#2176: add ACS style reaction layout #2307
Merged
GitHub Actions / ubuntu-latest-x86_64-java_test_report
failed
Sep 12, 2024 in 0s
274 tests run, 257 passed, 0 skipped, 17 failed.
Annotations
Check failure on line 1 in api/tests/integration/tests/basic/molecules/arom.sdf
github-actions / ubuntu-latest-x86_64-java_test_report
arom.basic
[FAILED]
Raw output
Diff:
- 0.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -2.4000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.4000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.4000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -2.4000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.4000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.4000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -2.4000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.4000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.4000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
Check failure on line 1 in api/c/tests/unit/tests/basic.cpp
github-actions / ubuntu-latest-x86_64-java_test_report
basic.allenes
[FAILED]
Raw output
Diff:
- -0.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -0.8000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -0.5000 0.8660 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
+ -0.8000 1.3856 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 4.0000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.5000 0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 4.0000 1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -0.5000 -0.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
+ -0.8000 -1.3856 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -0.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -0.8000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.5000 -0.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
+ 4.0000 -1.3856 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 2.5000 0.8660 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
+ 4.0000 1.3856 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
- -3.4641 1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -5.5426 1.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -3.4641 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -5.5426 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -4.3301 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -6.9282 -0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5981 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.1569 -0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -2.7713 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.3856 0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -0.8660 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.3856 2.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.3856 0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.7321 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.7713 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.5981 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 4.1569 0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 -1.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 -1.6000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8660 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.3856 -2.4000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.3856 0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.3856 -0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -2.7713 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.7321 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.7713 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.3856 0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.3856 -0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -2.7713 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.7321 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.7713 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.3856 0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.3856 -0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -2.7713 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.7321 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.7713 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.3856 0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.3856 -0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -2.7713 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.7321 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.7713 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.3856 0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.3856 -0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -2.7713 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.7321 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.7713 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.3856 0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.3856 -0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -2.7713 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.7321 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.7713 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.3856 0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.3856 -0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -2.7713 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.7321 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.7713 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.3856 0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.3856 -0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -2.7713 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.7321 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.7713 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.3856 0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.3856 -0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -2.7713 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.7321 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.7713 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.3856 0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.3856 -0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -2.7713 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.7321 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.7713 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.3856 0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.3856 -0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -2.7713 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.7321 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.7713 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.3856 0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.3856 -0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -2.7713 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.7321 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.7713 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.3856 0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.3856 -0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -2.7713 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.7321 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.7713 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 -0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 -1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 -0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 -1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 -0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 -1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 -0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 -1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 -0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 -1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 -0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 -1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 -0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 -1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 -0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 -1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 -0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 -1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 -0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 -1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 -0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 -1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 -0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 -1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 -0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 -1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 -0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 -1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 -0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 -1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 -0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 -1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 -0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 -1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 -0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 -1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 0.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 1.3856 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 -0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 -1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 0.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 1.3856 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 -0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 -1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 0.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 1.3856 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -0.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -0.8000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.5000 -0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 4.0000 -1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -0.5000 0.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
+ -0.8000 1.3856 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 2.5000 0.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
+ 4.0000 1.3856 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -0.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -0.8000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.5000 -0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 4.0000 -1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -0.5000 0.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
+ -0.8000 1.3856 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 2.5000 0.8660 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
+ 4.0000 1.3856 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 2.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 4.0000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.4000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 1.7321 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 2.7713 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
- 3.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 4.8000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 3.0000 1.7321 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
+ 4.8000 2.7713 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
- 7.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 12.0000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 6.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 10.4000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.5000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 8.8000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 8.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.0000 1.7321 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
+ 8.0000 2.7713 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 12.8000 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 8.0000 1.7321 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
+ 12.8000 2.7713 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -3.2000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 0.8660 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 1.3856 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 -0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 -1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.7321 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.7713 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8660 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.3856 -0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -0.8660 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.3856 0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -2.7713 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5981 -0.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.1569 -0.8000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.5981 -0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 4.1569 -0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
Check failure on line 1 in api/c/tests/unit/tests/basic.cpp
github-actions / ubuntu-latest-x86_64-java_test_report
basic.attachment_points
[FAILED]
Raw output
Diff:
- 1.7321 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 4.4341 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.5981 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 6.6510 1.2800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4641 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 8.8682 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.4641 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 8.8682 -2.5600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.5981 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 6.6510 -3.8400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.7321 -1.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 4.4341 -2.5600 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8661 0.5000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
+ 3.0484 0.8000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8661 -1.5000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
+ 3.0484 -3.3600 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0000 0.0000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.6000 0.0000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0000 0.0000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.6000 0.0000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0000 0.0000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.6000 0.0000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
- -0.8660 0.5000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.3856 0.8000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8660 0.5000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.3856 0.8000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0000 0.0000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.6000 0.0000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
- -0.8660 0.5000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.3856 0.8000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8660 0.5000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.3856 0.8000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0000 0.0000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.6000 0.0000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
- -0.8660 0.5000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.3856 0.8000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
- 0.8660 0.5000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.3856 0.8000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
- 1.0000 0.0000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.6000 0.0000 0.0000 I 0 0 0 0 0 0 0 0 0 0 0 0
Check failure on line 1 in api/c/tests/unit/tests/basic.cpp
github-actions / ubuntu-latest-x86_64-java_test_report
basic.ketfile_stereo_desc
[FAILED]
Raw output
Diff:
- crazystereo.rxn:SUCCEED
+ crazystereo.rxn:FAILED
+ ---
+ +++
+ @@ -13,12 +13,12 @@
+ "mode": "open-angle",
+ "pos": [
+ {
+ - "x": 4.164198398590088,
+ + "x": 9.542717933654786,
+ "y": 0.0,
+ "z": 0.0
+ },
+ {
+ - "x": 4.7641987800598148,
+ + "x": 11.542718887329102,
+ "y": 0.0,
+ "z": 0.0
+ }
+ @@ -33,80 +33,80 @@
+ {
+ "label": "C",
+ "location": [
+ - 1.7320992946624756,
+ - 0.49999362230300906,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 0.8660491108894348,
+ - 0.9999874234199524,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 0.0,
+ - 0.49999362230300906,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 0.0,
+ - -0.4999937117099762,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 0.8660491108894348,
+ - -0.9999874234199524,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 1.7320992946624756,
+ - -0.4999937117099762,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 2.5980277061462404,
+ - -0.9999874234199524,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 3.464198589324951,
+ - -0.4999937117099762,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 3.464198589324951,
+ - 0.49999362230300906,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 2.5980277061462404,
+ - 0.9999874234199524,
+ + 4.071358680725098,
+ + 0.7999899387359619,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 2.685678482055664,
+ + 1.599979877471924,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 1.2999999523162842,
+ + 0.7999899387359619,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 1.2999999523162842,
+ + -0.7999899387359619,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 2.685678482055664,
+ + -1.599979877471924,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 4.071358680725098,
+ + -0.7999899387359619,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 5.456844329833984,
+ + -1.599979877471924,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 6.842718124389648,
+ + -0.7999899387359619,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 6.842718124389648,
+ + 0.7999899387359619,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 5.456844329833984,
+ + 1.599979877471924,
+ 0.0
+ ]
+ }
+ @@ -197,24 +197,24 @@
+ {
+ "label": "C",
+ "location": [
+ - 8.928276062011719,
+ - 2.249971866607666,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 8.062226295471192,
+ - 1.7499775886535645,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 8.062226295471192,
+ - 0.7499902248382568,
+ + 19.78524208068848,
+ + 3.599954843521118,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 18.39956283569336,
+ + 2.799964189529419,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 18.39956283569336,
+ + 1.1999847888946534,
+ 0.0
+ ],
+ "stereoLabel": "&1"
+ @@ -222,32 +222,32 @@
+ {
+ "label": "C",
+ "location": [
+ - 8.928276062011719,
+ - 0.2499966621398926,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 9.794326782226565,
+ - 0.7499902248382568,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 9.794326782226565,
+ - 1.7499775886535645,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 7.196298122406006,
+ - 0.2499966621398926,
+ + 19.78524208068848,
+ + 0.3999948501586914,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 21.170923233032228,
+ + 1.1999847888946534,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 21.170923233032228,
+ + 2.799964189529419,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 17.01407814025879,
+ + 0.3999948501586914,
+ 0.0
+ ],
+ "stereoLabel": "&1"
+ @@ -255,64 +255,64 @@
+ {
+ "label": "C",
+ "location": [
+ - 6.330248355865479,
+ - 0.7499902248382568,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 5.464198589324951,
+ - 0.2499966621398926,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 5.464198589324951,
+ - -0.7499908208847046,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 6.330248355865479,
+ - -1.2499845027923585,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 7.196298122406006,
+ - -0.7499908208847046,
+ + 15.628397941589356,
+ + 1.1999847888946534,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 14.24271869659424,
+ + 0.3999948501586914,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 14.24271869659424,
+ + -1.1999850273132325,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 15.628397941589356,
+ + -1.999975085258484,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 17.01407814025879,
+ + -1.1999850273132325,
+ 0.0
+ ]
+ },
+ {
+ "label": "P",
+ "location": [
+ - 8.062226295471192,
+ - -1.2499845027923585,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 9.06221389770508,
