector(); + this.vDiff = new Vector(); + this.impulse1 = new Vector(); + this.impulse2 = new Vector(); + + Constraint.call(this); +} + +Collision.prototype = Object.create(Constraint.prototype); +Collision.prototype.constructor = Collision; + +Collision.DEFAULT_OPTIONS = { + restitution : 0.5, + drift : 0.5, + slop : 0 +}; + +function _normalVelocity(particle1, particle2) { + return particle1.velocity.dot(particle2.velocity); +} + +/* + * Setter for options. + * + * @method setOptions + * @param options {Objects} + */ +Collision.prototype.setOptions = function setOptions(options) { + for (var key in options) this.options[key] = options[key]; +}; + +/** + * Adds an impulse to a physics body's velocity due to the constraint + * + * @method applyConstraint + * @param targets {Array.Body} Array of bodies to apply the constraint to + * @param source {Body} The source of the constraint + * @param dt {Number} Delta time + */ +Collision.prototype.applyConstraint = function applyConstraint(targets, source, dt) { + if (source === undefined) return; + + var v1 = source.velocity; + var p1 = source.position; + var w1 = source.inverseMass; + var r1 = source.radius; + + var options = this.options; + var drift = options.drift; + var slop = -options.slop; + var restitution = options.restitution; + + var n = this.normal; + var pDiff = this.pDiff; + var vDiff = this.vDiff; + var impulse1 = this.impulse1; + var impulse2 = this.impulse2; + + for (var i = 0; i < targets.length; i++) { + var target = targets[i]; + + if (target === source) continue; + + var v2 = target.velocity; + var p2 = target.position; + var w2 = target.inverseMass; + var r2 = target.radius; + + pDiff.set(p2.sub(p1)); + vDiff.set(v2.sub(v1)); + + var dist = pDiff.norm(); + var overlap = dist - (r1 + r2); + var effMass = 1/(w1 + w2); + var gamma = 0; + + if (overlap < 0) { + + n.set(pDiff.normalize()); + + if (this._eventOutput) { + var collisionData = { + target : target, + source : source, + overlap : overlap, + normal : n + }; + + this._eventOutput.emit('preCollision', collisionData); + this._eventOutput.emit('collision', collisionData); + } + + var lambda = (overlap <= slop) + ? ((1 + restitution) * n.dot(vDiff) + drift/dt * (overlap - slop)) / (gamma + dt/effMass) + : ((1 + restitution) * n.dot(vDiff)) / (gamma + dt/effMass); + + n.mult(dt*lambda).put(impulse1); + impulse1.mult(-1).put(impulse2); + + source.applyImpulse(impulse1); + target.applyImpulse(impulse2); + + //source.setPosition(p1.add(n.mult(overlap/2))); + //target.setPosition(p2.sub(n.mult(overlap/2))); + + if (this._eventOutput) this._eventOutput.emit('postCollision', collisionData); + + } + } +}; + +module.exports = Collision; +},{"../../math/Vector":42,"./Constraint":56}],56:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var EventHandler = _dereq_('../../core/EventHandler'); + +/** + * Allows for two circular bodies to collide and bounce off each other. + * + * @class Constraint + * @constructor + * @uses EventHandler + * @param options {Object} + */ +function Constraint() { + this.options = this.options || {}; + this._eventOutput = new EventHandler(); + EventHandler.setOutputHandler(this, this._eventOutput); +} + +/* + * Setter for options. + * + * @method setOptions + * @param options {Objects} + */ +Constraint.prototype.setOptions = function setOptions(options) { + this._eventOutput.emit('change', options); +}; + +/** + * Adds an impulse to a physics body's velocity due to the constraint + * + * @method applyConstraint + */ +Constraint.prototype.applyConstraint = function applyConstraint() {}; + +/** + * Getter for energy + * + * @method getEnergy + * @return energy {Number} + */ +Constraint.prototype.getEnergy = function getEnergy() { + return 0.0; +}; + +module.exports = Constraint; +},{"../../core/EventHandler":7}],57:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Constraint = _dereq_('./Constraint'); +var Vector = _dereq_('../../math/Vector'); + +/** + * A constraint that keeps a physics body on a given implicit curve + * regardless of other physical forces are applied to it. + * + * A curve constraint is two surface constraints in disguise, as a curve is + * the intersection of two surfaces, and is essentially constrained to both + * + * @class Curve + * @constructor + * @extends Constraint + * @param {Options} [options] An object of configurable options. + * @param {Function} [options.equation] An implicitly defined surface f(x,y,z) = 0 that body is constrained to e.g. function(x,y,z) { x*x + y*y - r*r } corresponds to a circle of radius r pixels + * @param {Function} [options.plane] An implicitly defined second surface that the body is constrained to + * @param {Number} [options.period] The spring-like reaction when the constraint is violated + * @param {Number} [options.number] The damping-like reaction when the constraint is violated + */ +function Curve(options) { + this.options = Object.create(Curve.DEFAULT_OPTIONS); + if (options) this.setOptions(options); + + //registers + this.J = new Vector(); + this.impulse = new Vector(); + + Constraint.call(this); +} + +Curve.prototype = Object.create(Constraint.prototype); +Curve.prototype.constructor = Curve; + +/** @const */ var epsilon = 1e-7; +/** @const */ var pi = Math.PI; + +Curve.DEFAULT_OPTIONS = { + equation : function(x,y,z) { + return 0; + }, + plane : function(x,y,z) { + return z; + }, + period : 0, + dampingRatio : 0 +}; + +/** + * Basic options setter + * + * @method setOptions + * @param options {Objects} + */ +Curve.prototype.setOptions = function setOptions(options) { + for (var key in options) this.options[key] = options[key]; +}; + +/** + * Adds a curve impulse to a physics body. + * + * @method applyConstraint + * @param targets {Array.Body} Array of bodies to apply force to. + * @param source {Body} Not applicable + * @param dt {Number} Delta time + */ +Curve.prototype.applyConstraint = function applyConstraint(targets, source, dt) { + var options = this.options; + var impulse = this.impulse; + var J = this.J; + + var f = options.equation; + var g = options.plane; + var dampingRatio = options.dampingRatio; + var period = options.period; + + for (var i = 0; i < targets.length; i++) { + var body = targets[i]; + + var v = body.velocity; + var p = body.position; + var m = body.mass; + + var gamma; + var beta; + + if (period === 0) { + gamma = 0; + beta = 1; + } + else { + var c = 4 * m * pi * dampingRatio / period; + var k = 4 * m * pi * pi / (period * period); + + gamma = 1 / (c + dt*k); + beta = dt*k / (c + dt*k); + } + + var x = p.x; + var y = p.y; + var z = p.z; + + var f0 = f(x, y, z); + var dfx = (f(x + epsilon, p, p) - f0) / epsilon; + var dfy = (f(x, y + epsilon, p) - f0) / epsilon; + var dfz = (f(x, y, p + epsilon) - f0) / epsilon; + + var g0 = g(x, y, z); + var dgx = (g(x + epsilon, y, z) - g0) / epsilon; + var dgy = (g(x, y + epsilon, z) - g0) / epsilon; + var dgz = (g(x, y, z + epsilon) - g0) / epsilon; + + J.setXYZ(dfx + dgx, dfy + dgy, dfz + dgz); + + var antiDrift = beta/dt * (f0 + g0); + var lambda = -(J.dot(v) + antiDrift) / (gamma + dt * J.normSquared() / m); + + impulse.set(J.mult(dt*lambda)); + body.applyImpulse(impulse); + } +}; + +module.exports = Curve; +},{"../../math/Vector":42,"./Constraint":56}],58:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Constraint = _dereq_('./Constraint'); +var Vector = _dereq_('../../math/Vector'); + +/** + * A constraint that keeps a physics body a given distance away from a given + * anchor, or another attached body. + * + * + * @class Distance + * @constructor + * @extends Constraint + * @param {Options} [options] An object of configurable options. + * @param {Array} [options.anchor] The location of the anchor + * @param {Number} [options.length] The amount of distance from the anchor the constraint should enforce + * @param {Number} [options.minLength] The minimum distance before the constraint is activated. Use this property for a "rope" effect. + * @param {Number} [options.period] The spring-like reaction when the constraint is broken. + * @param {Number} [options.dampingRatio] The damping-like reaction when the constraint is broken. + * + */ +function Distance(options) { + this.options = Object.create(this.constructor.DEFAULT_OPTIONS); + if (options) this.setOptions(options); + + //registers + this.impulse = new Vector(); + this.normal = new Vector(); + this.diffP = new Vector(); + this.diffV = new Vector(); + + Constraint.call(this); +} + +Distance.prototype = Object.create(Constraint.prototype); +Distance.prototype.constructor = Distance; + +Distance.DEFAULT_OPTIONS = { + anchor : null, + length : 0, + minLength : 0, + period : 0, + dampingRatio : 0 +}; + +/** @const */ var pi = Math.PI; + +/** + * Basic options setter + * + * @method setOptions + * @param options {Objects} + */ +Distance.prototype.setOptions = function setOptions(options) { + if (options.anchor) { + if (options.anchor.position instanceof Vector) this.options.anchor = options.anchor.position; + if (options.anchor instanceof Vector) this.options.anchor = options.anchor; + if (options.anchor instanceof Array) this.options.anchor = new Vector(options.anchor); + } + if (options.length !== undefined) this.options.length = options.length; + if (options.dampingRatio !== undefined) this.options.dampingRatio = options.dampingRatio; + if (options.period !== undefined) this.options.period = options.period; + if (options.minLength !