+ - -1.2499845027923585,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 8.062226295471192,
+ - -2.249971866607666,
+ + 18.39956283569336,
+ + -1.999975085258484,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 19.99954223632813,
+ + -1.999975085258484,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 18.39956283569336,
+ + -3.599954843521118,
+ 0.0
+ ]
+ }
Check failure on line 1 in api/c/tests/unit/tests/formats.cpp
github-actions / ubuntu-latest-x86_64-java_test_report
formats.fasta_to_ket
[FAILED]
Raw output
Diff:
- test_peptide.ket:SUCCEED
+ test_peptide.ket:FAILED
- test_rna.ket:SUCCEED
+ ---
- test_dna.ket:SUCCEED
- multiseq.ket:SUCCEED
+ +++
- break_peptide.ket:SUCCEED
+ @@ -7072,7 +7072,7 @@
+ "id": "1",
+ "seqid": 2,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -7083,7 +7083,7 @@
+ "id": "2",
+ "seqid": 3,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -7094,7 +7094,7 @@
+ "id": "3",
+ "seqid": 4,
+ "position": {
+ - "x": 3.000000,
+ + "x": 4.800000,
+ "y": -0.000000
+ },
+ "alias": "G",
+ @@ -7105,7 +7105,7 @@
+ "id": "4",
+ "seqid": 5,
+ "position": {
+ - "x": 4.000000,
+ + "x": 6.400000,
+ "y": -0.000000
+ },
+ "alias": "Y",
+ @@ -7116,7 +7116,7 @@
+ "id": "5",
+ "seqid": 6,
+ "position": {
+ - "x": 5.000000,
+ + "x": 8.000000,
+ "y": -0.000000
+ },
+ "alias": "V",
+ @@ -7127,7 +7127,7 @@
+ "id": "6",
+ "seqid": 7,
+ "position": {
+ - "x": 6.000000,
+ + "x": 9.600000,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -7138,7 +7138,7 @@
+ "id": "7",
+ "seqid": 8,
+ "position": {
+ - "x": 7.000000,
+ + "x": 11.200000,
+ "y": -0.000000
+ },
+ "alias": "G",
+ @@ -7149,7 +7149,7 @@
+ "id": "8",
+ "seqid": 9,
+ "position": {
+ - "x": 8.000000,
+ + "x": 12.800000,
+ "y": -0.000000
+ },
+ "alias": "Q",
+ @@ -7160,7 +7160,7 @@
+ "id": "9",
+ "seqid": 10,
+ "position": {
+ - "x": 9.000000,
+ + "x": 14.400001,
+ "y": -0.000000
+ },
+ "alias": "A",
+ @@ -7171,7 +7171,7 @@
+ "id": "10",
+ "seqid": 11,
+ "position": {
+ - "x": 10.000000,
+ + "x": 16.000000,
+ "y": -0.000000
+ },
+ "alias": "T",
+ @@ -7182,7 +7182,7 @@
+ "id": "11",
+ "seqid": 12,
+ "position": {
+ - "x": 11.000000,
+ + "x": 17.600000,
+ "y": -0.000000
+ },
+ "alias": "T",
+ @@ -7193,7 +7193,7 @@
+ "id": "12",
+ "seqid": 13,
+ "position": {
+ - "x": 12.000000,
+ + "x": 19.200001,
+ "y": -0.000000
+ },
+ "alias": "Q",
+ @@ -7204,7 +7204,7 @@
+ "id": "13",
+ "seqid": 14,
+ "position": {
+ - "x": 13.000000,
+ + "x": 20.800001,
+ "y": -0.000000
+ },
+ "alias": "E",
+ @@ -7215,7 +7215,7 @@
+ "id": "14",
+ "seqid": 15,
+ "position": {
+ - "x": 14.000000,
+ + "x": 22.400000,
+ "y": -0.000000
+ },
+ "alias": "A",
+ @@ -7226,7 +7226,7 @@
+ "id": "15",
+ "seqid": 16,
+ "position": {
+ - "x": 15.000000,
+ + "x": 24.000000,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -7237,7 +7237,7 @@
+ "id": "16",
+ "seqid": 17,
+ "position": {
+ - "x": 16.000000,
+ + "x": 25.600000,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -7248,7 +7248,7 @@
+ "id": "17",
+ "seqid": 18,
+ "position": {
+ - "x": 17.000000,
+ + "x": 27.200001,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -7259,7 +7259,7 @@
+ "id": "18",
+ "seqid": 19,
+ "position": {
+ - "x": 18.000000,
+ + "x": 28.800001,
+ "y": -0.000000
+ },
+ "alias": "A",
+ @@ -7270,7 +7270,7 @@
+ "id": "19",
+ "seqid": 20,
+ "position": {
+ - "x": 19.000000,
+ + "x": 30.400000,
+ "y": -0.000000
+ },
+ "alias": "E",
+ @@ -7281,7 +7281,7 @@
+ "id": "20",
+ "seqid": 21,
+ "position": {
+ - "x": 20.000000,
+ + "x": 32.000000,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -7292,7 +7292,7 @@
+ "id": "21",
+ "seqid": 22,
+ "position": {
+ - "x": 21.000000,
+ + "x": 33.600002,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -7303,7 +7303,7 @@
+ "id": "22",
+ "seqid": 23,
+ "position": {
+ - "x": 22.000000,
+ + "x": 35.200001,
+ "y": -0.000000
+ },
+ "alias": "V",
+ @@ -7314,7 +7314,7 @@
+ "id": "23",
+ "seqid": 24,
+ "position": {
+ - "x": 23.000000,
+ + "x": 36.799999,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -7325,7 +7325,7 @@
+ "id": "24",
+ "seqid": 25,
+ "position": {
+ - "x": 24.000000,
+ + "x": 38.400002,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -7336,7 +7336,7 @@
+ "id": "25",
+ "seqid": 26,
+ "position": {
+ - "x": 25.000000,
+ + "x": 40.000000,
+ "y": -0.000000
+ },
+ "alias": "G",
+ @@ -7347,7 +7347,7 @@
+ "id": "26",
+ "seqid": 27,
+ "position": {
+ - "x": 26.000000,
+ + "x": 41.600002,
+ "y": -0.000000
+ },
+ "alias": "T",
+ @@ -7358,7 +7358,7 @@
+ "id": "27",
+ "seqid": 28,
+ "position": {
+ - "x": 27.000000,
+ + "x": 43.200001,
+ "y": -0.000000
+ },
+ "alias": "Y",
+ @@ -7369,7 +7369,7 @@
+ "id": "28",
+ "seqid": 29,
+ "position": {
+ - "x": 28.000000,
+ + "x": 44.799999,
+ "y": -0.000000
+ },
+ "alias": "V",
+ @@ -7380,7 +7380,7 @@
+ "id": "29",
+ "seqid": 30,
+ "position": {
+ - "x": 29.000000,
+ + "x": 46.400002,
+ "y": -0.000000
+ },
+ "alias": "V",
+ @@ -7391,7 +7391,7 @@
+ "id": "30",
+ "seqid": 31,
+ "position": {
+ - "x": 30.000000,
+ + "x": 48.000000,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -7402,7 +7402,7 @@
+ "id": "31",
+ "seqid": 32,
+ "position": {
+ - "x": 31.000000,
+ + "x": 49.600002,
+ "y": -0.000000
+ },
+ "alias": "E",
+ @@ -7413,7 +7413,7 @@
+ "id": "32",
+ "seqid": 33,
+ "position": {
+ - "x": 32.000000,
+ + "x": 51.200001,
+ "y": -0.000000
+ },
+ "alias": "Y",
+ @@ -7424,7 +7424,7 @@
+ "id": "33",
+ "seqid": 34,
+ "position": {
+ - "x": 33.000000,
+ + "x": 52.799999,
+ "y": -0.000000
+ },
+ "alias": "D",
+ @@ -7435,7 +7435,7 @@
+ "id": "34",
+ "seqid": 35,
+ "position": {
+ - "x": 34.000000,
+ + "x": 54.400002,
+ "y": -0.000000
+ },
+ "alias": "N",
+ @@ -7446,7 +7446,7 @@
+ "id": "35",
+ "seqid": 36,
+ "position": {
+ - "x": 35.000000,
+ + "x": 56.000000,
+ "y": -0.000000
+ },
+ "alias": "V",
+ @@ -7457,7 +7457,7 @@
+ "id": "36",
+ "seqid": 37,
+ "position": {
+ - "x": 36.000000,
+ + "x": 57.600002,
+ "y": -0.000000
+ },
+ "alias": "K",
+ @@ -7468,7 +7468,7 @@
+ "id": "37",
+ "seqid": 38,
+ "position": {
+ - "x": 37.000000,
+ + "x": 59.200001,
+ "y": -0.000000
+ },
+ "alias": "A",
+ @@ -7479,7 +7479,7 @@
+ "id": "38",
+ "seqid": 39,
+ "position": {
+ - "x": 38.000000,
+ + "x": 60.799999,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -7490,7 +7490,7 @@
+ "id": "39",
+ "seqid": 40,
+ "position": {
+ - "x": 39.000000,
+ + "x": 62.400002,
+ "y": -0.000000
+ },
+ "alias": "G",
+ @@ -7501,7 +7501,7 @@
+ "id": "40",
+ "seqid": 41,
+ "position": {
+ - "x": 40.000000,
+ + "x": 64.000000,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -7512,7 +7512,7 @@
+ "id": "41",
+ "seqid": 42,
+ "position": {
+ - "x": 41.000000,
+ + "x": 65.599998,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -7523,7 +7523,7 @@
+ "id": "42",
+ "seqid": 43,
+ "position": {
+ - "x": 42.000000,
+ + "x": 67.200005,
+ "y": -0.000000
+ },
+ "alias": "T",
+ @@ -7534,7 +7534,7 @@
+ "id": "43",
+ "seqid": 44,
+ "position": {
+ - "x": 43.000000,
+ + "x": 68.800003,
+ "y": -0.000000
+ },
+ "alias": "N",
+ @@ -7545,7 +7545,7 @@
+ "id": "44",
+ "seqid": 45,
+ "position": {
+ - "x": 44.000000,
+ + "x": 70.400002,
+ "y": -0.000000
+ },
+ "alias": "V",
+ @@ -7556,7 +7556,7 @@
+ "id": "45",
+ "seqid": 46,
+ "position": {
+ - "x": 45.000000,
+ + "x": 72.000000,
+ "y": -0.000000
+ },
+ "alias": "T",
+ @@ -7567,7 +7567,7 @@
+ "id": "46",
+ "seqid": 47,
+ "position": {
+ - "x": 46.000000,
+ + "x": 73.599998,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -7578,7 +7578,7 @@
+ "id": "47",
+ "seqid": 48,
+ "position": {
+ - "x": 47.000000,
+ + "x": 75.200005,
+ "y": -0.000000
+ },
+ "alias": "G",
+ @@ -7589,7 +7589,7 @@
+ "id": "48",
+ "seqid": 49,
+ "position": {
+ - "x": 48.000000,
+ + "x": 76.800003,
+ "y": -0.000000
+ },
+ "alias": "S",
+ @@ -7600,7 +7600,7 @@
+ "id": "49",
+ "seqid": 50,
+ "position": {
+ - "x": 49.000000,
+ + "x": 78.400002,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -7611,7 +7611,7 @@
+ "id": "50",
+ "seqid": 51,
+ "position": {
+ - "x": 50.000000,
+ + "x": 80.000000,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -7622,7 +7622,7 @@
+ "id": "51",
+ "seqid": 52,
+ "position": {
+ - "x": 51.000000,
+ + "x": 81.599998,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -7633,7 +7633,7 @@
+ "id": "52",
+ "seqid": 53,
+ "position": {
+ - "x": 52.000000,
+ + "x": 83.200005,
+ "y": -0.000000
+ },
+ "alias": "D",
+ @@ -7644,7 +7644,7 @@
+ "id": "53",
+ "seqid": 54,
+ "position": {
+ - "x": 53.000000,
+ + "x": 84.800003,
+ "y": -0.000000
+ },
+ "alias": "D",
+ @@ -7655,7 +7655,7 @@
+ "id": "54",
+ "seqid": 55,
+ "position": {
+ - "x": 54.000000,
+ + "x": 86.400002,
+ "y": -0.000000
+ },
+ "alias": "N",
+ @@ -7666,7 +7666,7 @@
+ "id": "55",
+ "seqid": 56,
+ "position": {
+ - "x": 55.000000,
+ + "x": 88.000000,
+ "y": -0.000000
+ },
+ "alias": "M",
+ @@ -7677,7 +7677,7 @@
+ "id": "56",
+ "seqid": 57,
+ "position": {
+ - "x": 56.000000,
+ + "x": 89.599998,
+ "y": -0.000000
+ },
+ "alias": "N",
+ @@ -7688,7 +7688,7 @@
+ "id": "57",
+ "seqid": 58,
+ "position": {
+ - "x": 57.000000,
+ + "x": 91.200005,
+ "y": -0.000000
+ },
+ "alias": "D",
+ @@ -7699,7 +7699,7 @@
+ "id": "58",
+ "seqid": 59,
+ "position": {
+ - "x": 58.000000,
+ + "x": 92.800003,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -7710,7 +7710,7 @@
+ "id": "59",
+ "seqid": 60,
+ "position": {
+ - "x": 59.000000,
+ + "x": 94.400002,
+ "y": -0.000000
+ },
+ "alias": "E",
+ @@ -7721,7 +7721,7 @@
+ "id": "60",
+ "seqid": 61,
+ "position": {
+ - "x": 60.000000,
+ + "x": 96.000000,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -7732,7 +7732,7 @@
+ "id": "61",
+ "seqid": 62,
+ "position": {
+ - "x": 61.000000,
+ + "x": 97.599998,
+ "y": -0.000000
+ },
+ "alias": "V",
+ @@ -7743,7 +7743,7 @@
+ "id": "62",
+ "seqid": 63,
+ "position": {
+ - "x": 62.000000,
+ + "x": 99.200005,
+ "y": -0.000000
+ },
+ "alias": "Q",
+ @@ -7754,7 +7754,7 @@
+ "id": "63",
+ "seqid": 64,
+ "position": {
+ - "x": 63.000000,
+ + "x": 100.800003,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -7765,7 +7765,7 @@
+ "id": "64",
+ "seqid": 65,
+ "position": {
+ - "x": 64.000000,
+ + "x": 102.400002,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -7776,7 +7776,7 @@
+ "id": "65",
+ "seqid": 66,
+ "position": {
+ - "x": 65.000000,
+ + "x": 104.000000,
+ "y": -0.000000
+ },
+ "alias": "K",
+ @@ -7787,7 +7787,7 @@
+ "id": "66",
+ "seqid": 67,
+ "position": {
+ - "x": 66.000000,
+ + "x": 105.599998,
+ "y": -0.000000
+ },
+ "alias": "Q",
+ @@ -7798,7 +7798,7 @@
+ "id": "67",
+ "seqid": 68,
+ "position": {
+ - "x": 67.000000,
+ + "x": 107.200005,
+ "y": -0.000000
+ },
+ "alias": "F",
+ @@ -7809,7 +7809,7 @@
+ "id": "68",
+ "seqid": 69,
+ "position": {
+ - "x": 68.000000,
+ + "x": 108.800003,
+ "y": -0.000000
+ },
+ "alias": "N",
+ @@ -7820,7 +7820,7 @@
+ "id": "69",
+ "seqid": 70,
+ "position": {
+ - "x": 69.000000,
+ + "x": 110.400002,
+ "y": -0.000000
+ },
+ "alias": "N",
+ @@ -7831,7 +7831,7 @@
+ "id": "70",
+ "seqid": 71,
+ "position": {
+ - "x": 70.000000,
+ + "x": 112.000000,
+ "y": -0.000000
+ },
+ "alias": "S",
+ @@ -7842,7 +7842,7 @@
+ "id": "71",
+ "seqid": 72,
+ "position": {
+ - "x": 71.000000,
+ + "x": 113.599998,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -7853,7 +7853,7 @@
+ "id": "72",
+ "seqid": 73,
+ "position": {
+ - "x": 72.000000,
+ + "x": 115.200005,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -7864,7 +7864,7 @@
+ "id": "73",
+ "seqid": 74,
+ "position": {
+ - "x": 73.000000,
+ + "x": 116.800003,
+ "y": -0.000000
+ },
+ "alias": "V",
+ @@ -7875,7 +7875,7 @@
+ "id": "74",
+ "seqid": 75,
+ "position": {
+ - "x": 74.000000,
+ + "x": 118.400002,
+ "y": -0.000000
+ },
+ "alias": "Y",
+ @@ -7886,7 +7886,7 @@
+ "id": "75",
+ "seqid": 76,
+ "position": {
+ - "x": 75.000000,
+ + "x": 120.000000,
+ "y": -0.000000
+ },
+ "alias": "T",
+ @@ -7897,7 +7897,7 @@
+ "id": "76",
+ "seqid": 77,
+ "position": {
+ - "x": 76.000000,
+ + "x": 121.599998,
+ "y": -0.000000
+ },
+ "alias": "K",
+ @@ -7908,7 +7908,7 @@
+ "id": "77",
+ "seqid": 78,
+ "position": {
+ - "x": 77.000000,
+ + "x": 123.200005,
+ "y": -0.000000
+ },
+ "alias": "A",
+ @@ -7919,7 +7919,7 @@
+ "id": "78",
+ "seqid": 79,
+ "position": {
+ - "x": 78.000000,
+ + "x": 124.800003,
+ "y": -0.000000
+ },
+ "alias": "K",
+ @@ -7930,7 +7930,7 @@
+ "id": "79",
+ "seqid": 80,
+ "position": {
+ - "x": 79.000000,
+ + "x": 126.400002,
+ "y": -0.000000
+ },
+ "alias": "V",
+ @@ -7941,7 +7941,7 @@
+ "id": "80",
+ "seqid": 81,
+ "position": {
+ - "x": 80.000000,
+ + "x": 128.000000,
+ "y": -0.000000
+ },
+ "alias": "K",
+ @@ -7952,7 +7952,7 @@
+ "id": "81",
+ "seqid": 82,
+ "position": {
+ - "x": 81.000000,
+ + "x": 129.600006,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -7963,7 +7963,7 @@
+ "id": "82",
+ "seqid": 83,
+ "position": {
+ - "x": 82.000000,
+ + "x": 131.199997,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -7974,7 +7974,7 @@
+ "id": "83",
+ "seqid": 84,
+ "position": {
+ - "x": 83.000000,
+ + "x": 132.800003,
+ "y": -0.000000
+ },
+ "alias": "C",
+ @@ -7985,7 +7985,7 @@
+ "id": "84",
+ "seqid": 85,
+ "position": {
+ - "x": 84.000000,
+ + "x": 134.400009,
+ "y": -0.000000
+ },
+ "alias": "D",
+ @@ -7996,7 +7996,7 @@
+ "id": "85",
+ "seqid": 86,
+ "position": {
+ - "x": 85.000000,
+ + "x": 136.000000,
+ "y": -0.000000
+ },
+ "alias": "M",
+ @@ -8007,7 +8007,7 @@
+ "id": "86",
+ "seqid": 87,
+ "position": {
+ - "x": 86.000000,
+ + "x": 137.600006,
+ "y": -0.000000
+ },
+ "alias": "N",
+ @@ -8018,7 +8018,7 @@
+ "id": "87",
+ "seqid": 88,
+ "position": {
+ - "x": 87.000000,
+ + "x": 139.199997,
+ "y": -0.000000
+ },
+ "alias": "N",
+ @@ -8029,7 +8029,7 @@
+ "id": "88",
+ "seqid": 89,
+ "position": {
+ - "x": 88.000000,
+ + "x": 140.800003,
+ "y": -0.000000
+ },
+ "alias": "H",
+ @@ -8040,7 +8040,7 @@
+ "id": "89",
+ "seqid": 90,
+ "position": {
+ - "x": 89.000000,
+ + "x": 142.400009,
+ "y": -0.000000
+ },
+ "alias": "F",
+ @@ -8051,7 +8051,7 @@
+ "id": "90",
+ "seqid": 91,
+ "position": {
+ - "x": 90.000000,
+ + "x": 144.000000,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -8062,7 +8062,7 @@
+ "id": "91",
+ "seqid": 92,
+ "position": {
+ - "x": 91.000000,
+ + "x": 145.600006,
+ "y": -0.000000
+ },
+ "alias": "M",
+ @@ -8073,7 +8073,7 @@
+ "id": "92",
+ "seqid": 93,
+ "position": {
+ - "x": 92.000000,
+ + "x": 147.199997,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -8084,7 +8084,7 @@
+ "id": "93",
+ "seqid": 94,
+ "position": {
+ - "x": 93.000000,
+ + "x": 148.800003,
+ "y": -0.000000
+ },
+ "alias": "D",
+ @@ -8095,7 +8095,7 @@
+ "id": "94",
+ "seqid": 95,
+ "position": {
+ - "x": 94.000000,
+ + "x": 150.400009,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -8106,7 +8106,7 @@
+ "id": "95",
+ "seqid": 96,
+ "position": {
+ - "x": 95.000000,
+ + "x": 152.000000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -8117,7 +8117,7 @@
+ "id": "96",
+ "seqid": 97,
+ "position": {
+ - "x": 96.000000,
+ + "x": 153.600006,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -8128,7 +8128,7 @@
+ "id": "97",
+ "seqid": 98,
+ "position": {
+ - "x": 97.000000,
+ + "x": 155.199997,
+ "y": -0.000000
+ },
+ "alias": "F",
+ @@ -8139,7 +8139,7 @@
+ "id": "98",
+ "seqid": 99,
+ "position": {
+ - "x": 98.000000,
+ + "x": 156.800003,
+ "y": -0.000000
+ },
+ "alias": "A",
+ @@ -8150,7 +8150,7 @@
+ "id": "99",
+ "seqid": 100,
+ "position": {
+ - "x": 99.000000,
+ + "x": 158.400009,
+ "y": -0.000000
+ },
+ "alias": "G",
+ @@ -8161,7 +8161,7 @@
+ "id": "100",
+ "seqid": 101,
+ "position": {
+ - "x": 100.000000,
+ + "x": 160.000000,
+ "y": -0.000000
+ },
+ "alias": "T",
+ @@ -8172,7 +8172,7 @@
+ "id": "101",
+ "seqid": 102,
+ "position": {
+ - "x": 101.000000,
+ + "x": 161.600006,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -8183,7 +8183,7 @@
+ "id": "102",
+ "seqid": 103,
+ "position": {
+ - "x": 102.000000,
+ + "x": 163.199997,
+ "y": -0.000000
+ },
+ "alias": "A",
+ @@ -8194,7 +8194,7 @@
+ "id": "103",
+ "seqid": 104,
+ "position": {
+ - "x": 103.000000,
+ + "x": 164.800003,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -8205,7 +8205,7 @@
+ "id": "104",
+ "seqid": 105,
+ "position": {
+ - "x": 104.000000,
+ + "x": 166.400009,
+ "y": -0.000000
+ },
+ "alias": "E",
+ @@ -8216,7 +8216,7 @@
+ "id": "105",
+ "seqid": 106,
+ "position": {
+ - "x": 105.000000,
+ + "x": 168.000000,
+ "y": -0.000000
+ },
+ "alias": "A",
+ @@ -8227,7 +8227,7 @@
+ "id": "106",
+ "seqid": 107,
+ "position": {
+ - "x": 106.000000,
+ + "x": 169.600006,
+ "y": -0.000000
+ },
+ "alias": "E",
+ @@ -8238,7 +8238,7 @@
+ "id": "107",
+ "seqid": 108,
+ "position": {
+ - "x": 107.000000,
+ + "x": 171.199997,
+ "y": -0.000000
+ },
+ "alias": "D",
+ @@ -8249,7 +8249,7 @@
+ "id": "108",
+ "seqid": 109,
+ "position": {
+ - "x": 108.000000,
+ + "x": 172.800003,
+ "y": -0.000000
+ },
+ "alias": "E",
+ @@ -8260,7 +8260,7 @@
+ "id": "109",
+ "seqid": 110,
+ "position": {
+ - "x": 109.000000,
+ + "x": 174.400009,
+ "y": -0.000000
+ },
+ "alias": "E",
+ @@ -8271,7 +8271,7 @@
+ "id": "110",
+ "seqid": 111,
+ "position": {
+ - "x": 110.000000,
+ + "x": 176.000000,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -8282,7 +8282,7 @@
+ "id": "111",
+ "seqid": 112,
+ "position": {
+ - "x": 111.000000,
+ + "x": 177.600006,
+ "y": -0.000000
+ },
+ "alias": "K",
+ @@ -8293,7 +8293,7 @@
+ "id": "112",
+ "seqid": 113,
+ "position": {
+ - "x": 112.000000,
+ + "x": 179.199997,
+ "y": -0.000000
+ },
+ "alias": "S",
+ @@ -8304,7 +8304,7 @@
+ "id": "113",
+ "seqid": 114,
+ "position": {
+ - "x": 113.000000,
+ + "x": 180.800003,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -8315,7 +8315,7 @@
+ "id": "114",
+ "seqid": 115,
+ "position": {
+ - "x": 114.000000,
+ + "x": 182.400009,
+ "y": -0.000000
+ },
+ "alias": "Y",
+ @@ -8326,7 +8326,7 @@
+ "id": "115",
+ "seqid": 116,
+ "position": {
+ - "x": 115.000000,
+ + "x": 184.000000,
+ "y": -0.000000
+ },
+ "alias": "S",
+ @@ -8337,7 +8337,7 @@
+ "id": "116",
+ "seqid": 117,
+ "position": {
+ - "x": 116.000000,
+ + "x": 185.600006,
+ "y": -0.000000
+ },
+ "alias": "Q",
+ @@ -8348,7 +8348,7 @@
+ "id": "117",
+ "seqid": 118,
+ "position": {
+ - "x": 117.000000,
+ + "x": 187.199997,
+ "y": -0.000000
+ },
+ "alias": "D",
+ @@ -8359,7 +8359,7 @@
+ "id": "118",
+ "seqid": 119,
+ "position": {
+ - "x": 118.000000,
+ + "x": 188.800003,
+ "y": -0.000000
+ },
+ "alias": "G",
+ @@ -8370,7 +8370,7 @@
+ "id": "119",
+ "seqid": 120,
+ "position": {
+ - "x": 119.000000,
+ + "x": 190.400009,
+ "y": -0.000000
+ },
+ "alias": "Q",
+ @@ -8381,7 +8381,7 @@
+ "id": "120",
+ "seqid": 121,
+ "position": {
+ - "x": 120.000000,
+ + "x": 192.000000,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -8392,7 +8392,7 @@
+ "id": "121",
+ "seqid": 122,
+ "position": {
+ - "x": 121.000000,
+ + "x": 193.600006,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -8403,7 +8403,7 @@
+ "id": "122",
+ "seqid": 123,
+ "position": {
+ - "x": 122.000000,
+ + "x": 195.199997,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -8414,7 +8414,7 @@
+ "id": "123",
+ "seqid": 124,
+ "position": {
+ - "x": 123.000000,
+ + "x": 196.800003,
+ "y": -0.000000
+ },
+ "alias": "G",
+ @@ -8425,7 +8425,7 @@
+ "id": "124",
+ "seqid": 125,
+ "position": {
+ - "x": 124.000000,
+ + "x": 198.400009,
+ "y": -0.000000
+ },
+ "alias": "S",
+ @@ -8436,7 +8436,7 @@
+ "id": "125",
+ "seqid": 126,
+ "position": {
+ - "x": 125.000000,
+ + "x": 200.000000,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -8447,7 +8447,7 @@
+ "id": "126",
+ "seqid": 127,
+ "position": {
+ - "x": 126.000000,
+ + "x": 201.600006,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -8458,7 +8458,7 @@
+ "id": "127",
+ "seqid": 128,
+ "position": {
+ - "x": 127.000000,
+ + "x": 203.199997,
+ "y": -0.000000
+ },
+ "alias": "G",
+ @@ -8469,7 +8469,7 @@
+ "id": "128",
+ "seqid": 129,
+ "position": {
+ - "x": 128.000000,
+ + "x": 204.800003,
+ "y": -0.000000
+ },
+ "alias": "K",
+ @@ -8480,7 +8480,7 @@
+ "id": "129",
+ "seqid": 130,
+ "position": {
+ - "x": 129.000000,
+ + "x": 206.400009,
+ "y": -0.000000
+ },
+ "alias": "N",
+ @@ -8491,7 +8491,7 @@
+ "id": "130",
+ "seqid": 131,
+ "position": {
+ - "x": 130.000000,
+ + "x": 208.000000,
+ "y": -0.000000
+ },
+ "alias": "V",
+ @@ -8502,7 +8502,7 @@
+ "id": "131",
+ "seqid": 132,
+ "position": {
+ - "x": 131.000000,
+ + "x": 209.600006,
+ "y": -0.000000
+ },
+ "alias": "E",
+ @@ -8513,7 +8513,7 @@
+ "id": "132",
+ "seqid": 133,
+ "position": {
+ - "x": 132.000000,
+ + "x": 211.199997,
+ "y": -0.000000
+ },
+ "alias": "V",
+ @@ -8524,7 +8524,7 @@
+ "id": "133",
+ "seqid": 134,
+ "position": {
+ - "x": 133.000000,
+ + "x": 212.800003,
+ "y": -0.000000
+ },
+ "alias": "K",
+ @@ -8535,7 +8535,7 @@
+ "id": "134",
+ "seqid": 135,
+ "position": {
+ - "x": 134.000000,
+ + "x": 214.400009,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -8546,7 +8546,7 @@
+ "id": "135",
+ "seqid": 136,
+ "position": {
+ - "x": 135.000000,
+ + "x": 216.000000,
+ "y": -0.000000
+ },
+ "alias": "N",
+ @@ -8557,7 +8557,7 @@
+ "id": "136",
+ "seqid": 137,
+ "position": {
+ - "x": 136.000000,
+ + "x": 217.600006,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -8568,7 +8568,7 @@
+ "id": "137",
+ "seqid": 138,
+ "position": {
+ - "x": 137.000000,
+ + "x": 219.199997,
+ "y": -0.000000
+ },
+ "alias": "N",
+ @@ -8579,7 +8579,7 @@
+ "id": "138",
+ "seqid": 139,
+ "position": {
+ - "x": 138.000000,
+ + "x": 220.800003,
+ "y": -0.000000
+ },
+ "alias": "S",
+ @@ -8590,7 +8590,7 @@
+ "id": "139",
+ "seqid": 140,
+ "position": {
+ - "x": 139.000000,
+ + "x": 222.400009,
+ "y": -0.000000
+ },
+ "alias": "F",
+ @@ -8601,7 +8601,7 @@
+ "id": "140",
+ "seqid": 141,
+ "position": {
+ - "x": 140.000000,
+ + "x": 224.000000,
+ "y": -0.000000
+ },
+ "alias": "A",
+ @@ -8612,7 +8612,7 @@
+ "id": "141",
+ "seqid": 142,
+ "position": {
+ - "x": 141.000000,
+ + "x": 225.600006,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -8623,7 +8623,7 @@
+ "id": "142",
+ "seqid": 143,
+ "position": {
+ - "x": 142.000000,
+ + "x": 227.199997,
+ "y": -0.000000
+ },
+ "alias": "H",
+ @@ -8634,7 +8634,7 @@
+ "id": "143",
+ "seqid": 144,
+ "position": {
+ - "x": 143.000000,
+ + "x": 228.800003,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -8645,7 +8645,7 @@
+ "id": "144",
+ "seqid": 145,
+ "position": {
+ - "x": 144.000000,
+ + "x": 230.400009,
+ "y": -0.000000
+ },
+ "alias": "A",
+ @@ -8656,7 +8656,7 @@
+ "id": "145",
+ "seqid": 146,
+ "position": {
+ - "x": 145.000000,
+ + "x": 232.000000,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -8667,7 +8667,7 @@
+ "id": "146",
+ "seqid": 147,
+ "position": {
+ - "x": 146.000000,
+ + "x": 233.600006,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -8678,7 +8678,7 @@
+ "id": "147",
+ "seqid": 148,
+ "position": {
+ - "x": 147.000000,
+ + "x": 235.199997,
+ "y": -0.000000
+ },
+ "alias": "A",
+ @@ -8689,7 +8689,7 @@
+ "id": "148",
+ "seqid": 149,
+ "position": {
+ - "x": 148.000000,
+ + "x": 236.800003,
+ "y": -0.000000
+ },
+ "alias": "A",
+ @@ -8700,7 +8700,7 @@
+ "id": "149",
+ "seqid": 150,
+ "position": {
+ - "x": 149.000000,
+ + "x": 238.400009,
+ "y": -0.000000
+ },
+ "alias": "T",
+ @@ -8711,7 +8711,7 @@
+ "id": "150",
+ "seqid": 151,
+ "position": {
+ - "x": 150.000000,
+ + "x": 240.000000,
+ "y": -0.000000
+ },
+ "alias": "G",
+ @@ -8722,7 +8722,7 @@
+ "id": "151",
+ "seqid": 152,
+ "position": {
+ - "x": 151.000000,
+ + "x": 241.600006,
+ "y": -0.000000
+ },
+ "alias": "S",
+ @@ -8733,7 +8733,7 @@
+ "id": "152",
+ "seqid": 153,
+ "position": {
+ - "x": 152.000000,
+ + "x": 243.199997,
+ "y": -0.000000
+ },
+ "alias": "G",
+ @@ -8744,7 +8744,7 @@
+ "id": "153",
+ "seqid": 154,
+ "position": {
+ - "x": 153.000000,
+ + "x": 244.800003,
+ "y": -0.000000
+ },
+ "alias": "K",
+ @@ -8755,7 +8755,7 @@
+ "id": "154",
+ "seqid": 155,
+ "position": {
+ - "x": 154.000000,
+ + "x": 246.400009,
+ "y": -0.000000
+ },
+ "alias": "S",
+ @@ -8766,7 +8766,7 @@
+ "id": "155",
+ "seqid": 156,
+ "position": {
+ - "x": 155.000000,
+ + "x": 248.000000,
+ "y": -0.000000
+ },
+ "alias": "N",
+ @@ -8777,7 +8777,7 @@
+ "id": "156",
+ "seqid": 157,
+ "position": {
+ - "x": 156.000000,
+ + "x": 249.600006,
+ "y": -0.000000
+ },
+ "alias": "T",
+ @@ -8788,7 +8788,7 @@
+ "id": "157",
+ "seqid": 158,
+ "position": {
+ - "x": 157.000000,
+ + "x": 251.199997,
+ "y": -0.000000
+ },
+ "alias": "V",
+ @@ -8799,7 +8799,7 @@
+ "id": "158",
+ "seqid": 159,
+ "position": {
+ - "x": 158.000000,
+ + "x": 252.800003,
+ "y": -0.000000
+ },
+ "alias": "A",
+ @@ -8810,7 +8810,7 @@
+ "id": "159",
+ "seqid": 160,
+ "position": {
+ - "x": 159.000000,
+ + "x": 254.400009,
+ "y": -0.000000
+ },
+ "alias": "V",
+ @@ -8821,7 +8821,7 @@
+ "id": "160",
+ "seqid": 161,
+ "position": {
+ - "x": 160.000000,
+ + "x": 256.000000,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -8832,7 +8832,7 @@
+ "id": "161",
+ "seqid": 162,
+ "position": {
+ - "x": 161.000000,
+ + "x": 257.600006,
+ "y": -0.000000
+ },
+ "alias": "S",
+ @@ -8843,7 +8843,7 @@
+ "id": "162",
+ "seqid": 163,
+ "position": {
+ - "x": 162.000000,
+ + "x": 259.200012,
+ "y": -0.000000
+ },
+ "alias": "Q",
+ @@ -8854,7 +8854,7 @@
+ "id": "163",
+ "seqid": 164,
+ "position": {
+ - "x": 163.000000,
+ + "x": 260.800018,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -8865,7 +8865,7 @@
+ "id": "164",
+ "seqid": 165,
+ "position": {
+ - "x": 164.000000,
+ + "x": 262.399994,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -8876,7 +8876,7 @@
+ "id": "165",
+ "seqid": 166,
+ "position": {
+ - "x": 165.000000,
+ + "x": 264.000000,
+ "y": -0.000000
+ },
+ "alias": "S",
+ @@ -8887,7 +8887,7 @@
+ "id": "166",
+ "seqid": 167,
+ "position": {
+ - "x": 166.000000,
+ + "x": 265.600006,
+ "y": -0.000000
+ },
+ "alias": "E",
+ @@ -8898,7 +8898,7 @@
+ "id": "167",
+ "seqid": 168,
+ "position": {
+ - "x": 167.000000,
+ + "x": 267.200012,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -8909,7 +8909,7 @@
+ "id": "168",
+ "seqid": 169,
+ "position": {
+ - "x": 168.000000,
+ + "x": 268.800018,
+ "y": -0.000000
+ },
+ "alias": "G",
+ @@ -8920,7 +8920,7 @@
+ "id": "169",
+ "seqid": 170,
+ "position": {
+ - "x": 169.000000,
+ + "x": 270.399994,
+ "y": -0.000000
+ },
+ "alias": "G",
+ @@ -8931,7 +8931,7 @@
+ "id": "170",
+ "seqid": 171,
+ "position": {
+ - "x": 170.000000,
+ + "x": 272.000000,
+ "y": -0.000000
+ },
+ "alias": "S",
+ @@ -8942,7 +8942,7 @@
+ "id": "171",
+ "seqid": 172,
+ "position": {
+ - "x": 171.000000,
+ + "x": 273.600006,
+ "y": -0.000000
+ },
+ "alias": "V",
+ @@ -8953,7 +8953,7 @@
+ "id": "172",
+ "seqid": 173,
+ "position": {
+ - "x": 172.000000,
+ + "x": 275.200012,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -8964,7 +8964,7 @@
+ "id": "173",
+ "seqid": 174,
+ "position": {
+ - "x": 173.000000,
+ + "x": 276.800018,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -8975,7 +8975,7 @@
+ "id": "174",
+ "seqid": 175,
+ "position": {
+ - "x": 174.000000,
+ + "x": 278.399994,
+ "y": -0.000000
+ },
+ "alias": "F",
+ @@ -8986,7 +8986,7 @@
+ "id": "175",
+ "seqid": 176,
+ "position": {
+ - "x": 175.000000,
+ + "x": 280.000000,
+ "y": -0.000000
+ },
+ "alias": "D",
+ @@ -8997,7 +8997,7 @@
+ "id": "176",
+ "seqid": 177,
+ "position": {
+ - "x": 176.000000,
+ + "x": 281.600006,
+ "y": -0.000000
+ },
+ "alias": "Y",
+ @@ -9008,7 +9008,7 @@
+ "id": "177",
+ "seqid": 178,
+ "position": {
+ - "x": 177.000000,
+ + "x": 283.200012,
+ "y": -0.000000
+ },
+ "alias": "H",
+ @@ -9019,7 +9019,7 @@
+ "id": "178",
+ "seqid": 179,
+ "position": {
+ - "x": 178.000000,
+ + "x": 284.800018,
+ "y": -0.000000
+ },
+ "alias": "G",
+ @@ -9030,7 +9030,7 @@
+ "id": "179",
+ "seqid": 180,
+ "position": {
+ - "x": 179.000000,
+ + "x": 286.399994,
+ "y": -0.000000
+ },
+ "alias": "E",
+ @@ -9041,7 +9041,7 @@
+ "id": "180",
+ "seqid": 181,
+ "position": {
+ - "x": 180.000000,
+ + "x": 288.000000,
+ "y": -0.000000
+ },
+ "alias": "Y",
+ @@ -9052,7 +9052,7 @@
+ "id": "181",
+ "seqid": 182,
+ "position": {
+ - "x": 181.000000,
+ + "x": 289.600006,
+ "y": -0.000000
+ },
+ "alias": "Y",
+ @@ -9063,7 +9063,7 @@
+ "id": "182",
+ "seqid": 183,
+ "position": {
+ - "x": 182.000000,
+ + "x": 291.200012,
+ "y": -0.000000
+ },
+ "alias": "D",
+ @@ -9074,7 +9074,7 @@
+ "id": "183",
+ "seqid": 184,
+ "position": {
+ - "x": 183.000000,
+ + "x": 292.800018,
+ "y": -0.000000
+ },
+ "alias": "S",
+ @@ -9085,7 +9085,7 @@
+ "id": "184",
+ "seqid": 185,
+ "position": {
+ - "x": 184.000000,
+ + "x": 294.399994,
+ "y": -0.000000
+ },
+ "alias": "D",
+ @@ -9096,7 +9096,7 @@
+ "id": "185",
+ "seqid": 186,
+ "position": {
+ - "x": 185.000000,
+ + "x": 296.000000,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -9107,7 +9107,7 @@
+ "id": "186",
+ "seqid": 187,
+ "position": {
+ - "x": 186.000000,
+ + "x": 297.600006,
+ "y": -0.000000
+ },
+ "alias": "K",
+ @@ -9118,7 +9118,7 @@
+ "id": "187",
+ "seqid": 188,
+ "position": {
+ - "x": 187.000000,
+ + "x": 299.200012,
+ "y": -0.000000
+ },
+ "alias": "N",
+ @@ -9129,7 +9129,7 @@
+ "id": "188",
+ "seqid": 189,
+ "position": {
+ - "x": 188.000000,
+ + "x": 300.800018,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -9140,7 +9140,7 @@
+ "id": "189",
+ "seqid": 190,
+ "position": {
+ - "x": 189.000000,
+ + "x": 302.399994,
+ "y": -0.000000
+ },
+ "alias": "N",
+ @@ -9151,7 +9151,7 @@
+ "id": "190",
+ "seqid": 191,
+ "position": {
+ - "x": 190.000000,
+ + "x": 304.000000,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -9162,7 +9162,7 @@
+ "id": "191",
+ "seqid": 192,
+ "position": {
+ - "x": 191.000000,
+ + "x": 305.600006,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -9173,7 +9173,7 @@
+ "id": "192",
+ "seqid": 193,
+ "position": {
+ - "x": 192.000000,
+ + "x": 307.200012,
+ "y": -0.000000
+ },
+ "alias": "E",
+ @@ -9184,7 +9184,7 @@
+ "id": "193",
+ "seqid": 194,
+ "position": {
+ - "x": 193.000000,
+ + "x": 308.800018,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -9195,7 +9195,7 @@
+ "id": "194",
+ "seqid": 195,
+ "position": {
+ - "x": 194.000000,
+ + "x": 310.399994,
+ "y": -0.000000
+ },
+ "alias": "K",
+ @@ -9206,7 +9206,7 @@
+ "id": "195",
+ "seqid": 196,
+ "position": {
+ - "x": 195.000000,
+ + "x": 312.000000,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -9217,7 +9217,7 @@
+ "id": "196",
+ "seqid": 197,
+ "position": {
+ - "x": 196.000000,
+ + "x": 313.600006,
+ "y": -0.000000
+ },
+ "alias": "N",
+ @@ -9228,7 +9228,7 @@
+ "id": "197",
+ "seqid": 198,
+ "position": {
+ - "x": 197.000000,
+ + "x": 315.200012,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -9239,7 +9239,7 @@
+ "id": "198",
+ "seqid": 199,
+ "position": {
+ - "x": 198.000000,
+ + "x": 316.800018,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -9250,7 +9250,7 @@
+ "id": "199",
+ "seqid": 200,
+ "position": {
+ - "x": 199.000000,
+ + "x": 318.399994,
+ "y": -0.000000
+ },
+ "alias": "Y",
+ @@ -9261,7 +9261,7 @@
+ "id": "200",
+ "seqid": 201,
+ "position": {
+ - "x": 200.000000,
+ + "x": 320.000000,
+ "y": -0.000000
+ },
+ "alias": "M",
+ @@ -9272,7 +9272,7 @@
+ "id": "201",
+ "seqid": 202,
+ "position": {
+ - "x": 201.000000,
+ + "x": 321.600006,
+ "y": -0.000000
+ },
+ "alias": "T",
+ @@ -9283,7 +9283,7 @@
+ "id": "202",
+ "seqid": 203,
+ "position": {
+ - "x": 202.000000,
+ + "x": 323.200012,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -9294,7 +9294,7 @@
+ "id": "203",
+ "seqid": 204,
+ "position": {
+ - "x": 203.000000,
+ + "x": 324.800018,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -9305,7 +9305,7 @@
+ "id": "204",
+ "seqid": 205,
+ "position": {
+ - "x": 204.000000,
+ + "x": 326.399994,
+ "y": -0.000000
+ },
+ "alias": "E",
+ @@ -9316,7 +9316,7 @@
+ "id": "205",
+ "seqid": 206,
+ "position": {
+ - "x": 205.000000,
+ + "x": 328.000000,
+ "y": -0.000000
+ },
+ "alias": "F",
+ @@ -9327,7 +9327,7 @@
+ "id": "206",
+ "seqid": 207,
+ "position": {
+ - "x": 206.000000,
+ + "x": 329.600006,
+ "y": -0.000000
+ },
+ "alias": "S",
+ @@ -9338,7 +9338,7 @@
+ "id": "207",
+ "seqid": 208,
+ "position": {
+ - "x": 207.000000,
+ + "x": 331.200012,
+ "y": -0.000000
+ },
+ "alias": "T",
+ @@ -9349,7 +9349,7 @@
+ "id": "208",
+ "seqid": 209,
+ "position": {
+ - "x": 208.000000,
+ + "x": 332.800018,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -9360,7 +9360,7 @@
+ "id": "209",
+ "seqid": 210,
+ "position": {
+ - "x": 209.000000,
+ + "x": 334.399994,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -9371,7 +9371,7 @@
+ "id": "210",
+ "seqid": 211,
+ "position": {
+ - "x": 210.000000,
+ + "x": 336.000000,
+ "y": -0.000000
+ },
+ "alias": "E",
+ @@ -9382,7 +9382,7 @@
+ "id": "211",
+ "seqid": 212,
+ "position": {
+ - "x": 211.000000,
+ + "x": 337.600006,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -9393,7 +9393,7 @@
+ "id": "212",
+ "seqid": 213,
+ "position": {
+ - "x": 212.000000,
+ + "x": 339.200012,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -9404,7 +9404,7 @@
+ "id": "213",
+ "seqid": 214,
+ "position": {
+ - "x": 213.000000,
+ + "x": 340.800018,
+ "y": -0.000000
+ },
+ "alias": "E",
+ @@ -9415,7 +9415,7 @@
+ "id": "214",
+ "seqid": 215,
+ "position": {
+ - "x": 214.000000,
+ + "x": 342.399994,
+ "y": -0.000000
+ },
+ "alias": "N",
+ @@ -9426,7 +9426,7 @@
+ "id": "215",
+ "seqid": 216,
+ "position": {
+ - "x": 215.000000,
+ + "x": 344.000000,
+ "y": -0.000000
+ },
+ "alias": "A",
+ @@ -9437,7 +9437,7 @@
+ "id": "216",
+ "seqid": 217,
+ "position": {
+ - "x": 216.000000,
+ + "x": 345.600006,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -9448,7 +9448,7 @@
+ "id": "217",
+ "seqid": 218,
+ "position": {
+ - "x": 217.000000,
+ + "x": 347.200012,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -9459,7 +9459,7 @@
+ "id": "218",
+ "seqid": 219,
+ "position": {
+ - "x": 218.000000,
+ + "x": 348.800018,
+ "y": -0.000000
+ },
+ "alias": "Q",
+ @@ -9470,7 +9470,7 @@
+ "id": "219",
+ "seqid": 220,
+ "position": {
+ - "x": 219.000000,
+ + "x": 350.399994,
+ "y": -0.000000
+ },
+ "alias": "Y",
+ @@ -9481,7 +9481,7 @@
+ "id": "220",
+ "seqid": 221,
+ "position": {
+ - "x": 220.000000,
+ + "x": 352.000000,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -9492,7 +9492,7 @@
+ "id": "221",
+ "seqid": 222,
+ "position": {
+ - "x": 221.000000,
+ + "x": 353.600006,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -9503,7 +9503,7 @@
+ "id": "222",
+ "seqid": 223,
+ "position": {
+ - "x": 222.000000,
+ + "x": 355.200012,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -9514,7 +9514,7 @@
+ "id": "223",
+ "seqid": 224,
+ "position": {
+ - "x": 223.000000,
+ + "x": 356.800018,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -9525,7 +9525,7 @@
+ "id": "224",
+ "seqid": 225,
+ "position": {
+ - "x": 224.000000,
+ + "x": 358.399994,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -9536,7 +9536,7 @@
+ "id": "225",
+ "seqid": 226,
+ "position": {
+ - "x": 225.000000,
+ + "x": 360.000000,
+ "y": -0.000000
+ },
+ "alias": "A",
+ @@ -9547,7 +9547,7 @@
+ "id": "226",
+ "seqid": 227,
+ "position": {
+ - "x": 226.000000,
+ + "x": 361.600006,
+ "y": -0.000000
+ },
+ "alias": "F",
+ @@ -9558,7 +9558,7 @@
+ "id": "227",
+ "seqid": 228,
+ "position": {
+ - "x": 227.000000,
+ + "x": 363.200012,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -9569,7 +9569,7 @@
+ "id": "228",
+ "seqid": 229,
+ "position": {
+ - "x": 228.000000,
+ + "x": 364.800018,
+ "y": -0.000000
+ },
+ "alias": "K",
+ @@ -9580,7 +9580,7 @@
+ "id": "229",
+ "seqid": 230,
+ "position": {
+ - "x": 229.000000,
+ + "x": 366.399994,
+ "y": -0.000000
+ },
+ "alias": "V",
+ @@ -9591,7 +9591,7 @@
+ "id": "230",
+ "seqid": 231,
+ "position": {
+ - "x": 230.000000,
+ + "x": 368.000000,
+ "y": -0.000000
+ },
+ "alias": "T",
+ @@ -9602,7 +9602,7 @@
+ "id": "231",
+ "seqid": 232,
+ "position": {
+ - "x": 231.000000,
+ + "x": 369.600006,
+ "y": -0.000000
+ },
+ "alias": "N",
+ @@ -9613,7 +9613,7 @@
+ "id": "232",
+ "seqid": 233,
+ "position": {
+ - "x": 232.000000,
+ + "x": 371.200012,
+ "y": -0.000000
+ },
+ "alias": "G",
+ @@ -9624,7 +9624,7 @@
+ "id": "233",
+ "seqid": 234,
+ "position": {
+ - "x": 233.000000,
+ + "x": 372.800018,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -9635,7 +9635,7 @@
+ "id": "234",
+ "seqid": 235,
+ "position": {
+ - "x": 234.000000,
+ + "x": 374.399994,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -9646,7 +9646,7 @@
+ "id": "235",
+ "seqid": 236,
+ "position": {
+ - "x": 235.000000,
+ + "x": 376.000000,
+ "y": -0.000000
+ },
+ "alias": "A",
+ @@ -9657,7 +9657,7 @@
+ "id": "236",
+ "seqid": 237,
+ "position": {
+ - "x": 236.000000,
+ + "x": 377.600006,
+ "y": -0.000000
+ },
+ "alias": "A",
+ @@ -9668,7 +9668,7 @@
+ "id": "237",
+ "seqid": 238,
+ "position": {
+ - "x": 237.000000,
+ + "x": 379.200012,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -9679,7 +9679,7 @@
+ "id": "238",
+ "seqid": 239,
+ "position": {
+ - "x": 238.000000,
+ + "x": 380.800018,
+ "y": -0.000000
+ },
+ "alias": "A",
+ @@ -9690,7 +9690,7 @@
+ "id": "239",
+ "seqid": 240,
+ "position": {
+ - "x": 239.000000,
+ + "x": 382.399994,
+ "y": -0.000000
+ },
+ "alias": "A",
+ @@ -9701,7 +9701,7 @@
+ "id": "240",
+ "seqid": 241,
+ "position": {
+ - "x": 240.000000,
+ + "x": 384.000000,
+ "y": -0.000000
+ },
+ "alias": "G",
+ @@ -9712,7 +9712,7 @@
+ "id": "241",
+ "seqid": 242,
+ "position": {
+ - "x": 241.000000,
+ + "x": 385.600006,
+ "y": -0.000000
+ },
+ "alias": "Q",
+ @@ -9723,7 +9723,7 @@
+ "id": "242",
+ "seqid": 243,
+ "position": {
+ - "x": 242.000000,
+ + "x": 387.200012,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -9734,7 +9734,7 @@
+ "id": "243",
+ "seqid": 244,
+ "position": {
+ - "x": 243.000000,
+ + "x": 388.800018,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -9745,7 +9745,7 @@
+ "id": "244",
+ "seqid": 245,
+ "position": {
+ - "x": 244.000000,
+ + "x": 390.399994,
+ "y": -0.000000
+ },
+ "alias": "F",
+ @@ -9756,7 +9756,7 @@
+ "id": "245",
+ "seqid": 246,
+ "position": {
+ - "x": 245.000000,
+ + "x": 392.000000,
+ "y": -0.000000
+ },
+ "alias": "S",
+ @@ -9767,7 +9767,7 @@
+ "id": "246",
+ "seqid": 247,
+ "position": {
+ - "x": 246.000000,
+ + "x": 393.600006,
+ "y": -0.000000
+ },
+ "alias": "T",
+ @@ -9778,7 +9778,7 @@
+ "id": "247",
+ "seqid": 248,
+ "position": {
+ - "x": 247.000000,
+ + "x": 395.200012,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -9789,7 +9789,7 @@
+ "id": "248",
+ "seqid": 249,
+ "position": {
+ - "x": 248.000000,
+ + "x": 396.800018,
+ "y": -0.000000
+ },
+ "alias": "N",
+ @@ -9800,7 +9800,7 @@
+ "id": "249",
+ "seqid": 250,
+ "position": {
+ - "x": 249.000000,
+ + "x": 398.399994,
+ "y": -0.000000
+ },
+ "alias": "S",
+ @@ -9811,7 +9811,7 @@
+ "id": "250",
+ "seqid": 251,
+ "position": {
+ - "x": 250.000000,
+ + "x": 400.000000,
+ "y": -0.000000
+ },
+ "alias": "Q",
+ @@ -9822,7 +9822,7 @@
+ "id": "251",
+ "seqid": 252,
+ "position": {
+ - "x": 251.000000,
+ + "x": 401.600006,
+ "y": -0.000000
+ },
+ "alias": "F",
+ @@ -9833,7 +9833,7 @@
+ "id": "252",
+ "seqid": 253,
+ "position": {
+ - "x": 252.000000,
+ + "x": 403.200012,
+ "y": -0.000000
+ },
+ "alias": "Y",
+ @@ -9844,7 +9844,7 @@
+ "id": "253",
+ "seqid": 254,
+ "position": {
+ - "x": 253.000000,
+ + "x": 404.800018,
+ "y": -0.000000
+ },
+ "alias": "E",
+ @@ -9855,7 +9855,7 @@
+ "id": "254",
+ "seqid": 255,
+ "position": {
+ - "x": 254.000000,
+ + "x": 406.399994,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -9866,7 +9866,7 @@
+ "id": "255",
+ "seqid": 256,
+ "position": {
+ - "x": 255.000000,
+ + "x": 408.000000,
+ "y": -0.000000
+ },
+ "alias": "M",
+ @@ -9877,7 +9877,7 @@
+ "id": "256",
+ "seqid": 257,
+ "position": {
+ - "x": 256.000000,
+ + "x": 409.600006,
+ "y": -0.000000
+ },
+ "alias": "A",
+ @@ -9888,7 +9888,7 @@
+ "id": "257",
+ "seqid": 258,
+ "position": {
+ - "x": 257.000000,
+ + "x": 411.200012,
+ "y": -0.000000
+ },
+ "alias": "D",
+ @@ -9899,7 +9899,7 @@
+ "id": "258",
+ "seqid": 259,
+ "position": {
+ - "x": 258.000000,
+ + "x": 412.800018,
+ "y": -0.000000
+ },
+ "alias": "A",
+ @@ -9910,7 +9910,7 @@
+ "id": "259",
+ "seqid": 260,
+ "position": {
+ - "x": 259.000000,
+ + "x": 414.399994,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -9921,7 +9921,7 @@
+ "id": "260",
+ "seqid": 261,
+ "position": {
+ - "x": 260.000000,
+ + "x": 416.000000,
+ "y": -0.000000
+ },
+ "alias": "E",
+ @@ -9932,7 +9932,7 @@
+ "id": "261",
+ "seqid": 262,
+ "position": {
+ - "x": 261.000000,
+ + "x": 417.600006,
+ "y": -0.000000
+ },
+ "alias": "T",
+ @@ -9943,7 +9943,7 @@
+ "id": "262",
+ "seqid": 263,
+ "position": {
+ - "x": 262.000000,
+ + "x": 419.200012,
+ "y": -0.000000
+ },
+ "alias": "Q",
+ @@ -9954,7 +9954,7 @@
+ "id": "263",
+ "seqid": 264,
+ "position": {
+ - "x": 263.000000,
+ + "x": 420.800018,
+ "y": -0.000000
+ },
+ "alias": "G",
+ @@ -9965,7 +9965,7 @@
+ "id": "264",
+ "seqid": 265,
+ "position": {
+ - "x": 264.000000,
+ + "x": 422.399994,
+ "y": -0.000000
+ },
+ "alias": "N",
+ @@ -9976,7 +9976,7 @@
+ "id": "265",
+ "seqid": 266,
+ "position": {
+ - "x": 265.000000,
+ + "x": 424.000000,
+ "y": -0.000000
+ },
+ "alias": "S",
+ @@ -9987,7 +9987,7 @@
+ "id": "266",
+ "seqid": 267,
+ "position": {
+ - "x": 266.000000,
+ + "x": 425.600006,
+ "y": -0.000000
+ },
+ "alias": "D",
+ @@ -9998,7 +9998,7 @@
+ "id": "267",
+ "seqid": 268,
+ "position": {
+ - "x": 267.000000,
+ + "x": 427.200012,
+ "y": -0.000000
+ },
+ "alias": "K",
+ @@ -10009,7 +10009,7 @@
+ "id": "268",
+ "seqid": 269,
+ "position": {
+ - "x": 268.000000,
+ + "x": 428.800018,