== undefined) this.options.minLength = options.minLength; +}; + +function _calcError(impulse, body) { + return body.mass * impulse.norm(); +} + +/** + * Set the anchor position + * + * @method setOptions + * @param anchor {Array} + */ +Distance.prototype.setAnchor = function setAnchor(anchor) { + if (!this.options.anchor) this.options.anchor = new Vector(); + this.options.anchor.set(anchor); +}; + +/** + * Adds an impulse to a physics body's velocity due to the constraint + * + * @method applyConstraint + * @param targets {Array.Body} Array of bodies to apply the constraint to + * @param source {Body} The source of the constraint + * @param dt {Number} Delta time + */ +Distance.prototype.applyConstraint = function applyConstraint(targets, source, dt) { + var n = this.normal; + var diffP = this.diffP; + var diffV = this.diffV; + var impulse = this.impulse; + var options = this.options; + + var dampingRatio = options.dampingRatio; + var period = options.period; + var minLength = options.minLength; + + var p2; + var w2; + + if (source) { + var v2 = source.velocity; + p2 = source.position; + w2 = source.inverseMass; + } + else { + p2 = this.options.anchor; + w2 = 0; + } + + var length = this.options.length; + + for (var i = 0; i < targets.length; i++) { + var body = targets[i]; + + var v1 = body.velocity; + var p1 = body.position; + var w1 = body.inverseMass; + + diffP.set(p1.sub(p2)); + n.set(diffP.normalize()); + + var dist = diffP.norm() - length; + + //rope effect + if (Math.abs(dist) < minLength) return; + + if (source) diffV.set(v1.sub(v2)); + else diffV.set(v1); + + var effMass = 1 / (w1 + w2); + var gamma; + var beta; + + if (period === 0) { + gamma = 0; + beta = 1; + } + else { + var c = 4 * effMass * pi * dampingRatio / period; + var k = 4 * effMass * pi * pi / (period * period); + + gamma = 1 / (c + dt*k); + beta = dt*k / (c + dt*k); + } + + var antiDrift = beta/dt * dist; + var lambda = -(n.dot(diffV) + antiDrift) / (gamma + dt/effMass); + + impulse.set(n.mult(dt*lambda)); + body.applyImpulse(impulse); + + if (source) source.applyImpulse(impulse.mult(-1)); + } +}; + +module.exports = Distance; +},{"../../math/Vector":42,"./Constraint":56}],59:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Constraint = _dereq_('./Constraint'); +var Vector = _dereq_('../../math/Vector'); + +/** + * A spring constraint is like a spring force, except that it is always + * numerically stable (even for low periods), at the expense of introducing + * damping (even with dampingRatio set to 0). + * + * Use this if you need fast spring-like behavior, e.g., snapping + * + * @class Snap + * @constructor + * @extends Constraint + * @param {Options} [options] An object of configurable options. + * @param {Number} [options.period] The amount of time in milliseconds taken for one complete oscillation when there is no damping. Range : [150, Infinity] + * @param {Number} [options.dampingRatio] Additional damping of the spring. Range : [0, 1]. At 0 this spring will still be damped, at 1 the spring will be critically damped (the spring will never oscillate) + * @param {Number} [options.length] The rest length of the spring. Range: [0, Infinity]. + * @param {Array} [options.anchor] The location of the spring's anchor, if not another physics body. + * + */ +function Snap(options) { + Constraint.call(this); + + this.options = Object.create(this.constructor.DEFAULT_OPTIONS); + if (options) this.setOptions(options); + + //registers + this.pDiff = new Vector(); + this.vDiff = new Vector(); + this.impulse1 = new Vector(); + this.impulse2 = new Vector(); +} + +Snap.prototype = Object.create(Constraint.prototype); +Snap.prototype.constructor = Snap; + +Snap.DEFAULT_OPTIONS = { + period : 300, + dampingRatio : 0.1, + length : 0, + anchor : undefined +}; + +/** const */ var pi = Math.PI; + +/** + * Basic options setter + * + * @method setOptions + * @param options {Objects} options + */ +Snap.prototype.setOptions = function setOptions(options) { + if (options.anchor !== undefined) { + if (options.anchor instanceof Vector) this.options.anchor = options.anchor; + if (options.anchor.position instanceof Vector) this.options.anchor = options.anchor.position; + if (options.anchor instanceof Array) this.options.anchor = new Vector(options.anchor); + } + if (options.length !== undefined) this.options.length = options.length; + if (options.dampingRatio !== undefined) this.options.dampingRatio = options.dampingRatio; + if (options.period !== undefined) this.options.period = options.period; + Constraint.prototype.setOptions.call(this, options); +}; + +/** + * Calculates energy of spring + * + * @method getEnergy + * @param targets {Body} target physics body + * @param source {Body} source physics body + * @return energy {Number} + */ +Snap.prototype.getEnergy = function getEnergy(targets, source) { + var options = this.options; + var restLength = options.length; + var anchor = options.anchor || source.position; + var strength = Math.pow(2 * pi / options.period, 2); + + var energy = 0.0; + for (var i = 0; i < targets.length; i++){ + var target = targets[i]; + var dist = anchor.sub(target.position).norm() - restLength; + energy += 0.5 * strength * dist * dist; + } + return energy; +}; + +/** + * Adds a spring impulse to a physics body's velocity due to the constraint + * + * @method applyConstraint + * @param targets {Array.Body} Array of bodies to apply the constraint to + * @param source {Body} The source of the constraint + * @param dt {Number} Delta time + */ +Snap.prototype.applyConstraint = function applyConstraint(targets, source, dt) { + var options = this.options; + var pDiff = this.pDiff; + var vDiff = this.vDiff; + var impulse1 = this.impulse1; + var impulse2 = this.impulse2; + var length = options.length; + var anchor = options.anchor || source.position; + var period = options.period; + var dampingRatio = options.dampingRatio; + + for (var i = 0; i < targets.length ; i++) { + var target = targets[i]; + + var p1 = target.position; + var v1 = target.velocity; + var m1 = target.mass; + var w1 = target.inverseMass; + + pDiff.set(p1.sub(anchor)); + var dist = pDiff.norm() - length; + var effMass; + + if (source) { + var w2 = source.inverseMass; + var v2 = source.velocity; + vDiff.set(v1.sub(v2)); + effMass = 1 / (w1 + w2); + } + else { + vDiff.set(v1); + effMass = m1; + } + + var gamma; + var beta; + + if (this.options.period === 0) { + gamma = 0; + beta = 1; + } + else { + var k = 4 * effMass * pi * pi / (period * period); + var c = 4 * effMass * pi * dampingRatio / period; + + beta = dt * k / (c + dt * k); + gamma = 1 / (c + dt*k); + } + + var antiDrift = beta/dt * dist; + pDiff.normalize(-antiDrift) + .sub(vDiff) + .mult(dt / (gamma + dt/effMass)) + .put(impulse1); + + // var n = new Vector(); + // n.set(pDiff.normalize()); + // var lambda = -(n.dot(vDiff) + antiDrift) / (gamma + dt/effMass); + // impulse2.set(n.mult(dt*lambda)); + + target.applyImpulse(impulse1); + + if (source) { + impulse1.mult(-1).put(impulse2); + source.applyImpulse(impulse2); + } + } +}; + +module.exports = Snap; +},{"../../math/Vector":42,"./Constraint":56}],60:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Constraint = _dereq_('./Constraint'); +var Vector = _dereq_('../../math/Vector'); + +/** + * A constraint that keeps a physics body on a given implicit surface + * regardless of other physical forces are applied to it. + * + * @class Surface + * @constructor + * @extends Constraint + * @param {Options} [options] An object of configurable options. + * @param {Function} [options.equation] An implicitly defined surface f(x,y,z) = 0 that body is constrained to e.g. function(x,y,z) { x*x + y*y + z*z - r*r } corresponds to a sphere of radius r pixels. + * @param {Number} [options.period] The spring-like reaction when the constraint is violated. + * @param {Number} [options.dampingRatio] The damping-like reaction when the constraint is violated. + */ +function Surface(options) { + this.options = Object.create(Surface.DEFAULT_OPTIONS); + if (options) this.setOptions(options); + + this.J = new Vector(); + this.impulse = new Vector(); + + Constraint.call(this); +} + +Surface.prototype = Object.create(Constraint.prototype); +Surface.prototype.constructor = Surface; + +Surface.DEFAULT_OPTIONS = { + equation : undefined, + period : 0, + dampingRatio : 0 +}; + +/** @const */ var epsilon = 1e-7; +/** @const */ var pi = Math.PI; + +/** + * Basic options setter + * + * @method setOptions + * @param options {Objects} + */ +Surface.prototype.setOptions = function setOptions(options) { + for (var key in options) this.options[key] = options[key]; +}; + +/** + * Adds a surface impulse to a physics body. + * + * @method applyConstraint + * @param targets {Array.Body} Array of bodies to apply force to. + * @param source {Body} Not applicable + * @param dt {Number} Delta time + */ +Surface.prototype.applyConstraint = function applyConstraint(targets, source, dt) { + var impulse = this.impulse; + var J = this.J; + var options = this.options; + + var f = options.equation; + var dampingRatio = options.dampingRatio; + var period = options.period; + + for (var i = 0; i < targets.length; i++) { + var particle = targets[i]; + + var v = particle.velocity; + var p = particle.position; + var m = particle.mass; + + var gamma; + var beta; + + if (period === 0) { + gamma = 0; + beta = 1; + } + else { + var c = 4 * m * pi * dampingRatio / period; + var k = 4 * m * pi * pi / (period * period); + + gamma = 1 / (c + dt*k); + beta = dt*k / (c + dt*k); + } + + var x = p.x; + var y = p.y; + var z = p.z; + + var f0 = f(x, y, z); + var dfx = (f(x + epsilon, p, p) - f0) / epsilon; + var dfy = (f(x, y + epsilon, p) - f0) / epsilon; + var dfz = (f(x, y, p + epsilon) - f0) / epsilon; + J.setXYZ(dfx, dfy, dfz); + + var antiDrift = beta/dt * f0; + var lambda = -(J.dot(v) + antiDrift) / (gamma + dt * J.normSquared() / m); + + impulse.set(J.mult(dt*lambda)); + particle.applyImpulse(impulse); + } +}; + +module.exports = Surface; +},{"../../math/Vector":42,"./Constraint":56}],61:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Constraint = _dereq_('./Constraint'); +var Vector = _dereq_('../../math/Vector'); + +/** + * A wall describes an infinite two-dimensional plane that physics bodies + * can collide with. To define a wall, you must give it a distance (from + * the center of the physics engine's origin, and a normal defining the plane + * of the wall. + * + * (wall) + * | + * | (normal) (origin) + * | ---> * + * | + * | (distance) + * ................... + * (100px) + * + * e.g., Wall({normal : [1,0,0], distance : 100}) + * would be a wall 100 pixels to the left, whose normal points right + * + * @class Wall + * @constructor + * @extends Constraint + * @param {Options} [options] An object of configurable options. + * @param {Number} [options.restitution] The energy ratio lost in a collision (0 = stick, 1 = elastic). Range : [0, 1] + * @param {Number} [options.drift] Baumgarte stabilization parameter. Makes constraints "loosely" (0) or "tightly" (1) enforced. Range : [0, 1] + * @param {Number} [options.slop] Amount of penetration in pixels to ignore before collision event triggers. + * @param {Array} [options.normal] The normal direction to the wall. + * @param {Number} [options.distance] The distance from the origin that the wall is placed. + * @param {onContact} [options.onContact] How to handle collision against the wall. + * + */ +function Wall(options) { + this.options = Object.create(Wall.DEFAULT_OPTIONS); + if (options) this.setOptions(options); + + //registers + this.diff = new Vector(); + this.impulse = new Vector(); + + Constraint.call(this); +} + +Wall.prototype = Object.create(Constraint.prototype); +Wall.prototype.constructor = Wall; + +/** + * @property Wall.ON_CONTACT + * @type Object + * @protected + * @static + */ +Wall.ON_CONTACT = { + + /** + * Physical bodies bounce off the wall + * @attribute REFLECT + */ + REFLECT : 0, + + /** + * Physical bodies are unaffected. Usecase is to fire events on contact. + * @attribute SILENT + */ + SILENT : 1 +}; + +Wall.DEFAULT_OPTIONS = { + restitution : 0.5, + drift : 0.5, + slop : 0, + normal : [1, 0, 0], + distance : 0, + onContact : Wall.ON_CONTACT.REFLECT +}; + +/* + * Setter for options. + * + * @method setOptions + * @param options {Objects} + */ +Wall.prototype.setOptions = function setOptions(options) { + if (options.normal !