+ "y": -0.000000
+ },
+ "alias": "K",
+ @@ -10020,7 +10020,7 @@
+ "id": "269",
+ "seqid": 270,
+ "position": {
+ - "x": 269.000000,
+ + "x": 430.399994,
+ "y": -0.000000
+ },
+ "alias": "S",
+ @@ -10031,7 +10031,7 @@
+ "id": "270",
+ "seqid": 271,
+ "position": {
+ - "x": 270.000000,
+ + "x": 432.000000,
+ "y": -0.000000
+ },
+ "alias": "S",
+ @@ -10042,7 +10042,7 @@
+ "id": "271",
+ "seqid": 272,
+ "position": {
+ - "x": 271.000000,
+ + "x": 433.600006,
+ "y": -0.000000
+ },
+ "alias": "A",
+ @@ -10053,7 +10053,7 @@
+ "id": "272",
+ "seqid": 273,
+ "position": {
+ - "x": 272.000000,
+ + "x": 435.200012,
+ "y": -0.000000
+ },
+ "alias": "K",
+ @@ -10064,7 +10064,7 @@
+ "id": "273",
+ "seqid": 274,
+ "position": {
+ - "x": 273.000000,
+ + "x": 436.800018,
+ "y": -0.000000
+ },
+ "alias": "D",
+ @@ -10075,7 +10075,7 @@
+ "id": "274",
+ "seqid": 275,
+ "position": {
+ - "x": 274.000000,
+ + "x": 438.399994,
+ "y": -0.000000
+ },
+ "alias": "E",
+ @@ -10086,7 +10086,7 @@
+ "id": "275",
+ "seqid": 276,
+ "position": {
+ - "x": 275.000000,
+ + "x": 440.000000,
+ "y": -0.000000
+ },
+ "alias": "V",
+ @@ -10097,7 +10097,7 @@
+ "id": "276",
+ "seqid": 277,
+ "position": {
+ - "x": 276.000000,
+ + "x": 441.600006,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -10108,7 +10108,7 @@
+ "id": "277",
+ "seqid": 278,
+ "position": {
+ - "x": 277.000000,
+ + "x": 443.200012,
+ "y": -0.000000
+ },
+ "alias": "N",
+ @@ -10119,7 +10119,7 @@
+ "id": "278",
+ "seqid": 279,
+ "position": {
+ - "x": 278.000000,
+ + "x": 444.800018,
+ "y": -0.000000
+ },
+ "alias": "K",
+ @@ -10130,7 +10130,7 @@
+ "id": "279",
+ "seqid": 280,
+ "position": {
+ - "x": 279.000000,
+ + "x": 446.399994,
+ "y": -0.000000
+ },
+ "alias": "F",
+ @@ -10141,7 +10141,7 @@
+ "id": "280",
+ "seqid": 281,
+ "position": {
+ - "x": 280.000000,
+ + "x": 448.000000,
+ "y": -0.000000
+ },
+ "alias": "E",
+ @@ -10152,7 +10152,7 @@
+ "id": "281",
+ "seqid": 282,
+ "position": {
+ - "x": 281.000000,
+ + "x": 449.600006,
+ "y": -0.000000
+ },
+ "alias": "E",
+ @@ -10163,7 +10163,7 @@
+ "id": "282",
+ "seqid": 283,
+ "position": {
+ - "x": 282.000000,
+ + "x": 451.200012,
+ "y": -0.000000
+ },
+ "alias": "F",
+ @@ -10174,7 +10174,7 @@
+ "id": "283",
+ "seqid": 284,
+ "position": {
+ - "x": 283.000000,
+ + "x": 452.800018,
+ "y": -0.000000
+ },
+ "alias": "M",
+ @@ -10185,7 +10185,7 @@
+ "id": "284",
+ "seqid": 285,
+ "position": {
+ - "x": 284.000000,
+ + "x": 454.399994,
+ "y": -0.000000
+ },
+ "alias": "D",
+ @@ -10196,7 +10196,7 @@
+ "id": "285",
+ "seqid": 286,
+ "position": {
+ - "x
Check failure on line 1 in api/c/tests/unit/tests/formats.cpp
github-actions / ubuntu-latest-x86_64-java_test_report
formats.helm_to_ket
[FAILED]
Raw output
Diff:
- aminoacids_variants.ket:SUCCEED
+ aminoacids_variants.ket:FAILED
- helm_annotations.ket:SUCCEED
+ ---
- helm_chem_peptide.ket:SUCCEED
- helm_chem_rna.ket:SUCCEED
+ +++
- helm_mixed_base.ket:SUCCEED
- helm_mixed_custom.ket:SUCCEED
+ @@ -145,7 +145,7 @@
- helm_multi_char_rna.ket:SUCCEED
- helm_peptide.ket:SUCCEED
+ "type": "ambiguousMonomer",
- helm_rna_without_base.ket:SUCCEED
+ "id": "1",
- helm_simple_rna.ket:SUCCEED
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "seqid": 2,
+ @@ -156,7 +156,7 @@
+ "type": "ambiguousMonomer",
+ "id": "2",
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "seqid": 3,
+ @@ -167,7 +167,7 @@
+ "type": "ambiguousMonomer",
+ "id": "3",
+ "position": {
+ - "x": 3.000000,
+ + "x": 4.800000,
+ "y": -0.000000
+ },
+ "seqid": 4,
+ helm_annotations.ket:FAILED
+ ---
+ +++
+ @@ -149,7 +149,7 @@
+ "seqid": 1,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "hxy",
+ "templateId": "hxy___Hexynyl alcohol"
+ @@ -160,7 +160,7 @@
+ "seqid": 2,
+ "position": {
+ "x": 0.000000,
+ - "y": -2.000000
+ + "y": -3.200000
+ },
+ "alias": "R",
+ "templateId": "R___Ribose"
+ @@ -171,7 +171,7 @@
+ "seqid": 3,
+ "position": {
+ "x": 0.000000,
+ - "y": -3.000000
+ + "y": -4.800000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -181,8 +181,8 @@
+ "id": "3",
+ "seqid": 4,
+ "position": {
+ - "x": 1.000000,
+ - "y": -2.000000
+ + "x": 1.600000,
+ + "y": -3.200000
+ },
+ "alias": "P",
+ "templateId": "P___Phosphate"
+ @@ -192,8 +192,8 @@
+ "id": "4",
+ "seqid": 5,
+ "position": {
+ - "x": 2.000000,
+ - "y": -2.000000
+ + "x": 3.200000,
+ + "y": -3.200000
+ },
+ "alias": "R",
+ "templateId": "R___Ribose"
+ @@ -203,8 +203,8 @@
+ "id": "5",
+ "seqid": 6,
+ "position": {
+ - "x": 2.000000,
+ - "y": -3.000000
+ + "x": 3.200000,
+ + "y": -4.800000
+ },
+ "alias": "U",
+ "templateId": "U___Uracil"
+ @@ -214,8 +214,8 @@
+ "id": "6",
+ "seqid": 7,
+ "position": {
+ - "x": 3.000000,
+ - "y": -2.000000
+ + "x": 4.800000,
+ + "y": -3.200000
+ },
+ "alias": "P",
+ "templateId": "P___Phosphate"
+ @@ -225,8 +225,8 @@
+ "id": "7",
+ "seqid": 8,
+ "position": {
+ - "x": 4.000000,
+ - "y": -2.000000
+ + "x": 6.400000,
+ + "y": -3.200000
+ },
+ "alias": "R",
+ "templateId": "R___Ribose"
+ @@ -236,8 +236,8 @@
+ "id": "8",
+ "seqid": 9,
+ "position": {
+ - "x": 4.000000,
+ - "y": -3.000000
+ + "x": 6.400000,
+ + "y": -4.800000
+ },
+ "alias": "G",
+ "templateId": "G___Guanine"
+ @@ -247,8 +247,8 @@
+ "id": "9",
+ "seqid": 10,
+ "position": {
+ - "x": 5.000000,
+ - "y": -2.000000
+ + "x": 8.000000,
+ + "y": -3.200000
+ },
+ "alias": "P",
+ "templateId": "P___Phosphate"
+ helm_chem_peptide.ket:FAILED
+ ---
+ +++
+ @@ -239,7 +239,7 @@
+ "seqid": 2,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "W",
+ "templateId": "W___Tryptophan"
+ @@ -249,8 +249,8 @@
+ "id": "2",
+ "seqid": 3,
+ "position": {
+ - "x": 1.000000,
+ - "y": -1.000000
+ + "x": 1.600000,
+ + "y": -1.600000
+ },
+ "alias": "N",
+ "templateId": "N___Asparagine"
+ @@ -260,8 +260,8 @@
+ "id": "3",
+ "seqid": 4,
+ "position": {
+ - "x": 2.000000,
+ - "y": -1.000000
+ + "x": 3.200000,
+ + "y": -1.600000
+ },
+ "alias": "D",
+ "templateId": "D___Aspartic acid"
+ @@ -271,8 +271,8 @@
+ "id": "4",
+ "seqid": 5,
+ "position": {
+ - "x": 3.000000,
+ - "y": -1.000000
+ + "x": 4.800000,
+ + "y": -1.600000
+ },
+ "alias": "Pen",
+ "templateId": "Pen___penicillamine (3-mercaptovaline)"
+ @@ -282,8 +282,8 @@
+ "id": "5",
+ "seqid": 6,
+ "position": {
+ - "x": 4.000000,
+ - "y": -1.000000
+ + "x": 6.400000,
+ + "y": -1.600000
+ },
+ "alias": "G",
+ "templateId": "G___Glycine"
+ @@ -293,8 +293,8 @@
+ "id": "6",
+ "seqid": 7,
+ "position": {
+ - "x": 5.000000,
+ - "y": -1.000000
+ + "x": 8.000000,
+ + "y": -1.600000
+ },
+ "alias": "Orn",
+ "templateId": "Orn___L-ornithine"
+ @@ -304,8 +304,8 @@
+ "id": "7",
+ "seqid": 8,
+ "position": {
+ - "x": 6.000000,
+ - "y": -1.000000
+ + "x": 9.600000,
+ + "y": -1.600000
+ },
+ "alias": "D",
+ "templateId": "D___Aspartic acid"
+ @@ -315,8 +315,8 @@
+ "id": "8",
+ "seqid": 9,
+ "position": {
+ - "x": 7.000000,
+ - "y": -1.000000
+ + "x": 11.200000,
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Alanine"
+ @@ -326,8 +326,8 @@
+ "id": "9",
+ "seqid": 10,
+ "position": {
+ - "x": 8.000000,
+ - "y": -1.000000
+ + "x": 12.800000,
+ + "y": -1.600000
+ },
+ "alias": "D",
+ "templateId": "D___Aspartic acid"
+ @@ -337,8 +337,8 @@
+ "id": "10",
+ "seqid": 11,
+ "position": {
+ - "x": 9.000000,
+ - "y": -1.000000
+ + "x": 14.400001,
+ + "y": -1.600000
+ },
+ "alias": "G",
+ "templateId": "G___Glycine"
+ @@ -348,8 +348,8 @@
+ "id": "11",
+ "seqid": 12,
+ "position": {
+ - "x": 10.000000,
+ - "y": -1.000000
+ + "x": 16.000000,
+ + "y": -1.600000
+ },
+ "alias": "S",
+ "templateId": "S___Serine"
+ @@ -359,8 +359,8 @@
+ "id": "12",
+ "seqid": 13,
+ "position": {
+ - "x": 11.000000,
+ - "y": -1.000000
+ + "x": 17.600000,
+ + "y": -1.600000
+ },
+ "alias": "G",
+ "templateId": "G___Glycine"
+ @@ -370,8 +370,8 @@
+ "id": "13",
+ "seqid": 14,
+ "position": {
+ - "x": 12.000000,
+ - "y": -1.000000
+ + "x": 19.200001,
+ + "y": -1.600000
+ },
+ "alias": "Cap",
+ "templateId": "Cap___gamma-amino-beta-hydroxycyclohexanepentanoic acid"
+ helm_chem_rna.ket:FAILED
+ ---
+ +++
+ @@ -81,7 +81,7 @@
+ "seqid": 2,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "R",
+ "templateId": "R___Ribose"
+ @@ -92,7 +92,7 @@
+ "seqid": 3,
+ "position": {
+ "x": 0.000000,
+ - "y": -2.000000
+ + "y": -3.200000
+ },
+ "alias": "U",
+ "templateId": "U___Uracil"
+ @@ -102,8 +102,8 @@
+ "id": "3",
+ "seqid": 4,
+ "position": {
+ - "x": 1.000000,
+ - "y": -1.000000
+ + "x": 1.600000,
+ + "y": -1.600000
+ },
+ "alias": "P",
+ "templateId": "P___Phosphate"
+ helm_mixed_base.ket:FAILED
+ ---
+ +++
+ @@ -188,7 +188,7 @@
+ "seqid": 2,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -198,7 +198,7 @@
+ "id": "2",
+ "seqid": 3,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -209,7 +209,7 @@
+ "id": "3",
+ "seqid": 4,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -219,8 +219,8 @@
+ "type": "ambiguousMonomer",
+ "id": "4",
+ "position": {
+ - "x": 2.000000,
+ - "y": -1.000000
+ + "x": 3.200000,
+ + "y": -1.600000
+ },
+ "seqid": 5,
+ "alias": "R",
+ @@ -231,7 +231,7 @@
+ "id": "5",
+ "seqid": 6,
+ "position": {
+ - "x": 3.000000,
+ + "x": 4.800000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -242,7 +242,7 @@
+ "id": "6",
+ "seqid": 7,
+ "position": {
+ - "x": 4.000000,
+ + "x": 6.400000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -253,8 +253,8 @@
+ "id": "7",
+ "seqid": 8,
+ "position": {
+ - "x": 4.000000,
+ - "y": -1.000000
+ + "x": 6.400000,
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -264,7 +264,7 @@
+ "id": "8",
+ "seqid": 9,
+ "position": {
+ - "x": 5.000000,
+ + "x": 8.000000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -275,7 +275,7 @@
+ "id": "9",
+ "seqid": 10,
+ "position": {
+ - "x": 6.000000,
+ + "x": 9.600000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -285,8 +285,8 @@
+ "type": "ambiguousMonomer",
+ "id": "10",
+ "position": {
+ - "x": 6.000000,
+ - "y": -1.000000
+ + "x": 9.600000,
+ + "y": -1.600000
+ },
+ "seqid": 11,
+ "alias": "S",
+ helm_mixed_custom.ket:FAILED
+ ---
+ +++
+ @@ -148,7 +148,7 @@
+ "id": "1",
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "seqid": 2,
+ "alias": "N0",
+ @@ -159,7 +159,7 @@
+ "id": "2",
+ "seqid": 3,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -170,7 +170,7 @@
+ "id": "3",
+ "seqid": 4,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -180,8 +180,8 @@
+ "type": "ambiguousMonomer",
+ "id": "4",
+ "position": {
+ - "x": 2.000000,
+ - "y": -1.000000
+ + "x": 3.200000,
+ + "y": -1.600000
+ },
+ "seqid": 5,
+ "alias": "N0",
+ @@ -192,7 +192,7 @@
+ "id": "5",
+ "seqid": 6,
+ "position": {
+ - "x": 3.000000,
+ + "x": 4.800000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -203,7 +203,7 @@
+ "id": "6",
+ "seqid": 7,
+ "position": {
+ - "x": 4.000000,
+ + "x": 6.400000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -213,8 +213,8 @@
+ "type": "ambiguousMonomer",
+ "id": "7",
+ "position": {
+ - "x": 4.000000,
+ - "y": -1.000000
+ + "x": 6.400000,
+ + "y": -1.600000
+ },
+ "seqid": 8,
+ "alias": "N",
+ helm_multi_char_rna.ket:FAILED
+ ---
+ +++
+ @@ -230,7 +230,7 @@
+ "seqid": 2,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "U",
+ "templateId": "U___Uracil"
+ @@ -240,7 +240,7 @@
+ "id": "2",
+ "seqid": 3,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -251,7 +251,7 @@
+ "id": "3",
+ "seqid": 4,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -262,8 +262,8 @@
+ "id": "4",
+ "seqid": 5,
+ "position": {
+ - "x": 2.000000,
+ - "y": -1.000000
+ + "x": 3.200000,
+ + "y": -1.600000
+ },
+ "alias": "T",
+ "templateId": "T___Thymine"
+ @@ -273,7 +273,7 @@
+ "id": "5",
+ "seqid": 6,
+ "position": {
+ - "x": 3.000000,
+ + "x": 4.800000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -284,7 +284,7 @@
+ "id": "6",
+ "seqid": 7,
+ "position": {
+ - "x": 4.000000,
+ + "x": 6.400000,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -295,8 +295,8 @@
+ "id": "7",
+ "seqid": 8,
+ "position": {
+ - "x": 4.000000,
+ - "y": -1.000000
+ + "x": 6.400000,
+ + "y": -1.600000
+ },
+ "alias": "G",
+ "templateId": "G___Guanine"
+ @@ -306,7 +306,7 @@
+ "id": "8",
+ "seqid": 9,
+ "position": {
+ - "x": 5.000000,
+ + "x": 8.000000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -317,7 +317,7 @@
+ "id": "9",
+ "seqid": 10,
+ "position": {
+ - "x": 6.000000,
+ + "x": 9.600000,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -328,8 +328,8 @@
+ "id": "10",
+ "seqid": 11,
+ "position": {
+ - "x": 6.000000,
+ - "y": -1.000000
+ + "x": 9.600000,
+ + "y": -1.600000
+ },
+ "alias": "C",
+ "templateId": "C___Cytosine"
+ @@ -339,7 +339,7 @@
+ "id": "11",
+ "seqid": 12,
+ "position": {
+ - "x": 7.000000,
+ + "x": 11.200000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -350,7 +350,7 @@
+ "id": "12",
+ "seqid": 13,
+ "position": {
+ - "x": 8.000000,
+ + "x": 12.800000,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -361,8 +361,8 @@
+ "id": "13",
+ "seqid": 14,
+ "position": {
+ - "x": 8.000000,
+ - "y": -1.000000
+ + "x": 12.800000,
+ + "y": -1.600000
+ },
+ "alias": "daA",
+ "templateId": "daA___N,N-dimethyl-Adenine"
+ helm_peptide.ket:FAILED
+ ---
+ +++
+ @@ -63,7 +63,7 @@
+ "id": "1",
+ "seqid": 2,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "meA",
+ @@ -74,7 +74,7 @@
+ "id": "2",
+ "seqid": 3,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "C",
+ helm_rna_without_base.ket:FAILED
+ ---
+ +++
+ @@ -46,7 +46,7 @@
+ "id": "1",
+ "seqid": 2,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ helm_simple_rna.ket:FAILED
+ ---
+ +++
+ @@ -230,7 +230,7 @@
+ "seqid": 2,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "U",
+ "templateId": "U___Uracil"
+ @@ -240,7 +240,7 @@
+ "id": "2",
+ "seqid": 3,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -251,7 +251,7 @@
+ "id": "3",
+ "seqid": 4,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -262,8 +262,8 @@
+ "id": "4",
+ "seqid": 5,
+ "position": {
+ - "x": 2.000000,
+ - "y": -1.000000
+ + "x": 3.200000,
+ + "y": -1.600000
+ },
+ "alias": "T",
+ "templateId": "T___Thymine"
+ @@ -273,7 +273,7 @@
+ "id": "5",
+ "seqid": 6,
+ "position": {
+ - "x": 3.000000,
+ + "x": 4.800000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -284,7 +284,7 @@
+ "id": "6",
+ "seqid": 7,
+ "position": {
+ - "x": 4.000000,
+ + "x": 6.400000,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -295,8 +295,8 @@
+ "id": "7",
+ "seqid": 8,
+ "position": {
+ - "x": 4.000000,
+ - "y": -1.000000
+ + "x": 6.400000,
+ + "y": -1.600000
+ },
+ "alias": "G",
+ "templateId": "G___Guanine"
+ @@ -306,7 +306,7 @@
+ "id": "8",
+ "seqid": 9,
+ "position": {
+ - "x": 5.000000,
+ + "x": 8.000000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -317,7 +317,7 @@
+ "id": "9",
+ "seqid": 10,
+ "position": {
+ - "x": 6.000000,
+ + "x": 9.600000,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -328,8 +328,8 @@
+ "id": "10",
+ "seqid": 11,
+ "position": {
+ - "x": 6.000000,
+ - "y": -1.000000
+ + "x": 9.600000,
+ + "y": -1.600000
+ },
+ "alias": "C",
+ "templateId": "C___Cytosine"
+ @@ -339,7 +339,7 @@
+ "id": "11",
+ "seqid": 12,
+ "position": {
+ - "x": 7.000000,
+ + "x": 11.200000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -350,7 +350,7 @@
+ "id": "12",
+ "seqid": 13,
+ "position": {
+ - "x": 8.000000,
+ + "x": 12.800000,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -361,8 +361,8 @@
+ "id": "13",
+ "seqid": 14,
+ "position": {
+ - "x": 8.000000,
+ - "y": -1.000000
+ + "x": 12.800000,
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
Check failure on line 1 in api/c/tests/unit/tests/formats.cpp
github-actions / ubuntu-latest-x86_64-java_test_report
formats.idt_to_ket
[FAILED]
Raw output
Diff:
- idt_32moera.ket:SUCCEED
+ idt_32moera.ket:FAILED
+ ---
+ +++
+ @@ -47,7 +47,7 @@
+ "seqid": 0,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
- idt_52moera.ket:SUCCEED
+ idt_52moera.ket:FAILED
- idt_52moera_32moera.ket:SUCCEED
+ ---
- idt_52moera_i2moera.ket:SUCCEED
- idt_52moera_sp.ket:SUCCEED
+ +++
- idt_52moera_sp_32moera.ket:SUCCEED
- idt_52moera_sp_i2moera_sp.ket:SUCCEED
+ @@ -64,7 +64,7 @@
- idt_52moera_with_3phos.ket:SUCCEED
+ "seqid": 0,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -74,7 +74,7 @@
+ "id": "2",
+ "seqid": 0,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ idt_52moera_32moera.ket:FAILED
+ ---
+ +++
+ @@ -92,7 +92,7 @@
+ "seqid": 0,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -102,7 +102,7 @@
+ "id": "2",
+ "seqid": 0,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -113,7 +113,7 @@
+ "id": "3",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "MOE",
+ @@ -124,8 +124,8 @@
+ "id": "4",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ - "y": -1.000000
+ + "x": 3.200000,
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ idt_52moera_i2moera.ket:FAILED
+ ---
+ +++
+ @@ -106,7 +106,7 @@
+ "seqid": 0,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -116,7 +116,7 @@
+ "id": "2",
+ "seqid": 0,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -127,7 +127,7 @@
+ "id": "3",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "MOE",
+ @@ -138,8 +138,8 @@
+ "id": "4",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ - "y": -1.000000
+ + "x": 3.200000,
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -149,7 +149,7 @@
+ "id": "5",
+ "seqid": 1,
+ "position": {
+ - "x": 3.000000,
+ + "x": 4.800000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ idt_52moera_sp.ket:FAILED
+ ---
+ +++
+ @@ -64,7 +64,7 @@
+ "seqid": 0,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -74,7 +74,7 @@
+ "id": "2",
+ "seqid": 0,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "sP",
+ idt_52moera_sp_32moera.ket:FAILED
+ ---
+ +++
+ @@ -92,7 +92,7 @@
+ "seqid": 0,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -102,7 +102,7 @@
+ "id": "2",
+ "seqid": 0,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "sP",
+ @@ -113,7 +113,7 @@
+ "id": "3",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "MOE",
+ @@ -124,8 +124,8 @@
+ "id": "4",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ - "y": -1.000000
+ + "x": 3.200000,
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ idt_52moera_sp_i2moera_sp.ket:FAILED
+ ---
+ +++
+ @@ -106,7 +106,7 @@
+ "seqid": 0,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -116,7 +116,7 @@
+ "id": "2",
+ "seqid": 0,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "sP",
+ @@ -127,7 +127,7 @@
+ "id": "3",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "MOE",
+ @@ -138,8 +138,8 @@
+ "id": "4",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ - "y": -1.000000
+ + "x": 3.200000,
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -149,7 +149,7 @@
+ "id": "5",
+ "seqid": 1,
+ "position": {
+ - "x": 3.000000,
+ + "x": 4.800000,
+ "y": -0.000000
+ },
+ "alias": "sP",
+ idt_52moera_with_3phos.ket:FAILED
+ ---
+ +++
+ @@ -78,7 +78,7 @@
+ "seqid": 0,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -88,7 +88,7 @@
+ "id": "2",
+ "seqid": 0,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -99,7 +99,7 @@
+ "id": "3",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "P",
- idt_bases.ket:SUCCEED
+ idt_bases.ket:FAILED
- idt_i2moera.ket:SUCCEED
+ ---
- idt_i2moera_32moera.ket:SUCCEED
- idt_i2moera_sp.ket:SUCCEED
+ +++
- idt_i2moera_sp_32moera.ket:SUCCEED
- idt_i2moera_t.ket:SUCCEED
+ @@ -275,7 +275,7 @@
- idt_many_molecules.ket:SUCCEED
- idt_mixed.ket:SUCCEED
+ "seqid": 0,
- idt_mixed_custom.ket:SUCCEED
+ "position": {
- idt_mixed_std.ket:SUCCEED
+ "x": 0.000000,
- idt_mod_phosphates.ket:SUCCEED
+ - "y": -1.000000
- idt_modifications.ket:SUCCEED
+ + "y": -1.600000
- idt_prefix_suffix.ket:SUCCEED
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -285,7 +285,7 @@
+ "id": "2",
+ "seqid": 0,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -296,7 +296,7 @@
+ "id": "3",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -307,8 +307,8 @@
+ "id": "4",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ - "y": -1.000000
+ + "x": 3.200000,
+ + "y": -1.600000
+ },
+ "alias": "T",
+ "templateId": "T___Thymine"
+ @@ -318,7 +318,7 @@
+ "id": "5",
+ "seqid": 1,
+ "position": {
+ - "x": 3.000000,
+ + "x": 4.800000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -329,7 +329,7 @@
+ "id": "6",
+ "seqid": 2,
+ "position": {
+ - "x": 4.000000,
+ + "x": 6.400000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -340,8 +340,8 @@
+ "id": "7",
+ "seqid": 2,
+ "position": {
+ - "x": 4.000000,
+ - "y": -1.000000
+ + "x": 6.400000,
+ + "y": -1.600000
+ },
+ "alias": "C",
+ "templateId": "C___Cytosine"
+ @@ -351,7 +351,7 @@
+ "id": "8",
+ "seqid": 2,
+ "position": {
+ - "x": 5.000000,
+ + "x": 8.000000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -362,7 +362,7 @@
+ "id": "9",
+ "seqid": 3,
+ "position": {
+ - "x": 6.000000,
+ + "x": 9.600000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -373,8 +373,8 @@
+ "id": "10",
+ "seqid": 3,
+ "position": {
+ - "x": 6.000000,
+ - "y": -1.000000
+ + "x": 9.600000,
+ + "y": -1.600000
+ },
+ "alias": "G",
+ "templateId": "G___Guanine"
+ @@ -384,7 +384,7 @@
+ "id": "11",
+ "seqid": 3,
+ "position": {
+ - "x": 7.000000,
+ + "x": 11.200001,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -395,7 +395,7 @@
+ "id": "12",
+ "seqid": 4,
+ "position": {
+ - "x": 8.000000,
+ + "x": 12.800000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -406,8 +406,8 @@
+ "id": "13",
+ "seqid": 4,
+ "position": {
+ - "x": 8.000000,
+ - "y": -1.000000
+ + "x": 12.800000,
+ + "y": -1.600000
+ },
+ "alias": "U",
+ "templateId": "U___Uracil"
+ @@ -417,7 +417,7 @@
+ "id": "14",
+ "seqid": 4,
+ "position": {
+ - "x": 9.000000,
+ + "x": 14.400001,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -428,7 +428,7 @@
+ "id": "15",
+ "seqid": 5,
+ "position": {
+ - "x": 10.000000,
+ + "x": 16.000000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -439,8 +439,8 @@
+ "id": "16",
+ "seqid": 5,
+ "position": {
+ - "x": 10.000000,
+ - "y": -1.000000
+ + "x": 16.000000,
+ + "y": -1.600000
+ },
+ "alias": "In",
+ "templateId": "In___Inosine"
+ idt_i2moera.ket:FAILED
+ ---
+ +++
+ @@ -64,7 +64,7 @@
+ "seqid": 0,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -74,7 +74,7 @@
+ "id": "2",
+ "seqid": 0,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ idt_i2moera_32moera.ket:FAILED
+ ---
+ +++
+ @@ -92,7 +92,7 @@
+ "seqid": 0,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -102,7 +102,7 @@
+ "id": "2",
+ "seqid": 0,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -113,7 +113,7 @@
+ "id": "3",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "MOE",
+ @@ -124,8 +124,8 @@
+ "id": "4",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ - "y": -1.000000
+ + "x": 3.200000,
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ idt_i2moera_sp.ket:FAILED
+ ---
+ +++
+ @@ -64,7 +64,7 @@
+ "seqid": 0,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -74,7 +74,7 @@
+ "id": "2",
+ "seqid": 0,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "sP",
+ idt_i2moera_sp_32moera.ket:FAILED
+ ---
+ +++
+ @@ -92,7 +92,7 @@
+ "seqid": 0,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -102,7 +102,7 @@
+ "id": "2",
+ "seqid": 0,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "sP",
+ @@ -113,7 +113,7 @@
+ "id": "3",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "MOE",
+ @@ -124,8 +124,8 @@
+ "id": "4",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ - "y": -1.000000
+ + "x": 3.200000,
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ idt_i2moera_t.ket:FAILED
+ ---
+ +++
+ @@ -98,7 +98,7 @@
+ "seqid": 0,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -108,7 +108,7 @@
+ "id": "2",
+ "seqid": 0,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -119,7 +119,7 @@
+ "id": "3",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -130,8 +130,8 @@
+ "id": "4",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ - "y": -1.000000
+ + "x": 3.200000,
+ + "y": -1.600000
+ },
+ "alias": "T",
+ "templateId": "T___Thymine"
+ idt_many_molecules.ket:FAILED
+ ---
+ +++
+ @@ -584,7 +584,7 @@
+ "seqid": 0,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -594,7 +594,7 @@
+ "id": "2",
+ "seqid": 0,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -605,7 +605,7 @@
+ "id": "3",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -616,8 +616,8 @@
+ "id": "4",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ - "y": -1.000000
+ + "x": 3.200000,
+ + "y": -1.600000
+ },
+ "alias": "C",
+ "templateId": "C___Cytosine"
+ @@ -627,7 +627,7 @@
+ "id": "5",
+ "seqid": 1,
+ "position": {
+ - "x": 3.000000,
+ + "x": 4.800000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -638,7 +638,7 @@
+ "id": "6",
+ "seqid": 2,
+ "position": {
+ - "x": 4.000000,
+ + "x": 6.400000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -649,8 +649,8 @@
+ "id": "7",
+ "seqid": 2,
+ "position": {
+ - "x": 4.000000,
+ - "y": -1.000000
+ + "x": 6.400000,
+ + "y": -1.600000
+ },
+ "alias": "T",
+ "templateId": "T___Thymine"
+ @@ -660,7 +660,7 @@
+ "id": "8",
+ "seqid": 2,
+ "position": {
+ - "x": 5.000000,
+ + "x": 8.000000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -671,7 +671,7 @@
+ "id": "9",
+ "seqid": 3,
+ "position": {
+ - "x": 6.000000,
+ + "x": 9.600000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -682,8 +682,8 @@
+ "id": "10",
+ "seqid": 3,
+ "position": {
+ - "x": 6.000000,
+ - "y": -1.000000
+ + "x": 9.600000,
+ + "y": -1.600000
+ },
+ "alias": "G",
+ "templateId": "G___Guanine"
+ @@ -694,7 +694,7 @@
+ "seqid": 0,
+ "position": {
+ "x": 0.000000,
+ - "y": -2.000000
+ + "y": -3.200000
+ },
+ "alias": "MOE",
+ "templateId": "MOE___2'-O-Methoxyethyl ribose"
+ @@ -705,7 +705,7 @@
+ "seqid": 0,
+ "position": {
+ "x": 0.000000,
+ - "y": -3.000000
+ + "y": -4.800000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -715,8 +715,8 @@
+ "id": "13",
+ "seqid": 0,
+ "position": {
+ - "x": 1.000000,
+ - "y": -2.000000
+ + "x": 1.600000,
+ + "y": -3.200000
+ },
+ "alias": "sP",
+ "templateId": "sP___Phosporothioate"
+ @@ -726,8 +726,8 @@
+ "id": "14",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ - "y": -2.000000
+ + "x": 3.200000,
+ + "y": -3.200000
+ },
+ "alias": "dR",
+ "templateId": "dR___Deoxy-Ribose"
+ @@ -737,8 +737,8 @@
+ "id": "15",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ - "y": -3.000000
+ + "x": 3.200000,
+ + "y": -4.800000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -748,8 +748,8 @@
+ "id": "16",
+ "seqid": 1,
+ "position": {
+ - "x": 3.000000,
+ - "y": -2.000000
+ + "x": 4.800000,
+ + "y": -3.200000
+ },
+ "alias": "P",
+ "templateId": "P___Phosphate"
+ @@ -759,8 +759,8 @@
+ "id": "17",
+ "seqid": 2,
+ "position": {
+ - "x": 4.000000,
+ - "y": -2.000000
+ + "x": 6.400000,
+ + "y": -3.200000
+ },
+ "alias": "dR",
+ "templateId": "dR___Deoxy-Ribose"
+ @@ -770,8 +770,8 @@
+ "id": "18",
+ "seqid": 2,
+ "position": {
+ - "x": 4.000000,
+ - "y": -3.000000
+ + "x": 6.400000,
+ + "y": -4.800000
+ },
+ "alias": "U",
+ "templateId": "U___Uracil"
+ @@ -781,8 +781,8 @@
+ "id": "19",
+ "seqid": 2,
+ "position": {
+ - "x": 5.000000,
+ - "y": -2.000000
+ + "x": 8.000000,
+ + "y": -3.200000
+ },
+ "alias": "P",
+ "templateId": "P___Phosphate"
+ @@ -793,7 +793,7 @@
+ "seqid": 0,
+ "position": {
+ "x": 0.000000,
+ - "y": -4.000000
+ + "y": -6.400000
+ },
+ "alias": "dR",
+ "templateId": "dR___Deoxy-Ribose"
+ @@ -804,7 +804,7 @@
+ "seqid": 0,
+ "position": {
+ "x": 0.000000,
+ - "y": -5.000000
+ + "y": -8.000000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -814,8 +814,8 @@
+ "id": "22",
+ "seqid": 0,
+ "position": {
+ - "x": 1.000000,
+ - "y": -4.000000
+ + "x": 1.600000,
+ + "y": -6.400000
+ },
+ "alias": "P",
+ "templateId": "P___Phosphate"
+ @@ -825,8 +825,8 @@
+ "id": "23",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ - "y": -4.000000
+ + "x": 3.200000,
+ + "y": -6.400000
+ },
+ "alias": "dR",
+ "templateId": "dR___Deoxy-Ribose"
+ @@ -836,8 +836,8 @@
+ "id": "24",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ - "y": -5.000000
+ + "x": 3.200000,
+ + "y": -8.000000
+ },
+ "alias": "C",
+ "templateId": "C___Cytosine"
+ @@ -847,8 +847,8 @@
+ "id": "25",
+ "seqid": 1,
+ "position": {
+ - "x": 3.000000,
+ - "y": -4.000000
+ + "x": 4.800000,
+ + "y": -6.400000
+ },
+ "alias": "P",
+ "templateId": "P___Phosphate"
+ @@ -858,8 +858,8 @@
+ "id": "26",
+ "seqid": 2,
+ "position": {
+ - "x": 4.000000,
+ - "y": -4.000000
+ + "x": 6.400000,
+ + "y": -6.400000
+ },
+ "alias": "MOE",
+ "templateId": "MOE___2'-O-Methoxyethyl ribose"
+ @@ -869,8 +869,8 @@
+ "id": "27",
+ "seqid": 2,
+ "position": {
+ - "x": 4.000000,
+ - "y": -5.000000
+ + "x": 6.400000,
+ + "y": -8.000000
+ },
+ "alias": "5meC",
+ "templateId": "5meC___5-methyl-cytidine"
+ @@ -880,8 +880,8 @@
+ "id": "28",
+ "seqid": 2,
+ "position": {
+ - "x": 5.000000,
+ - "y": -4.000000
+ + "x": 8.000000,
+ + "y": -6.400000
+ },
+ "alias": "P",
+ "templateId": "P___Phosphate"
+ @@ -891,8 +891,8 @@
+ "id": "29",
+ "seqid": 3,
+ "position": {
+ - "x": 6.000000,
+ - "y": -4.000000
+ + "x": 9.600000,
+ + "y": -6.400000
+ },
+ "alias": "P",
+ "templateId": "P___Phosphate"
+ @@ -903,7 +903,7 @@
+ "seqid": 0,
+ "position": {
+ "x": 0.000000,
+ - "y": -6.000000
+ + "y": -9.600000
+ },
+ "alias": "dR",
+ "templateId": "dR___Deoxy-Ribose"
+ @@ -914,7 +914,7 @@
+ "seqid": 0,
+ "position": {
+ "x": 0.000000,
+ - "y": -7.000000
+ + "y": -11.200001
+ },
+ "alias": "T",
+ "templateId": "T___Thymine"
+ @@ -924,8 +924,8 @@
+ "id": "32",
+ "seqid": 0,
+ "position": {
+ - "x": 1.000000,
+ - "y": -6.000000
+ + "x": 1.600000,
+ + "y": -9.600000
+ },
+ "alias": "P",
+ "templateId": "P___Phosphate"
+ @@ -935,8 +935,8 @@
+ "id": "33",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ - "y": -6.000000
+ + "x": 3.200000,
+ + "y": -9.600000
+ },
+ "alias": "dR",
+ "templateId": "dR___Deoxy-Ribose"
+ @@ -946,8 +946,8 @@
+ "id": "34",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ - "y": -7.000000
+ + "x": 3.200000,
+ + "y": -11.200001
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -957,8 +957,8 @@
+ "id": "35",
+ "seqid": 1,
+ "position": {
+ - "x": 3.000000,
+ - "y": -6.000000
+ + "x": 4.800000,
+ + "y": -9.600000
+ },
+ "alias": "P",
+ "templateId": "P___Phosphate"
+ @@ -968,8 +968,8 @@
+ "id": "36",
+ "seqid": 2,
+ "position": {
+ - "x": 4.000000,
+ - "y": -6.000000
+ + "x": 6.400000,
+ + "y": -9.600000
+ },
+ "alias": "dR",
+ "templateId": "dR___Deoxy-Ribose"
+ @@ -979,8 +979,8 @@
+ "id": "37",
+ "seqid": 2,
+ "position": {
+ - "x": 4.000000,
+ - "y": -7.000000
+ + "x": 6.400000,
+ + "y": -11.200001
+ },
+ "alias": "C",
+ "templateId": "C___Cytosine"
+ @@ -990,8 +990,8 @@
+ "id": "38",
+ "seqid": 2,
+ "position": {
+ - "x": 5.000000,
+ - "y": -6.000000
+ + "x": 8.000000,
+ + "y": -9.600000
+ },
+ "alias": "P",
+ "templateId": "P___Phosphate"
+ @@ -1001,8 +1001,8 @@
+ "id": "39",
+ "seqid": 3,
+ "position": {
+ - "x": 6.000000,
+ - "y": -6.000000
+ + "x": 9.600000,
+ + "y": -9.600000
+ },
+ "alias": "dR",
+ "templateId": "dR___Deoxy-Ribose"
+ @@ -1012,8 +1012,8 @@
+ "id": "40",
+ "seqid": 3,
+ "position": {
+ - "x": 6.000000,
+ - "y": -7.000000
+ + "x": 9.600000,
+ + "y": -11.200001
+ },
+ "alias": "G",
+ "templateId": "G___Guanine"
+ idt_mixed.ket:FAILED
+ ---
+ +++
+ @@ -173,7 +173,7 @@
+ "id": "1",
+ "seqid": 1,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "LR",
+ @@ -184,8 +184,8 @@
+ "id": "2",
+ "seqid": 1,
+ "position": {
+ - "x": 1.000000,
+ - "y": -1.000000
+ + "x": 1.600000,
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -195,7 +195,7 @@
+ "id": "3",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "sP",
+ @@ -206,7 +206,7 @@
+ "id": "4",
+ "seqid": 2,
+ "position": {
+ - "x": 3.000000,
+ + "x": 4.800000,
+ "y": -0.000000
+ },
+ "alias": "MOE",
+ @@ -217,8 +217,8 @@
+ "id": "5",
+ "seqid": 2,
+ "position": {
+ - "x": 3.000000,
+ - "y": -1.000000
+ + "x": 4.800000,
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -228,7 +228,7 @@
+ "id": "6",
+ "seqid": 2,
+ "position": {
+ - "x": 4.000000,
+ + "x": 6.400000,
+ "y": -0.000000
+ },
+ "alias": "sP",
+ @@ -239,7 +239,7 @@
+ "id": "7",
+ "seqid": 3,
+ "position": {
+ - "x": 5.000000,
+ + "x": 8.000000,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -250,8 +250,8 @@
+ "id": "8",
+ "seqid": 3,
+ "position": {
+ - "x": 5.000000,
+ - "y": -1.000000
+ + "x": 8.000000,
+ + "y": -1.600000
+ },
+ "alias": "G",
+ "templateId": "G___Guanine"
+ @@ -261,7 +261,7 @@
+ "id": "9",
+ "seqid": 3,
+ "position": {
+ - "x": 6.000000,
+ + "x": 9.600000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ idt_mixed_custom.ket:FAILED
+ ---
+ +++
+ @@ -148,7 +148,7 @@
+ "id": "1",
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "seqid": 0,
+ "alias": "(N1)",
+ @@ -159,7 +159,7 @@
+ "id": "2",
+ "seqid": 0,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -170,7 +170,7 @@
+ "id": "3",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -180,8 +180,8 @@
+ "type": "ambiguousMonomer",
+ "id": "4",
+ "position": {
+ - "x": 2.000000,
+ - "y": -1.000000
+ + "x": 3.200000,
+ + "y": -1.600000
+ },
+ "seqid": 1,
+ "alias": "(N1)",
+ @@ -192,7 +192,7 @@
+ "id": "5",
+ "seqid": 1,
+ "position": {
+ - "x": 3.000000,
+ + "x": 4.800000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -203,7 +203,7 @@
+ "id": "6",
+ "seqid": 2,
+ "position": {
+ - "x": 4.000000,
+ + "x": 6.400000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -213,8 +213,8 @@
+ "type": "ambiguousMonomer",
+ "id": "7",
+ "position": {
+ - "x": 4.000000,
+ - "y": -1.000000
+ + "x": 6.400000,
+ + "y": -1.600000
+ },
+ "seqid": 2,
+ "alias": "N",
+ idt_mixed_std.ket:FAILED
+ ---
+ +++
+ @@ -188,7 +188,7 @@
+ "seqid": 0,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -198,7 +198,7 @@
+ "id": "2",
+ "seqid": 0,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -209,7 +209,7 @@
+ "id": "3",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -219,8 +219,8 @@
+ "type": "ambiguousMonomer",
+ "id": "4",
+ "position": {
+ - "x": 2.000000,
+ - "y": -1.000000
+ + "x": 3.200000,
+ + "y": -1.600000
+ },
+ "seqid": 1,
+ "alias": "R",
+ @@ -231,7 +231,7 @@
+ "id": "5",
+ "seqid": 1,
+ "position": {
+ - "x": 3.000000,
+ + "x": 4.800000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -242,7 +242,7 @@
+ "id": "6",
+ "seqid": 2,
+ "position": {
+ - "x": 4.000000,
+ + "x": 6.400000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -253,8 +253,8 @@
+ "id": "7",
+ "seqid": 2,
+ "position": {
+ - "x": 4.000000,
+ - "y": -1.000000
+ + "x": 6.400000,
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -264,7 +264,7 @@
+ "id": "8",
+ "seqid": 2,
+ "position": {
+ - "x": 5.000000,
+ + "x": 8.000000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -275,7 +275,7 @@
+ "id": "9",
+ "seqid": 3,
+ "position": {
+ - "x": 6.000000,
+ + "x": 9.600000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -285,8 +285,8 @@
+ "type": "ambiguousMonomer",
+ "id": "10",
+ "position": {
+ - "x": 6.000000,
+ - "y": -1.000000
+ + "x": 9.600000,
+ + "y": -1.600000
+ },
+ "seqid": 3,
+ "alias": "S",
+ idt_mod_phosphates.ket:FAILED
+ ---
+ +++
+ @@ -91,7 +91,7 @@
+ "id": "1",
+ "seqid": 1,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "MOE",
+ @@ -102,8 +102,8 @@
+ "id": "2",
+ "seqid": 1,
+ "position": {
+ - "x": 1.000000,
+ - "y": -1.000000
+ + "x": 1.600000,
+ + "y": -1.600000
+ },
+ "alias": "5meC",
+ "templateId": "5meC___5-methyl-cytidine"
+ @@ -113,7 +113,7 @@
+ "id": "3",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -124,7 +124,7 @@
+ "id": "4",
+ "seqid": 2,
+ "position": {
+ - "x": 3.000000,
+ + "x": 4.800000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ idt_modifications.ket:FAILED
+ ---
+ +++
+ @@ -137,7 +137,7 @@
+ "seqid": 0,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -147,7 +147,7 @@
+ "id": "2",
+ "seqid": 0,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "sP",
+ @@ -158,7 +158,7 @@
+ "id": "3",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "MOE",
+ @@ -169,8 +169,8 @@
+ "id": "4",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ - "y": -1.000000
+ + "x": 3.200000,
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -180,7 +180,7 @@
+ "id": "5",
+ "seqid": 1,
+ "position": {
+ - "x": 3.000000,
+ + "x": 4.800000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -191,7 +191,7 @@
+ "id": "6",
+ "seqid": 2,
+ "position": {
+ - "x": 4.000000,
+ + "x": 6.400000,
+ "y": -0.000000
+ },
+ "alias": "MOE",
+ @@ -202,8 +202,8 @@
+ "id": "7",
+ "seqid": 2,
+ "position": {
+ - "x": 4.000000,
+ - "y": -1.000000
+ + "x": 6.400000,
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ idt_prefix_suffix.ket:FAILED
+ ---
+ +++
+ @@ -329,7 +329,7 @@
+ "seqid": 0,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -339,7 +339,7 @@
+ "id": "2",
+ "seqid": 0,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "sP",
+ @@ -350,7 +350,7 @@
+ "id": "3",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -361,8 +361,8 @@
+ "id": "4",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ - "y": -1.000000
+ + "x": 3.200000,
+ + "y": -1.600000
+ },
+ "alias": "T",
+ "templateId": "T___Thymine"
+ @@ -372,7 +372,7 @@
+ "id": "5",
+ "seqid": 1,
+ "position": {
+ - "x": 3.000000,
+ + "x": 4.800000,
+ "y": -0.000000
+ },
+ "alias": "sP",
+ @@ -383,7 +383,7 @@
+ "id": "6",
+ "seqid": 2,
+ "position": {
+ - "x": 4.000000,
+ + "x": 6.400000,
+ "y": -0.000000
+ },
+ "alias": "LR",
+ @@ -394,8 +394,8 @@
+ "id": "7",
+ "seqid": 2,
+ "position": {
+ - "x": 4.000000,
+ - "y": -1.000000
+ + "x": 6.400000,
+ + "y": -1.600000
+ },
+ "alias": "C",
+ "templateId": "C___Cytosine"
+ @@ -405,7 +405,7 @@
+ "id": "8",
+ "seqid": 2,
+ "position": {
+ - "x": 5.000000,
+ + "x": 8.000000,
+ "y": -0.000000
+ },
+ "alias": "sP",
+ @@ -416,7 +416,7 @@
+ "id": "9",
+ "seqid": 3,
+ "position": {
+ - "x": 6.000000,
+ + "x": 9.600000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -427,8 +427,8 @@
+ "id": "10",
+ "seqid": 3,
+ "position": {
+ - "x": 6.000000,
+ - "y": -1.000000
+ + "x": 9.600000,
+ + "y": -1.600000
+ },
+ "alias": "G",
+ "templateId": "G___Guanine"
+ @@ -438,7 +438,7 @@
+ "id": "11",
+ "seqid": 3,
+ "position": {
+ - "x": 7.000000,
+ + "x": 11.200001,
+ "y": -0.000000
+ },
+ "alias": "sP",
+ @@ -449,7 +449,7 @@
+ "id": "12",
+ "seqid": 4,
+ "position": {
+ - "x": 8.000000,
+ + "x": 12.800000,
+ "y": -0.000000
+ },
+ "alias": "LR",
+ @@ -460,8 +460,8 @@
+ "id": "13",
+ "seqid": 4,
+ "position": {
+ - "x": 8.000000,
+ - "y": -1.000000
+ + "x": 12.800000,
+ + "y": -1.600000
+ },
+ "alias": "U",
+ "templateId": "U___Uracil"
+ @@ -471,7 +471,7 @@
+ "id": "14",
+ "seqid": 4,
+ "position": {
+ - "x": 9.000000,
+ + "x": 14.400001,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -482,7 +482,7 @@
+ "id": "15",
+ "seqid": 5,
+ "position": {
+ - "x": 10.000000,
+ + "x": 16.000000,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -493,8 +493,8 @@
+ "id": "16",
+ "seqid": 5,
+ "position": {
+ - "x": 10.000000,
+ - "y": -1.000000
+ + "x": 16.000000,
+ + "y": -1.600000
+ },
+ "alias": "In",
+ "templateId": "In___Inosine"
+ @@ -504,7 +504,7 @@
+ "id": "17",
+ "seqid": 5,
+ "position": {
+ - "x": 11.000000,
+ + "x": 17.600000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -515,7 +515,7 @@
+ "id": "18",
+ "seqid": 6,
+ "position": {
+ - "x": 12.000000,
+ + "x": 19.200001,
+ "y": -0.000000
+ },
+ "alias": "mR",
+ @@ -526,8 +526,8 @@
+ "id": "19",
+ "seqid": 6,
+ "position": {
+ - "x": 12.000000,
+ - "y": -1.000000
+ + "x": 19.200001,
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
- idt_single_nucleoside.ket:SUCCEED
+ idt_single_nucleoside.ket:FAILED
- idt_std_phosphates.ket:SUCCEED
+ ---
- idt_t_i2moera.ket:SUCCEED
- idt_unresolved.ket:SUCCEED
+ +++
- idt_unresolved_many.ket:SUCCEED
+ @@ -47,7 +47,7 @@
+ "seqid": 0,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ idt_std_phosphates.ket:FAILED
+ ---
+ +++
+ @@ -167,7 +167,7 @@
+ "id": "1",
+ "seqid": 1,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -178,8 +178,8 @@
+ "id": "2",
+ "seqid": 1,
+ "position": {
+ - "x": 1.000000,
+ - "y": -1.000000
+ + "x": 1.600000,
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -189,7 +189,7 @@
+ "id": "3",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -200,7 +200,7 @@
+ "id": "4",
+ "seqid": 2,
+ "position": {
+ - "x": 3.000000,
+ + "x": 4.800000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -211,8 +211,8 @@
+ "id": "5",
+ "seqid": 2,
+ "position": {
+ - "x": 3.000000,
+ - "y": -1.000000
+ + "x": 4.800000,
+ + "y": -1.600000
+ },
+ "alias": "T",
+ "templateId": "T___Thymine"
+ @@ -222,7 +222,7 @@
+ "id": "6",
+ "seqid": 2,
+ "position": {
+ - "x": 4.000000,
+ + "x": 6.400000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -233,7 +233,7 @@
+ "id": "7",
+ "seqid": 3,
+ "position": {
+ - "x": 5.000000,
+ + "x": 8.000000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -244,8 +244,8 @@
+ "id": "8",
+ "seqid": 3,
+ "position": {
+ - "x": 5.000000,
+ - "y": -1.000000
+ + "x": 8.000000,
+ + "y": -1.600000
+ },
+ "alias": "G",
+ "templateId": "G___Guanine"
+ @@ -255,7 +255,7 @@
+ "id": "9",
+ "seqid": 3,
+ "position": {
+ - "x": 6.000000,
+ + "x": 9.600000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ idt_t_i2moera.ket:FAILED
+ ---
+ +++
+ @@ -112,7 +112,7 @@
+ "seqid": 0,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "T",
+ "templateId": "T___Thymine"
+ @@ -122,7 +122,7 @@
+ "id": "2",
+ "seqid": 0,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -133,7 +133,7 @@