== undefined) { + if (options.normal instanceof Vector) this.options.normal = options.normal.clone(); + if (options.normal instanceof Array) this.options.normal = new Vector(options.normal); + } + if (options.restitution !== undefined) this.options.restitution = options.restitution; + if (options.drift !== undefined) this.options.drift = options.drift; + if (options.slop !== undefined) this.options.slop = options.slop; + if (options.distance !== undefined) this.options.distance = options.distance; + if (options.onContact !== undefined) this.options.onContact = options.onContact; +}; + +function _getNormalVelocity(n, v) { + return v.dot(n); +} + +function _getDistanceFromOrigin(p) { + var n = this.options.normal; + var d = this.options.distance; + return p.dot(n) + d; +} + +function _onEnter(particle, overlap, dt) { + var p = particle.position; + var v = particle.velocity; + var m = particle.mass; + var n = this.options.normal; + var action = this.options.onContact; + var restitution = this.options.restitution; + var impulse = this.impulse; + + var drift = this.options.drift; + var slop = -this.options.slop; + var gamma = 0; + + if (this._eventOutput) { + var data = {particle : particle, wall : this, overlap : overlap, normal : n}; + this._eventOutput.emit('preCollision', data); + this._eventOutput.emit('collision', data); + } + + switch (action) { + case Wall.ON_CONTACT.REFLECT: + var lambda = (overlap < slop) + ? -((1 + restitution) * n.dot(v) + drift / dt * (overlap - slop)) / (m * dt + gamma) + : -((1 + restitution) * n.dot(v)) / (m * dt + gamma); + + impulse.set(n.mult(dt * lambda)); + particle.applyImpulse(impulse); + particle.setPosition(p.add(n.mult(-overlap))); + break; + } + + if (this._eventOutput) this._eventOutput.emit('postCollision', data); +} + +function _onExit(particle, overlap, dt) { + var action = this.options.onContact; + var p = particle.position; + var n = this.options.normal; + + if (action === Wall.ON_CONTACT.REFLECT) { + particle.setPosition(p.add(n.mult(-overlap))); + } +} + +/** + * Adds an impulse to a physics body's velocity due to the wall constraint + * + * @method applyConstraint + * @param targets {Array.Body} Array of bodies to apply the constraint to + * @param source {Body} The source of the constraint + * @param dt {Number} Delta time + */ +Wall.prototype.applyConstraint = function applyConstraint(targets, source, dt) { + var n = this.options.normal; + + for (var i = 0; i < targets.length; i++) { + var particle = targets[i]; + var p = particle.position; + var v = particle.velocity; + var r = particle.radius || 0; + + var overlap = _getDistanceFromOrigin.call(this, p.add(n.mult(-r))); + var nv = _getNormalVelocity.call(this, n, v); + + if (overlap <= 0) { + if (nv < 0) _onEnter.call(this, particle, overlap, dt); + else _onExit.call(this, particle, overlap, dt); + } + } +}; + +module.exports = Wall; +},{"../../math/Vector":42,"./Constraint":56}],62:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Constraint = _dereq_('./Constraint'); +var Wall = _dereq_('./Wall'); +var Vector = _dereq_('../../math/Vector'); + +/** + * Walls combines one or more Wall primitives and exposes a simple API to + * interact with several walls at once. A common use case would be to set up + * a bounding box for a physics body, that would collide with each side. + * + * @class Walls + * @constructor + * @extends Constraint + * @uses Wall + * @param {Options} [options] An object of configurable options. + * @param {Array} [options.sides] An array of sides e.g., [Walls.LEFT, Walls.TOP] + * @param {Array} [options.size] The size of the bounding box of the walls. + * @param {Array} [options.origin] The center of the wall relative to the size. + * @param {Array} [options.drift] Baumgarte stabilization parameter. Makes constraints "loosely" (0) or "tightly" (1) enforced. Range : [0, 1] + * @param {Array} [options.slop] Amount of penetration in pixels to ignore before collision event triggers. + * @param {Array} [options.restitution] The energy ratio lost in a collision (0 = stick, 1 = elastic) The energy ratio lost in a collision (0 = stick, 1 = elastic) + * @param {Array} [options.onContact] How to handle collision against the wall. + */ +function Walls(options) { + this.options = Object.create(Walls.DEFAULT_OPTIONS); + if (options) this.setOptions(options); + _createComponents.call(this, options.sides || this.options.sides); + + Constraint.call(this); +} + +Walls.prototype = Object.create(Constraint.prototype); +Walls.prototype.constructor = Walls; +/** + * @property Walls.ON_CONTACT + * @type Object + * @extends Wall.ON_CONTACT + * @static + */ +Walls.ON_CONTACT = Wall.ON_CONTACT; + +/** + * An enumeration of common types of walls + * LEFT, RIGHT, TOP, BOTTOM, FRONT, BACK + * TWO_DIMENSIONAL, THREE_DIMENSIONAL + * + * @property Walls.SIDES + * @type Object + * @final + * @static + */ +Walls.SIDES = { + LEFT : 0, + RIGHT : 1, + TOP : 2, + BOTTOM : 3, + FRONT : 4, + BACK : 5, + TWO_DIMENSIONAL : [0, 1, 2, 3], + THREE_DIMENSIONAL : [0, 1, 2, 3, 4, 5] +}; + +Walls.DEFAULT_OPTIONS = { + sides : Walls.SIDES.TWO_DIMENSIONAL, + size : [window.innerWidth, window.innerHeight, 0], + origin : [.5, .5, .5], + drift : 0.5, + slop : 0, + restitution : 0.5, + onContact : Walls.ON_CONTACT.REFLECT +}; + +var _SIDE_NORMALS = { + 0 : new Vector(1, 0, 0), + 1 : new Vector(-1, 0, 0), + 2 : new Vector(0, 1, 0), + 3 : new Vector(0,-1, 0), + 4 : new Vector(0, 0, 1), + 5 : new Vector(0, 0,-1) +}; + +function _getDistance(side, size, origin) { + var distance; + var SIDES = Walls.SIDES; + switch (parseInt(side)) { + case SIDES.LEFT: + distance = size[0] * origin[0]; + break; + case SIDES.TOP: + distance = size[1] * origin[1]; + break; + case SIDES.FRONT: + distance = size[2] * origin[2]; + break; + case SIDES.RIGHT: + distance = size[0] * (1 - origin[0]); + break; + case SIDES.BOTTOM: + distance = size[1] * (1 - origin[1]); + break; + case SIDES.BACK: + distance = size[2] * (1 - origin[2]); + break; + } + return distance; +} + +/* + * Setter for options. + * + * @method setOptions + * @param options {Objects} + */ +Walls.prototype.setOptions = function setOptions(options) { + var resizeFlag = false; + if (options.restitution !== undefined) _setOptionsForEach.call(this, {restitution : options.restitution}); + if (options.drift !== undefined) _setOptionsForEach.call(this, {drift : options.drift}); + if (options.slop !== undefined) _setOptionsForEach.call(this, {slop : options.slop}); + if (options.onContact !== undefined) _setOptionsForEach.call(this, {onContact : options.onContact}); + if (options.size !== undefined) resizeFlag = true; + if (options.sides !== undefined) this.options.sides = options.sides; + if (options.origin !== undefined) resizeFlag = true; + if (resizeFlag) this.setSize(options.size, options.origin); +}; + +function _createComponents(sides) { + this.components = {}; + var components = this.components; + + for (var i = 0; i < sides.length; i++) { + var side = sides[i]; + components[i] = new Wall({ + normal : _SIDE_NORMALS[side].clone(), + distance : _getDistance(side, this.options.size, this.options.origin) + }); + } +} + +/* + * Setter for size. + * + * @method setOptions + * @param options {Objects} + */ +Walls.prototype.setSize = function setSize(size, origin) { + origin = origin || this.options.origin; + if (origin.length < 3) origin[2] = 0.5; + + this.forEach(function(wall, side) { + var d = _getDistance(side, size, origin); + wall.setOptions({distance : d}); + }); + + this.options.size = size; + this.options.origin = origin; +}; + +function _setOptionsForEach(options) { + this.forEach(function(wall) { + wall.setOptions(options); + }); + for (var key in options) this.options[key] = options[key]; +} + +/** + * Adds an impulse to a physics body's velocity due to the walls constraint + * + * @method applyConstraint + * @param targets {Array.Body} Array of bodies to apply the constraint to + * @param source {Body} The source of the constraint + * @param dt {Number} Delta time + */ +Walls.prototype.applyConstraint = function applyConstraint(targets, source, dt) { + this.forEach(function(wall) { + wall.applyConstraint(targets, source, dt); + }); +}; + +/** + * Apply a method to each wall making up the walls + * + * @method applyConstraint + * @param fn {Function} Function that takes in a wall as its first parameter + */ +Walls.prototype.forEach = function forEach(fn) { + var sides = this.options.sides; + for (var key in this.sides) fn(sides[key], key); +}; + +/** + * Rotates the walls by an angle in the XY-plane + * + * @method applyConstraint + * @param angle {Function} + */ +Walls.prototype.rotateZ = function rotateZ(angle) { + this.forEach(function(wall) { + var n = wall.options.normal; + n.rotateZ(angle).put(n); + }); +}; + +/** + * Rotates the walls by an angle in the YZ-plane + * + * @method applyConstraint + * @param angle {Function} + */ +Walls.prototype.rotateX = function rotateX(angle) { + this.forEach(function(wall) { + var n = wall.options.normal; + n.rotateX(angle).put(n); + }); +}; + +/** + * Rotates the walls by an angle in the XZ-plane + * + * @method applyConstraint + * @param angle {Function} + */ +Walls.prototype.rotateY = function rotateY(angle) { + this.forEach(function(wall) { + var n = wall.options.normal; + n.rotateY(angle).put(n); + }); +}; + +/** + * Resets the walls to their starting oritentation + */ +Walls.prototype.reset = function reset() { + var sides = this.options.sides; + for (var i in sides) { + var component = this.components[i]; + component.options.normal.set(_SIDE_NORMALS[i]); + } +}; + +module.exports = Walls; +},{"../../math/Vector":42,"./Constraint":56,"./Wall":61}],63:[function(_dereq_,module,exports){ +module.exports = { + Collision: _dereq_('./Collision'), + Constraint: _dereq_('./Constraint'), + Curve: _dereq_('./Curve'), + Distance: _dereq_('./Distance'), + Snap: _dereq_('./Snap'), + Surface: _dereq_('./Surface'), + Wall: _dereq_('./Wall'), + Walls: _dereq_('./Walls') +}; + +},{"./Collision":55,"./Constraint":56,"./Curve":57,"./Distance":58,"./Snap":59,"./Surface":60,"./Wall":61,"./Walls":62}],64:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Force = _dereq_('./Force'); + +/** + * Drag is a force that opposes velocity. Attach it to the physics engine + * to slow down a physics body in motion. + * + * @class Drag + * @constructor + * @extends Force + * @param {Object} options options to set on drag + */ +function Drag(options) { + this.options = Object.create(this.constructor.DEFAULT_OPTIONS); + if (options) this.setOptions(options); + + Force.call(this); +} + +Drag.prototype = Object.create(Force.prototype); +Drag.prototype.constructor = Drag; + +/** + * @property Drag.FORCE_FUNCTIONS + * @type Object + * @protected + * @static + */ +Drag.FORCE_FUNCTIONS = { + + /** + * A drag force proportional to the velocity + * @attribute LINEAR + * @type Function + * @param {Vector} velocity + * @return {Vector} drag force + */ + LINEAR : function(velocity) { + return velocity; + }, + + /** + * A drag force proportional to the square of the velocity + * @attribute QUADRATIC + * @type Function + * @param {Vector} velocity + * @return {Vector} drag force + */ + QUADRATIC : function(velocity) { + return velocity.mult(velocity.norm()); + } +}; + +/** + * @property Drag.DEFAULT_OPTIONS + * @type Object + * @protected + * @static + */ +Drag.DEFAULT_OPTIONS = { + + /** + * The strength of the force + * Range : [0, 0.1] + * @attribute strength + * @type Number + * @default 0.01 + */ + strength : 0.01, + + /** + * The type of opposing force + * @attribute forceFunction + * @type Function + */ + forceFunction : Drag.FORCE_FUNCTIONS.LINEAR +}; + +/** + * Adds a drag force to a physics body's force accumulator. + * + * @method applyForce + * @param targets {Array.Body} Array of bodies to apply drag force to. + */ +Drag.prototype.applyForce = function applyForce(targets) { + var strength = this.options.strength; + var forceFunction = this.options.forceFunction; + var force = this.force; + var index; + var particle; + + for (index = 0; index < targets.length; index++) { + particle = targets[index]; + forceFunction(particle.velocity).mult(-strength).put(force); + particle.applyForce(force); + } +}; + +/** + * Basic options setter + * + * @method setOptions + * @param {Objects} options + */ +Drag.prototype.setOptions = function setOptions(options) { + for (var key in options) this.options[key] = options[key]; +}; + +module.exports = Drag; +},{"./Force":65}],65:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Vector = _dereq_('../../math/Vector'); +var EventHandler = _dereq_('../../core/EventHandler'); + +/** + * Force base class. + * + * @class Force + * @uses EventHandler + * @constructor + */ +function Force(force) { + this.force = new Vector(force); + this._eventOutput = new EventHandler(); + EventHandler.setOutputHandler(this, this._eventOutput); +} + +/** + * Basic setter for options + * + * @method setOptions + * @param options {Objects} + */ +Force.prototype.setOptions = function setOptions(options) { + this._eventOutput.emit('change', options); +}; + +/** + * Adds a force to a physics body's force accumulator. + * + * @method applyForce + * @param targets {Array.Body} Array of bodies to apply a force to. + */ +Force.prototype.applyForce = function applyForce(targets) { + var length = targets.length; + while (length--) { + targets[length].applyForce(this.force); + } +}; + +/** + * Getter for a force's potential energy. + * + * @method getEnergy + * @return energy {Number} + */ +Force.prototype.getEnergy = function getEnergy() { + return 0.0; +}; + +module.exports = Force; +},{"../../core/EventHandler":7,"../../math/Vector":42}],66:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Force = _dereq_('./Force'); +var Vector = _dereq_('../../math/Vector'); + +/** + * Repulsion is a force that repels (attracts) bodies away (towards) + * each other. A repulsion of negative strength is attractive. + * + * @class Repulsion + * @constructor + * @extends Force + * @param {Object} options overwrites default options + */ +function Repulsion(options) { + this.options = Object.create(Repulsion.DEFAULT_OPTIONS); + if (options) this.setOptions(options); + + //registers + this.disp = new Vector(); + + Force.call(this); +} + +Repulsion.prototype = Object.create(Force.prototype); +Repulsion.prototype.constructor = Repulsion; +/** + * @property Repulsion.DECAY_FUNCTIONS + * @type Object + * @protected + * @static + */ +Repulsion.DECAY_FUNCTIONS = { + + /** + * A linear decay function + * @attribute LINEAR + * @type Function + * @param {Number} r distance from the source body + * @param {Number} cutoff the effective radius of influence + */ + LINEAR : function(r, cutoff) { + return Math.max(1 - (1 / cutoff) * r, 0); + }, + + /** + * A Morse potential decay function (http://en.wikipedia.org/wiki/Morse_potential) + * @attribute MORSE + * @type Function + * @param {Number} r distance from the source body + * @param {Number} cutoff the minimum radius of influence + */ + MORSE : function(r, cutoff) { + var r0 = (cutoff === 0) ? 100 : cutoff; + var rShifted = r + r0 * (1 - Math.log(2)); //shift by x-intercept + return Math.max(1 - Math.pow(1 - Math.exp(rShifted/r0 - 1), 2), 0); + }, + + /** + * An inverse distance decay function + * @attribute INVERSE + * @type Function + * @param {Number} r distance from the source body + * @param {Number} cutoff a distance shift to avoid singularities + */ + INVERSE : function(r, cutoff) { + return 1 / (1 - cutoff + r); + }, + + /** + * An inverse squared distance decay function + * @attribute GRAVITY + * @type Function + * @param {Number} r distance from the source body + * @param {Number} cutoff a distance shift to avoid singularities + */ + GRAVITY : function(r, cutoff) { + return 1 / (1 - cutoff + r*r); + } +}; + +/** + * @property Repulsion.DEFAULT_OPTIONS + * @type Object + * @protected + * @static + */ +Repulsion.DEFAULT_OPTIONS = { + + /** + * The strength of the force + * Range : [0, 100] + * @attribute strength + * @type Number + * @default 1 + */ + strength : 1, + + /** + * The location of the force, if not another physics body + * + * @attribute anchor + * @type Number + * @default 0.01 + * @optional + */ + anchor : undefined, + + /** + * The range of the repulsive force + * @attribute radii + * @type Array + * @default [0, Infinity] + */ + range : [0, Infinity], + + /** + * A normalization for the force to avoid singularities at the origin + * @attribute cutoff + * @type Number + * @default 0 + */ + cutoff : 0, + + /** + * The maximum magnitude of the force + * Range : [0, Infinity] + * @attribute cap + * @type Number + * @default Infinity + */ + cap : Infinity, + + /** + * The type of decay the repulsive force should have + * @attribute decayFunction + * @type Function + */ + decayFunction : Repulsion.DECAY_FUNCTIONS.GRAVITY +}; + +/* + * Setter for options. + * + * @method setOptions + * @param {Objects} options + */ +Repulsion.prototype.setOptions = function setOptions(options) { + if (options.anchor !== undefined) { + if (options.anchor.position instanceof Vector) this.options.anchor = options.anchor.position; + if (options.anchor instanceof Array) this.options.anchor = new Vector(options.anchor); + delete options.anchor; + } + for (var key in options) this.options[key] = options[key]; +}; + +/** + * Adds a drag force to a physics body's force accumulator. + * + * @method applyForce + * @param targets {Array.Body} Array of bodies to apply force to. + * @param source {Body} The source of the force + */ +Repulsion.prototype.applyForce = function applyForce(targets, source) { + var options = this.options; + var force = this.force; + var disp = this.disp; + + var strength = options.strength; + var anchor = options.anchor || source.position; + var cap = options.cap; + var cutoff = options.cutoff; + var rMin = options.range[0]; + var rMax = options.range[1]; + var decayFn = options.decayFunction; + + if (strength === 0) return; + + var length = targets.length; + var particle; + var m1; + var p1; + var r; + + while (length--) { + particle = targets[length]; + + if (particle === source) continue; + + m1 = particle.mass; + p1 = particle.position; + + disp.set(p1.sub(anchor)); + r = disp.norm(); + + if (r < rMax && r > rMin) { + force.set(disp.normalize(strength * m1 * decayFn(r, cutoff)).cap(cap)); + particle.applyForce(force); + } + } + +}; + +module.exports = Repulsion; +},{"../../math/Vector":42,"./Force":65}],67:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Drag = _dereq_('./Drag'); + +/** + * Rotational drag is a force that opposes angular velocity. + * Attach it to a physics body to slow down its rotation. + * + * @class RotationalDrag + * @constructor + * @extends Force + * @param {Object} options options to set on drag + */ +function RotationalDrag(options) { + Drag.call(this, options); +} + +RotationalDrag.prototype = Object.create(Drag.prototype); +RotationalDrag.prototype.constructor = RotationalDrag; + +RotationalDrag.DEFAULT_OPTIONS = Drag.DEFAULT_OPTIONS; +RotationalDrag.FORCE_FUNCTIONS = Drag.FORCE_FUNCTIONS; + +/** + * @property Repulsion.FORCE_FUNCTIONS + * @type Object + * @protected + * @static + */ +RotationalDrag.FORCE_FUNCTIONS = { + + /** + * A drag force proprtional to the angular velocity + * @attribute LINEAR + * @type Function + * @param {Vector} angularVelocity + * @return {Vector} drag force + */ + LINEAR : function(angularVelocity) { + return angularVelocity; + }, + + /** + * A drag force proprtional to the square of the angular velocity + * @attribute QUADRATIC + * @type Function + * @param {Vector} angularVelocity + * @return {Vector} drag force + */ + QUADRATIC : function(angularVelocity) { + return angularVelocity.mult(angularVelocity.norm()); + } +}; + +/** + * Adds a rotational drag force to a physics body's torque accumulator. + * + * @method applyForce + * @param targets {Array.Body} Array of bodies to apply drag force to. + */ +RotationalDrag.prototype.applyForce = function applyForce(targets) { + var strength = this.options.strength; + var forceFunction = this.options.forceFunction; + var force = this.force; + + //TODO: rotational drag as function of inertia + + var index; + var particle; + + for (index = 0; index < targets.length; index++) { + particle = targets[index]; + forceFunction(particle.angularVelocity).mult(-100*strength).put(force); + particle.applyTorque(force); + } +}; + +/* + * Setter for options. + * + * @method setOptions + * @param {Objects} options + */ +RotationalDrag.prototype.setOptions = function setOptions(options) { + for (var key in options) this.options[key] = options[key]; +}; + +module.exports = RotationalDrag; +},{"./Drag":64}],68:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +//TODO: test inheritance +var Force = _dereq_('./Force'); +var Spring = _dereq_('./Spring'); +var Quaternion = _dereq_('../../math/Quaternion'); + +/** + * A force that rotates a physics body back to target Euler angles. + * Just as a spring translates a body to a particular X, Y, Z, location, + * a rotational spring rotates a body to a particular X, Y, Z Euler angle. + * Note: there is no physical agent that does this in the "real world" + * + * @class RotationalSpring + * @constructor + * @extends Spring + * @param {Object} options options to set on drag + */ +function RotationalSpring(options) { + Spring.call(this, options); +} + +RotationalSpring.prototype = Object.create(Spring.prototype); +RotationalSpring.prototype.constructor = RotationalSpring; + +RotationalSpring.DEFAULT_OPTIONS = Spring.DEFAULT_OPTIONS; +RotationalSpring.FORCE_FUNCTIONS = Spring.FORCE_FUNCTIONS; + +/** @const */ +var pi = Math.PI; + +function _calcStiffness() { + var options = this.options; + options.stiffness = Math.pow(2 * pi / options.period, 2); +} + +function _calcDamping() { + var options = this.options; + options.damping = 4 * pi * options.dampingRatio / options.period; +} + +function _init() { + _calcStiffness.call(this); + _calcDamping.call(this); +} + +RotationalSpring.prototype.setOptions = function setOptions(options) { + // TODO fix no-console error + /* eslint no-console: 0 */ + + if (options.anchor !== undefined) { + if (options.anchor instanceof Quaternion) this.options.anchor = options.anchor; + if (options.anchor instanceof Array) this.options.anchor = new Quaternion(options.anchor); + } + + if (options.period !== undefined){ + this.options.period = options.period; + } + + if (options.dampingRatio !== undefined) this.options.dampingRatio = options.dampingRatio; + if (options.length !== undefined) this.options.length = options.length; + if (options.forceFunction !== undefined) this.options.forceFunction = options.forceFunction; + if (options.maxLength !== undefined) this.options.maxLength = options.maxLength; + + _init.call(this); + Force.prototype.setOptions.call(this, options); +}; + +/** + * Adds a torque force to a physics body's torque accumulator. + * + * @method applyForce + * @param targets {Array.Body} Array of bodies to apply torque to. + */ +RotationalSpring.prototype.applyForce = function applyForce(targets) { + var force = this.force; + var options = this.options; + var disp = this.disp; + + var stiffness = options.stiffness; + var damping = options.damping; + var restLength = options.length; + var anchor = options.anchor; + var forceFunction = options.forceFunction; + var maxLength = options.maxLength; + + var i; + var target; + var dist; + var m; + + for (i = 0; i < targets.length; i++) { + target = targets[i]; + + disp.set(anchor.sub(target.orientation)); + dist = disp.norm() - restLength; + + if (dist === 0) return; + + //if dampingRatio specified, then override strength and damping + m = target.mass; + stiffness *= m; + damping *= m; + + force.set(disp.normalize(stiffness * forceFunction(dist, maxLength))); + + if (damping) force.add(target.angularVelocity.mult(-damping)).put(force); + + target.applyTorque(force); + } +}; + +/** + * Calculates the potential energy of the rotational spring. + * + * @method getEnergy + * @param [targets] target The physics body attached to the spring + */ +RotationalSpring.prototype.getEnergy = function getEnergy(targets) { + var options = this.options; + var restLength = options.length; + var anchor = options.anchor; + var strength = options.stiffness; + + var energy = 0.0; + for (var i = 0; i < targets.length; i++) { + var target = targets[i]; + var dist = anchor.sub(target.orientation).norm() - restLength; + energy += 0.5 * strength * dist * dist; + } + return energy; +}; + +module.exports = RotationalSpring; +},{"../../math/Quaternion":39,"./Force":65,"./Spring":69}],69:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +/*global console */ + +var Force = _dereq_('./Force'); +var Vector = _dereq_('../../math/Vector'); + +/** + * A force that moves a physics body to a location with a spring motion. + * The body can be moved to another physics body, or an anchor point. + * + * @class Spring + * @constructor + * @extends Force + * @param {Object} options options to set on drag + */ +function Spring(options) { + Force.call(this); + + this.options = Object.create(this.constructor.DEFAULT_OPTIONS); + if (options) this.setOptions(options); + + //registers + this.disp = new Vector(0,0,0); + + _init.call(this); +} + +Spring.prototype = Object.create(Force.prototype); +Spring.prototype.constructor = Spring; + +/** @const */ +var pi = Math.PI; +var MIN_PERIOD = 150; + +/** + * @property Spring.FORCE_FUNCTIONS + * @type Object + * @protected + * @static + */ +Spring.FORCE_FUNCTIONS = { + + /** + * A FENE (Finitely Extensible Nonlinear Elastic) spring force + * see: http://en.wikipedia.org/wiki/FENE + * @attribute FENE + * @type Function + * @param {Number} dist current distance target is from source body + * @param {Number} rMax maximum range of influence + * @return {Number} unscaled force + */ + FENE : function(dist, rMax) { + var rMaxSmall = rMax * .99; + var r = Math.max(Math.min(dist, rMaxSmall), -rMaxSmall); + return r / (1 - r * r/(rMax * rMax)); + }, + + /** + * A Hookean spring force, linear in the displacement + * see: http://en.wikipedia.org/wiki/Hooke's_law + * @attribute FENE + * @type Function + * @param {Number} dist current distance target is from source body + * @return {Number} unscaled force + */ + HOOK : function(dist) { + return dist; + } +}; + +/** + * @property Spring.DEFAULT_OPTIONS + * @type Object + * @protected + * @static + */ +Spring.DEFAULT_OPTIONS = { + + /** + * The amount of time in milliseconds taken for one complete oscillation + * when there is no damping + * Range : [150, Infinity] + * @attribute period + * @type Number + * @default 300 + */ + period : 300, + + /** + * The damping of the spring. + * Range : [0, 1] + * 0 = no damping, and the spring will oscillate forever + * 1 = critically damped (the spring will never oscillate) + * @attribute dampingRatio + * @type Number + * @default 0.1 + */ + dampingRatio : 0.1, + + /** + * The rest length of the spring + * Range : [0, Infinity] + * @attribute length + * @type Number + * @default 0 + */ + length : 0, + + /** + * The maximum length of the spring (for a FENE spring) + * Range : [0, Infinity] + * @attribute length + * @type Number + * @default Infinity + */ + maxLength : Infinity, + + /** + * The location of the spring's anchor, if not another physics body + * + * @attribute anchor + * @type Array + * @optional + */ + anchor : undefined, + + /** + * The type of spring force + * @attribute forceFunction + * @type Function + */ + forceFunction : Spring.FORCE_FUNCTIONS.HOOK +}; + +function _calcStiffness() { + var options = this.options; + options.stiffness = Math.pow(2 * pi / options.period, 2); +} + +function _calcDamping() { + var options = this.options; + options.damping = 4 * pi * options.dampingRatio / options.period; +} + +function _init() { + _calcStiffness.call(this); + _calcDamping.call(this); +} + +/** + * Basic options setter + * + * @method setOptions + * @param options {Object} + */ +Spring.prototype.setOptions = function setOptions(options) { + // TODO fix no-console error + /* eslint no-console: 0 */ + + if (options.anchor !== undefined) { + if (options.anchor.position instanceof Vector) this.options.anchor = options.anchor.position; + if (options.anchor instanceof Vector) this.options.anchor = options.anchor; + if (options.anchor instanceof Array) this.options.anchor = new Vector(options.anchor); + } + + if (options.period !== undefined){ + if (options.period < MIN_PERIOD) { + options.period = MIN_PERIOD; + console.warn('The period of a SpringTransition is capped at ' + MIN_PERIOD + ' ms. Use a SnapTransition for faster transitions'); + } + this.options.period = options.period; + } + + if (options.dampingRatio !== undefined) this.options.dampingRatio = options.dampingRatio; + if (options.length !== undefined) this.options.length = options.length; + if (options.forceFunction !== undefined) this.options.forceFunction = options.forceFunction; + if (options.maxLength !== undefined) this.options.maxLength = options.maxLength; + + _init.call(this); + Force.prototype.setOptions.call(this, options); +}; + +/** + * Adds a spring force to a physics body's force accumulator. + * + * @method applyForce + * @param targets {Array.Body} Array of bodies to apply force to. + */ +Spring.prototype.applyForce = function applyForce(targets, source) { + var force = this.force; + var disp = this.disp; + var options = this.options; + + var stiffness = options.stiffness; + var damping = options.damping; + var restLength = options.length; + var maxLength = options.maxLength; + var anchor = options.anchor || source.position; + var forceFunction = options.forceFunction; + + var i; + var target; + var p2; + var v2; + var dist; + var m; + + for (i = 0; i < targets.length; i++) { + target = targets[i]; + p2 = target.position; + v2 = target.velocity; + + anchor.sub(p2).put(disp); + dist = disp.norm() - restLength; + + if (dist === 0) return; + + //if dampingRatio specified, then override strength and damping + m = target.mass; + stiffness *= m; + damping *= m; + + disp.normalize(stiffness * forceFunction(dist, maxLength)) + .put(force); + + if (damping) + if (source) force.add(v2.sub(source.velocity).mult(-damping)).put(force); + else force.add(v2.mult(-damping)).put(force); + + target.applyForce(force); + if (source) source.applyForce(force.mult(-1)); + } +}; + +/** + * Calculates the potential energy of the spring. + * + * @method getEnergy + * @param [targets] target The physics body attached to the spring + * @return {source} The potential energy of the spring + */ +Spring.prototype.getEnergy = function getEnergy(targets, source) { + var options = this.options; + var restLength = options.length; + var anchor = (source) ? source.position : options.anchor; + var strength = options.stiffness; + + var energy = 0.0; + for (var i = 0; i < targets.length; i++){ + var target = targets[i]; + var dist = anchor.sub(target.position).norm() - restLength; + energy += 0.5 * strength * dist * dist; + } + return energy; +}; + +module.exports = Spring; +},{"../../math/Vector":42,"./Force":65}],70:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Force = _dereq_('./Force'); +var Vector = _dereq_('../../math/Vector'); + +/** + * A force that moves a physics body to a location with a spring motion. + * The body can be moved to another physics body, or an anchor point. + * + * @class VectorField + * @constructor + * @extends Force + * @param {Object} options options to set on drag + */ +function VectorField(options) { + Force.call(this); + + this.options = Object.create(VectorField.DEFAULT_OPTIONS); + if (options) this.setOptions(options); + + //registers + this.evaluation = new Vector(); +} + +VectorField.prototype = Object.create(Force.prototype); +VectorField.prototype.constructor = VectorField; + +/** + * @property Spring.FORCE_FUNCTIONS + * @type Object + * @protected + * @static + */ +VectorField.FIELDS = { + /** + * Constant force, e.g., gravity + * @attribute CONSTANT + * @type Function + * @param v {Vector} Current position of physics body + * @param options {Object} The direction of the force + * Pass a {direction : Vector} into the VectorField options + * @return {Number} unscaled force + */ + CONSTANT : function(v, options) { + options.direction.put(this.evaluation); + }, + + /** + * Linear force + * @attribute LINEAR + * @type Function + * @param v {Vector} Current position of physics body + * @return {Vector} unscaled force + */ + LINEAR : function(v) { + v.put(this.evaluation); + }, + + /** + * Radial force, e.g., Hookean spring + * @attribute RADIAL + * @type Function + * @param v {Vector} Current position of physics body + * @return {Vector} unscaled force + */ + RADIAL : function(v) { + v.mult(-1).put(this.evaluation); + }, + + /** + * Point attractor force, e.g., Hookean spring with an anchor + * @attribute POINT_ATTRACTOR + * @type Function + * @param v {Vector} Current position of physics body + * @param options {Object} And object with the position of the attractor + * Pass a {position : Vector} into the VectorField options + * @return {Vector} unscaled force + */ + POINT_ATTRACTOR : function(v, options) { + options.position.sub(v).put(this.evaluation); + } +}; + +/** + * @property VectorField.DEFAULT_OPTIONS + * @type Object + * @protected + * @static + */ +VectorField.DEFAULT_OPTIONS = { + + /** + * The strength of the force + * Range : [0, 10] + * @attribute strength + * @type Number + * @default .01 + */ + strength : .01, + + /** + * Type of vectorfield + * Range : [0, 100] + * @attribute field + * @type Function + */ + field : VectorField.FIELDS.CONSTANT +}; + +/** + * Basic options setter + * + * @method setOptions + * @param {Objects} options + */ +VectorField.prototype.setOptions = function setOptions(options) { + if (options.strength !== undefined) this.options.strength = options.strength; + if (options.direction !== undefined) this.options.direction = options.direction; + if (options.field !== undefined) { + this.options.field = options.field; + _setFieldOptions.call(this, this.options.field); + } +}; + +function _setFieldOptions(field) { + var FIELDS = VectorField.FIELDS; + + switch (field) { + case FIELDS.CONSTANT: + if (!this.options.direction) this.options.direction = new Vector(0,1,0); + else if (this.options.direction instanceof Array) this.options.direction = new Vector(this.options.direction); + break; + case FIELDS.POINT_ATTRACTOR: + if (!this.options.position) this.options.position = new Vector(0,0,0); + else if (this.options.position instanceof Array) this.options.position = new Vector(this.options.position); + break; + } +} + +/** + * Adds the VectorField's force to a physics body's force accumulator. + * + * @method applyForce + * @param targets {Array.body} Array of bodies to apply force to. + */ +VectorField.prototype.applyForce = function applyForce(targets) { + var force = this.force; + var strength = this.options.strength; + var field = this.options.field; + + var i; + var target; + + for (i = 0; i < targets.length; i++) { + target = targets[i]; + field.call(this, target.position, this.options); + this.evaluation.mult(target.mass * strength).put(force); + target.applyForce(force); + } +}; + +VectorField.prototype.getEnergy = function getEnergy(targets) { + var field = this.options.field; + var FIELDS = VectorField.FIELDS; + + var energy = 0; + + var i; + var target; + switch (field) { + case FIELDS.CONSTANT: + energy = targets.length * this.options.direction.norm(); + break; + case FIELDS.RADIAL: + for (i = 0; i < targets.length; i++){ + target = targets[i]; + energy += target.position.norm(); + } + break; + case FIELDS.POINT_ATTRACTOR: + for (i = 0; i < targets.length; i++){ + target = targets[i]; + energy += target.position.sub(this.options.position).norm(); + } + break; + } + energy *= this.options.strength; + return energy; +}; + +module.exports = VectorField; +},{"../../math/Vector":42,"./Force":65}],71:[function(_dereq_,module,exports){ +module.exports = { + Drag: _dereq_('./Drag'), + Force: _dereq_('./Force'), + Repulsion: _dereq_('./Repulsion'), + RotationalDrag: _dereq_('./RotationalDrag'), + RotationalSpring: _dereq_('./RotationalSpring'), + Spring: _dereq_('./Spring'), + VectorField: _dereq_('./VectorField') +}; + +},{"./Drag":64,"./Force":65,"./Repulsion":66,"./RotationalDrag":67,"./RotationalSpring":68,"./Spring":69,"./VectorField":70}],72:[function(_dereq_,module,exports){ +module.exports = { + PhysicsEngine: _dereq_('./PhysicsEngine'), + bodies: _dereq_('./bodies'), + constraints: _dereq_('./constraints'), + forces: _dereq_('./forces'), + integrators: _dereq_('./integrators') +}; + +},{"./PhysicsEngine":49,"./bodies":54,"./constraints":63,"./forces":71,"./integrators":74}],73:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: david@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + + + + +/** + * Ordinary Differential Equation (ODE) Integrator. + * Manages updating a physics body's state over time. + * + * p = position, v = velocity, m = mass, f = force, dt = change in time + * + * v <- v + dt * f / m + * p <- p + dt * v + * + * q = orientation, w = angular velocity, L = angular momentum + * + * L <- L + dt * t + * q <- q + dt/2 * q * w + * + * @class SymplecticEuler + * @constructor + * @param {Object} options Options to set + */ +var SymplecticEuler = {}; + +/* + * Updates the velocity of a physics body from its accumulated force. + * v <- v + dt * f / m + * + * @method integrateVelocity + * @param {Body} physics body + * @param {Number} dt delta time + */ +SymplecticEuler.integrateVelocity = function integrateVelocity(body, dt) { + var v = body.velocity; + var w = body.inverseMass; + var f = body.force; + + if (f.isZero()) return; + + v.add(f.mult(dt * w)).put(v); + f.clear(); +}; + +/* + * Updates the position of a physics body from its velocity. + * p <- p + dt * v + * + * @method integratePosition + * @param {Body} physics body + * @param {Number} dt delta time + */ +SymplecticEuler.integratePosition = function integratePosition(body, dt) { + var p = body.position; + var v = body.velocity; + + p.add(v.mult(dt)).put(p); +}; + +/* + * Updates the angular momentum of a physics body from its accumuled torque. + * L <- L + dt * t + * + * @method integrateAngularMomentum + * @param {Body} physics body (except a particle) + * @param {Number} dt delta time + */ +SymplecticEuler.integrateAngularMomentum = function integrateAngularMomentum(body, dt) { + var L = body.angularMomentum; + var t = body.torque; + + if (t.isZero()) return; + + L.add(t.mult(dt)).put(L); + t.clear(); +}; + +/* + * Updates the orientation of a physics body from its angular velocity. + * q <- q + dt/2 * q * w + * + * @method integrateOrientation + * @param {Body} physics body (except a particle) + * @param {Number} dt delta time + */ +SymplecticEuler.integrateOrientation = function integrateOrientation(body, dt) { + var q = body.orientation; + var w = body.angularVelocity; + + if (w.isZero()) return; + q.add(q.multiply(w).scalarMultiply(0.5 * dt)).put(q); +// q.normalize.put(q); +}; + +module.exports = SymplecticEuler; +},{}],74:[function(_dereq_,module,exports){ +module.exports = { + SymplecticEuler: _dereq_('./SymplecticEuler') +}; + +},{"./SymplecticEuler":73}],75:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Surface = _dereq_('../core/Surface'); + +/** + * A surface containing an HTML5 Canvas element. + * This extends the Surface class. + * + * @class CanvasSurface + * @extends Surface + * @constructor + * @param {Object} [options] overrides of default options + * @param {Array.Number} [options.canvasSize] [width, height] for document element + */ +function CanvasSurface(options) { + if (options && options.canvasSize) this._canvasSize = options.canvasSize; + Surface.apply(this, arguments); + if (!this._canvasSize) this._canvasSize = this.getSize(); + this._backBuffer = document.createElement('canvas'); + if (this._canvasSize) { + this._backBuffer.width = this._canvasSize[0]; + this._backBuffer.height = this._canvasSize[1]; + } + this._contextId = undefined; +} + +CanvasSurface.prototype = Object.create(Surface.prototype); +CanvasSurface.prototype.constructor = CanvasSurface; +CanvasSurface.prototype.elementType = 'canvas'; +CanvasSurface.prototype.elementClass = 'famous-surface'; + +/** + * Set inner document content. Note that this is a noop for CanvasSurface. + * + * @method setContent + * + */ +CanvasSurface.prototype.setContent = function setContent() {}; + +/** + * Place the document element this component manages into the document. + * This will draw the content to the document. + * + * @private + * @method deploy + * @param {Node} target document parent of this container + */ +CanvasSurface.prototype.deploy = function deploy(target) { + if (this._canvasSize) { + target.width = this._canvasSize[0]; + target.height = this._canvasSize[1]; + } + if (this._contextId === '2d') { + target.getContext(this._contextId).drawImage(this._backBuffer, 0, 0); + this._backBuffer.width = 0; + this._backBuffer.height = 0; + } +}; + +/** + * Remove this component and contained content from the document + * + * @private + * @method recall + * + * @param {Node} target node to which the component was deployed + */ +CanvasSurface.prototype.recall = function recall(target) { + var size = this.getSize(); + + this._backBuffer.width = target.width; + this._backBuffer.height = target.height; + + if (this._contextId === '2d') { + this._backBuffer.getContext(this._contextId).drawImage(target, 0, 0); + target.width = 0; + target.height = 0; + } +}; + +/** + * Returns the canvas element's context + * + * @method getContext + * @param {string} contextId context identifier + */ +CanvasSurface.prototype.getContext = function getContext(contextId) { + this._contextId = contextId; + return this._currentTarget ? this._currentTarget.getContext(contextId) : this._backBuffer.getContext(contextId); +}; + +/** + * Set the size of the surface and canvas element. + * + * @method setSize + * @param {Array.number} size [width, height] of surface + * @param {Array.number} canvasSize [width, height] of canvas surface + */ +CanvasSurface.prototype.setSize = function setSize(size, canvasSize) { + Surface.prototype.setSize.apply(this, arguments); + if (canvasSize) this._canvasSize = [canvasSize[0], canvasSize[1]]; + if (this._currentTarget) { + this._currentTarget.width = this._canvasSize[0]; + this._currentTarget.height = this._canvasSize[1]; + } +}; + +module.exports = CanvasSurface; +},{"../core/Surface":14}],76:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Surface = _dereq_('../core/Surface'); +var Context = _dereq_('../core/Context'); + +/** + * ContainerSurface is an object designed to contain surfaces and + * set properties to be applied to all of them at once. + * This extends the Surface class. + * A container surface will enforce these properties on the + * surfaces it contains: + * + * size (clips contained surfaces to its own width and height); + * + * origin; + * + * its own opacity and transform, which will be automatically + * applied to all Surfaces contained directly and indirectly. + * + * @class ContainerSurface + * @extends Surface + * @constructor + * @param {Array.Number} [options.size] [width, height] in pixels + * @param {Array.string} [options.classes] CSS classes to set on all inner content + * @param {Array} [options.properties] string dictionary of HTML attributes to set on target div + * @param {string} [options.content] inner (HTML) content of surface (should not be used) + */ +function ContainerSurface(options) { + Surface.call(this, options); + this._container = document.createElement('div'); + this._container.classList.add('famous-group'); + this._container.classList.add('famous-container-group'); + this._shouldRecalculateSize = false; + this.context = new Context(this._container); + this.setContent(this._container); +} + +ContainerSurface.prototype = Object.create(Surface.prototype); +ContainerSurface.prototype.constructor = ContainerSurface; +ContainerSurface.prototype.elementType = 'div'; +ContainerSurface.prototype.elementClass = 'famous-surface'; + +/** + * Add renderables to this object's render tree + * + * @method add + * + * @param {Object} obj renderable object + * @return {RenderNode} RenderNode wrapping this object, if not already a RenderNode + */ +ContainerSurface.prototype.add = function add() { + return this.context.add.apply(this.context, arguments); +}; + +/** + * Return spec for this surface. Note: Can result in a size recalculation. + * + * @private + * @method render + * + * @return {Object} render spec for this surface (spec id) + */ +ContainerSurface.prototype.render = function render() { + if (this._sizeDirty) this._shouldRecalculateSize = true; + return Surface.prototype.render.apply(this, arguments); +}; + +/** + * Place the document element this component manages into the document. + * + * @private + * @method deploy + * @param {Node} target document parent of this container + */ +ContainerSurface.prototype.deploy = function deploy() { + this._shouldRecalculateSize = true; + return Surface.prototype.deploy.apply(this, arguments); +}; + +/** + * Apply changes from this component to the corresponding document element. + * This includes changes to classes, styles, size, content, opacity, origin, + * and matrix transforms. + * + * @private + * @method commit + * @param {Context} context commit context + * @param {Transform} transform unused TODO + * @param {Number} opacity unused TODO + * @param {Array.Number} origin unused TODO + * @param {Array.Number} size unused TODO + * @return {undefined} TODO returns an undefined value + */ +ContainerSurface.prototype.commit = function commit(context, transform, opacity, origin, size) { + var previousSize = this._size ? [this._size[0], this._size[1]] : null; + var result = Surface.prototype.commit.apply(this, arguments); + if (this._shouldRecalculateSize || (previousSize && (this._size[0] !== previousSize[0] || this._size[1] !== previousSize[1]))) { + this.context.setSize(); + this._shouldRecalculateSize = false; + } + this.context.update(); + return result; +}; + +module.exports = ContainerSurface; +},{"../core/Context":1,"../core/Surface":14}],77:[function(_dereq_,module,exports){ +var ContainerSurface = _dereq_('./ContainerSurface'); + +function FormContainerSurface(options) { + if (options) this._method = options.method || ''; + ContainerSurface.apply(this, arguments); +} + +FormContainerSurface.prototype = Object.create(ContainerSurface.prototype); +FormContainerSurface.prototype.constructor = FormContainerSurface; + +FormContainerSurface.prototype.elementType = 'form'; + +FormContainerSurface.prototype.deploy = function deploy(target) { + if (this._method) target.method = this._method; + return ContainerSurface.prototype.deploy.apply(this, arguments); +}; + +module.exports = FormContainerSurface; +},{"./ContainerSurface":76}],78:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Surface = _dereq_('../core/Surface'); + +/** + * A surface containing image content. + * This extends the Surface class. + * + * @class ImageSurface + * + * @extends Surface + * @constructor + * @param {Object} [options] overrides of default options + */ +function ImageSurface(options) { + this._imageUrl = undefined; + Surface.apply(this, arguments); +} + +var urlCache = []; +var countCache = []; +var nodeCache = []; +var cacheEnabled = true; + +ImageSurface.enableCache = function enableCache() { + cacheEnabled = true; +}; + +ImageSurface.disableCache = function disableCache() { + cacheEnabled = false; +}; + +ImageSurface.clearCache = function clearCache() { + urlCache = []; + countCache = []; + nodeCache = []; +}; + +ImageSurface.getCache = function getCache() { + return { + urlCache: urlCache, + countCache: countCache, + nodeCache: countCache + }; +}; + +ImageSurface.prototype = Object.create(Surface.prototype); +ImageSurface.prototype.constructor = ImageSurface; +ImageSurface.prototype.elementType = 'img'; +ImageSurface.prototype.elementClass = 'famous-surface'; + +/** + * Set content URL. This will cause a re-rendering. + * @method setContent + * @param {string} imageUrl + */ +ImageSurface.prototype.setContent = function setContent(imageUrl) { + var urlIndex = urlCache.indexOf(this._imageUrl); + if (urlIndex !== -1) { + if (countCache[urlIndex] === 1) { + urlCache.splice(urlIndex, 1); + countCache.splice(urlIndex, 1); + nodeCache.splice(urlIndex, 1); + } else { + countCache[urlIndex]--; + } + } + + urlIndex = urlCache.indexOf(imageUrl); + if (urlIndex === -1) { + urlCache.push(imageUrl); + countCache.push(1); + } + else { + countCache[urlIndex]++; + } + + this._imageUrl = imageUrl; + this._contentDirty = true; +}; + +/** + * Place the document element that this component manages into the document. + * + * @private + * @method deploy + * @param {Node} target document parent of this container + */ +ImageSurface.prototype.deploy = function deploy(target) { + var urlIndex = urlCache.indexOf(this._imageUrl); + if (nodeCache[urlIndex] === undefined && cacheEnabled) { + var img = new Image(); + img.src = this._imageUrl || ''; + nodeCache[urlIndex] = img; + } + + target.src = this._imageUrl || ''; +}; + +/** + * Remove this component and contained content from the document + * + * @private + * @method recall + * + * @param {Node} target node to which the component was deployed + */ +ImageSurface.prototype.recall = function recall(target) { + target.src = ''; +}; + +module.exports = ImageSurface; +},{"../core/Surface":14}],79:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Surface = _dereq_('../core/Surface'); + +/** + * A Famo.us surface in the form of an HTML input element. + * This extends the Surface class. + * + * @class InputSurface + * @extends Surface + * @constructor + * @param {Object} [options] overrides of default options + * @param {string} [options.placeholder] placeholder text hint that describes the expected value of an element + * @param {string} [options.type] specifies the type of element to display (e.g. 'datetime', 'text', 'button', etc.) + * @param {string} [options.value] value of text + */ +function InputSurface(options) { + this._placeholder = options.placeholder || ''; + this._value = options.value || ''; + this._type = options.type || 'text'; + this._name = options.name || ''; + + Surface.apply(this, arguments); + + this.on('click', this.focus.bind(this)); + window.addEventListener('click', function(event) { + if (event.target !== this._currentTarget) this.blur(); + }.bind(this)); +} +InputSurface.prototype = Object.create(Surface.prototype); +InputSurface.prototype.constructor = InputSurface; + +InputSurface.prototype.elementType = 'input'; +InputSurface.prototype.elementClass = 'famous-surface'; + +/** + * Set placeholder text. Note: Triggers a repaint. + * + * @method setPlaceholder + * @param {string} str Value to set the placeholder to. + * @return {InputSurface} this, allowing method chaining. + */ +InputSurface.prototype.setPlaceholder = function setPlaceholder(str) { + this._placeholder = str; + this._contentDirty = true; + return this; +}; + +/** + * Focus on the current input, pulling up the keyboard on mobile. + * + * @method focus + * @return {InputSurface} this, allowing method chaining. + */ +InputSurface.prototype.focus = function focus() { + if (this._currentTarget) this._currentTarget.focus(); + return this; +}; + +/** + * Blur the current input, hiding the keyboard on mobile. + * + * @method blur + * @return {InputSurface} this, allowing method chaining. + */ +InputSurface.prototype.blur = function blur() { + if (this._currentTarget) this._currentTarget.blur(); + return this; +}; + +/** + * Set the placeholder conent. + * Note: Triggers a repaint next tick. + * + * @method setValue + * @param {string} str Value to set the main input value to. + * @return {InputSurface} this, allowing method chaining. + */ +InputSurface.prototype.setValue = function setValue(str) { + this._value = str; + this._contentDirty = true; + return this; +}; + +/** + * Set the type of element to display conent. + * Note: Triggers a repaint next tick. + * + * @method setType + * @param {string} str type of the input surface (e.g. 