+ "id": "3",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "MOE",
+ @@ -144,8 +144,8 @@
+ "id": "4",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ - "y": -1.000000
+ + "x": 3.200000,
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -155,7 +155,7 @@
+ "id": "5",
+ "seqid": 1,
+ "position": {
+ - "x": 3.000000,
+ + "x": 4.800000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ idt_unresolved.ket:FAILED
+ ---
+ +++
+ @@ -46,7 +46,7 @@
+ "id": "1",
+ "seqid": 1,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "unr2",
+ idt_unresolved_many.ket:FAILED
+ ---
+ +++
+ @@ -409,7 +409,7 @@
+ "id": "1",
+ "seqid": 1,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -420,8 +420,8 @@
+ "id": "2",
+ "seqid": 1,
+ "position": {
+ - "x": 1.000000,
+ - "y": -1.000000
+ + "x": 1.600000,
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -431,7 +431,7 @@
+ "id": "3",
+ "seqid": 1,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -442,7 +442,7 @@
+ "id": "4",
+ "seqid": 2,
+ "position": {
+ - "x": 3.000000,
+ + "x": 4.800000,
+ "y": -0.000000
+ },
+ "alias": "unr1",
+ @@ -453,7 +453,7 @@
+ "id": "5",
+ "seqid": 3,
+ "position": {
+ - "x": 4.000000,
+ + "x": 6.400000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -464,8 +464,8 @@
+ "id": "6",
+ "seqid": 3,
+ "position": {
+ - "x": 4.000000,
+ - "y": -1.000000
+ + "x": 6.400000,
+ + "y": -1.600000
+ },
+ "alias": "C",
+ "templateId": "C___Cytosine"
+ @@ -475,7 +475,7 @@
+ "id": "7",
+ "seqid": 3,
+ "position": {
+ - "x": 5.000000,
+ + "x": 8.000000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -486,7 +486,7 @@
+ "id": "8",
+ "seqid": 4,
+ "position": {
+ - "x": 6.000000,
+ + "x": 9.600000,
+ "y": -0.000000
+ },
+ "alias": "unr2",
+ @@ -497,7 +497,7 @@
+ "id": "9",
+ "seqid": 5,
+ "position": {
+ - "x": 7.000000,
+ + "x": 11.200000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -508,8 +508,8 @@
+ "id": "10",
+ "seqid": 5,
+ "position": {
+ - "x": 7.000000,
+ - "y": -1.000000
+ + "x": 11.200000,
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -519,7 +519,7 @@
+ "id": "11",
+ "seqid": 5,
+ "position": {
+ - "x": 8.000000,
+ + "x": 12.800000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -530,7 +530,7 @@
+ "id": "12",
+ "seqid": 6,
+ "position": {
+ - "x": 9.000000,
+ + "x": 14.400001,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -541,8 +541,8 @@
+ "id": "13",
+ "seqid": 6,
+ "position": {
+ - "x": 9.000000,
+ - "y": -1.000000
+ + "x": 14.400001,
+ + "y": -1.600000
+ },
+ "alias": "C",
+ "templateId": "C___Cytosine"
+ @@ -552,7 +552,7 @@
+ "id": "14",
+ "seqid": 6,
+ "position": {
+ - "x": 10.000000,
+ + "x": 16.000000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -563,7 +563,7 @@
+ "id": "15",
+ "seqid": 7,
+ "position": {
+ - "x": 11.000000,
+ + "x": 17.600000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -574,8 +574,8 @@
+ "id": "16",
+ "seqid": 7,
+ "position": {
+ - "x": 11.000000,
+ - "y": -1.000000
+ + "x": 17.600000,
+ + "y": -1.600000
+ },
+ "alias": "T",
+ "templateId": "T___Thymine"
+ @@ -585,7 +585,7 @@
+ "id": "17",
+ "seqid": 7,
+ "position": {
+ - "x": 12.000000,
+ + "x": 19.200001,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -596,7 +596,7 @@
+ "id": "18",
+ "seqid": 8,
+ "position": {
+ - "x": 13.000000,
+ + "x": 20.800001,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -607,8 +607,8 @@
+ "id": "19",
+ "seqid": 8,
+ "position": {
+ - "x": 13.000000,
+ - "y": -1.000000
+ + "x": 20.800001,
+ + "y": -1.600000
+ },
+ "alias": "G",
+ "templateId": "G___Guanine"
+ @@ -618,7 +618,7 @@
+ "id": "20",
+ "seqid": 8,
+ "position": {
+ - "x": 14.000000,
+ + "x": 22.400002,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -629,7 +629,7 @@
+ "id": "21",
+ "seqid": 9,
+ "position": {
+ - "x": 15.000000,
+ + "x": 24.000000,
+ "y": -0.000000
+ },
+ "alias": "unr3",
+ @@ -640,7 +640,7 @@
+ "id": "22",
+ "seqid": 10,
+ "position": {
+ - "x": 16.000000,
+ + "x": 25.600000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -651,8 +651,8 @@
+ "id": "23",
+ "seqid": 10,
+ "position": {
+ - "x": 16.000000,
+ - "y": -1.000000
+ + "x": 25.600000,
+ + "y": -1.600000
+ },
+ "alias": "G",
+ "templateId": "G___Guanine"
+ @@ -662,7 +662,7 @@
+ "id": "24",
+ "seqid": 10,
+ "position": {
+ - "x": 17.000000,
+ + "x": 27.200001,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -673,7 +673,7 @@
+ "id": "25",
+ "seqid": 11,
+ "position": {
+ - "x": 18.000000,
+ + "x": 28.800001,
+ "y": -0.000000
+ },
+ "alias": "unr4",
Check failure on line 1 in api/c/tests/unit/tests/formats.cpp
github-actions / ubuntu-latest-x86_64-java_test_report
formats.mol_to_ket
[FAILED]
Raw output
Diff:
- acgt_1412.ket:SUCCEED
+ acgt_1412.ket:FAILED
+ ---
+ +++
+ @@ -299,7 +299,7 @@
+ "seqid": 2,
+ "position": {
+ "x": 7.409950256347656,
+ - "y": -8.6875
+ + "y": -9.287500381469727
+ },
+ "alias": "A",
+ "templateId": "Ade"
+ @@ -321,7 +321,7 @@
+ "seqid": 3,
+ "position": {
+ "x": 8.354849815368653,
+ - "y": -8.6875
+ + "y": -9.287500381469727
+ },
+ "alias": "C",
+ "templateId": "Cyt"
+ @@ -343,7 +343,7 @@
+ "seqid": 4,
+ "position": {
+ "x": 9.299699783325196,
+ - "y": -8.6875
+ + "y": -9.287500381469727
+ },
+ "alias": "G",
+ "templateId": "Gua"
+ @@ -365,7 +365,7 @@
+ "seqid": 5,
+ "position": {
+ "x": 10.244550704956055,
+ - "y": -8.6875
+ + "y": -9.287500381469727
+ },
+ "alias": "T",
+ "templateId": "Thy"
+ @@ -375,7 +375,7 @@
+ "id": "13",
+ "seqid": 6,
+ "position": {
+ - "x": 11.717000007629395,
+ + "x": 12.317000389099121,
+ "y": -7.6875
+ },
+ "alias": "R",
+ @@ -386,8 +386,8 @@
+ "id": "14",
+ "seqid": 6,
+ "position": {
+ - "x": 11.717000007629395,
+ - "y": -8.6875
+ + "x": 12.317000389099121,
+ + "y": -9.287500381469727
+ },
+ "alias": "U",
+ "templateId": "Ura"
- conjugate.ket:SUCCEED
+ conjugate.ket:FAILED
+ ---
+ +++
+ @@ -1667,7 +1667,7 @@
+ "seqid": 22,
+ "position": {
+ "x": 10.088197708129883,
+ - "y": -12.218631744384766
+ + "y": -12.818632125854493
+ },
+ "alias": "G",
+ "templateId": "Gua"
+ @@ -1700,7 +1700,7 @@
+ "seqid": 20,
+ "position": {
+ "x": 7.537199974060059,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "C",
+ "templateId": "Cyt"
+ @@ -1722,7 +1722,7 @@
+ "seqid": 19,
+ "position": {
+ "x": 7.263199806213379,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "G",
+ "templateId": "Gua"
+ @@ -1744,7 +1744,7 @@
+ "seqid": 18,
+ "position": {
+ "x": 6.989200115203857,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "C",
+ "templateId": "Cyt"
+ @@ -1766,7 +1766,7 @@
+ "seqid": 17,
+ "position": {
+ "x": 6.715199947357178,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "T",
+ "templateId": "Thy"
+ @@ -1788,7 +1788,7 @@
+ "seqid": 16,
+ "position": {
+ "x": 6.441200256347656,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "G",
+ "templateId": "Gua"
+ @@ -1810,7 +1810,7 @@
+ "seqid": 15,
+ "position": {
+ "x": 6.167200088500977,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "A",
+ "templateId": "Ade"
+ @@ -1832,7 +1832,7 @@
+ "seqid": 21,
+ "position": {
+ "x": 7.948249816894531,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "C",
+ "templateId": "Cyt"
+ @@ -1854,7 +1854,7 @@
+ "seqid": 14,
+ "position": {
+ "x": 5.893150329589844,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "C",
+ "templateId": "Cyt"
+ @@ -1887,7 +1887,7 @@
+ "seqid": 12,
+ "position": {
+ "x": 5.345099925994873,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "A",
+ "templateId": "Ade"
+ @@ -1909,7 +1909,7 @@
+ "seqid": 11,
+ "position": {
+ "x": 4.934100151062012,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "C",
+ "templateId": "Cyt"
+ @@ -1920,7 +1920,7 @@
+ "seqid": 13,
+ "position": {
+ "x": 5.619100093841553,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "C",
+ "templateId": "Cyt"
+ @@ -1942,7 +1942,7 @@
+ "seqid": 10,
+ "position": {
+ "x": 4.523099899291992,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "T",
+ "templateId": "Thy"
+ @@ -1975,7 +1975,7 @@
+ "seqid": 9,
+ "position": {
+ "x": 4.249050140380859,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "C",
+ "templateId": "Cyt"
+ @@ -1997,7 +1997,7 @@
+ "seqid": 8,
+ "position": {
+ "x": 3.9749999046325685,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "A",
+ "templateId": "Ade"
+ @@ -2019,7 +2019,7 @@
+ "seqid": 7,
+ "position": {
+ "x": 3.7009999752044679,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "T",
+ "templateId": "Thy"
+ @@ -2041,7 +2041,7 @@
+ "seqid": 6,
+ "position": {
+ "x": 3.427000045776367,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "G",
+ "templateId": "Gua"
+ @@ -2063,7 +2063,7 @@
+ "seqid": 5,
+ "position": {
+ "x": 3.1529998779296877,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "C",
+ "templateId": "Cyt"
+ @@ -2085,7 +2085,7 @@
+ "seqid": 4,
+ "position": {
+ "x": 2.879000186920166,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "G",
+ "templateId": "Gua"
+ @@ -2107,7 +2107,7 @@
+ "seqid": 3,
+ "position": {
+ "x": 2.604949951171875,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "G",
+ "templateId": "Gua"
+ @@ -2129,7 +2129,7 @@
+ "seqid": 2,
+ "position": {
+ "x": 2.330900192260742,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "T",
+ "templateId": "Thy"
- dna_mod.ket:SUCCEED
+ dna_mod.ket:FAILED
+ ---
+ +++
+ @@ -1038,8 +1038,8 @@
+ "id": "20",
+ "seqid": 22,
+ "position": {
+ - "x": 9.222299575805664,
+ - "y": -12.979000091552735
+ + "x": 9.82229995727539,
+ + "y": -13.579000473022461
+ },
+ "alias": "G",
+ "templateId": "Gua"
+ @@ -1049,7 +1049,7 @@
+ "id": "21",
+ "seqid": 22,
+ "position": {
+ - "x": 9.222299575805664,
+ + "x": 9.82229995727539,
+ "y": -11.979000091552735
+ },
+ "alias": "dR",
+ @@ -1061,7 +1061,7 @@
+ "seqid": 21,
+ "position": {
+ "x": 7.948249816894531,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "C",
+ "templateId": "Cyt"
+ @@ -1083,7 +1083,7 @@
+ "seqid": 20,
+ "position": {
+ "x": 7.537199974060059,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "C",
+ "templateId": "Cyt"
+ @@ -1104,8 +1104,8 @@
+ "id": "26",
+ "seqid": 18,
+ "position": {
+ - "x": 7.852200031280518,
+ - "y": -12.979000091552735
+ + "x": 8.452199935913086,
+ + "y": -13.579000473022461
+ },
+ "alias": "C",
+ "templateId": "Cyt"
+ @@ -1115,7 +1115,7 @@
+ "id": "27",
+ "seqid": 18,
+ "position": {
+ - "x": 7.852200031280518,
+ + "x": 8.452199935913086,
+ "y": -11.979000091552735
+ },
+ "alias": "dR",
+ @@ -1127,7 +1127,7 @@
+ "seqid": 17,
+ "position": {
+ "x": 6.715199947357178,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "T",
+ "templateId": "Thy"
+ @@ -1149,7 +1149,7 @@
+ "seqid": 16,
+ "position": {
+ "x": 6.441200256347656,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "G",
+ "templateId": "Gua"
+ @@ -1171,7 +1171,7 @@
+ "seqid": 15,
+ "position": {
+ "x": 6.167200088500977,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "A",
+ "templateId": "Ade"
+ @@ -1204,7 +1204,7 @@
+ "seqid": 14,
+ "position": {
+ "x": 5.893150329589844,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "C",
+ "templateId": "Cyt"
+ @@ -1226,7 +1226,7 @@
+ "seqid": 12,
+ "position": {
+ "x": 5.659220218658447,
+ - "y": -12.806477546691895
+ + "y": -13.406477928161621
+ },
+ "alias": "A",
+ "templateId": "Ade"
+ @@ -1248,7 +1248,7 @@
+ "seqid": 11,
+ "position": {
+ "x": 4.934100151062012,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "C",
+ "templateId": "Cyt"
+ @@ -1269,8 +1269,8 @@
+ "id": "41",
+ "seqid": 9,
+ "position": {
+ - "x": 5.111999988555908,
+ - "y": -12.979000091552735
+ + "x": 5.711999893188477,
+ + "y": -13.579000473022461
+ },
+ "alias": "C",
+ "templateId": "Cyt"
+ @@ -1280,7 +1280,7 @@
+ "id": "42",
+ "seqid": 9,
+ "position": {
+ - "x": 5.111999988555908,
+ + "x": 5.711999893188477,
+ "y": -11.979000091552735
+ },
+ "alias": "dR",
+ @@ -1292,7 +1292,7 @@
+ "seqid": 8,
+ "position": {
+ "x": 3.9749999046325685,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "A",
+ "templateId": "Ade"
+ @@ -1313,8 +1313,8 @@
+ "id": "45",
+ "seqid": 6,
+ "position": {
+ - "x": 4.289999961853027,
+ - "y": -12.979000091552735
+ + "x": 4.889999866485596,
+ + "y": -13.579000473022461
+ },
+ "alias": "G",
+ "templateId": "Gua"
+ @@ -1324,7 +1324,7 @@
+ "id": "46",
+ "seqid": 6,
+ "position": {
+ - "x": 4.289999961853027,
+ + "x": 4.889999866485596,
+ "y": -11.979000091552735
+ },
+ "alias": "dR",
+ @@ -1336,7 +1336,7 @@
+ "seqid": 5,
+ "position": {
+ "x": 3.1529998779296877,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "C",
+ "templateId": "Cyt"
+ @@ -1358,7 +1358,7 @@
+ "seqid": 4,
+ "position": {
+ "x": 2.879000186920166,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "G",
+ "templateId": "Gua"
+ @@ -1380,7 +1380,7 @@
+ "seqid": 3,
+ "position": {
+ "x": 2.604949951171875,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "G",
+ "templateId": "Gua"
+ @@ -1402,7 +1402,7 @@
+ "seqid": 2,
+ "position": {
+ "x": 2.330900192260742,
+ - "y": -12.979000091552735
+ + "y": -13.579000473022461
+ },
+ "alias": "T",
+ "templateId": "Thy"
- removed_phosphate.ket:SUCCEED
+ removed_phosphate.ket:FAILED
- rna_mod.ket:SUCCEED
+ ---
+ +++
+ @@ -206,8 +206,8 @@
+ "id": "3",
+ "seqid": 5,
+ "position": {
+ - "x": 2.2960000038146974,
+ - "y": -7.210899829864502
+ + "x": 2.8959999084472658,
+ + "y": -7.81089973449707
+ },
+ "alias": "T",
+ "templateId": "Thy"
+ @@ -217,7 +217,7 @@
+ "id": "4",
+ "seqid": 5,
+ "position": {
+ - "x": 2.2960000038146974,
+ + "x": 2.8959999084472658,
+ "y": -6.210899829864502
+ },
+ "alias": "R",
+ @@ -229,7 +229,7 @@
+ "seqid": 4,
+ "position": {
+ "x": 1.2156500816345215,
+ - "y": -7.210899829864502
+ + "y": -7.81089973449707
+ },
+ "alias": "G",
+ "templateId": "Gua"
+ @@ -251,7 +251,7 @@
+ "seqid": 3,
+ "position": {
+ "x": 1.0550000667572022,
+ - "y": -7.210899829864502
+ + "y": -7.81089973449707
+ },
+ "alias": "C",
+ "templateId": "Cyt"
+ rna_mod.ket:FAILED
+ ---
+ +++
+ @@ -748,8 +748,8 @@
+ "id": "14",
+ "seqid": 17,
+ "position": {
+ - "x": 14.602999687194825,
+ - "y": -7.3125
+ + "x": 15.20300006866455,
+ + "y": -7.912499904632568
+ },
+ "alias": "A",
+ "templateId": "Ade"
+ @@ -759,7 +759,7 @@
+ "id": "15",
+ "seqid": 17,
+ "position": {
+ - "x": 14.602999687194825,
+ + "x": 15.20300006866455,
+ "y": -6.3125
+ },
+ "alias": "R",
+ @@ -771,7 +771,7 @@
+ "seqid": 15,
+ "position": {
+ "x": 13.490978240966797,
+ - "y": -7.115175247192383
+ + "y": -7.715175151824951
+ },
+ "alias": "C",
+ "templateId": "Cyt"
+ @@ -804,7 +804,7 @@
+ "seqid": 14,
+ "position": {
+ "x": 12.918000221252442,
+ - "y": -7.3125
+ + "y": -7.912499904632568
+ },
+ "alias": "A",
+ "templateId": "Ade"
+ @@ -826,7 +826,7 @@
+ "seqid": 13,
+ "position": {
+ "x": 12.643949508666993,
+ - "y": -7.3125
+ + "y": -7.912499904632568
+ },
+ "alias": "C",
+ "templateId": "Cyt"
+ @@ -847,8 +847,8 @@
+ "id": "23",
+ "seqid": 11,
+ "position": {
+ - "x": 12.684900283813477,
+ - "y": -7.3125
+ + "x": 13.284900665283204,
+ + "y": -7.912499904632568
+ },
+ "alias": "A",
+ "templateId": "Ade"
+ @@ -858,7 +858,7 @@
+ "id": "24",
+ "seqid": 11,
+ "position": {
+ - "x": 12.684900283813477,
+ + "x": 13.284900665283204,
+ "y": -6.3125
+ },
+ "alias": "R",
+ @@ -870,7 +870,7 @@
+ "seqid": 10,
+ "position": {
+ "x": 11.547900199890137,
+ - "y": -7.3125
+ + "y": -7.912499904632568
+ },
+ "alias": "A",
+ "templateId": "Ade"
+ @@ -891,8 +891,8 @@
+ "id": "27",
+ "seqid": 8,
+ "position": {
+ - "x": 11.862799644470215,
+ - "y": -7.3125
+ + "x": 12.462800025939942,
+ + "y": -7.912499904632568
+ },
+ "alias": "G",
+ "templateId": "Gua"
+ @@ -902,7 +902,7 @@
+ "id": "28",
+ "seqid": 8,
+ "position": {
+ - "x": 11.862799644470215,
+ + "x": 12.462800025939942,
+ "y": -6.3125
+ },
+ "alias": "R",
+ @@ -914,7 +914,7 @@
+ "seqid": 7,
+ "position": {
+ "x": 10.725799560546875,
+ - "y": -7.3125
+ + "y": -7.912499904632568
+ },
+ "alias": "C",
+ "templateId": "Cyt"
+ @@ -936,7 +936,7 @@
+ "seqid": 6,
+ "position": {
+ "x": 10.451800346374512,
+ - "y": -7.3125
+ + "y": -7.912499904632568
+ },
+ "alias": "G",
+ "templateId": "Gua"
+ @@ -957,8 +957,8 @@
+ "id": "33",
+ "seqid": 4,
+ "position": {
+ - "x": 10.766799926757813,
+ - "y": -7.3125
+ + "x": 11.366800308227539,
+ + "y": -7.912499904632568
+ },
+ "alias": "G",
+ "templateId": "Gua"
+ @@ -968,7 +968,7 @@
+ "id": "34",
+ "seqid": 4,
+ "position": {
+ - "x": 10.766799926757813,
+ + "x": 11.366800308227539,
+ "y": -6.3125
+ },
+ "alias": "R",
+ @@ -980,7 +980,7 @@
+ "seqid": 3,
+ "position": {
+ "x": 9.629799842834473,
+ - "y": -7.3125
+ + "y": -7.912499904632568
+ },
+ "alias": "C",
+ "templateId": "Cyt"
+ @@ -1002,7 +1002,7 @@
+ "seqid": 2,
+ "position": {
+ "x": 9.355799674987793,
+ - "y": -7.3125
+ + "y": -7.912499904632568
+ },
+ "alias": "C",
+ "templateId": "Cyt"
Check failure on line 1 in api/c/tests/unit/tests/formats.cpp
github-actions / ubuntu-latest-x86_64-java_test_report
formats.rxn_no_layout
[FAILED]
Raw output
Diff:
- 5.901083469390869,
+ 10.201733589172364,
- 13.702167510986329,
+ 21.603466033935548,
- 17.502166748046876,
+ 26.603466033935548,
- 21.302165985107427,
+ 31.60346221923828,
- 26.102184295654298,
+ 38.203495025634769,
- 35.7059440612793,
+ 57.80950927734375,
- "x": 29.70220375061035,
+ "x": 45.0035285949707,
- "x": 30.30220222473145,
+ "x": 47.00352478027344,
- 1.5023635625839234,
+ 3.7037816047668459,
- 0.8676860332489014,
+ 1.3882975578308106,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 3.0010616779327394,
+ 6.101698875427246,
- 0.0030012130737304689,
+ 0.004801750183105469,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 2.5030517578125,
+ 5.304883003234863,
- 0.8673515319824219,
+ 1.3877620697021485,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 2.500718593597412,
+ 5.301149368286133,
- -0.8640168309211731,
+ -1.3824270963668824,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 1.0000206232070926,
+ 2.900032997131348,
- -0.002666711807250977,
+ -0.004266738891601563,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 1.50503146648407,
+ 3.708050489425659,
- -0.8656835556030273,
+ -1.3850938081741334,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 1.0023539066314698,
+ 2.90376615524292,
- 1.7337028980255128,
+ 2.773924827575684,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 1.0083551406860352,
+ 2.9133682250976564,
- -1.7337028980255128,
+ -2.773924827575684,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 0.0,
+ 1.2999999523162842,
- -0.005331993103027344,
+ -0.008531332015991211,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 4.0010833740234379,
+ 7.701733589172363,
- 0.002666711807250977,
+ 0.004266738891601563,
- 9.303446769714356,
+ 15.105515480041504,
- 0.8676860332489014,
+ 1.3882975578308106,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 10.80214500427246,
+ 17.503433227539064,
- 0.0030012130737304689,
+ 0.004801750183105469,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 10.3041353225708,
+ 16.70661735534668,
- 0.8673515319824219,
+ 1.3877620697021485,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 10.301801681518557,
+ 16.702882766723634,
- -0.8640168309211731,
+ -1.3824270963668824,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 8.801104545593262,
+ 14.301766395568848,
- -0.002666711807250977,
+ -0.004266738891601563,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 9.30611515045166,
+ 15.10978412628174,
- -0.8656835556030273,
+ -1.3850938081741334,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 8.803437232971192,
+ 14.30550003051758,
- 1.7337028980255128,
+ 2.773924827575684,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 8.809438705444336,
+ 14.315101623535157,
- -1.7337028980255128,
+ -2.773924827575684,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 7.801083564758301,
+ 12.701733589172364,
- -0.005331993103027344,
+ -0.008531332015991211,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 11.80216693878174,
+ 19.10346794128418,
- 0.002666711807250977,
+ 0.004266738891601563,
- 15.602167129516602,
+ 24.103466033935548,
- 19.40216636657715,
+ 29.103464126586919,
- 23.202165603637697,
+ 34.10346221923828,
- 24.202184677124025,
+ 35.703495025634769,
- 28.00218391418457,
+ 40.703495025634769,
- 0.0,
+ 0.0,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "O",
+ "label": "O",
- "location": [
+ "location": [
- 29.0022029876709,
+ 42.30352783203125,
- 33.00724411010742,
+ 52.91159057617188,
- 0.8676860332489014,
+ 1.3882975578308106,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 34.50594329833985,
+ 55.30950927734375,
- 0.0030012130737304689,
+ 0.004801750183105469,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 34.007930755615237,
+ 54.512691497802737,
- 0.8673515319824219,
+ 1.3877620697021485,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 34.00559997558594,
+ 54.50896072387695,
- -0.8640168309211731,
+ -1.3824270963668824,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 32.50490188598633,
+ 52.10784530639649,
- -0.002666711807250977,
+ -0.004266738891601563,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 33.009910583496097,
+ 52.91585922241211,
- -0.8656835556030273,
+ -1.3850938081741334,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 32.51323699951172,
+ 52.12118148803711,
- -1.7337028980255128,
+ -2.773924827575684,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 31.504880905151368,
+ 50.507808685302737,
- -0.005331993103027344,
+ -0.008531332015991211,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "O",
+ "label": "O",
- "location": [
+ "location": [
- 31.0022029876709,
+ 49.70352554321289,
- 0.859018087387085,
+ 1.3744287490844729,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "O",
+ "label": "O",
- "location": [
+ "location": [
- 31.0072021484375,
+ 49.71152496337891,
- -0.873016893863678,
+ -1.3968271017074586,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 32.50723648071289,
+ 52.11157608032227,
- 1.7337028980255128,
+ 2.773924827575684,
- 38.91098403930664,
+ 63.517574310302737,
- 0.8676860332489014,
+ 1.3882975578308106,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 40.40968322753906,
+ 65.91549682617188,
- 0.0030012130737304689,
+ 0.004801750183105469,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 39.91167449951172,
+ 65.1186752319336,
- 0.8673515319824219,
+ 1.3877620697021485,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 39.90933990478516,
+ 65.11494445800781,
- -0.8640168309211731,
+ -1.3824270963668824,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 38.40864562988281,
+ 62.713829040527347,
- -0.002666711807250977,
+ -0.004266738891601563,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 38.91365432739258,
+ 63.52184295654297,
- -0.8656835556030273,
+ -1.3850938081741334,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 38.41697692871094,
+ 62.72716522216797,
- -1.7337028980255128,
+ -2.773924827575684,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 37.40862274169922,
+ 61.1137924194336,
- -0.005331993103027344,
+ -0.008531332015991211,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "O",
+ "label": "O",
- "location": [
+ "location": [
- 36.90594482421875,
+ 60.30950927734375,
- 0.859018087387085,
+ 1.3744287490844729,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "O",
+ "label": "O",
- "location": [
+ "location": [
- 36.91094207763672,
+ 60.317508697509769,
- -0.873016893863678,
+ -1.3968271017074586,
- 0.0
+ 0.0
- ]
+ ]
- },
+ },
- {
+ {
- "label": "C",
+ "label": "C",
- "location": [
+ "location": [
- 38.41097640991211,
+ 62.717559814453128,
- 1.7337028980255128,
+ 2.773924827575684,
Check failure on line 1 in api/c/tests/unit/tests/formats.cpp
github-actions / ubuntu-latest-x86_64-java_test_report
formats.seq_to_ket
[FAILED]
Raw output
Diff:
- all_aminoacids.ket:SUCCEED
+ all_aminoacids.ket:FAILED
- rna_acgtu.ket:SUCCEED
+ ---
- dna_acgtu.ket:SUCCEED
- spaces.ket:SUCCEED
+ +++
- aminoacids_variants.ket:SUCCEED
- rna_variants.ket:SUCCEED
+ @@ -383,7 +383,7 @@
- dna_variants.ket:SUCCEED
+ "id": "1",
+ "seqid": 2,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "C",
+ @@ -394,7 +394,7 @@
+ "id": "2",
+ "seqid": 3,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "D",
+ @@ -405,7 +405,7 @@
+ "id": "3",
+ "seqid": 4,
+ "position": {
+ - "x": 3.000000,
+ + "x": 4.800000,
+ "y": -0.000000
+ },
+ "alias": "E",
+ @@ -416,7 +416,7 @@
+ "id": "4",
+ "seqid": 5,
+ "position": {
+ - "x": 4.000000,
+ + "x": 6.400000,
+ "y": -0.000000
+ },
+ "alias": "F",
+ @@ -427,7 +427,7 @@
+ "id": "5",
+ "seqid": 6,
+ "position": {
+ - "x": 5.000000,
+ + "x": 8.000000,
+ "y": -0.000000
+ },
+ "alias": "G",
+ @@ -438,7 +438,7 @@
+ "id": "6",
+ "seqid": 7,
+ "position": {
+ - "x": 6.000000,
+ + "x": 9.600000,
+ "y": -0.000000
+ },
+ "alias": "H",
+ @@ -449,7 +449,7 @@
+ "id": "7",
+ "seqid": 8,
+ "position": {
+ - "x": 7.000000,
+ + "x": 11.200000,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -460,7 +460,7 @@
+ "id": "8",
+ "seqid": 9,
+ "position": {
+ - "x": 8.000000,
+ + "x": 12.800000,
+ "y": -0.000000
+ },
+ "alias": "K",
+ @@ -471,7 +471,7 @@
+ "id": "9",
+ "seqid": 10,
+ "position": {
+ - "x": 9.000000,
+ + "x": 14.400001,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -482,7 +482,7 @@
+ "id": "10",
+ "seqid": 11,
+ "position": {
+ - "x": 10.000000,
+ + "x": 16.000000,
+ "y": -0.000000
+ },
+ "alias": "M",
+ @@ -493,7 +493,7 @@
+ "id": "11",
+ "seqid": 12,
+ "position": {
+ - "x": 11.000000,
+ + "x": 17.600000,
+ "y": -0.000000
+ },
+ "alias": "N",
+ @@ -504,7 +504,7 @@
+ "id": "12",
+ "seqid": 13,
+ "position": {
+ - "x": 12.000000,
+ + "x": 19.200001,
+ "y": -0.000000
+ },
+ "alias": "O",
+ @@ -515,7 +515,7 @@
+ "id": "13",
+ "seqid": 14,
+ "position": {
+ - "x": 13.000000,
+ + "x": 20.800001,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -526,7 +526,7 @@
+ "id": "14",
+ "seqid": 15,
+ "position": {
+ - "x": 14.000000,
+ + "x": 22.400000,
+ "y": -0.000000
+ },
+ "alias": "Q",
+ @@ -537,7 +537,7 @@
+ "id": "15",
+ "seqid": 16,
+ "position": {
+ - "x": 15.000000,
+ + "x": 24.000000,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -548,7 +548,7 @@
+ "id": "16",
+ "seqid": 17,
+ "position": {
+ - "x": 16.000000,
+ + "x": 25.600000,
+ "y": -0.000000
+ },
+ "alias": "S",
+ @@ -559,7 +559,7 @@
+ "id": "17",
+ "seqid": 18,
+ "position": {
+ - "x": 17.000000,
+ + "x": 27.200001,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -570,7 +570,7 @@
+ "id": "18",
+ "seqid": 19,
+ "position": {
+ - "x": 18.000000,
+ + "x": 28.800001,
+ "y": -0.000000
+ },
+ "alias": "U",
+ @@ -581,7 +581,7 @@
+ "id": "19",
+ "seqid": 20,
+ "position": {
+ - "x": 19.000000,
+ + "x": 30.400000,
+ "y": -0.000000
+ },
+ "alias": "V",
+ @@ -592,7 +592,7 @@
+ "id": "20",
+ "seqid": 21,
+ "position": {
+ - "x": 20.000000,
+ + "x": 32.000000,
+ "y": -0.000000
+ },
+ "alias": "W",
+ @@ -603,7 +603,7 @@
+ "id": "21",
+ "seqid": 22,
+ "position": {
+ - "x": 21.000000,
+ + "x": 33.600002,
+ "y": -0.000000
+ },
+ "alias": "Y",
+ rna_acgtu.ket:FAILED
+ ---
+ +++
+ @@ -230,7 +230,7 @@
+ "seqid": 1,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -240,7 +240,7 @@
+ "id": "2",
+ "seqid": 2,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -251,8 +251,8 @@
+ "id": "3",
+ "seqid": 2,
+ "position": {
+ - "x": 2.000000,
+ - "y": -1.000000
+ + "x": 3.200000,
+ + "y": -1.600000
+ },
+ "alias": "C",
+ "templateId": "C___Cytosine"
+ @@ -262,7 +262,7 @@
+ "id": "4",
+ "seqid": 1,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -273,7 +273,7 @@
+ "id": "5",
+ "seqid": 3,
+ "position": {
+ - "x": 4.000000,
+ + "x": 6.400000,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -284,8 +284,8 @@
+ "id": "6",
+ "seqid": 3,
+ "position": {
+ - "x": 4.000000,
+ - "y": -1.000000
+ + "x": 6.400000,
+ + "y": -1.600000
+ },
+ "alias": "G",
+ "templateId": "G___Guanine"
+ @@ -295,7 +295,7 @@
+ "id": "7",
+ "seqid": 2,
+ "position": {
+ - "x": 3.000000,
+ + "x": 4.800000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -306,7 +306,7 @@
+ "id": "8",
+ "seqid": 4,
+ "position": {
+ - "x": 6.000000,
+ + "x": 9.600000,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -317,8 +317,8 @@
+ "id": "9",
+ "seqid": 4,
+ "position": {
+ - "x": 6.000000,
+ - "y": -1.000000
+ + "x": 9.600000,
+ + "y": -1.600000
+ },
+ "alias": "T",
+ "templateId": "T___Thymine"
+ @@ -328,7 +328,7 @@
+ "id": "10",
+ "seqid": 3,
+ "position": {
+ - "x": 5.000000,
+ + "x": 8.000000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -339,7 +339,7 @@
+ "id": "11",
+ "seqid": 5,
+ "position": {
+ - "x": 8.000000,
+ + "x": 12.800000,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -350,8 +350,8 @@
+ "id": "12",
+ "seqid": 5,
+ "position": {
+ - "x": 8.000000,
+ - "y": -1.000000
+ + "x": 12.800000,
+ + "y": -1.600000
+ },
+ "alias": "U",
+ "templateId": "U___Uracil"
+ @@ -361,7 +361,7 @@
+ "id": "13",
+ "seqid": 4,
+ "position": {
+ - "x": 7.000000,
+ + "x": 11.200000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ dna_acgtu.ket:FAILED
+ ---
+ +++
+ @@ -230,7 +230,7 @@
+ "seqid": 1,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "A",
+ "templateId": "A___Adenine"
+ @@ -240,7 +240,7 @@
+ "id": "2",
+ "seqid": 2,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -251,8 +251,8 @@
+ "id": "3",
+ "seqid": 2,
+ "position": {
+ - "x": 2.000000,
+ - "y": -1.000000
+ + "x": 3.200000,
+ + "y": -1.600000
+ },
+ "alias": "C",
+ "templateId": "C___Cytosine"
+ @@ -262,7 +262,7 @@
+ "id": "4",
+ "seqid": 1,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -273,7 +273,7 @@
+ "id": "5",
+ "seqid": 3,
+ "position": {
+ - "x": 4.000000,
+ + "x": 6.400000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -284,8 +284,8 @@
+ "id": "6",
+ "seqid": 3,
+ "position": {
+ - "x": 4.000000,
+ - "y": -1.000000
+ + "x": 6.400000,
+ + "y": -1.600000
+ },
+ "alias": "G",
+ "templateId": "G___Guanine"
+ @@ -295,7 +295,7 @@
+ "id": "7",
+ "seqid": 2,
+ "position": {
+ - "x": 3.000000,
+ + "x": 4.800000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -306,7 +306,7 @@
+ "id": "8",
+ "seqid": 4,
+ "position": {
+ - "x": 6.000000,
+ + "x": 9.600000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -317,8 +317,8 @@
+ "id": "9",
+ "seqid": 4,
+ "position": {
+ - "x": 6.000000,
+ - "y": -1.000000
+ + "x": 9.600000,
+ + "y": -1.600000
+ },
+ "alias": "T",
+ "templateId": "T___Thymine"
+ @@ -328,7 +328,7 @@
+ "id": "10",
+ "seqid": 3,
+ "position": {
+ - "x": 5.000000,
+ + "x": 8.000000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ @@ -339,7 +339,7 @@
+ "id": "11",
+ "seqid": 5,
+ "position": {
+ - "x": 8.000000,
+ + "x": 12.800000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -350,8 +350,8 @@
+ "id": "12",
+ "seqid": 5,
+ "position": {
+ - "x": 8.000000,
+ - "y": -1.000000
+ + "x": 12.800000,
+ + "y": -1.600000
+ },
+ "alias": "U",
+ "templateId": "U___Uracil"
+ @@ -361,7 +361,7 @@
+ "id": "13",
+ "seqid": 4,
+ "position": {
+ - "x": 7.000000,
+ + "x": 11.200000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ spaces.ket:FAILED
+ ---
+ +++
+ @@ -372,7 +372,7 @@
+ "id": "1",
+ "seqid": 2,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "C",
+ @@ -383,7 +383,7 @@
+ "id": "2",
+ "seqid": 3,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "D",
+ @@ -394,7 +394,7 @@
+ "id": "3",
+ "seqid": 4,
+ "position": {
+ - "x": 3.000000,
+ + "x": 4.800000,
+ "y": -0.000000
+ },
+ "alias": "E",
+ @@ -405,7 +405,7 @@
+ "id": "4",
+ "seqid": 5,
+ "position": {
+ - "x": 4.000000,
+ + "x": 6.400000,
+ "y": -0.000000
+ },
+ "alias": "F",
+ @@ -416,7 +416,7 @@
+ "id": "5",
+ "seqid": 6,
+ "position": {
+ - "x": 5.000000,
+ + "x": 8.000000,
+ "y": -0.000000
+ },
+ "alias": "G",
+ @@ -427,7 +427,7 @@
+ "id": "6",
+ "seqid": 7,
+ "position": {
+ - "x": 6.000000,
+ + "x": 9.600000,
+ "y": -0.000000
+ },
+ "alias": "H",
+ @@ -438,7 +438,7 @@
+ "id": "7",
+ "seqid": 8,
+ "position": {
+ - "x": 7.000000,
+ + "x": 11.200000,
+ "y": -0.000000
+ },
+ "alias": "I",
+ @@ -449,7 +449,7 @@
+ "id": "8",
+ "seqid": 9,
+ "position": {
+ - "x": 8.000000,
+ + "x": 12.800000,
+ "y": -0.000000
+ },
+ "alias": "K",
+ @@ -460,7 +460,7 @@
+ "id": "9",
+ "seqid": 10,
+ "position": {
+ - "x": 9.000000,
+ + "x": 14.400001,
+ "y": -0.000000
+ },
+ "alias": "L",
+ @@ -471,7 +471,7 @@
+ "id": "10",
+ "seqid": 11,
+ "position": {
+ - "x": 10.000000,
+ + "x": 16.000000,
+ "y": -0.000000
+ },
+ "alias": "M",
+ @@ -482,7 +482,7 @@
+ "id": "11",
+ "seqid": 12,
+ "position": {
+ - "x": 11.000000,
+ + "x": 17.600000,
+ "y": -0.000000
+ },
+ "alias": "N",
+ @@ -494,7 +494,7 @@
+ "seqid": 1,
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "alias": "O",
+ "templateId": "O___Pyrrolysine"
+ @@ -504,8 +504,8 @@
+ "id": "13",
+ "seqid": 2,
+ "position": {
+ - "x": 1.000000,
+ - "y": -1.000000
+ + "x": 1.600000,
+ + "y": -1.600000
+ },
+ "alias": "P",
+ "templateId": "P___Proline"
+ @@ -515,8 +515,8 @@
+ "id": "14",
+ "seqid": 3,
+ "position": {
+ - "x": 2.000000,
+ - "y": -1.000000
+ + "x": 3.200000,
+ + "y": -1.600000
+ },
+ "alias": "Q",
+ "templateId": "Q___Glutamine"
+ @@ -526,8 +526,8 @@
+ "id": "15",
+ "seqid": 4,
+ "position": {
+ - "x": 3.000000,
+ - "y": -1.000000
+ + "x": 4.800000,
+ + "y": -1.600000
+ },
+ "alias": "R",
+ "templateId": "R___Arginine"
+ @@ -537,8 +537,8 @@
+ "id": "16",
+ "seqid": 5,
+ "position": {
+ - "x": 4.000000,
+ - "y": -1.000000
+ + "x": 6.400000,
+ + "y": -1.600000
+ },
+ "alias": "S",
+ "templateId": "S___Serine"
+ @@ -548,8 +548,8 @@
+ "id": "17",
+ "seqid": 6,
+ "position": {
+ - "x": 5.000000,
+ - "y": -1.000000
+ + "x": 8.000000,
+ + "y": -1.600000
+ },
+ "alias": "R",
+ "templateId": "R___Arginine"
+ @@ -559,8 +559,8 @@
+ "id": "18",
+ "seqid": 7,
+ "position": {
+ - "x": 6.000000,
+ - "y": -1.000000
+ + "x": 9.600000,
+ + "y": -1.600000
+ },
+ "alias": "U",
+ "templateId": "U___Selenocysteine"
+ @@ -570,8 +570,8 @@
+ "id": "19",
+ "seqid": 8,
+ "position": {
+ - "x": 7.000000,
+ - "y": -1.000000
+ + "x": 11.200000,
+ + "y": -1.600000
+ },
+ "alias": "V",
+ "templateId": "V___Valine"
+ @@ -581,8 +581,8 @@
+ "id": "20",
+ "seqid": 9,
+ "position": {
+ - "x": 8.000000,
+ - "y": -1.000000
+ + "x": 12.800000,
+ + "y": -1.600000
+ },
+ "alias": "W",
+ "templateId": "W___Tryptophan"
+ @@ -592,8 +592,8 @@
+ "id": "21",
+ "seqid": 10,
+ "position": {
+ - "x": 9.000000,
+ - "y": -1.000000
+ + "x": 14.400001,
+ + "y": -1.600000
+ },
+ "alias": "Y",
+ "templateId": "Y___Tyrosine"
+ aminoacids_variants.ket:FAILED
+ ---
+ +++
+ @@ -145,7 +145,7 @@
+ "type": "ambiguousMonomer",
+ "id": "1",
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "seqid": 2,
+ @@ -156,7 +156,7 @@
+ "type": "ambiguousMonomer",
+ "id": "2",
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "seqid": 3,
+ @@ -167,7 +167,7 @@
+ "type": "ambiguousMonomer",
+ "id": "3",
+ "position": {
+ - "x": 3.000000,
+ + "x": 4.800000,
+ "y": -0.000000
+ },
+ "seqid": 4,
+ rna_variants.ket:FAILED
+ ---
+ +++
+ @@ -106,7 +106,7 @@
+ "id": "1",
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "seqid": 1,
+ "alias": "K",
+ @@ -117,7 +117,7 @@
+ "id": "2",
+ "seqid": 2,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "R",
+ @@ -127,8 +127,8 @@
+ "type": "ambiguousMonomer",
+ "id": "3",
+ "position": {
+ - "x": 2.000000,
+ - "y": -1.000000
+ + "x": 3.200000,
+ + "y": -1.600000
+ },
+ "seqid": 2,
+ "alias": "N",
+ @@ -139,7 +139,7 @@
+ "id": "4",
+ "seqid": 1,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "P",
+ dna_variants.ket:FAILED
+ ---
+ +++
+ @@ -106,7 +106,7 @@
+ "id": "1",
+ "position": {
+ "x": 0.000000,
+ - "y": -1.000000
+ + "y": -1.600000
+ },
+ "seqid": 1,
+ "alias": "B",
+ @@ -117,7 +117,7 @@
+ "id": "2",
+ "seqid": 2,
+ "position": {
+ - "x": 2.000000,
+ + "x": 3.200000,
+ "y": -0.000000
+ },
+ "alias": "dR",
+ @@ -127,8 +127,8 @@
+ "type": "ambiguousMonomer",
+ "id": "3",
+ "position": {
+ - "x": 2.000000,
+ - "y": -1.000000
+ + "x": 3.200000,
+ + "y": -1.600000
+ },
+ "seqid": 2,
+ "alias": "N",
+ @@ -139,7 +139,7 @@
+ "id": "4",
+ "seqid": 1,
+ "position": {
+ - "x": 1.000000,
+ + "x": 1.600000,
+ "y": -0.000000
+ },
+ "alias": "P",
Check failure on line 1 in api/c/tests/unit/tests/formats.cpp
github-actions / ubuntu-latest-x86_64-java_test_report
formats.smiles
[FAILED]
Raw output
Diff:
- C1=CC=C(C)C(C2=C(N)C=C(C)C=C2)=C1O |o1:5,r,wU:5.4,(1.50,-0.87,;2.00,-0.00,;1.50,0.87,;0.50,0.87,;0.00,1.73,;0.00,0.00,;-1.00,0.00,;-1.50,0.87,;-1.00,1.73,;-2.50,0.87,;-3.00,0.00,;-4.00,0.00,;-2.50,-0.87,;-1.50,-0.87,;0.50,-0.87,;-0.00,-1.73,)|
+ C1=CC=C(C)C(C2=C(N)C=C(C)C=C2)=C1O |o1:5,r,wU:5.4,(2.40,-1.39,;3.20,-0.00,;2.40,1.39,;0.80,1.39,;0.00,2.77,;0.00,0.00,;-1.60,0.00,;-2.40,1.39,;-1.60,2.77,;-4.00,1.39,;-4.80,0.00,;-6.40,0.00,;-4.00,-1.39,;-2.40,-1.39,;0.80,-1.39,;-0.00,-2.77,)|
- C1C(O)=C(C2C=CC(C)=CC=2N)C(C)=CC=1 |wU:3.12,wD:3.3,(-1.50,0.87,;-0.50,0.87,;-0.00,1.73,;0.00,0.00,;1.00,0.00,;1.50,0.87,;2.50,0.87,;3.00,0.00,;4.00,0.00,;2.50,-0.87,;1.50,-0.87,;1.00,-1.73,;-0.50,-0.87,;0.00,-1.73,;-1.50,-0.87,;-2.00,-0.00,)|
+ C1C(O)=C(C2C=CC(C)=CC=2N)C(C)=CC=1 |wU:3.12,wD:3.3,(-2.40,1.39,;-0.80,1.39,;-0.00,2.77,;0.00,0.00,;1.60,0.00,;2.40,1.39,;4.00,1.39,;4.80,0.00,;6.40,0.00,;4.00,-1.39,;2.40,-1.39,;1.60,-2.77,;-0.80,-1.39,;0.00,-2.77,;-2.40,-1.39,;-3.20,-0.00,)|
- C1C(O)=C(C2C=CC(C)=CC=2N)C(C)=CC=1 |w:3.3,3.12,(-1.50,0.87,;-0.50,0.87,;-0.00,1.73,;0.00,0.00,;1.00,0.00,;1.50,0.87,;2.50,0.87,;3.00,0.00,;4.00,0.00,;2.50,-0.87,;1.50,-0.87,;1.00,-1.73,;-0.50,-0.87,;0.00,-1.73,;-1.50,-0.87,;-2.00,-0.00,)|
+ C1C(O)=C(C2C=CC(C)=CC=2N)C(C)=CC=1 |w:3.3,3.12,(-2.40,1.39,;-0.80,1.39,;-0.00,2.77,;0.00,0.00,;1.60,0.00,;2.40,1.39,;4.00,1.39,;4.80,0.00,;6.40,0.00,;4.00,-1.39,;2.40,-1.39,;1.60,-2.77,;-0.80,-1.39,;0.00,-2.77,;-2.40,-1.39,;-3.20,-0.00,)|
Check failure on line 1 in api/c/tests/unit/tests/layout.cpp
github-actions / ubuntu-latest-x86_64-java_test_report
layout.basic
[FAILED]
Raw output
Diff:
- Result: Molecule #0: Success
+ Result: Molecule #0: Error: atom #0 (Cl) contains delta 0.499999940811 > 0.001
- Molecule #1: Success
+ atom #1 (C) contains delta 0.499999761985 > 0.001
+ atom #2 (C) contains delta 0.500000000403 > 0.001
+ atom #3 (C) contains delta 0.499958992413 > 0.001
+ atom #4 (O) contains delta 0.49995899242 > 0.001
+ Molecule #1: Error: atom #0 (C) contains delta 0.299978256263 > 0.001
+ atom #1 (N) contains delta 0.299978256255 > 0.001
+ atom #2 (C) contains delta 0.300019264256 > 0.001
+ atom #3 (C) contains delta 0.299960136455 > 0.001
+ atom #4 (C) contains delta 0.299958232414 > 0.001
+ atom #5 (O) contains delta 0.299958229094 > 0.001
+ atom #6 (S) contains delta 0.300037384061 > 0.001
+ atom #7 (O) contains delta 0.300037386265 > 0.001
+ atom #8 (O) contains delta 0.300035480033 > 0.001
+ atom #9 (C) contains delta 0.299995422383 > 0.001
+ atom #10 (F) contains delta 0.300004959137 > 0.001
+ atom #11 (F) contains delta 0.299991607685 > 0.001
+ atom #12 (C) contains delta 0.299957275409 > 0.001
+ atom #13 (F) contains delta 0.300048828334 > 0.001
+ atom #14 (F) contains delta 0.299962997633 > 0.001
+ atom #15 (C) contains delta 0.300014495864 > 0.001
+ atom #16 (F) contains delta 0.300024032631 > 0.001
+ atom #17 (F) contains delta 0.300010681171 > 0.001
+ atom #18 (C) contains delta 0.299974441535 > 0.001
+ atom #19 (F) contains delta 0.299974441534 > 0.001
+ atom #20 (F) contains delta 0.300035476686 > 0.001
+ atom #21 (F) contains delta 0.300033569338 > 0.001
- Result: Molecule #0: Success
+ Result: Molecule #0: Error: atom #0 (C) contains delta 0.500000240081 > 0.001
- Molecule #1: Success
+ atom #1 (C) contains delta 0.500000001662 > 0.001
+ atom #2 (C) contains delta 0.499999940395 > 0.001
+ atom #3 (C) contains delta 0.500000001643 > 0.001
+ atom #4 (C) contains delta 0.500000001662 > 0.001
+ atom #5 (C) contains delta 0.499999523163 > 0.001
+ data sgroup #0 contains delta 0.499999761581 > 0.001
+ Molecule #1: Error: atom #0 (C) contains delta 0.300000193505 > 0.001
+ atom #1 (C) contains delta 0.299999239831 > 0.001
+ atom #2 (C) contains delta 0.299999237061 > 0.001
+ atom #3 (C) contains delta 0.299999239799 > 0.001
+ atom #4 (C) contains delta 0.299999239831 > 0.001
+ atom #5 (C) contains delta 0.299999237061 > 0.001
+ data sgroup #0 contains delta 0.300049781799 > 0.001
Check failure on line 1 in api/c/tests/unit/tests/layout.cpp
github-actions / ubuntu-latest-x86_64-java_test_report
layout.reaction_layout_and_clean2d
[FAILED]
Raw output
Diff:
- Item #0: Result of layout: Molecule #0: Success
+ Item #0: Result of layout: Molecule #0: Error: atom #0 (C) contains delta 0.499999940395 > 0.001
- Molecule #1: Success
+ atom #1 (C) contains delta 0.499959468842 > 0.001
- Molecule #2: Success
+ atom #2 (C) contains delta 0.500019073486 > 0.001
- Molecule #3: Success
+ atom #3 (C) contains delta 0.499978065491 > 0.001
+ atom #4 (C) contains delta 0.500037193298 > 0.001
+ atom #5 (C) contains delta 0.499996185303 > 0.001
+ atom #6 (P) contains delta 0.499956130982 > 0.001
+ atom #7 (O) contains delta 0.499978065491 > 0.001
+ Molecule #1: Error: atom #0 (C) contains delta 0.70001411438 > 0.001
+ atom #1 (C) contains delta 0.699955940247 > 0.001
+ atom #2 (C) contains delta 0.699955940247 > 0.001
+ atom #3 (C) contains delta 0.70001411438 > 0.001
+ atom #4 (C) contains delta 0.699974060059 > 0.001
+ atom #5 (C) contains delta 0.699974060059 > 0.001
+ Molecule #2: Error: atom #0 (C) contains delta 0.499977111817 > 0.001
+ atom #1 (C) contains delta 0.500036239624 > 0.001
+ atom #2 (C) contains delta 0.499994277954 > 0.001