'button', 'text') + * @return {InputSurface} this, allowing method chaining. + */ +InputSurface.prototype.setType = function setType(str) { + this._type = str; + this._contentDirty = true; + return this; +}; + +/** + * Get the value of the inner content of the element (e.g. the entered text) + * + * @method getValue + * @return {string} value of element + */ +InputSurface.prototype.getValue = function getValue() { + if (this._currentTarget) { + return this._currentTarget.value; + } + else { + return this._value; + } +}; + +/** + * Set the name attribute of the element. + * Note: Triggers a repaint next tick. + * + * @method setName + * @param {string} str element name + * @return {InputSurface} this, allowing method chaining. + */ +InputSurface.prototype.setName = function setName(str) { + this._name = str; + this._contentDirty = true; + return this; +}; + +/** + * Get the name attribute of the element. + * + * @method getName + * @return {string} name of element + */ +InputSurface.prototype.getName = function getName() { + return this._name; +}; + +/** + * Place the document element this component manages into the document. + * + * @private + * @method deploy + * @param {Node} target document parent of this container + */ +InputSurface.prototype.deploy = function deploy(target) { + if (this._placeholder !== '') target.placeholder = this._placeholder; + target.value = this._value; + target.type = this._type; + target.name = this._name; +}; + +module.exports = InputSurface; +},{"../core/Surface":14}],80:[function(_dereq_,module,exports){ +var InputSurface = _dereq_('./InputSurface'); + +function SubmitInputSurface(options) { + InputSurface.apply(this, arguments); + this._type = 'submit'; + if (options && options.onClick) this.setOnClick(options.onClick); +} + +SubmitInputSurface.prototype = Object.create(InputSurface.prototype); +SubmitInputSurface.prototype.constructor = SubmitInputSurface; + +SubmitInputSurface.prototype.setOnClick = function(onClick) { + this.onClick = onClick; +}; + +SubmitInputSurface.prototype.deploy = function deploy(target) { + if (this.onclick) target.onClick = this.onClick; + InputSurface.prototype.deploy.apply(this, arguments); +}; + +module.exports = SubmitInputSurface; +},{"./InputSurface":79}],81:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Surface = _dereq_('../core/Surface'); + +/** + * A Famo.us surface in the form of an HTML textarea element. + * This extends the Surface class. + * + * @class TextareaSurface + * @extends Surface + * @constructor + * @param {Object} [options] overrides of default options + * @param {string} [options.placeholder] placeholder text hint that describes the expected value of an textarea element + * @param {string} [options.value] value of text + * @param {string} [options.name] specifies the name of textarea + * @param {string} [options.wrap] specify 'hard' or 'soft' wrap for textarea + * @param {number} [options.cols] number of columns in textarea + * @param {number} [options.rows] number of rows in textarea + */ +function TextareaSurface(options) { + this._placeholder = options.placeholder || ''; + this._value = options.value || ''; + this._name = options.name || ''; + this._wrap = options.wrap || ''; + this._cols = options.cols || ''; + this._rows = options.rows || ''; + + Surface.apply(this, arguments); + this.on('click', this.focus.bind(this)); +} +TextareaSurface.prototype = Object.create(Surface.prototype); +TextareaSurface.prototype.constructor = TextareaSurface; + +TextareaSurface.prototype.elementType = 'textarea'; +TextareaSurface.prototype.elementClass = 'famous-surface'; + +/** + * Set placeholder text. Note: Triggers a repaint. + * + * @method setPlaceholder + * @param {string} str Value to set the placeholder to. + * @return {TextareaSurface} this, allowing method chaining. + */ +TextareaSurface.prototype.setPlaceholder = function setPlaceholder(str) { + this._placeholder = str; + this._contentDirty = true; + return this; +}; + +/** + * Focus on the current input, pulling up the keyboard on mobile. + * + * @method focus + * @return {TextareaSurface} this, allowing method chaining. + */ +TextareaSurface.prototype.focus = function focus() { + if (this._currentTarget) this._currentTarget.focus(); + return this; +}; + +/** + * Blur the current input, hiding the keyboard on mobile. + * + * @method focus + * @return {TextareaSurface} this, allowing method chaining. + */ +TextareaSurface.prototype.blur = function blur() { + if (this._currentTarget) this._currentTarget.blur(); + return this; +}; + +/** + * Set the value of textarea. + * Note: Triggers a repaint next tick. + * + * @method setValue + * @param {string} str Value to set the main textarea value to. + * @return {TextareaSurface} this, allowing method chaining. + */ +TextareaSurface.prototype.setValue = function setValue(str) { + this._value = str; + this._contentDirty = true; + return this; +}; + +/** + * Get the value of the inner content of the textarea (e.g. the entered text) + * + * @method getValue + * @return {string} value of element + */ +TextareaSurface.prototype.getValue = function getValue() { + if (this._currentTarget) { + return this._currentTarget.value; + } + else { + return this._value; + } +}; + +/** + * Set the name attribute of the element. + * Note: Triggers a repaint next tick. + * + * @method setName + * @param {string} str element name + * @return {TextareaSurface} this, allowing method chaining. + */ +TextareaSurface.prototype.setName = function setName(str) { + this._name = str; + this._contentDirty = true; + return this; +}; + +/** + * Get the name attribute of the element. + * + * @method getName + * @return {string} name of element + */ +TextareaSurface.prototype.getName = function getName() { + return this._name; +}; + +/** + * Set the wrap of textarea. + * Note: Triggers a repaint next tick. + * + * @method setWrap + * @param {string} str wrap of the textarea surface (e.g. 'soft', 'hard') + * @return {TextareaSurface} this, allowing method chaining. + */ +TextareaSurface.prototype.setWrap = function setWrap(str) { + this._wrap = str; + this._contentDirty = true; + return this; +}; + +/** + * Set the number of columns visible in the textarea. + * Note: Overridden by surface size; set width to true. (eg. size: [true, *]) + * Triggers a repaint next tick. + * + * @method setColumns + * @param {number} num columns in textarea surface + * @return {TextareaSurface} this, allowing method chaining. + */ +TextareaSurface.prototype.setColumns = function setColumns(num) { + this._cols = num; + this._contentDirty = true; + return this; +}; + +/** + * Set the number of rows visible in the textarea. + * Note: Overridden by surface size; set height to true. (eg. size: [*, true]) + * Triggers a repaint next tick. + * + * @method setRows + * @param {number} num rows in textarea surface + * @return {TextareaSurface} this, allowing method chaining. + */ +TextareaSurface.prototype.setRows = function setRows(num) { + this._rows = num; + this._contentDirty = true; + return this; +}; + +/** + * Place the document element this component manages into the document. + * + * @private + * @method deploy + * @param {Node} target document parent of this container + */ +TextareaSurface.prototype.deploy = function deploy(target) { + if (this._placeholder !== '') target.placeholder = this._placeholder; + if (this._value !== '') target.value = this._value; + if (this._name !== '') target.name = this._name; + if (this._wrap !== '') target.wrap = this._wrap; + if (this._cols !== '') target.cols = this._cols; + if (this._rows !== '') target.rows = this._rows; +}; + +module.exports = TextareaSurface; +},{"../core/Surface":14}],82:[function(_dereq_,module,exports){ +/* This Source Code Form is subject to the terms of the Mozilla Public + * License, v. 2.0. If a copy of the MPL was not distributed with this + * file, You can obtain one at http://mozilla.org/MPL/2.0/. + * + * Owner: mark@famo.us + * @license MPL 2.0 + * @copyright Famous Industries, Inc. 2014 + */ + +var Surface = _dereq_('../core/Surface'); + +/** + * Creates a famous surface containing video content. Currently adding + * controls and manipulating the video are not supported through the + * surface interface, but can be accomplished via standard JavaScript + * manipulation of the video DOM element. + * This extends the Surface class. + * + * @class VideoSurface + * @extends Surface + * @constructor + * @param {Object} [options] default option overrides + * @param {Array.Number} [options.size] [width, height] in pixels + * @param {Array.string} [options.classes] CSS classes to set on inner content + * @param {Array} [options.properties] string dictionary of HTML attributes to set on target div + * @param {String} [options.src] videoUrl URL + * @param {boolean} [options.autoplay] autoplay + */ +function VideoSurface(options) { + Surface.apply(this, arguments); + this._videoUrl = undefined; + this.options = Object.create(VideoSurface.DEFAULT_OPTIONS); + if (options) this.setOptions(options); +} + +VideoSurface.prototype = Object.create(Surface.prototype); +VideoSurface.prototype.constructor = VideoSurface; + +VideoSurface.DEFAULT_OPTIONS = { + autoplay: false +}; + +VideoSurface.prototype.elementType = 'video'; +VideoSurface.prototype.elementClass = 'famous-surface'; + +/** + * Set internal options, overriding any default options + * + * @method setOptions + * + * @param {Object} [options] overrides of default options + * @param {Boolean} [options.autoplay] HTML autoplay + */ +VideoSurface.prototype.setOptions = function setOptions(options) { + if (options.size) this.setSize(options.size); + if (options.classes) this.setClasses(options.classes); + if (options.properties) this.setProperties(options.properties); + if (options.autoplay) this.options.autoplay = options.autoplay; + if (options.src) { + this._videoUrl = options.src; + this._contentDirty = true; + } +}; + +/** + * Set url of the video. + * + * @method setContent + * @param {string} videoUrl URL + */ +VideoSurface.prototype.setContent = function setContent(videoUrl) { + this._videoUrl = videoUrl; + this._contentDirty = true; +}; + +/** + * Place the document element this component manages into the document. + * Note: In the case of VideoSurface, simply changes the options on the target. + * + * @private + * @method deploy + * @param {Node} target document parent of this container + */ +VideoSurface.prototype.deploy = function deploy(target) { + target.src = this._videoUrl; + target.autoplay = this.options.autoplay; +}; + +/** + * Remove this component and contained content from the document. + * Note: This doesn't actually remove the