+ atom #3 (C) contains delta 0.499954223633 > 0.001
+ atom #4 (C) contains delta 0.50001335144 > 0.001
+ atom #5 (P) contains delta 0.499973297119 > 0.001
+ atom #6 (C) contains delta 0.499994277954 > 0.001
+ Molecule #3: Error: atom #0 (C) contains delta 0.699974060059 > 0.001
+ atom #1 (C) contains delta 0.69997787595 > 0.001
+ atom #2 (C) contains delta 0.699974061253 > 0.001
+ atom #3 (C) contains delta 0.699974060059 > 0.001
+ atom #4 (C) contains delta 0.699974061253 > 0.001
+ atom #5 (C) contains delta 0.69997787595 > 0.001
+ atom #6 (O) contains delta 0.699977874756 > 0.001
Check failure on line 1 in api/c/tests/unit/tests/layout.cpp
github-actions / ubuntu-latest-x86_64-java_test_report
layout.smiles_layout
[FAILED]
Raw output
Diff:
- 932-agents.ket:SUCCEED
+ 932-agents.ket:FAILED
+ ---
+ +++
+ @@ -43,7 +43,7 @@
+ {
+ "type": "plus",
+ "location": [
+ - 1.75,
+ + 4.099999904632568,
+ 0.0,
+ 0.0
+ ]
+ @@ -51,7 +51,7 @@
+ {
+ "type": "plus",
+ "location": [
+ - 3.25,
+ + 7.500000476837158,
+ 0.0,
+ 0.0
+ ]
+ @@ -59,7 +59,7 @@
+ {
+ "type": "plus",
+ "location": [
+ - 14.464101791381836,
+ + 40.44254302978516,
+ 0.0,
+ 0.0
+ ]
+ @@ -67,7 +67,7 @@
+ {
+ "type": "plus",
+ "location": [
+ - 17.878314971923829,
+ + 47.705284118652347,
+ 0.0,
+ 0.0
+ ]
+ @@ -78,12 +78,12 @@
+ "mode": "open-angle",
+ "pos": [
+ {
+ - "x": 5.25,
+ + "x": 12.40000057220459,
+ "y": 0.0,
+ "z": 0.0
+ },
+ {
+ - "x": 13.464101791381836,
+ + "x": 37.14254760742188,
+ "y": 0.0,
+ "z": 0.0
+ }
+ @@ -98,24 +98,24 @@
+ {
+ "label": "C",
+ "location": [
+ - 0.0,
+ - 0.4330127239227295,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 1.0,
+ - 0.4330127239227295,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 0.5,
+ - -0.4330127239227295,
+ + 0.800000011920929,
+ + 0.6928203105926514,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 2.399999856948853,
+ + 0.6928203105926514,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 1.5999999046325684,
+ + -0.6928203105926514,
+ 0.0
+ ]
+ }
+ @@ -150,7 +150,7 @@
+ {
+ "label": "S",
+ "location": [
+ - 2.5,
+ + 5.800000190734863,
+ 0.0,
+ 0.0
+ ]
+ @@ -164,32 +164,32 @@
+ {
+ "label": "C",
+ "location": [
+ - 4.0,
+ - 0.5,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 5.0,
+ - 0.5,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 5.0,
+ - -0.5,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 4.0,
+ - -0.5,
+ + 9.200000762939454,
+ + 0.7999998927116394,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 10.800000190734864,
+ + 0.7999998927116394,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 10.800000190734864,
+ + -0.7999998927116394,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 9.200000762939454,
+ + -0.7999998927116394,
+ 0.0
+ ]
+ }
+ @@ -231,24 +231,24 @@
+ {
+ "label": "C",
+ "location": [
+ - 5.75,
+ - 1.1830127239227296,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 6.616025447845459,
+ - 0.6830127239227295,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 7.482050895690918,
+ - 1.1830127239227296,
+ + 14.000000953674317,
+ + 2.692820310592652,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 15.38564109802246,
+ + 1.8928204774856568,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 16.771282196044927,
+ + 2.692820310592652,
+ 0.0
+ ]
+ }
+ @@ -276,8 +276,8 @@
+ {
+ "label": "C",
+ "location": [
+ - 7.982050895690918,
+ - 0.9330127239227296,
+ + 19.171279907226564,
+ + 2.292820453643799,
+ 0.0
+ ]
+ }
+ @@ -290,8 +290,8 @@
+ {
+ "label": "P",
+ "location": [
+ - 8.482050895690918,
+ - 0.9330127239227296,
+ + 21.571277618408204,
+ + 2.292820453643799,
+ 0.0
+ ]
+ }
+ @@ -304,24 +304,24 @@
+ {
+ "label": "C",
+ "location": [
+ - 8.982050895690918,
+ - 1.1830127239227296,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 9.84807586669922,
+ - 0.6830127239227295,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 10.714101791381836,
+ - 1.1830127239227296,
+ + 23.971275329589845,
+ + 2.692820310592652,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 25.356916427612306,
+ + 1.8928204774856568,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 26.742555618286138,
+ + 2.692820310592652,
+ 0.0
+ ]
+ }
+ @@ -349,24 +349,24 @@
+ {
+ "label": "C",
+ "location": [
+ - 11.214101791381836,
+ - 1.366025447845459,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 12.214101791381836,
+ - 1.366025447845459,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 11.714101791381836,
+ - 0.5,
+ + 29.142553329467778,
+ + 2.98564076423645,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 30.7425537109375,
+ + 2.98564076423645,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 29.94255256652832,
+ + 1.6000001430511477,
+ 0.0
+ ]
+ }
+ @@ -401,8 +401,8 @@
+ {
+ "label": "F",
+ "location": [
+ - 12.714101791381836,
+ - 0.9330127239227296,
+ + 33.14255142211914,
+ + 2.292820453643799,
+ 0.0
+ ]
+ }
+ @@ -415,8 +415,8 @@
+ {
+ "label": "I",
+ "location": [
+ - 13.214101791381836,
+ - 0.9330127239227296,
+ + 35.54254913330078,
+ + 2.292820453643799,
+ 0.0
+ ]
+ }
+ @@ -429,7 +429,7 @@
+ {
+ "label": "S",
+ "location": [
+ - 13.964101791381836,
+ + 38.74254608154297,
+ 0.0,
+ 0.0
+ ]
+ @@ -443,64 +443,64 @@
+ {
+ "label": "C",
+ "location": [
+ - 16.67120933532715,
+ - 1.2071068286895753,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 15.671208381652832,
+ - 1.2071068286895753,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 14.964101791381836,
+ - 0.5,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 14.964101791381836,
+ - -0.5,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 15.671208381652832,
+ - -1.2071068286895753,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 16.67120933532715,
+ - -1.2071068286895753,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 17.378314971923829,
+ - -0.5,
+ - 0.0
+ - ]
+ - },
+ - {
+ - "label": "C",
+ - "location": [
+ - 17.378314971923829,
+ - 0.5,
+ + 44.8739128112793,
+ + 1.931370735168457,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 43.2739143371582,
+ + 1.931370735168457,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 42.14254379272461,
+ + 0.7999999523162842,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 42.14254379272461,
+ + -0.7999998331069946,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 43.2739143371582,
+ + -1.931370735168457,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 44.8739128112793,
+ + -1.931370735168457,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 46.00528717041016,
+ + -0.7999998331069946,
+ + 0.0
+ + ]
+ + },
+ + {
+ + "label": "C",
+ + "location": [
+ + 46.00528335571289,
+ + 0.7999999523162842,
+ 0.0
+ ]
+ }
+ @@ -570,7 +570,7 @@
+ {
+ "label": "O",
+ "location": [
+ - 18.378314971923829,
+ + 49.4052848815918,
+ 0.0,
+ 0.0
+ ]
Check failure on line 1 in api/cpp/tests/basic/reaction.cpp
github-actions / ubuntu-latest-x86_64-java_test_report
reaction.save_ket_layout_1205
[FAILED]
Raw output
Diff:
- Test passed
+ ('Difference found:\n', u'--- \n\n+++ \n\n@@ -1 +1 @@\n\n-{"root":{"nodes":[{"$ref":"mol0"},{"$ref":"mol1"},{"$ref":"mol2"},{"$ref":"mol3"},{"type":"arrow","data":{"mode":"open-angle","pos":[{"x":10.515000343322754,"y":-8.324899673461914,"z":0.0},{"x":15.03459930419922,"y":-8.274900436401368,"z":0.0}]}}]},"mol0":{"type":"molecule","atoms":[{"label":"C","location":[7.7846999168396,-7.824999809265137,0.0]},{"label":"C","location":[9.515000343322754,-7.82450008392334,0.0]},{"label":"C","location":[8.65149974822998,-7.324900150299072,0.0]},{"label":"C","location":[9.515000343322754,-8.825400352478028,0.0]},{"label":"C","location":[7.7846999168396,-8.829899787902832,0.0]},{"label":"C","location":[8.65369987487793,-9.324899673461914,0.0]}],"bonds":[{"type":2,"atoms":[2,0]},{"type":2,"atoms":[3,1]},{"type":1,"atoms":[0,4]},{"type":1,"atoms":[1,2]},{"type":2,"atoms":[4,5]},{"type":1,"atoms":[5,3]}]},"mol1":{"type":"molecule","atoms":[{"label":"C","location":[16.03459930419922,-7.775000095367432,0.0]},{"label":"C","location":[17.76499938964844,-7.774499893188477,0.0]},{"label":"C","location":[16.90139961242676,-7.274899959564209,0.0]},{"label":"C","location":[17.76499938964844,-8.775400161743164,0.0]},{"label":"C","location":[16.03459930419922,-8.779899597167969,0.0]},{"label":"C","location":[16.903600692749025,-9.274900436401368,0.0]}],"bonds":[{"type":2,"atoms":[2,0]},{"type":2,"atoms":[3,1]},{"type":1,"atoms":[0,4]},{"type":1,"atoms":[1,2]},{"type":2,"atoms":[4,5]},{"type":1,"atoms":[5,3]}]},"mol2":{"type":"molecule","atoms":[{"label":"Cl","location":[12.974800109863282,-8.824899673461914,0.0]}],"bonds":[]},"mol3":{"type":"molecule","atoms":[{"label":"N","location":[12.549799919128418,-7.724899768829346,0.0]}],"bonds":[]}}\n+{"root":{"nodes":[{"$ref":"mol0"},{"$ref":"mol1"},{"$ref":"mol2"},{"$ref":"mol3"},{"type":"arrow","data":{"mode":"open-angle","pos":[{"x":11.11500072479248,"y":-8.324899673461914,"z":0.0},{"x":14.434598922729493,"y":-8.274900436401368,"z":0.0}]}}]},"mol0":{"type":"molecule","atoms":[{"label":"C","location":[7.7846999168396,-7.824999809265137,0.0]},{"label":"C","location":[9.515000343322754,-7.82450008392334,0.0]},{"label":"C","location":[8.65149974822998,-7.324900150299072,0.0]},{"label":"C","location":[9.515000343322754,-8.825400352478028,0.0]},{"label":"C","location":[7.7846999168396,-8.829899787902832,0.0]},{"label":"C","location":[8.65369987487793,-9.324899673461914,0.0]}],"bonds":[{"type":2,"atoms":[2,0]},{"type":2,"atoms":[3,1]},{"type":1,"atoms":[0,4]},{"type":1,"atoms":[1,2]},{"type":2,"atoms":[4,5]},{"type":1,"atoms":[5,3]}]},"mol1":{"type":"molecule","atoms":[{"label":"C","location":[16.03459930419922,-7.775000095367432,0.0]},{"label":"C","location":[17.76499938964844,-7.774499893188477,0.0]},{"label":"C","location":[16.90139961242676,-7.274899959564209,0.0]},{"label":"C","location":[17.76499938964844,-8.775400161743164,0.0]},{"label":"C","location":[16.03459930419922,-8.779899597167969,0.0]},{"label":"C","location":[16.903600692749025,-9.274900436401368,0.0]}],"bonds":[{"type":2,"atoms":[2,0]},{"type":2,"atoms":[3,1]},{"type":1,"atoms":[0,4]},{"type":1,"atoms":[1,2]},{"type":2,"atoms":[4,5]},{"type":1,"atoms":[5,3]}]},"mol2":{"type":"molecule","atoms":[{"label":"Cl","location":[12.974800109863282,-8.824899673461914,0.0]}],"bonds":[]},"mol3":{"type":"molecule","atoms":[{"label":"N","location":[12.549799919128418,-7.724899768829346,0.0]}],"bonds":[]}}')
Check failure on line 1 in rendering
github-actions / ubuntu-latest-x86_64-java_test_report
rendering.sgroups_instrumentation
[FAILED]
Raw output
Diff:
- 1.5000 1.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.4000 2.7713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 1.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 2.7713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.5000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.4000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 3.2000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.0000 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 6.4000 0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.8660 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 7.7856 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7321 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 9.1713 0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.7321 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 12.3713 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 3.7321 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 5.9713 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0000 3.7321 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
+ 3.2000 5.9713 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
- 1.5000 1.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.4001 2.7713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0001 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 3.2001 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.5000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.4001 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 1.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 2.7713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.0000 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 6.4000 0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.8660 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 7.7856 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7320 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 9.1712 0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.7321 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 12.3713 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 3.7321 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 5.9713 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0001 3.7321 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
+ 3.2001 5.9713 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
- 1.5000 1.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.4000 2.7713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 1.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 2.7713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.5000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.4000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 3.2000 1.3856 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.0000 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 6.4000 0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.8660 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 7.7856 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7321 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 9.1713 0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.7321 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 12.3713 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 3.7321 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 5.9713 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0000 3.7321 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
+ 3.2000 5.9713 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
- 1.5001 1.7320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.4000 2.7713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9999 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 3.2001 1.3857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 1.5001 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 2.4000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5001 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 0.8660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 1.3857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5001 1.7320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 2.7713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.0001 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 6.3999 0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 4.8659 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 7.7857 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 5.7320 0.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 9.1713 0.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 7.7320 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 12.3714 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 3.7320 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 5.9713 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- 1.9999 3.7320 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
+ 3.2001 5.9713 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
Check failure on line 1 in standardize
github-actions / ubuntu-latest-x86_64-java_test_report
standardize.basic
[FAILED]
Raw output
Diff:
- -3.0000 1.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.8000 2.7713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 4.1569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -3.0000 3.4641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.8000 5.5426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -1.5000 2.5981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
+ -2.4000 4.1569 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 1.7321 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0
+ -1.6000 2.7713 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0
- -1.5000 0.8660 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0
+ -2.4000 1.3856 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0
- -2.5000 0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.9397 -0.3420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.5035 -0.5472 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 1.7321 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0
+ 0.0000 2.7713 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0
- 0.5000 2.5981 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0
+ 0.8000 4.1569 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0
- 0.0000 3.4641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 5.5426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.5000 2.5981 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0
+ 2.4000 4.1569 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0
- 2.0000 1.7321 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 3.2000 2.7713 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0000 3.4641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 3.2000 5.5426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.0000 3.4641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 4.8000 5.5426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -0.1736 -0.9848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -0.2778 -1.5757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.1133 -1.3268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.7813 -2.1229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5924 -1.6276 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.9478 -2.6042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -3.0000 1.7321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.8000 2.7713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -2.5000 2.5981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 4.1569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -3.0000 3.4641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.8000 5.5426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -1.5000 2.5981 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
+ -2.4000 4.1569 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 1.7321 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0
+ -1.6000 2.7713 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0
- -1.5000 0.8660 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0
+ -2.4000 1.3856 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0
- -2.5000 0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ -4.0000 1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -1.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.6000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 0.9397 -0.3420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 1.5035 -0.5472 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5000 0.8660 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.8000 1.3856 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.0000 1.7321 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0
+ 0.0000 2.7713 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0
- 0.5000 2.5981 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0
+ 0.8000 4.1569 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0
- 0.0000 3.4641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.0000 5.5426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 1.5000 2.5981 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0
+ 2.4000 4.1569 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0
- 2.0000 1.7321 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 3.2000 2.7713 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 2.0000 3.4641 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ 3.2000 5.5426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- 3.0000 3.4641 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 4.8000 5.5426 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- -0.1736 -0.9848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
+ -0.2778 -1.5757 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
- -1.1133 -1.3268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ -1.7813 -2.1229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
- 0.5924 -1.6276 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
+ 0.9478 -2.6042 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
Loading